diff --git a/cricos/circos-0.69-9/bin/circos b/cricos/circos-0.69-9/bin/circos new file mode 100644 index 0000000000000000000000000000000000000000..85f88f17cccd8db8fbb4fa9816f95b1c8eccddc0 --- /dev/null +++ b/cricos/circos-0.69-9/bin/circos @@ -0,0 +1,595 @@ +#!/usr/bin/env perl + +=pod + +=head1 NAME + + ____ _ + / ___(_)_ __ ___ ___ ___ + | | | | '__/ __/ _ \/ __| + | |___| | | | (_| (_) \__ \ + \____|_|_| \___\___/|___/ + + round is good + +circos - generate circular data visualizations + +=head1 SYNOPSIS + + # without -conf Circos will search for configuration + circos + + # use specific configuration file + circos -conf circos.conf + + # diagnose required modules + circos -modules + + # detailed debugging for code components + # see http://www.circos.ca/documentation/tutorials/configuration/debugging + circos -debug_group GROUP1,[GROUP2,...] + + # full debugging + circos -debug_group _all + + # absolutely no reporting + circos ... [-silent] + + # configuration dump of a block (or block tree) of + # any parameters that match REGEXP (optional) + circos -cdump [BLOCK1/[BLOCK2/...]]{:REGEXP} + circos -cdump ideogram + circos -cdump ideogram:label + circos -cdump ideogram/spacing + + # override configuration parameters + circos -param image/radius=2000p -param ideogram/show=no + + # for fun - randomize all colors in the image except for + # COLOR1, COLOR2,... + circos -randomcolor COLOR1,[COLOR2,...] + circos -randomcolor white,black + + # brief help + circos -h + + # man page + circos -man + + # version + circos -v + +=head1 SUPPORT + +For support please use the Google Group + +L + +=head1 DESCRIPTION + +Circos generates circular data visualizations. It is ideal for +exploring relationships between objects or positions. + +Circos does not have an interface. It is driven by plain-text configuration files (see below). This makes Circos scriptable and easily incorporated into automatic data analysis and reporting pipelines. + +=head2 Uses + +Circos was initially designed to visualize genomic information, specifically +genomic rearrangements in tumor genomes. Although some important parameters in configuration files are named to be intuitve to biologists (e.g. "chromosomes"), Circos is not limited to the kind of data it can display. Circular heatmaps, histograms, scatter plots and other types of data displays can be easily made from data collected in other fields, such as meteorology, social science, and computer security. + +=head2 Salience and Relevance + +One of the challenges in creating data visualizations is to aptly map what is important (relevance) onto graphical elements that stand out from others (salience). Being able to emphasize (e.g. change color) or attenuate (e.g. add transparency or even hide) salience of information without changing the original data input files is a key feature of Circos. + +How data is displayed can be easily changed by writing rules, which are evaluated at run-time. Rules can be designed to apply to all data points or only to those that pass certain conditions. Conditions can be based on any property of the data (value, position, format). Rules can be chained into a decision tree making it possible to progressively change the format of data based on the output of other rules. + +=head2 Data Input Format + +Data input formats are plain-text and made to be as simple as possible. + +=head2 Is it right for you? + +Circos is not a solution. It's a tool to solve visualization +problems. For a given problem, you are not guaranteed that Circos is +appropriate. + +=head1 CONFIGURATION + +Plain-text configuration file, which define a hierarchy of parameters, control creation of images. These files determine which files Circos uses for its input data, how the data are shown, the layout and formatting of elements in the image as well as system parameters that control low-level functions. + +=head2 Syntax + +Configuration is plain-text and composed of hierarchical blocks. Some +blocks, such as C<> are mandatory, while others like +C<> are optional. + +To get started, refer to the quick guide tutorial. + +L + +A typical configuration file might look like this + + # chromosome name and length definitions + karyotype = myfile.txt + + # image size and format + + ... + + + # position and size of ideograms + + ... + + + # frequency, position and labeling of tick marks + + ... + + + # position, type and format of data tracks + + + ... + # run-time rules to change data format and visibility + + + ... + + ... + + + ... + + + # colors, fonts and fill patterns + <> + + # system parameters + <> + +=head2 Modularity + +Configuration from one file can be included in another, making it possible to have a very modular setup. For example, if several kinds of images are made for a single project, there can be project-wide configuration definitions which are then complemeted, and possibly overwritten, by image-specific configuration. + +The C<<>> directive imports one configuration file into another. + + # circos.conf + <> + + # ideogram.conf + <> + <> + ... + +In the tutorials, you'll find that the C<> and C<> blocks are imported into the main configuration file. Because these blocks can get quite large, the main configuration file is more legible if they are relegated to separate files. + +Parameter definitions that do not frequently change, such as color and font definitions, are conventionally imported from files found in F in the distribution. Every Circos image should have + + # image size, output file name + + <> + + # color names and lists, location of fonts, fill patterns + <> + # low-level system parameters + <> + +=head2 Overriding with * + +To override a parameter that has been included from a file, use the C<*> suffix. The suffix is required because multiple definitions of a parameter are not allowed, except in cases where a parameter is may have more than one value. + + + # included file defines 'radius' + <> + # this will override the radius value + radius* = 2500p + + +The C<*> suffix can be repeated to specify which value takes precedence in a block. + + radius = 1500p + radius* = 2500p + radius** = 3000p # this instance of radius will be used + +=head2 Overriding with Command Line + +Any configuration parameter in a unique block name can be specified on +the command line using + + -param PATH/PARAM=value + +For example, + + + show = no + ... + + + -param ideogram/show=no + +and + + + + default = 0.01r + + ... + + + -param ideogram/spacing/default=0.01r + +=head2 Accessing Parameters + +The C function is used in the configuration file to retrieve the value of a parmameter. It can be used to retrieve any parameter, not just those set by C<-param>). This provides a very flexible system for changing the configuration at the command line. + +For example, in this case the karyotype file name will change as the C parameter is changed either in the configuration file or using the flag. Similarly, the color palette size and name can be adjusted. + + # circos.conf + species = human + palette = blues + num_colors = 9 + karytotype = data/karyotype/karyotype.conf(species).txt + ... + + color = conf(palette)-seq-conf(num_colors) + ... + + > circos ... -param species=rat -param palette=reds -param num_colors=5 + +Multiple parameters can be redefined, each with its own C<-param> flag + + -param show_ticks=no -param image/radius=2000p + +=head2 Merging Blocks + +Multiple instances of the following blocks are automatically merged: C<>, C<>, C<>, C<>, C<>, C<>, C<> and C<>. + +The purpose of this is to allow you to add to canonical definitions. + + # this file defines default , and + <> + + # add to the colors block + + mycolor = 150,25,25 + + +=head2 Absolute and Relative Paths + +The use of absolute paths are used in configuration file is discouraged. Doing so makes your configuration less modular and unuseable on another system. + +For example, if Joe's files are organized thus + + /user/joe/project/ + data/genes.txt + etc/circos.conf + +he could use + + file = /user/joe/project/data/genes.txt + +and run Circos from his home directory + + > cd ~ + > circos -conf project/etc/circos.conf + +It would be much better for him to define + + file = data/genes.txt + +and run Circos from the project/ directory + + > cd ~/project + > circos + +Now, if he creates a tarball of all the project files (e.g. C), anyone could use the files by executing exactly the same commands. + +When you define a file with a relative path, such as + + file = data/genes.txt + +Circos will look for this file relative to several reasonable start points, such as the location of the configuration file that you are using, one level up from the configuration location, your current directory, and so on. + +To see where Circos is searching for files, use + + > circos -debug_group io + +This is the same mechanism used to find the initial configuration file. If you run Circos without the C<-conf> flag, + + > cd ~/project + > circos + +then Circos will look for + + ~/project/circos.conf + ~/project/etc/circos.conf + ~/project/data/circos.conf + ~/project/../circos.conf + ~/project/../etc/circos.conf + ... + +If the configuration file cannot be found, Circos will default to looking into its distribution directory. + +Users who are unaware of this feature often manage to get away with unorganized project files because this automatic file search feature. The purpose of this feature is to make your life easier when you know what you're doing -- not necessarily to make it possible when you don't know what you're doing. + +If you want to redefine the search paths, see the C parameter in C in the distribution directory, or overide it in your configuration file + + <> + data_path* = ... + +=head1 OPTIONS + +=head2 Configuration + +=over + +=item -configfile FILE + +Name of configuration file. This is required. + +Circos will attempt to guess the location of this file, searching for +C in C<.>, C<..>, and C<../..>. This is described above. + +=back + +=head2 Output Format + +=over + +=item -png, -nopng + +=item -svg, -nosvg + +Toggles output of PNG and SVG files. + +=back + +=head2 Image Elements + +=over + +=item -show_ticks, -noshow_ticks + +=item -show_tick_labels, -noshow_tick_labels + +Override the display of ticks and their labels. These are both usually defined in the block. + +These flags are shortcuts to + + -param show_ticks=no + -param show_tick_labels=no + +=back + +=head2 Output Paths + +=over + +=item -outputdir DIR, -dir DIR + +=item -outputfile FILE, -file FILE + +Change the output directory and filename. The FILE can contain a path. + +=back + +=head2 Debugging + +=over + +=item -debug + +Turn on basic debugging output. Reports information from + + image, io, layer, summary, timer + +debug groups (see below). + +=item -debug_group {+-}GROUP1,[{+-}GROUP2,...] + +Turn on debugging output for specific groups. For a list of groups, see + +L + +To add a group to the output prefix it with +. To remove it, with -. + + # use default debugging groups but exclude layer and io + -debug -debug_group -layer,-io + + # use default debugging groups and add spacing + -debug -debug_group +spacing + + # explicitly specify the groups + -debug_group png,io,timer + +To list the groups that are supported, use the flag without an argument + + -debug_group + +Those listed with a "*" are turned on by default. To change this, adjust C in C in the distribution directory. + +=item -time + +Report timing information. Same as C<-debug_group +timer>. + +=item -silent + +Generate no reporting. + +=item -paranoid, -noparanoid + +Run in paranoid mode (default), or not. The default for this setting is defined by C in C. + +=item -warnings, -nowarnings + +Display warnings, or not (default). The default for this setting is defined by C in C. + +=item -fakeerror +=item -fakeerror CAT +=item -fakeerror ,ID +=item -fakeerror CAT,ID + +Fake an error by displaying the error message for category CAT and error name ID. If one or neither are specified, lists which errors are available. + +Unless you truly enjoy seeing error messages, there should be little reason for you to want to use this. + +=back + +=head2 Usage + +=over + +=item -version + +Show the version. + +=item -help + +Show brief usage synopsis. + +=item -man + +Show man page. + +=back + +=head2 Goofing Around + +=over + +=item -randomcolor [color1,color2,...] + +Randomize the color of every element in the image, except for an optional list of colors. + +For example, to keep the background white and anything that is black, + + -randomcolor white,black + +=back + +=head1 DOCUMENTATION + +For full documentation, see + +L + +=back + +=cut + +use strict; +use warnings; +use FindBin; +use Getopt::Long qw(:config pass_through posix_default auto_abbrev); +use Pod::Usage; + +use lib "$FindBin::RealBin"; +use lib "$FindBin::RealBin/../lib"; +use lib "$FindBin::RealBin/lib"; +use Circos; + +use Cwd; +use Circos::Debug; +use Circos::Error; + +our %OPT = (_argv=>join(" ",@ARGV),_cwd=>cwd()); + +my $option_success = GetOptions(\%OPT, + + 'configfile=s', + 'param=s@', + 'cdump:s', + + 'dir=s', + 'file=s', + 'outputdir=s', + 'outputfile=s', + 'png!', + 'svg!', + 'imagemap', + + 'color_cache_rebuild', + 'color_cache_static', + 'randomcolor:s', + 'wmmn:s', + + 'help', + 'man', + 'silent', + 'paranoid!', + 'warnings!', + 'fakeerror:s', + 'debug+', + 'debug_group:s', + 'version', + 'time', + 'timer', + 'timers', + + 'show_ticks!', + 'show_tick_labels!', + ); +fatal_error("configuration","bad_command_line_options",join(" ",@ARGV)) if ! $option_success || @ARGV; +pod2usage() if $OPT{'help'}; +pod2usage(-verbose=>2) if $OPT{'man'}; +Circos->run(%OPT); + +# ------------------------------------------------------------------- + +=pod + +=head1 AUTHOR + +Martin Krzywinski +L +L +L<@MKrzywinski> + +Canada's Michael Smith Genome Sciences Centre +100-570 W 7th Ave +Vancouver BC V5Z 4S6 Canada + +L + +=head1 RESOURCES + +L + +L + +=head1 CITING + +If you are using Circos in a publication, please cite as + +Krzywinski, M., J. Schein, I. Birol, J. Connors, R. Gascoyne, +D. Horsman, S. Jones, and M. Marra. 2009. Circos: an Information +Aesthetic for Comparative Genomics. Genome Res 19:1639-1645. + +=head1 CONTRIBUTORS + +Ken Youens-Clark L + +=head1 SEE ALSO + +Hive plots L + +=head1 COPYRIGHT & LICENSE + +Copyright 2004-2017 Martin Krzywinski, all rights reserved. + +This script is free software; you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation; either version 2 of the License, or +(at your option) any later version. + +This script is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this script; if not, write to the Free Software Foundation, +Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + +=cut diff --git a/cricos/circos-0.69-9/bin/circos.conf b/cricos/circos-0.69-9/bin/circos.conf new file mode 100644 index 0000000000000000000000000000000000000000..b1ec60ddb8b72782c51c9372301b755020a4d4cf --- /dev/null +++ b/cricos/circos-0.69-9/bin/circos.conf @@ -0,0 +1,270 @@ +karyotype = data/data.txt # copy.txt + + + +#default : the space distance between nodes +default=0.0035r +#default=1u + + +radius = 0.75r # big circle (=b.c) +thickness = 50p # thick of b.c +fill = yes # filled in b.c +stroke_color = dgrey # color of b.c +stroke_thickness = 1p # b.c's box's boundary thickness + +#BANDS +show_bands = yes +fill_bands = yes +band_stroke_thickness = 20 +band_stroke_color = white +band_transparency = 2 + +#LABELS +show_label = yes +# see etc/fonts.conf for list of font names +#label_radius = (dims(ideogram,radius_inner) + dims(ideogram,radius_outer))/2 +label_font = bold +#label_center = yes +label_size = 23 +label_radius = 1r+40p #+50p +label_with_tag = yes +label_case = upper +label_parallel = no + + +show_ticks = yes +show_tick_labels = yes +show_grid = yes + + +grid_start = 0.5r +grid_end = 0.975r +grid_color = black +grid_thickness = 1p + +skip_first_label = no +skip_last_label = no +radius = dims(ideogram,radius_outer) +tick_separaation = 30p +label_separation = 30p +multiplier = 0.01 #current pin multipy with tag ex. if want 1-14 but (100 ~1400) use this. +color = black +thickness = 3p +size = 10p + + # b.c's upper black line length # if too much big size, no show label units +spacing = 100u +show_label = yes +label_size = 15p +thickness = 3p +color = black + + + # b.c's upper red line length +spacing = 100u +show_label = yes +label_size = 12p +thickness = 1p +color = red +format = %d + + +# ------ original ---------- +# ------ Customized -------- + # where? band orange line +spacing = 99.9u +grid_start = 0.80r +grid_end = 0.99r +grid_color = orange +grid_thickness = 2p +grid = yes + + + # where? band orange line +spacing = 99.9u +grid_start = 0.48r +grid_end = 0.49r +grid_color = orange +grid_thickness = 2p +grid = yes + + + # 중간 pass +radius = 0.79r +spacing = 99.9u +size = 3p +thickness = 3p +show_label = yes +label_size = 10p +label_with_tag = yes +format = %d + + + # Link용 pass +radius = 0.5 #0.48r +spacing = 0.99u +size = 1p +thickness = 2p +show_label = yes +label_size = 10p +label_multiplier = 0.01 +orientation = out +format = %d + + +# +# spacing = 100u +# thickness = 3p +# color = green +# grid = yes +# grid_color = red +# grid_thickness = 3p +# grid_start = 0.3r +# grid_end = 0.8r +# + +# +# spacing = 1u +# color = blue +# grid = yes +# grid_color = blue +# grid_thickness = 1p +# grid_start = 0.55r +# grid_end = 0.95r +# +# ------ Customized -------- + + + +##################### BAND LABEL + + +type = text +color = black +file = data/band.txt +r0 = 0.83r +r1 = 1r +label_size = 18p +label_font = italicbold +label_parallel = no +#label_rotated = yes + +# label_snuggle = yes +# max_snuggle_distance = 1r +# snuggle_tolerance = 0.25r +# snuggle_sampling = 2 +# snuggle_refine = yes + + +# +# type = histogram +# file = data/hist.txt +# r0 = 0.65r +# r1 = 0.78r +# fill_color = dgrey +# thickness = 2p +# min=0 +# max=200 +# extend_bin = no +# +# +# condition = var(value) > 100 +# fill_color = vdblue +# +# +# +# +# color = vvlgrey +# +# +# + +# +# type = heatmap +# r1 = 0.64r +# r0 = 0.59r +# file = data/hist.txt +# color = spectral-6-div +# color_alt = black,spectral-5-div,grey +# scale_log_base = 1.0 +# stroke_thickness = undef +# min = 0 +# max = 200 +# # minsize = 1u +# # thickness = 20 +# # margin = 1u +# + +# +# type = tile +# r1 = 0.58r +# r0 = 0.5r +# file = data/hist.txt +# orientation = out +# layers = 5 +# layer_overflow = grow +# layer_overflow_color = red +# thickness = 15 +# padding = 10 +# stroke_thickness = undef +# stroke_color = dgreen +# color = dgreen +# +# +# y0 = 0.80r +# color = grey_a1 +# +# +# y0 = 0.60r +# y1 = 0.80r +# color = grey_a2 +# +# +# y0 = 0.40r +# y1 = 0.60r +# color = grey_a3 +# +# +# y0 = 0.20r +# y1 = 0.40r +# color = grey_a4 +# +# +# y1 = 0.20r +# color = grey_a5 +# +# +# +# +# condition = var(size) > 100 +# color = pred +# +# +# scale_log_base = 0.25 +# minsize = 1u +# margin = 1u +# + +###################### LINKS +# +# +# file = data/link.txt +# radius = 0.7r #0.7r +# bezier_radius = 0.05r #0.05r #0.05r +# bezier_radius_purity = 0.5 #0.5 +# thickness = 10p +# ribbon = no #wider +# +# + + +#include from circos distribution +angle_offset* = 20 +<> +#to modify the size of the output image, default is 1500 +#radius* = 100p + + +<> +<> \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/circos.exe b/cricos/circos-0.69-9/bin/circos.exe new file mode 100644 index 0000000000000000000000000000000000000000..869295d7affdb65d23e8c5f69b5545c8a65bd1ec --- /dev/null +++ b/cricos/circos-0.69-9/bin/circos.exe @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a0a9e2a71cf68809369ff7366b2aca8e69a38091bc5d9285b27a21931948c93b +size 5401162 diff --git a/cricos/circos-0.69-9/bin/circos.png b/cricos/circos-0.69-9/bin/circos.png new file mode 100644 index 0000000000000000000000000000000000000000..d08f9898d76618f264680bc6f7a5fc738f882aa6 --- /dev/null +++ b/cricos/circos-0.69-9/bin/circos.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c2124de7a49b69a27a5f0c3793df77702dc5efc6114197c5b60b0cb34172f67b +size 867300 diff --git a/cricos/circos-0.69-9/bin/circos.svg b/cricos/circos-0.69-9/bin/circos.svg new file mode 100644 index 0000000000000000000000000000000000000000..7d5149e3b828d75c54a249e0b01438fc9af0bdc6 --- /dev/null +++ b/cricos/circos-0.69-9/bin/circos.svg @@ -0,0 +1,13048 @@ + + + + + + + + +MOLWT + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +MOLMR + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +MOLTPSA + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +MOLLOGP + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +ROTATEDBONDS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +HEAVYATOM + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMHACCEPTOR + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMHDONER + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMHETEROATOM + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMVALENCEELEC + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NHOHCOUNT + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NOCOUNT + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +RINGCOUNT + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMAROMATICR + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMSATURATER + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMALIPHATICR + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +LABUTEASA + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +BALABANJS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +BERTZCTS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +IPC + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +KAPPASERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + +CHISERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +11 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +12 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +13 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +14 + + +PHI + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +HALLKIERALPHA + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMAMIDEBONDS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +FRACTIONCSP3 + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMSPIROATOMS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMBRIDGEHEADATOMS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +PEOEVSASERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +11 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +12 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +13 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +14 + + +SMRVSASERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + +SLOGPVSASERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +11 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +12 + + +ESTATEVSASERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +11 + + +VSAESTATESERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + +AUTOCORR2D + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +BCUT2D + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +PBF + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +PMISERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + +NPRSERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + +RADIUSOFGYRATION + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +INERTIALSHAPEFACTOR + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +ECCENTRICIT + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +ASPHERICITY + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +SPHEROCITYINDEX + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +MQNS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +AUTOCORR3D + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +RDF + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +MORSE + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +WHIM + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +GETAWAY + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + +EStateVSA10 +EStateVSA11 +VSAEState10 +PEOEVSA10 +PEOEVSA11 +PEOEVSA12 +PEOEVSA13 +PEOEVSA14 +SlogPVSA10 +SlogPVSA11 +SlogPVSA12 +EStateVSA1 +EStateVSA2 +EStateVSA3 +EStateVSA4 +EStateVSA5 +EStateVSA6 +EStateVSA7 +EStateVSA8 +EStateVSA9 +VSAEState1 +VSAEState2 +VSAEState3 +VSAEState4 +VSAEState5 +VSAEState6 +VSAEState7 +VSAEState8 +VSAEState9 +SMRVSA10 +PEOEVSA1 +PEOEVSA2 +PEOEVSA3 +PEOEVSA4 +PEOEVSA5 +PEOEVSA6 +PEOEVSA7 +PEOEVSA8 +PEOEVSA9 +SlogPVSA1 +SlogPVSA2 +SlogPVSA3 +SlogPVSA4 +SlogPVSA5 +SlogPVSA6 +SlogPVSA7 +SlogPVSA8 +SlogPVSA9 +SMRVSA1 +SMRVSA2 +SMRVSA3 +SMRVSA4 +SMRVSA5 +SMRVSA6 +SMRVSA7 +SMRVSA8 +SMRVSA9 +ChiNn_ +ChiNv_ +Kappa1 +Kappa2 +Kappa3 +NPR1 +NPR2 +Chi0n +Chi1n +Chi2n +Chi3n +Chi4n +Chi0v +Chi1v +Chi2v +Chi3v +Chi4v +PMI1 +PMI2 +PMI3 +Chi0 +Chi1 + + + + + + + + + + diff --git a/cricos/circos-0.69-9/bin/compile.bat b/cricos/circos-0.69-9/bin/compile.bat new file mode 100644 index 0000000000000000000000000000000000000000..8717b7b5e7e5e7baad77b314666e58c1fa5ebf8e --- /dev/null +++ b/cricos/circos-0.69-9/bin/compile.bat @@ -0,0 +1 @@ +pp -M Carp -M Clone -M Config::General -M Cwd -M Data::Dumper -M Digest::MD5 -M File::Basename -M File::Spec::Functions -M File::Temp -M FindBin -M Font::TTF:: -M GD -M GD::Polyline -M Getopt::Long -M IO::File -M List::MoreUtils -M List::Util -M Math::Bezier -M Math::BigFloat -M Math::Round -M Math::VecStat -M Memoize -M POSIX -M Params::Validate -M Pod::Usage -M Readonly -M Regexp::Common -M SVG -M Set::IntSpan -M Statistics::Basic -M Storable -M Sys::Hostname -M Text::Balanced -M Text::Format -M Time::HiRes -l c:\Dwimperl\c\bin\libgd-2_.dll -l c:\Dwimperl\c\bin\libfreetype-6_.dll -l c:\Dwimperl\c\bin\libpng12-0_.dll -l c:\Dwimperl\c\bin\libpng15-15_.dll -l c:\Dwimperl\c\bin\libXpm_.dll -l c:\Dwimperl\c\bin\libz_.dll -l c:\Dwimperl\c\bin\libiconv-2_.dll -l c:\Dwimperl\c\bin\libjpeg-62_.dll -o circos.exe circos diff --git a/cricos/circos-0.69-9/bin/compile.make b/cricos/circos-0.69-9/bin/compile.make new file mode 100644 index 0000000000000000000000000000000000000000..73d6c9b9ee693d6ab993838fde838d5f276f8c5e --- /dev/null +++ b/cricos/circos-0.69-9/bin/compile.make @@ -0,0 +1,8 @@ +#!/bin/bash +# +# create batch file to compile Circos for Windows systems +# + +LIBDIR="c:\\\Dwimperl\\\c\\\bin" +LINK="-l $LIBDIR\\\libgd-2_.dll -l $LIBDIR\\\libfreetype-6_.dll -l $LIBDIR\\\libpng12-0_.dll -l $LIBDIR\\\libpng15-15_.dll -l $LIBDIR\\\libXpm_.dll -l $LIBDIR\\\libz_.dll -l $LIBDIR\\\libiconv-2_.dll -l $LIBDIR\\\libjpeg-62_.dll" +./circos -modules | shrinkwrap | c2 | sed 's/^/-M /g' | unsplit -delim " " | sed 's/::Font/::/' | awk -v LINK="$LINK" '{print "pp "$0,LINK" -o circos.exe circos"}' diff --git a/cricos/circos-0.69-9/bin/data/band.txt b/cricos/circos-0.69-9/bin/data/band.txt new file mode 100644 index 0000000000000000000000000000000000000000..1bc09b14d019936c5e20d6f4ad3e048de9b717a4 --- /dev/null +++ b/cricos/circos-0.69-9/bin/data/band.txt @@ -0,0 +1,79 @@ +var21 0 100 Kappa1 +var21 101 200 Kappa2 +var21 201 300 Kappa3 +var22 0 100 Chi0 +var22 100 200 Chi0n +var22 201 300 Chi0v +var22 301 400 Chi1 +var22 401 500 Chi1n +var22 501 600 Chi1v +var22 601 700 Chi2n +var22 701 800 Chi2v +var22 801 900 Chi3n +var22 901 1000 Chi3v +var22 1001 1100 Chi4n +var22 1101 1200 Chi4v +var22 1201 1300 ChiNn_ +var22 1301 1400 ChiNv_ +var29 0 100 PEOE_VSA1 +var29 101 200 PEOE_VSA2 +var29 201 300 PEOE_VSA3 +var29 301 400 PEOE_VSA4 +var29 401 500 PEOE_VSA5 +var29 501 600 PEOE_VSA6 +var29 601 700 PEOE_VSA7 +var29 701 800 PEOE_VSA8 +var29 801 900 PEOE_VSA9 +var29 901 1000 PEOE_VSA10 +var29 1001 1100 PEOE_VSA11 +var29 1101 1200 PEOE_VSA12 +var29 1201 1300 PEOE_VSA13 +var29 1301 1400 PEOE_VSA14 +var30 0 100 SMR_VSA1 +var30 101 200 SMR_VSA2 +var30 201 300 SMR_VSA3 +var30 301 400 SMR_VSA4 +var30 401 500 SMR_VSA5 +var30 501 600 SMR_VSA6 +var30 601 700 SMR_VSA7 +var30 701 800 SMR_VSA8 +var30 801 900 SMR_VSA9 +var30 901 1000 SMR_VSA10 +var31 0 100 SlogP_VSA1 +var31 101 200 SlogP_VSA2 +var31 201 300 SlogP_VSA3 +var31 301 400 SlogP_VSA4 +var31 401 500 SlogP_VSA5 +var31 501 600 SlogP_VSA6 +var31 601 700 SlogP_VSA7 +var31 701 800 SlogP_VSA8 +var31 801 900 SlogP_VSA9 +var31 901 1000 SlogP_VSA10 +var31 1001 1100 SlogP_VSA11 +var31 1101 1200 SlogP_VSA12 +var32 0 100 EState_VSA1 +var32 101 200 EState_VSA2 +var32 201 300 EState_VSA3 +var32 301 400 EState_VSA4 +var32 401 500 EState_VSA5 +var32 501 600 EState_VSA6 +var32 601 700 EState_VSA7 +var32 701 800 EState_VSA8 +var32 801 900 EState_VSA9 +var32 901 1000 EState_VSA10 +var32 1001 1100 EState_VSA11 +var33 0 100 VSA_EState1 +var33 101 200 VSA_EState2 +var33 201 300 VSA_EState3 +var33 301 400 VSA_EState4 +var33 401 500 VSA_EState5 +var33 501 600 VSA_EState6 +var33 601 700 VSA_EState7 +var33 701 800 VSA_EState8 +var33 801 900 VSA_EState9 +var33 901 1000 VSA_EState10 +var37 0 100 PMI1 +var37 101 200 PMI2 +var37 201 300 PMI3 +var38 0 100 NPR1 +var38 101 200 NPR2 \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/data/data copy.txt b/cricos/circos-0.69-9/bin/data/data copy.txt new file mode 100644 index 0000000000000000000000000000000000000000..ee00e5117212faf0e3f95142a249091db41a14a8 --- /dev/null +++ b/cricos/circos-0.69-9/bin/data/data copy.txt @@ -0,0 +1,49 @@ +chr - var1 Mol_Weight 0 1 lpred +chr - var2 Mol_MR 0 1 lpred +chr - var3 Mol_TPSA 0 1 lpred +chr - var4 Mol_logP 0 1 lpred +chr - var5 RotatedBonds 0 1 lppurple +chr - var6 HeavyAtom 0 1 lppurple +chr - var7 numHAcceptor 0 1 lppurple +chr - var8 numHDoner 0 1 lppurple +chr - var9 numHeteroatom 0 1 lppurple +chr - var10 numValenceElec 0 1 lppurple +chr - var11 NHOHCount 0 1 lpblue +chr - var12 NOCount 0 1 lpblue +chr - var13 RingCount 0 1 lppurple +chr - var14 numAromaticR 0 1 lppurple +chr - var15 numSaturateR 0 1 lppurple +chr - var16 numAliphaticR 0 1 lppurple +chr - var17 LabuteASA 0 1 lppurple +chr - var18 BalabanJs 0 1 lppurple +chr - var19 BertzCTs 0 1 lppurple +chr - var20 Ipc 0 1 lppurple +chr - var21 Kappa_Series 0 3 pgreen +chr - var22 Chi_Series 0 14 pgreen +chr - var23 Phi 0 1 lppurple +chr - var24 HallKierAlpha 0 1 lppurple +chr - var25 NumAmideBonds 0 1 lppurple +chr - var26 FractionCSP3 0 1 lppurple +chr - var27 NumSpiroAtoms 0 1 lppurple +chr - var28 NumBridgeheadAtoms 0 1 lppurple +chr - var29 PEOE_VSA_Series 0 14 pgreen +chr - var30 SMR_VSA_Series 0 10 pgreen +chr - var31 SlogP_VSA_Series 0 12 pgreen +chr - var32 EState_VSA_Series 0 11 pgreen +chr - var33 VSA_EState_Series 0 10 pgreen +chr - var34 Asphericity 0 1 lppurple +chr - var35 PBF 0 1 lppurple +chr - var36 PMI_Series 0 3 lppurple +chr - var37 NPR_Series 0 2 lppurple +chr - var38 RadiusOfGyration 0 1 lppurple +chr - var39 InertialShapeFactor 0 1 lppurple +chr - var40 Eccentricit 0 1 lppurple +chr - var41 SpherocityIndex 0 1 lppurple +chr - var42 MQNs 0 1 vlporange +chr - var43 AUTOCORR2D 0 1 vlporange +chr - var44 BCUT2D 0 1 vlporange +chr - var45 AUTOCORR3D 0 1 vlporange +chr - var46 RDF 0 1 vlporange +chr - var47 MORSE 0 1 vlporange +chr - var48 WHIM 0 1 vlporange +chr - var49 GETAWAY 0 1 vlporange \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/data/data.txt b/cricos/circos-0.69-9/bin/data/data.txt new file mode 100644 index 0000000000000000000000000000000000000000..d91c703bbba4b373c64be137a9035cd65b767b9a --- /dev/null +++ b/cricos/circos-0.69-9/bin/data/data.txt @@ -0,0 +1,49 @@ +chr - var1 MolWT 0 100 lpred +chr - var2 MolMR 0 100 lpred +chr - var3 MolTPSA 0 100 lpred +chr - var4 MolLogP 0 100 lpred +chr - var5 RotatedBonds 0 100 lpred +chr - var6 HeavyAtom 0 100 lpred +chr - var7 numHAcceptor 0 100 lpred +chr - var8 numHDoner 0 100 lpred +chr - var9 numHeteroatom 0 100 lpred +chr - var10 numValenceElec 0 100 lpred +chr - var11 NHOHCount 0 100 lpred +chr - var12 NOCount 0 100 lpred +chr - var13 RingCount 0 100 lpred +chr - var14 numAromaticR 0 100 lpred +chr - var15 numSaturateR 0 100 lpred +chr - var16 numAliphaticR 0 100 lpred +chr - var17 LabuteASA 0 100 lpred +chr - var18 BalabanJs 0 100 lpred +chr - var19 BertzCTs 0 100 lpred +chr - var20 Ipc 0 100 lpred +chr - var21 Kappa_Series 0 300 lpred +chr - var22 Chi_Series 0 1400 lpred +chr - var23 Phi 0 100 lpred +chr - var24 HallKierAlpha 0 100 lpred +chr - var25 NumAmideBonds 0 100 lpred +chr - var26 FractionCSP3 0 100 lpred +chr - var27 NumSpiroAtoms 0 100 lpred +chr - var28 NumBridgeheadAtoms 0 100 lpred +chr - var29 PEOE_VSA_Series 0 1400 lpred +chr - var30 SMR_VSA_Series 0 1000 lpred +chr - var31 SlogP_VSA_Series 0 1200 lpred +chr - var32 EState_VSA_Series 0 1100 lpred +chr - var33 VSA_EState_Series 0 1000 lpred +chr - var34 AUTOCORR2D 0 100 lpred +chr - var35 BCUT2D 0 100 lpred +chr - var36 PBF 0 100 lpblue +chr - var37 PMI_Series 0 300 lpblue +chr - var38 NPR_Series 0 200 lpblue +chr - var39 RadiusOfGyration 0 100 lpblue +chr - var40 InertialShapeFactor 0 100 lpblue +chr - var41 Eccentricit 0 100 lpblue +chr - var42 Asphericity 0 100 lpblue +chr - var43 SpherocityIndex 0 100 lpblue +chr - var44 MQNs 0 100 lpblue +chr - var45 AUTOCORR3D 0 100 lpblue +chr - var46 RDF 0 100 lpblue +chr - var47 MORSE 0 100 lpblue +chr - var48 WHIM 0 100 lpblue +chr - var49 GETAWAY 0 100 lpblue \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/data/data2.txt b/cricos/circos-0.69-9/bin/data/data2.txt new file mode 100644 index 0000000000000000000000000000000000000000..0a0148182335c887cca2b4ac8c184db700ac89ac --- /dev/null +++ b/cricos/circos-0.69-9/bin/data/data2.txt @@ -0,0 +1,49 @@ +chr - var1 Mol_Weight 0 100 +chr - var2 Mol_MR 0 100 +chr - var3 Mol_TPSA 0 100 +chr - var4 Mol_logP 0 100 +chr - var5 RotatedBonds 0 100 +chr - var6 HeavyAtom 0 100 +chr - var7 numHAcceptor 0 100 +chr - var8 numHDoner 0 100 +chr - var9 numHeteroatom 0 100 +chr - var10 numValenceElec 0 100 +chr - var11 NHOHCount 0 100 +chr - var12 NOCount 0 100 +chr - var13 RingCount 0 100 +chr - var14 numAromaticR 0 100 +chr - var15 numSaturateR 0 100 +chr - var16 numAliphaticR 0 100 +chr - var17 LabuteASA 0 100 +chr - var18 BalabanJs 0 100 +chr - var19 BertzCTs 0 100 +chr - var20 Ipc 0 100 +chr - var21 Kappa_Series 0 300 +chr - var22 Chi_Series 0 1400 +chr - var23 Phi 0 100 +chr - var24 HallKierAlpha 0 100 +chr - var25 NumAmideBonds 0 100 +chr - var26 FractionCSP3 0 100 +chr - var27 NumSpiroAtoms 0 100 +chr - var28 NumBridgeheadAtoms 0 100 +chr - var29 PEOE_VSA_Series 0 1400 +chr - var30 SMR_VSA_Series 0 1000 +chr - var31 SlogP_VSA_Series 0 1200 +chr - var32 EState_VSA_Series 0 1100 +chr - var33 VSA_EState_Series 0 1000 +chr - var34 Asphericity 0 100 +chr - var35 PBF 0 100 +chr - var36 PMI_Series 0 300 +chr - var37 NPR_Series 0 200 +chr - var38 RadiusOfGyration 0 100 +chr - var39 InertialShapeFactor 0 100 +chr - var40 Eccentricit 0 100 +chr - var41 SpherocityIndex 0 100 +chr - var42 MQNs 0 100 +chr - var43 AUTOCORR2D 0 100 +chr - var44 BCUT2D 0 100 +chr - var45 AUTOCORR3D 0 100 +chr - var46 RDF 0 100 +chr - var47 MORSE 0 100 +chr - var48 WHIM 0 100 +chr - var49 GETAWAY 0 100 \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/data/hist copy 2.txt b/cricos/circos-0.69-9/bin/data/hist copy 2.txt new file mode 100644 index 0000000000000000000000000000000000000000..dcb9e594fcbd8bad227841c84040f2b551e32f5d --- /dev/null +++ b/cricos/circos-0.69-9/bin/data/hist copy 2.txt @@ -0,0 +1,63 @@ +hs1 0 1 529.0000 +hs2 1 2 0.0000 +hs3 3 4 0.0000 +hs4 5 6 0.0000 +hs5 7 8 1.0000 +hs6 9 10 0.0000 +hs7 11 12 0.0000 +hs8 13 14 0.0000 +hs9 15 16 0.0000 +hs10 17 18 1.0000 +hs11 19 20 0.0000 +hs12 21 22 0.0000 +hs13 23 24 0.0000 +hs14 25 26 0.0000 +hs15 27 28 1.0000 +hs16 29 30 0.0000 +hs17 31 32 0.0000 +hs18 33 34 0.0000 +hs19 35 36 0.0000 +hs20 37 38 1.0000 +hs21 39 41 0.0000 +hs22 42 55 0.0000 +hs23 56 57 0.0000 +hs24 58 59 0.0000 +hs25 60 61 1.0000 +hs26 62 63 0.0000 +hs27 64 65 0.0000 +hs28 66 67 0.0000 +hs29 68 82 0.0000 +hs30 83 92 1.0000 +hs31 93 104 0.0000 +hs32 105 115 0.0000 +hs33 116 125 0.0000 +hs34 126 127 0.0000 +hs35 128 129 1.0000 +hs36 130 133 0.0000 +hs37 134 135 0.0000 +hs38 136 137 0.0000 +hs39 138 139 0.0000 +hs40 140 140 1.0000 +hs41 146 147 0.0000 +hs42 148 149 0.0000 +hs43 150 151 0.0000 +hs44 152 153 0.0000 +hs45 154 155 1.0000 +hs46 156 157 0.0000 +hs47 158 160 0.0000 +hs48 160 161 0.0000 +hs49 162 163 1.0000 + +-9.66930e+01, 3.98700e+11, 7.97400e+11, 1.19610e+12, + 1.59480e+12, 1.99350e+12, 2.39220e+12, 2.79090e+12, + 3.18960e+12, 3.58830e+12, 3.98700e+12, 4.38570e+12, + 4.78440e+12, 5.18310e+12, 5.58180e+12, 5.98050e+12, + 6.37920e+12, 6.77790e+12, 7.17660e+12, 7.57530e+12, + 7.97400e+12, 8.37270e+12, 8.77140e+12, 9.17010e+12, + 9.56880e+12, 9.96750e+12, 1.03662e+13, 1.07649e+13, + 1.11636e+13, 1.15623e+13, 1.19610e+13, 1.23597e+13, + 1.27584e+13, 1.31571e+13, 1.35558e+13, 1.39545e+13, + 1.43532e+13, 1.47519e+13, 1.51506e+13, 1.55493e+13, + 1.59480e+13, 1.63467e+13, 1.67454e+13, 1.71441e+13, + 1.75428e+13, 1.79415e+13, 1.83402e+13, 1.87389e+13, + 1.91376e+13, 1.95363e+13 \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/data/hist copy 3.txt b/cricos/circos-0.69-9/bin/data/hist copy 3.txt new file mode 100644 index 0000000000000000000000000000000000000000..b178bc4b774a1413a46e1d39a828c60e252a94c4 --- /dev/null +++ b/cricos/circos-0.69-9/bin/data/hist copy 3.txt @@ -0,0 +1,49 @@ +hs1 0 1 529.0000 +hs2 1 2 0.0000 +hs3 3 4 0.0000 +hs4 5 6 0.0000 +hs5 7 8 1.0000 +hs6 9 10 0.0000 +hs7 11 12 0.0000 +hs8 13 14 0.0000 +hs9 15 16 0.0000 +hs10 17 18 1.0000 +hs11 19 20 0.0000 +hs12 21 22 0.0000 +hs13 23 24 0.0000 +hs14 25 26 0.0000 +hs15 27 28 1.0000 +hs16 29 30 0.0000 +hs17 31 32 0.0000 +hs18 33 34 0.0000 +hs19 35 36 0.0000 +hs20 37 38 1.0000 +hs21 39 41 0.0000 +hs22 42 55 0.0000 +hs23 56 57 0.0000 +hs24 58 59 0.0000 +hs25 60 61 1.0000 +hs26 62 63 0.0000 +hs27 64 65 0.0000 +hs28 66 67 0.0000 +hs29 68 82 0.0000 +hs30 83 92 1.0000 +hs31 93 104 0.0000 +hs32 105 115 0.0000 +hs33 116 125 0.0000 +hs34 126 127 0.0000 +hs35 128 129 1.0000 +hs36 130 133 0.0000 +hs37 134 135 0.0000 +hs38 136 137 0.0000 +hs39 138 139 0.0000 +hs40 140 140 1.0000 +hs41 146 147 0.0000 +hs42 148 149 0.0000 +hs43 150 151 0.0000 +hs44 152 153 0.0000 +hs45 154 155 1.0000 +hs46 156 157 0.0000 +hs47 158 160 0.0000 +hs48 160 161 0.0000 +hs49 162 163 1.0000 \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/data/hist copy.txt b/cricos/circos-0.69-9/bin/data/hist copy.txt new file mode 100644 index 0000000000000000000000000000000000000000..858a3d9a04e01525384007f6af16c75f9874f164 --- /dev/null +++ b/cricos/circos-0.69-9/bin/data/hist copy.txt @@ -0,0 +1,99 @@ +hs1 0 1 16.031300127999998,99.76126564639999,183.49123116479998,267.2211966832,350.95116220159997,434.68112771999995,518.4110932384,602.1410587567999,685.8710242751999,769.6009897936,853.3309553119999 +hs2 1 2 6.731,27.82690999999994,48.92281999999989,70.01872999999982,91.11463999999977,112.21054999999971,133.30645999999965,154.4023699999996,175.49827999999954,196.5941899999995,217.69009999999943 +hs3 3 4 0.0,26.867999999999995,53.73599999999999,80.60399999999998,107.47199999999998,134.33999999999997,161.20799999999997,188.07599999999996,214.94399999999996,241.81199999999995,268.67999999999995 +hs4 5 6 -7.571399999999989,-5.7753999999999905,-3.9793999999999925,-2.1833999999999945,-0.38739999999999597,1.4086000000000025,3.2046,5.0005999999999995,6.796599999999997,8.592599999999994,10.388599999999993 +hs5 7 8 0.0,2.3,4.6,6.8999999999999995,9.2,11.5,13.799999999999999,16.099999999999998,18.4,20.7,23.0 +hs6 9 10 1.0,7.1,13.2,19.299999999999997,25.4,31.5,37.599999999999994,43.699999999999996,49.8,55.9,62.0 +hs7 11 12 0.0,1.6,3.2,4.800000000000001,6.4,8.0,9.600000000000001,11.200000000000001,12.8,14.4,16.0 +hs8 13 14 0.0,1.1,2.2,3.3000000000000003,4.4,5.5,6.6000000000000005,7.700000000000001,8.8,9.9,11.0 +hs9 15 16 0.0,1.6,3.2,4.800000000000001,6.4,8.0,9.600000000000001,11.200000000000001,12.8,14.4,16.0 +hs10 17 18 8.0,40.0,72.0,104.0,136.0,168.0,200.0,232.0,264.0,296.0,328.0 +hs11 19 20 0.0,1.1,2.2,3.3000000000000003,4.4,5.5,6.6000000000000005,7.700000000000001,8.8,9.9,11.0 +hs12 21 22 0.0,1.6,3.2,4.800000000000001,6.4,8.0,9.600000000000001,11.200000000000001,12.8,14.4,16.0 +hs13 23 24 0.0,0.8,1.6,2.4000000000000004,3.2,4.0,4.800000000000001,5.6000000000000005,6.4,7.2,8.0 +hs14 25 26 0.0,0.7,1.4,2.0999999999999996,2.8,3.5,4.199999999999999,4.8999999999999995,5.6,6.3,7.0 +hs15 27 28 0.0,0.7,1.4,2.0999999999999996,2.8,3.5,4.199999999999999,4.8999999999999995,5.6,6.3,7.0 +hs16 29 30 0.0,0.8,1.6,2.4000000000000004,3.2,4.0,4.800000000000001,5.6000000000000005,6.4,7.2,8.0 +hs17 31 32 8.739251027829551,43.65386666412846,78.56848230042736,113.48309793672627,148.39771357302516,183.31232920932405,218.22694484562297,253.14156048192189,288.0561761182208,322.97079175451967,357.88540739081856 +hs18 33 34 0.0,0.5382759304174601,1.0765518608349203,1.6148277912523805,2.1531037216698405,2.6913796520873006,3.229655582504761,3.767931512922221,4.306207443339681,4.844483373757141,5.382759304174601 +hs19 35 36 0.0,228.03462695528657,456.06925391057314,684.1038808658598,912.1385078211463,1140.1731347764328,1368.2077617317195,1596.242388687006,1824.2770156422926,2052.311642597579,2280.3462695528656 +hs20 37 38 0.0,1953634259493.666,3907268518987.332,5860902778480.998,7814537037974.664,9768171297468.33,11721805556961.996,13675439816455.662,15629074075949.328,17582708335442.994,19536342594936.66 +hs21 39 41 -24.120000000000026,91.71378378378375,207.5475675675675,323.3813513513513,439.2151351351351,555.0489189189188,670.8827027027027,786.7164864864864,902.5502702702702,1018.384054054054,1134.2178378378376 +hs22 42 55 2.0,40.965657668121665,79.93131533624333,118.896973004365,157.86263067248666,196.8282883406083,235.79394600873,274.75960367685167,313.7252613449733,352.69091901309497,391.6565766812166 +hs23 56 57 0.0,2.5,5.0,7.5,10.0,12.5,15.0,17.5,20.0,22.5,25.0 +hs24 58 59 -5.739999999999999,-4.818,-3.8959999999999995,-2.9739999999999993,-2.0519999999999996,-1.13,-0.2079999999999993,0.7140000000000004,1.6360000000000001,2.5580000000000007,3.48 +hs25 60 61 0.0,0.8,1.6,2.4000000000000004,3.2,4.0,4.800000000000001,5.6000000000000005,6.4,7.2,8.0 +hs26 62 63 0.0,0.1,0.2,0.30000000000000004,0.4,0.5,0.6000000000000001,0.7000000000000001,0.8,0.9,1.0 +hs27 64 65 0.0,0.2,0.4,0.6000000000000001,0.8,1.0,1.2000000000000002,1.4000000000000001,1.6,1.8,2.0 +hs28 66 67 0.0,0.5,1.0,1.5,2.0,2.5,3.0,3.5,4.0,4.5,5.0 +hs29 68 82 7.426652776455239,42.59340752108031,77.76016226570539,112.92691701033046,148.09367175495552,183.2604264995806,218.42718124420566,253.59393598883074,288.7606907334558,323.92744547808087,359.094200222706 +hs30 83 92 7.426652776455239,42.59340752108031,77.76016226570538,112.92691701033044,148.0936717549555,183.26042649958055,218.42718124420563,253.5939359888307,288.76069073345576,323.9274454780808,359.0942002227059 +hs31 93 104 7.426652776455239,42.59340752108031,77.76016226570539,112.92691701033046,148.09367175495552,183.2604264995806,218.42718124420566,253.59393598883074,288.7606907334558,323.92744547808087,359.094200222706 +hs32 105 115 7.426652776455239,42.59340752108031,77.76016226570539,112.92691701033046,148.09367175495552,183.2604264995806,218.42718124420566,253.59393598883074,288.7606907334558,323.92744547808087,359.094200222706 +hs33 116 125 0.0,16.049999999999997,32.099999999999994,48.14999999999999,64.19999999999999,80.24999999999999,96.29999999999998,112.34999999999998,128.39999999999998,144.45,160.49999999999997 +hs34 126 127 0.0,0.1,0.2,0.30000000000000004,0.4,0.5,0.6000000000000001,0.7000000000000001,0.8,0.9,1.0 +hs35 128 129 -0.5,-0.4,-0.3,-0.19999999999999996,-0.09999999999999998,0.0,0.10000000000000009,0.20000000000000007,0.30000000000000004,0.4,0.5 +hs36 130 133 0.0,6774.312700421974,13548.625400843948,20322.93810126592,27097.250801687896,33871.56350210987,40645.87620253184,47420.18890295382,54194.50160337579,60968.814303797764,67743.12700421974 +hs37 134 135 0.0,0.10000000000000006,0.20000000000000012,0.30000000000000016,0.40000000000000024,0.5000000000000003,0.6000000000000003,0.7000000000000004,0.8000000000000005,0.9000000000000006,1.0000000000000007 +hs38 136 137 0.0,0.975,1.95,2.925,3.9,4.875,5.85,6.825,7.8,8.775,9.75 +hs39 138 139 0.0,0.019981683456831226,0.03996336691366245,0.05994505037049368,0.0799267338273249,0.09990841728415613,0.11989010074098735,0.1398717841978186,0.1598534676546498,0.17983515111148102,0.19981683456831226 +hs40 140 140 0.0,0.1,0.2,0.30000000000000004,0.4,0.5,0.6000000000000001,0.7000000000000001,0.8,0.9,1.0 +hs41 146 147 -0.5,-0.4,-0.3,-0.19999999999999996,-0.09999999999999998,0.0,0.10000000000000009,0.20000000000000007,0.30000000000000004,0.4,0.5 +hs42 148 149 0.0,6.2,12.4,18.6,24.8,31.0,37.2,43.4,49.6,55.800000000000004,62.0 +hs43 150 151 -4.017,42.9488,89.91460000000001,136.8804,183.8462,230.812,277.7778,324.7436,371.7094,418.6752,465.641 +hs44 152 153 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0 +hs45 154 155 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0 +hs46 156 157 0.0,49.5559,99.1118,148.6677,198.2236,247.7795,297.3354,346.8913,396.4472,446.0031,495.559 +hs47 158 160 -96.693,1423.8554,2944.4037999999996,4464.9522,5985.500599999999,7506.048999999999,9026.5974,10547.1458,12067.6942,13588.2426,15108.791 +hs48 160 161 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0 +hs49 162 163 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0 + +529.0000 +0.0000 +0.0000 +0.0000 +1.0000 +0.0000 +0.0000 +0.0000 +0.0000 +1.0000 +0.0000 +0.0000 +0.0000 +0.0000 +1.0000 +0.0000 +0.0000 +0.0000 +0.0000 +1.0000 +0.0000 +0.0000 +0.0000 +0.0000 +1.0000 +0.0000 +0.0000 +0.0000 +0.0000 +1.0000 +0.0000 +0.0000 +0.0000 +0.0000 +1.0000 +0.0000 +0.0000 +0.0000 +0.0000 +1.0000 +0.0000 +0.0000 +0.0000 +0.0000 +1.0000 +0.0000 +0.0000 +0.0000 +1.0000 \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/data/hist.txt b/cricos/circos-0.69-9/bin/data/hist.txt new file mode 100644 index 0000000000000000000000000000000000000000..e02e3829bc4f9df46b189a5bb66b1d20f49fe940 --- /dev/null +++ b/cricos/circos-0.69-9/bin/data/hist.txt @@ -0,0 +1,2650 @@ +var1 0 1 5.0000 +var1 2 3 7.0000 +var1 4 5 34.0000 +var1 6 7 84.0000 +var1 8 9 192.0000 +var1 10 11 392.0000 +var1 12 13 307.0000 +var1 14 15 283.0000 +var1 16 17 277.0000 +var1 18 19 202.0000 +var1 20 21 164.0000 +var1 22 23 159.0000 +var1 24 25 163.0000 +var1 26 27 162.0000 +var1 28 29 161.0000 +var1 30 31 119.0000 +var1 32 33 155.0000 +var1 34 35 96.0000 +var1 36 37 93.0000 +var1 38 39 70.0000 +var1 40 41 88.0000 +var1 42 43 57.0000 +var1 44 45 59.0000 +var1 46 47 35.0000 +var1 48 49 25.0000 +var1 50 51 20.0000 +var1 52 53 21.0000 +var1 54 55 12.0000 +var1 56 57 5.0000 +var1 58 59 5.0000 +var1 60 61 3.0000 +var1 62 63 2.0000 +var1 64 65 0.0000 +var1 66 67 1.0000 +var1 68 69 1.0000 +var1 70 71 2.0000 +var1 72 73 2.0000 +var1 74 75 2.0000 +var1 76 77 1.0000 +var1 78 79 0.0000 +var1 80 81 0.0000 +var1 82 83 0.0000 +var1 84 85 1.0000 +var1 86 87 0.0000 +var1 88 89 1.0000 +var1 90 91 2.0000 +var1 92 93 0.0000 +var1 94 95 0.0000 +var1 96 97 0.0000 +var1 98 99 1.0000 + + + +var2 0 1 3 +var2 2 3 19 +var2 4 5 32 +var2 6 7 129 +var2 8 9 214 +var2 10 11 239 +var2 12 13 371 +var2 14 15 328 +var2 16 17 245 +var2 18 19 211 +var2 20 21 139 +var2 22 23 148 +var2 24 25 174 +var2 26 27 149 +var2 28 29 140 +var2 30 31 133 +var2 32 33 126 +var2 34 35 136 +var2 36 37 89 +var2 38 39 103 +var2 40 41 88 +var2 42 43 56 +var2 44 45 56 +var2 46 47 29 +var2 48 49 41 +var2 50 51 25 +var2 52 53 10 +var2 54 55 13 +var2 56 57 4 +var2 58 59 4 +var2 60 61 1 +var2 62 63 6 +var2 64 65 3 +var2 66 67 0 +var2 68 69 1 +var2 70 71 0 +var2 72 73 0 +var2 74 75 1 +var2 76 77 0 +var2 78 79 0 +var2 80 81 0 +var2 82 83 1 +var2 84 85 1 +var2 86 87 1 +var2 88 89 1 +var2 90 91 0 +var2 92 93 0 +var2 94 95 0 +var2 96 97 0 +var2 98 99 1 + + +var3 0 1 701 +var3 2 3 89 +var3 4 5 91 +var3 6 7 500 +var3 8 9 218 +var3 10 11 93 +var3 12 13 212 +var3 14 15 151 +var3 16 17 196 +var3 18 19 181 +var3 20 21 136 +var3 22 23 144 +var3 24 25 93 +var3 26 27 102 +var3 28 29 144 +var3 30 31 48 +var3 32 33 58 +var3 34 35 56 +var3 36 37 59 +var3 38 39 45 +var3 40 41 24 +var3 42 43 18 +var3 44 45 41 +var3 46 47 10 +var3 48 49 13 +var3 50 51 1 +var3 52 53 2 +var3 54 55 4 +var3 56 57 1 +var3 58 59 6 +var3 60 61 3 +var3 62 63 0 +var3 64 65 1 +var3 66 67 9 +var3 68 69 3 +var3 70 71 5 +var3 72 73 2 +var3 74 75 6 +var3 76 77 0 +var3 78 79 2 +var3 80 81 0 +var3 82 83 1 +var3 84 85 1 +var3 86 87 0 +var3 88 89 0 +var3 90 91 0 +var3 92 93 0 +var3 94 95 0 +var3 96 97 0 +var3 98 99 1 + + + +var4 0 1 1 +var4 2 3 0 +var4 4 5 0 +var4 6 7 0 +var4 8 9 0 +var4 10 11 0 +var4 12 13 2 +var4 14 15 2 +var4 16 17 0 +var4 18 19 0 +var4 20 21 3 +var4 22 23 8 +var4 24 25 8 +var4 26 27 7 +var4 28 29 9 +var4 30 31 8 +var4 32 33 19 +var4 34 35 24 +var4 36 37 43 +var4 38 39 44 +var4 40 41 80 +var4 42 43 95 +var4 44 45 153 +var4 46 47 209 +var4 48 49 295 +var4 50 51 405 +var4 52 53 373 +var4 54 55 336 +var4 56 57 295 +var4 58 59 214 +var4 60 61 181 +var4 62 63 151 +var4 64 65 122 +var4 66 67 86 +var4 68 69 67 +var4 70 71 60 +var4 72 73 33 +var4 74 75 43 +var4 76 77 22 +var4 78 79 24 +var4 80 81 2 +var4 82 83 26 +var4 84 85 1 +var4 86 87 9 +var4 88 89 4 +var4 90 91 0 +var4 92 93 4 +var4 94 95 0 +var4 96 97 2 +var4 98 99 1 + + +var5 0 1 928 +var5 2 3 0 +var5 4 5 738 +var5 6 7 0 +var5 8 9 565 +var5 10 11 0 +var5 12 13 383 +var5 14 15 0 +var5 16 17 314 +var5 18 19 0 +var5 20 21 192 +var5 22 23 0 +var5 24 25 0 +var5 26 27 131 +var5 28 29 0 +var5 30 31 67 +var5 32 33 0 +var5 34 35 60 +var5 36 37 0 +var5 38 39 33 +var5 40 41 0 +var5 42 43 22 +var5 44 45 0 +var5 46 47 4 +var5 48 49 0 +var5 50 51 0 +var5 52 53 13 +var5 54 55 0 +var5 56 57 6 +var5 58 59 0 +var5 60 61 9 +var5 62 63 0 +var5 64 65 1 +var5 66 67 0 +var5 68 69 3 +var5 70 71 0 +var5 72 73 1 +var5 74 75 0 +var5 76 77 0 +var5 78 79 0 +var5 80 81 0 +var5 82 83 0 +var5 84 85 0 +var5 86 87 0 +var5 88 89 0 +var5 90 91 0 +var5 92 93 0 +var5 94 95 0 +var5 96 97 0 +var5 98 99 1 + + +var6 0 1 8 +var6 2 3 23 +var6 4 5 71 +var6 6 7 101 +var6 8 9 387 +var6 10 11 342 +var6 12 13 247 +var6 14 15 214 +var6 16 17 266 +var6 18 19 306 +var6 20 21 154 +var6 22 23 142 +var6 24 25 158 +var6 26 27 266 +var6 28 29 111 +var6 30 31 133 +var6 32 33 95 +var6 34 35 82 +var6 36 37 108 +var6 38 39 40 +var6 40 41 40 +var6 42 43 24 +var6 44 45 71 +var6 46 47 15 +var6 48 49 14 +var6 50 51 14 +var6 52 53 14 +var6 54 55 12 +var6 56 57 2 +var6 58 59 1 +var6 60 61 1 +var6 62 63 1 +var6 64 65 0 +var6 66 67 2 +var6 68 69 0 +var6 70 71 0 +var6 72 73 1 +var6 74 75 1 +var6 76 77 0 +var6 78 79 0 +var6 80 81 1 +var6 82 83 0 +var6 84 85 0 +var6 86 87 1 +var6 88 89 1 +var6 90 91 0 +var6 92 93 0 +var6 94 95 0 +var6 96 97 0 +var6 98 99 1 + + +var7 0 1 660 +var7 2 3 0 +var7 4 5 0 +var7 6 7 832 +var7 8 9 0 +var7 10 11 0 +var7 12 13 709 +var7 14 15 0 +var7 16 17 0 +var7 18 19 419 +var7 20 21 0 +var7 22 23 0 +var7 24 25 336 +var7 26 27 0 +var7 28 29 0 +var7 30 31 258 +var7 32 33 0 +var7 34 35 0 +var7 36 37 152 +var7 38 39 0 +var7 40 41 0 +var7 42 43 33 +var7 44 45 0 +var7 46 47 0 +var7 48 49 0 +var7 50 51 30 +var7 52 53 0 +var7 54 55 0 +var7 56 57 19 +var7 58 59 0 +var7 60 61 0 +var7 62 63 8 +var7 64 65 0 +var7 66 67 0 +var7 68 69 2 +var7 70 71 0 +var7 72 73 0 +var7 74 75 6 +var7 76 77 0 +var7 78 79 0 +var7 80 81 3 +var7 82 83 0 +var7 84 85 0 +var7 86 87 3 +var7 88 89 0 +var7 90 91 0 +var7 92 93 0 +var7 94 95 0 +var7 96 97 0 +var7 98 99 1 + + +var8 0 1 1614 +var8 2 3 0 +var8 4 5 0 +var8 6 7 0 +var8 8 9 1065 +var8 10 11 0 +var8 12 13 0 +var8 14 15 0 +var8 16 17 0 +var8 18 19 557 +var8 20 21 0 +var8 22 23 0 +var8 24 25 0 +var8 26 27 123 +var8 28 29 0 +var8 30 31 0 +var8 32 33 0 +var8 34 35 0 +var8 36 37 58 +var8 38 39 0 +var8 40 41 0 +var8 42 43 0 +var8 44 45 24 +var8 46 47 0 +var8 48 49 0 +var8 50 51 0 +var8 52 53 0 +var8 54 55 19 +var8 56 57 0 +var8 58 59 0 +var8 60 61 0 +var8 62 63 7 +var8 64 65 0 +var8 66 67 0 +var8 68 69 0 +var8 70 71 0 +var8 72 73 3 +var8 74 75 0 +var8 76 77 0 +var8 78 79 0 +var8 80 81 0 +var8 82 83 0 +var8 84 85 0 +var8 86 87 0 +var8 88 89 0 +var8 90 91 0 +var8 92 93 0 +var8 94 95 0 +var8 96 97 0 +var8 98 99 1 + + +var9 0 1 295 +var9 2 3 0 +var9 4 5 0 +var9 6 7 680 +var9 8 9 0 +var9 10 11 0 +var9 12 13 535 +var9 14 15 0 +var9 16 17 0 +var9 18 19 411 +var9 20 21 0 +var9 22 23 0 +var9 24 25 414 +var9 26 27 0 +var9 28 29 0 +var9 30 31 417 +var9 32 33 0 +var9 34 35 0 +var9 36 37 294 +var9 38 39 0 +var9 40 41 0 +var9 42 43 152 +var9 44 45 0 +var9 46 47 0 +var9 48 49 0 +var9 50 51 106 +var9 52 53 0 +var9 54 55 0 +var9 56 57 67 +var9 58 59 0 +var9 60 61 0 +var9 62 63 44 +var9 64 65 0 +var9 66 67 0 +var9 68 69 20 +var9 70 71 0 +var9 72 73 0 +var9 74 75 23 +var9 76 77 0 +var9 78 79 0 +var9 80 81 5 +var9 82 83 0 +var9 84 85 0 +var9 86 87 3 +var9 88 89 0 +var9 90 91 0 +var9 92 93 4 +var9 94 95 0 +var9 96 97 0 +var9 98 99 1 + + +var10 0 1 8 +var10 2 3 25 +var10 4 5 75 +var10 6 7 116 +var10 8 9 192 +var10 10 11 410 +var10 12 13 388 +var10 14 15 310 +var10 16 17 260 +var10 18 19 148 +var10 20 21 216 +var10 22 23 178 +var10 24 25 152 +var10 26 27 201 +var10 28 29 120 +var10 30 31 151 +var10 32 33 109 +var10 34 35 74 +var10 36 37 62 +var10 38 39 56 +var10 40 41 41 +var10 42 43 32 +var10 44 45 37 +var10 46 47 34 +var10 48 49 13 +var10 50 51 25 +var10 52 53 13 +var10 54 55 7 +var10 56 57 6 +var10 58 59 2 +var10 60 61 2 +var10 62 63 0 +var10 64 65 0 +var10 66 67 1 +var10 68 69 1 +var10 70 71 0 +var10 72 73 0 +var10 74 75 1 +var10 76 77 0 +var10 78 79 1 +var10 80 81 0 +var10 82 83 0 +var10 84 85 0 +var10 86 87 0 +var10 88 89 0 +var10 90 91 1 +var10 92 93 1 +var10 94 95 1 +var10 96 97 0 +var10 98 99 1 + + +var11 0 1 1625 +var11 2 3 0 +var11 4 5 0 +var11 6 7 0 +var11 8 9 906 +var11 10 11 0 +var11 12 13 0 +var11 14 15 0 +var11 16 17 0 +var11 18 19 542 +var11 20 21 0 +var11 22 23 0 +var11 24 25 0 +var11 26 27 204 +var11 28 29 0 +var11 30 31 0 +var11 32 33 0 +var11 34 35 0 +var11 36 37 115 +var11 38 39 0 +var11 40 41 0 +var11 42 43 0 +var11 44 45 41 +var11 46 47 0 +var11 48 49 0 +var11 50 51 0 +var11 52 53 0 +var11 54 55 18 +var11 56 57 0 +var11 58 59 0 +var11 60 61 0 +var11 62 63 12 +var11 64 65 0 +var11 66 67 0 +var11 68 69 0 +var11 70 71 0 +var11 72 73 7 +var11 74 75 0 +var11 76 77 0 +var11 78 79 0 +var11 80 81 0 +var11 82 83 0 +var11 84 85 0 +var11 86 87 0 +var11 88 89 0 +var11 90 91 0 +var11 92 93 0 +var11 94 95 0 +var11 96 97 0 +var11 98 99 1 + +var12 0 1 681 +var12 2 3 0 +var12 4 5 0 +var12 6 7 655 +var12 8 9 0 +var12 10 11 0 +var12 12 13 530 +var12 14 15 0 +var12 16 17 0 +var12 18 19 429 +var12 20 21 0 +var12 22 23 0 +var12 24 25 401 +var12 26 27 0 +var12 28 29 0 +var12 30 31 357 +var12 32 33 0 +var12 34 35 0 +var12 36 37 226 +var12 38 39 0 +var12 40 41 0 +var12 42 43 92 +var12 44 45 0 +var12 46 47 0 +var12 48 49 0 +var12 50 51 31 +var12 52 53 0 +var12 54 55 0 +var12 56 57 22 +var12 58 59 0 +var12 60 61 0 +var12 62 63 18 +var12 64 65 0 +var12 66 67 0 +var12 68 69 7 +var12 70 71 0 +var12 72 73 0 +var12 74 75 11 +var12 76 77 0 +var12 78 79 0 +var12 80 81 6 +var12 82 83 0 +var12 84 85 0 +var12 86 87 3 +var12 88 89 0 +var12 90 91 0 +var12 92 93 1 +var12 94 95 0 +var12 96 97 0 +var12 98 99 1 + + +var13 0 1 907 +var13 2 3 0 +var13 4 5 0 +var13 6 7 0 +var13 8 9 0 +var13 10 11 0 +var13 12 13 1210 +var13 14 15 0 +var13 16 17 0 +var13 18 19 0 +var13 20 21 0 +var13 22 23 0 +var13 24 25 731 +var13 26 27 0 +var13 28 29 0 +var13 30 31 0 +var13 32 33 0 +var13 34 35 0 +var13 36 37 305 +var13 38 39 0 +var13 40 41 0 +var13 42 43 0 +var13 44 45 0 +var13 46 47 0 +var13 48 49 0 +var13 50 51 235 +var13 52 53 0 +var13 54 55 0 +var13 56 57 0 +var13 58 59 0 +var13 60 61 0 +var13 62 63 64 +var13 64 65 0 +var13 66 67 0 +var13 68 69 0 +var13 70 71 0 +var13 72 73 0 +var13 74 75 7 +var13 76 77 0 +var13 78 79 0 +var13 80 81 0 +var13 82 83 0 +var13 84 85 0 +var13 86 87 8 +var13 88 89 0 +var13 90 91 0 +var13 92 93 0 +var13 94 95 0 +var13 96 97 0 +var13 98 99 4 + + +var14 0 1 1369 +var14 2 3 0 +var14 4 5 0 +var14 6 7 0 +var14 8 9 0 +var14 10 11 0 +var14 12 13 0 +var14 14 15 1180 +var14 16 17 0 +var14 18 19 0 +var14 20 21 0 +var14 22 23 0 +var14 24 25 0 +var14 26 27 0 +var14 28 29 749 +var14 30 31 0 +var14 32 33 0 +var14 34 35 0 +var14 36 37 0 +var14 38 39 0 +var14 40 41 0 +var14 42 43 126 +var14 44 45 0 +var14 46 47 0 +var14 48 49 0 +var14 50 51 0 +var14 52 53 0 +var14 54 55 0 +var14 56 57 31 +var14 58 59 0 +var14 60 61 0 +var14 62 63 0 +var14 64 65 0 +var14 66 67 0 +var14 68 69 0 +var14 70 71 12 +var14 72 73 0 +var14 74 75 0 +var14 76 77 0 +var14 78 79 0 +var14 80 81 0 +var14 82 83 0 +var14 84 85 3 +var14 86 87 0 +var14 88 89 0 +var14 90 91 0 +var14 92 93 0 +var14 94 95 0 +var14 96 97 0 +var14 98 99 1 + + +var15 0 1 2814 +var15 2 3 0 +var15 4 5 0 +var15 6 7 0 +var15 8 9 0 +var15 10 11 0 +var15 12 13 0 +var15 14 15 395 +var15 16 17 0 +var15 18 19 0 +var15 20 21 0 +var15 22 23 0 +var15 24 25 0 +var15 26 27 0 +var15 28 29 103 +var15 30 31 0 +var15 32 33 0 +var15 34 35 0 +var15 36 37 0 +var15 38 39 0 +var15 40 41 0 +var15 42 43 111 +var15 44 45 0 +var15 46 47 0 +var15 48 49 0 +var15 50 51 0 +var15 52 53 0 +var15 54 55 0 +var15 56 57 38 +var15 58 59 0 +var15 60 61 0 +var15 62 63 0 +var15 64 65 0 +var15 66 67 0 +var15 68 69 0 +var15 70 71 6 +var15 72 73 0 +var15 74 75 0 +var15 76 77 0 +var15 78 79 0 +var15 80 81 0 +var15 82 83 0 +var15 84 85 2 +var15 86 87 0 +var15 88 89 0 +var15 90 91 0 +var15 92 93 0 +var15 94 95 0 +var15 96 97 0 +var15 98 99 2 + + +var15 0 1 2814 +var15 2 3 0 +var15 4 5 0 +var15 6 7 0 +var15 8 9 0 +var15 10 11 0 +var15 12 13 0 +var15 14 15 395 +var15 16 17 0 +var15 18 19 0 +var15 20 21 0 +var15 22 23 0 +var15 24 25 0 +var15 26 27 0 +var15 28 29 103 +var15 30 31 0 +var15 32 33 0 +var15 34 35 0 +var15 36 37 0 +var15 38 39 0 +var15 40 41 0 +var15 42 43 111 +var15 44 45 0 +var15 46 47 0 +var15 48 49 0 +var15 50 51 0 +var15 52 53 0 +var15 54 55 0 +var15 56 57 38 +var15 58 59 0 +var15 60 61 0 +var15 62 63 0 +var15 64 65 0 +var15 66 67 0 +var15 68 69 0 +var15 70 71 6 +var15 72 73 0 +var15 74 75 0 +var15 76 77 0 +var15 78 79 0 +var15 80 81 0 +var15 82 83 0 +var15 84 85 2 +var15 86 87 0 +var15 88 89 0 +var15 90 91 0 +var15 92 93 0 +var15 94 95 0 +var15 96 97 0 +var15 98 99 2 + + +var16 0 1 2560 +var16 2 3 0 +var16 4 5 0 +var16 6 7 0 +var16 8 9 0 +var16 10 11 0 +var16 12 13 551 +var16 14 15 0 +var16 16 17 0 +var16 18 19 0 +var16 20 21 0 +var16 22 23 0 +var16 24 25 125 +var16 26 27 0 +var16 28 29 0 +var16 30 31 0 +var16 32 33 0 +var16 34 35 0 +var16 36 37 75 +var16 38 39 0 +var16 40 41 0 +var16 42 43 0 +var16 44 45 0 +var16 46 47 0 +var16 48 49 0 +var16 50 51 132 +var16 52 53 0 +var16 54 55 0 +var16 56 57 0 +var16 58 59 0 +var16 60 61 0 +var16 62 63 16 +var16 64 65 0 +var16 66 67 0 +var16 68 69 0 +var16 70 71 0 +var16 72 73 0 +var16 74 75 8 +var16 76 77 0 +var16 78 79 0 +var16 80 81 0 +var16 82 83 0 +var16 84 85 0 +var16 86 87 2 +var16 88 89 0 +var16 90 91 0 +var16 92 93 0 +var16 94 95 0 +var16 96 97 0 +var16 98 99 2 + + +var17 0 1 5 +var17 2 3 8 +var17 4 5 41 +var17 6 7 124 +var17 8 9 208 +var17 10 11 327 +var17 12 13 378 +var17 14 15 321 +var17 16 17 284 +var17 18 19 165 +var17 20 21 157 +var17 22 23 169 +var17 24 25 172 +var17 26 27 165 +var17 28 29 123 +var17 30 31 154 +var17 32 33 121 +var17 34 35 135 +var17 36 37 82 +var17 38 39 64 +var17 40 41 62 +var17 42 43 45 +var17 44 45 36 +var17 46 47 40 +var17 48 49 31 +var17 50 51 17 +var17 52 53 11 +var17 54 55 8 +var17 56 57 4 +var17 58 59 3 +var17 60 61 2 +var17 62 63 1 +var17 64 65 0 +var17 66 67 2 +var17 68 69 0 +var17 70 71 0 +var17 72 73 0 +var17 74 75 1 +var17 76 77 1 +var17 78 79 0 +var17 80 81 0 +var17 82 83 0 +var17 84 85 1 +var17 86 87 0 +var17 88 89 1 +var17 90 91 1 +var17 92 93 0 +var17 94 95 0 +var17 96 97 0 +var17 98 99 1 + + +var18 0 1 2 +var18 2 3 0 +var18 4 5 0 +var18 6 7 0 +var18 8 9 0 +var18 10 11 0 +var18 12 13 0 +var18 14 15 2 +var18 16 17 1 +var18 18 19 5 +var18 20 21 1 +var18 22 23 5 +var18 24 25 8 +var18 26 27 20 +var18 28 29 56 +var18 30 31 123 +var18 32 33 76 +var18 34 35 50 +var18 36 37 149 +var18 38 39 145 +var18 40 41 161 +var18 42 43 225 +var18 44 45 195 +var18 46 47 205 +var18 48 49 248 +var18 50 51 219 +var18 52 53 338 +var18 54 55 306 +var18 56 57 293 +var18 58 59 215 +var18 60 61 110 +var18 62 63 64 +var18 64 65 68 +var18 66 67 41 +var18 68 69 33 +var18 70 71 13 +var18 72 73 8 +var18 74 75 37 +var18 76 77 15 +var18 78 79 3 +var18 80 81 19 +var18 82 83 4 +var18 84 85 1 +var18 86 87 3 +var18 88 89 1 +var18 90 91 0 +var18 92 93 1 +var18 94 95 0 +var18 96 97 0 +var18 98 99 2 + + +var19 0 1 442 +var19 2 3 354 +var19 4 5 160 +var19 6 7 305 +var19 8 9 201 +var19 10 11 236 +var19 12 13 221 +var19 14 15 137 +var19 16 17 228 +var19 18 19 131 +var19 20 21 127 +var19 22 23 124 +var19 24 25 133 +var19 26 27 133 +var19 28 29 123 +var19 30 31 76 +var19 32 33 73 +var19 34 35 57 +var19 36 37 27 +var19 38 39 37 +var19 40 41 48 +var19 42 43 25 +var19 44 45 13 +var19 46 47 17 +var19 48 49 8 +var19 50 51 13 +var19 52 53 9 +var19 54 55 0 +var19 56 57 2 +var19 58 59 3 +var19 60 61 2 +var19 62 63 1 +var19 64 65 2 +var19 66 67 1 +var19 68 69 1 +var19 70 71 0 +var19 72 73 0 +var19 74 75 0 +var19 76 77 0 +var19 78 79 0 +var19 80 81 0 +var19 82 83 0 +var19 84 85 0 +var19 86 87 0 +var19 88 89 0 +var19 90 91 0 +var19 92 93 0 +var19 94 95 0 +var19 96 97 0 +var19 98 99 1 + +var20 0 1 3468 +var20 2 3 0 +var20 4 5 1 +var20 6 7 1 +var20 8 9 0 +var20 10 11 0 +var20 12 13 0 +var20 14 15 0 +var20 16 17 0 +var20 18 19 0 +var20 20 21 0 +var20 22 23 0 +var20 24 25 0 +var20 26 27 0 +var20 28 29 0 +var20 30 31 0 +var20 32 33 0 +var20 34 35 0 +var20 36 37 0 +var20 38 39 0 +var20 40 41 0 +var20 42 43 0 +var20 44 45 0 +var20 46 47 0 +var20 48 49 0 +var20 50 51 0 +var20 52 53 0 +var20 54 55 0 +var20 56 57 0 +var20 58 59 0 +var20 60 61 0 +var20 62 63 0 +var20 64 65 0 +var20 66 67 0 +var20 68 69 0 +var20 70 71 0 +var20 72 73 0 +var20 74 75 0 +var20 76 77 0 +var20 78 79 0 +var20 80 81 0 +var20 82 83 0 +var20 84 85 0 +var20 86 87 0 +var20 88 89 0 +var20 90 91 0 +var20 92 93 0 +var20 94 95 0 +var20 96 97 0 +var20 98 99 1 + + +var21 0 3 3 +var21 6 9 2609 +var21 12 15 825 +var21 18 21 30 +var21 24 27 2 +var21 30 33 0 +var21 36 39 0 +var21 42 45 0 +var21 48 51 0 +var21 54 57 0 +var21 60 63 0 +var21 66 69 0 +var21 72 75 0 +var21 78 81 0 +var21 84 87 0 +var21 90 93 0 +var21 96 99 0 +var21 102 105 0 +var21 108 111 0 +var21 114 117 0 +var21 120 123 0 +var21 126 129 0 +var21 132 135 0 +var21 138 141 0 +var21 144 147 0 +var21 150 153 0 +var21 156 159 0 +var21 162 165 0 +var21 168 171 0 +var21 174 177 0 +var21 180 183 0 +var21 186 189 0 +var21 192 195 0 +var21 198 201 0 +var21 204 207 0 +var21 210 213 0 +var21 216 219 0 +var21 222 225 0 +var21 228 231 0 +var21 234 237 0 +var21 240 243 0 +var21 246 249 0 +var21 252 255 0 +var21 258 261 0 +var21 264 267 0 +var21 270 273 0 +var21 276 279 0 +var21 282 285 0 +var21 288 291 0 +var21 294 297 2 + + +var22 0 14 1 +var22 28 42 14 +var22 56 70 59 +var22 84 98 121 +var22 112 126 197 +var22 140 154 337 +var22 168 182 416 +var22 196 210 321 +var22 224 238 274 +var22 252 266 174 +var22 280 294 174 +var22 308 322 193 +var22 336 350 146 +var22 364 378 166 +var22 392 406 167 +var22 420 434 132 +var22 448 462 91 +var22 476 490 93 +var22 504 518 60 +var22 532 546 52 +var22 560 574 53 +var22 588 602 34 +var22 616 630 50 +var22 644 658 29 +var22 672 686 33 +var22 700 714 28 +var22 728 742 18 +var22 756 770 12 +var22 784 798 9 +var22 812 826 6 +var22 840 854 2 +var22 868 882 1 +var22 896 910 0 +var22 924 938 2 +var22 952 966 0 +var22 980 994 0 +var22 1008 1022 1 +var22 1036 1050 0 +var22 1064 1078 0 +var22 1092 1106 0 +var22 1120 1134 1 +var22 1148 1162 0 +var22 1176 1190 0 +var22 1204 1218 1 +var22 1232 1246 0 +var22 1260 1274 0 +var22 1288 1302 0 +var22 1316 1330 1 +var22 1344 1358 1 +var22 1372 1386 1 + + +var23 0 1 8 +var23 2 3 109 +var23 4 5 350 +var23 6 7 481 +var23 8 9 417 +var23 10 11 376 +var23 12 13 352 +var23 14 15 257 +var23 16 17 283 +var23 18 19 195 +var23 20 21 148 +var23 22 23 112 +var23 24 25 101 +var23 26 27 70 +var23 28 29 43 +var23 30 31 43 +var23 32 33 27 +var23 34 35 19 +var23 36 37 16 +var23 38 39 9 +var23 40 41 14 +var23 42 43 4 +var23 44 45 4 +var23 46 47 4 +var23 48 49 4 +var23 50 51 3 +var23 52 53 6 +var23 54 55 3 +var23 56 57 2 +var23 58 59 2 +var23 60 61 1 +var23 62 63 4 +var23 64 65 1 +var23 66 67 0 +var23 68 69 0 +var23 70 71 1 +var23 72 73 0 +var23 74 75 0 +var23 76 77 1 +var23 78 79 0 +var23 80 81 0 +var23 82 83 0 +var23 84 85 0 +var23 86 87 0 +var23 88 89 0 +var23 90 91 0 +var23 92 93 0 +var23 94 95 0 +var23 96 97 0 +var23 98 99 1 + + +var24 0 1 1 +var24 2 3 0 +var24 4 5 0 +var24 6 7 0 +var24 8 9 0 +var24 10 11 1 +var24 12 13 2 +var24 14 15 1 +var24 16 17 0 +var24 18 19 3 +var24 20 21 2 +var24 22 23 2 +var24 24 25 4 +var24 26 27 21 +var24 28 29 24 +var24 30 31 40 +var24 32 33 53 +var24 34 35 81 +var24 36 37 94 +var24 38 39 104 +var24 40 41 149 +var24 42 43 228 +var24 44 45 317 +var24 46 47 229 +var24 48 49 252 +var24 50 51 302 +var24 52 53 204 +var24 54 55 163 +var24 56 57 253 +var24 58 59 184 +var24 60 61 342 +var24 62 63 102 +var24 64 65 80 +var24 66 67 71 +var24 68 69 42 +var24 70 71 37 +var24 72 73 20 +var24 74 75 23 +var24 76 77 19 +var24 78 79 2 +var24 80 81 9 +var24 82 83 7 +var24 84 85 1 +var24 86 87 0 +var24 88 89 0 +var24 90 91 1 +var24 92 93 0 +var24 94 95 0 +var24 96 97 0 +var24 98 99 1 + + +var25 0 1 2837 +var25 2 3 0 +var25 4 5 0 +var25 6 7 0 +var25 8 9 0 +var25 10 11 0 +var25 12 13 332 +var25 14 15 0 +var25 16 17 0 +var25 18 19 0 +var25 20 21 0 +var25 22 23 0 +var25 24 25 164 +var25 26 27 0 +var25 28 29 0 +var25 30 31 0 +var25 32 33 0 +var25 34 35 0 +var25 36 37 34 +var25 38 39 0 +var25 40 41 0 +var25 42 43 0 +var25 44 45 0 +var25 46 47 0 +var25 48 49 0 +var25 50 51 97 +var25 52 53 0 +var25 54 55 0 +var25 56 57 0 +var25 58 59 0 +var25 60 61 0 +var25 62 63 5 +var25 64 65 0 +var25 66 67 0 +var25 68 69 0 +var25 70 71 0 +var25 72 73 0 +var25 74 75 0 +var25 76 77 0 +var25 78 79 0 +var25 80 81 0 +var25 82 83 0 +var25 84 85 0 +var25 86 87 0 +var25 88 89 0 +var25 90 91 0 +var25 92 93 0 +var25 94 95 0 +var25 96 97 0 +var25 98 99 2 + + +var26 0 1 709 +var26 2 3 0 +var26 4 5 12 +var26 6 7 53 +var26 8 9 23 +var26 10 11 33 +var26 12 13 123 +var26 14 15 182 +var26 16 17 45 +var26 18 19 36 +var26 20 21 62 +var26 22 23 93 +var26 24 25 112 +var26 26 27 29 +var26 28 29 47 +var26 30 31 62 +var26 32 33 79 +var26 34 35 22 +var26 36 37 59 +var26 38 39 20 +var26 40 41 96 +var26 42 43 30 +var26 44 45 34 +var26 46 47 29 +var26 48 49 0 +var26 50 51 107 +var26 52 53 34 +var26 54 55 32 +var26 56 57 23 +var26 58 59 24 +var26 60 61 62 +var26 62 63 29 +var26 64 65 9 +var26 66 67 80 +var26 68 69 47 +var26 70 71 25 +var26 72 73 38 +var26 74 75 61 +var26 76 77 25 +var26 78 79 13 +var26 80 81 83 +var26 82 83 53 +var26 84 85 50 +var26 86 87 27 +var26 88 89 17 +var26 90 91 40 +var26 92 93 17 +var26 94 95 19 +var26 96 97 0 +var26 98 99 566 + + +var27 0 1 3442 +var27 2 3 0 +var27 4 5 0 +var27 6 7 0 +var27 8 9 0 +var27 10 11 0 +var27 12 13 0 +var27 14 15 0 +var27 16 17 0 +var27 18 19 0 +var27 20 21 0 +var27 22 23 0 +var27 24 25 0 +var27 26 27 0 +var27 28 29 0 +var27 30 31 0 +var27 32 33 0 +var27 34 35 0 +var27 36 37 0 +var27 38 39 0 +var27 40 41 0 +var27 42 43 0 +var27 44 45 0 +var27 46 47 0 +var27 48 49 0 +var27 50 51 28 +var27 52 53 0 +var27 54 55 0 +var27 56 57 0 +var27 58 59 0 +var27 60 61 0 +var27 62 63 0 +var27 64 65 0 +var27 66 67 0 +var27 68 69 0 +var27 70 71 0 +var27 72 73 0 +var27 74 75 0 +var27 76 77 0 +var27 78 79 0 +var27 80 81 0 +var27 82 83 0 +var27 84 85 0 +var27 86 87 0 +var27 88 89 0 +var27 90 91 0 +var27 92 93 0 +var27 94 95 0 +var27 96 97 0 +var27 98 99 1 + + +var28 0 1 3390 +var28 2 3 0 +var28 4 5 0 +var28 6 7 0 +var28 8 9 0 +var28 10 11 0 +var28 12 13 0 +var28 14 15 0 +var28 16 17 0 +var28 18 19 0 +var28 20 21 0 +var28 22 23 0 +var28 24 25 0 +var28 26 27 0 +var28 28 29 0 +var28 30 31 0 +var28 32 33 0 +var28 34 35 0 +var28 36 37 0 +var28 38 39 0 +var28 40 41 67 +var28 42 43 0 +var28 44 45 0 +var28 46 47 0 +var28 48 49 0 +var28 50 51 0 +var28 52 53 0 +var28 54 55 0 +var28 56 57 0 +var28 58 59 0 +var28 60 61 0 +var28 62 63 0 +var28 64 65 0 +var28 66 67 0 +var28 68 69 0 +var28 70 71 0 +var28 72 73 0 +var28 74 75 0 +var28 76 77 0 +var28 78 79 0 +var28 80 81 13 +var28 82 83 0 +var28 84 85 0 +var28 86 87 0 +var28 88 89 0 +var28 90 91 0 +var28 92 93 0 +var28 94 95 0 +var28 96 97 0 +var28 98 99 1 + +var29 0 14 5 +var29 28 42 7 +var29 56 70 42 +var29 84 98 119 +var29 112 126 211 +var29 140 154 323 +var29 168 182 384 +var29 196 210 318 +var29 224 238 288 +var29 252 266 160 +var29 280 294 158 +var29 308 322 165 +var29 336 350 175 +var29 364 378 168 +var29 392 406 120 +var29 420 434 150 +var29 448 462 127 +var29 476 490 113 +var29 504 518 105 +var29 532 546 63 +var29 560 574 60 +var29 588 602 47 +var29 616 630 37 +var29 644 658 39 +var29 672 686 33 +var29 700 714 17 +var29 728 742 11 +var29 756 770 8 +var29 784 798 2 +var29 812 826 4 +var29 840 854 3 +var29 868 882 1 +var29 896 910 0 +var29 924 938 2 +var29 952 966 0 +var29 980 994 0 +var29 1008 1022 0 +var29 1036 1050 1 +var29 1064 1078 1 +var29 1092 1106 0 +var29 1120 1134 0 +var29 1148 1162 0 +var29 1176 1190 1 +var29 1204 1218 0 +var29 1232 1246 1 +var29 1260 1274 1 +var29 1288 1302 0 +var29 1316 1330 0 +var29 1344 1358 0 +var29 1372 1386 1 + + +var30 0 10 5 +var30 20 30 7 +var30 40 50 42 +var30 60 70 119 +var30 80 90 211 +var30 100 110 323 +var30 120 130 384 +var30 140 150 318 +var30 160 170 288 +var30 180 190 160 +var30 200 210 158 +var30 220 230 165 +var30 240 250 175 +var30 260 270 168 +var30 280 290 120 +var30 300 310 150 +var30 320 330 127 +var30 340 350 113 +var30 360 370 105 +var30 380 390 63 +var30 400 410 60 +var30 420 430 47 +var30 440 450 37 +var30 460 470 39 +var30 480 490 33 +var30 500 510 17 +var30 520 530 11 +var30 540 550 8 +var30 560 570 2 +var30 580 590 4 +var30 600 610 3 +var30 620 630 1 +var30 640 650 0 +var30 660 670 2 +var30 680 690 0 +var30 700 710 0 +var30 720 730 0 +var30 740 750 1 +var30 760 770 1 +var30 780 790 0 +var30 800 810 0 +var30 820 830 0 +var30 840 850 1 +var30 860 870 0 +var30 880 890 1 +var30 900 910 1 +var30 920 930 0 +var30 940 950 0 +var30 960 970 0 +var30 980 990 1 + + +var31 0 12 5 +var31 24 36 7 +var31 48 60 42 +var31 72 84 119 +var31 96 108 211 +var31 120 132 323 +var31 144 156 384 +var31 168 180 318 +var31 192 204 288 +var31 216 228 160 +var31 240 252 158 +var31 264 276 165 +var31 288 300 175 +var31 312 324 168 +var31 336 348 120 +var31 360 372 150 +var31 384 396 127 +var31 408 420 113 +var31 432 444 105 +var31 456 468 63 +var31 480 492 60 +var31 504 516 47 +var31 528 540 37 +var31 552 564 39 +var31 576 588 33 +var31 600 612 17 +var31 624 636 11 +var31 648 660 8 +var31 672 684 2 +var31 696 708 4 +var31 720 732 3 +var31 744 756 1 +var31 768 780 0 +var31 792 804 2 +var31 816 828 0 +var31 840 852 0 +var31 864 876 0 +var31 888 900 1 +var31 912 924 1 +var31 936 948 0 +var31 960 972 0 +var31 984 996 0 +var31 1008 1020 1 +var31 1032 1044 0 +var31 1056 1068 1 +var31 1080 1092 1 +var31 1104 1116 0 +var31 1128 1140 0 +var31 1152 1164 0 +var31 1176 1188 1 + + +var32 0 11 5 +var32 22 33 7 +var32 44 55 42 +var32 66 77 119 +var32 88 99 211 +var32 110 121 323 +var32 132 143 384 +var32 154 165 318 +var32 176 187 288 +var32 198 209 160 +var32 220 231 158 +var32 242 253 165 +var32 264 275 175 +var32 286 297 168 +var32 308 319 120 +var32 330 341 150 +var32 352 363 127 +var32 374 385 113 +var32 396 407 105 +var32 418 429 63 +var32 440 451 60 +var32 462 473 47 +var32 484 495 37 +var32 506 517 39 +var32 528 539 33 +var32 550 561 17 +var32 572 583 11 +var32 594 605 8 +var32 616 627 2 +var32 638 649 4 +var32 660 671 3 +var32 682 693 1 +var32 704 715 0 +var32 726 737 2 +var32 748 759 0 +var32 770 781 0 +var32 792 803 0 +var32 814 825 1 +var32 836 847 1 +var32 858 869 0 +var32 880 891 0 +var32 902 913 0 +var32 924 935 1 +var32 946 957 0 +var32 968 979 1 +var32 990 1001 1 +var32 1012 1023 0 +var32 1034 1045 0 +var32 1056 1067 0 +var32 1078 1089 1 + + +var33 0 10 1 +var33 20 30 12 +var33 40 50 69 +var33 60 70 172 +var33 80 90 195 +var33 100 110 361 +var33 120 130 273 +var33 140 150 263 +var33 160 170 266 +var33 180 190 230 +var33 200 210 185 +var33 220 230 205 +var33 240 250 205 +var33 260 270 236 +var33 280 290 174 +var33 300 310 134 +var33 320 330 90 +var33 340 350 56 +var33 360 370 60 +var33 380 390 71 +var33 400 410 66 +var33 420 430 23 +var33 440 450 18 +var33 460 470 23 +var33 480 490 23 +var33 500 510 11 +var33 520 530 3 +var33 540 550 11 +var33 560 570 5 +var33 580 590 13 +var33 600 610 7 +var33 620 630 2 +var33 640 650 1 +var33 660 670 1 +var33 680 690 0 +var33 700 710 0 +var33 720 730 1 +var33 740 750 0 +var33 760 770 2 +var33 780 790 1 +var33 800 810 1 +var33 820 830 0 +var33 840 850 0 +var33 860 870 0 +var33 880 890 0 +var33 900 910 0 +var33 920 930 0 +var33 940 950 0 +var33 960 970 0 +var33 980 990 1 + + +var34 0 1 1 +var34 2 3 0 +var34 4 5 0 +var34 6 7 0 +var34 8 9 0 +var34 10 11 0 +var34 12 13 0 +var34 14 15 0 +var34 16 17 0 +var34 18 19 0 +var34 20 21 0 +var34 22 23 0 +var34 24 25 176 +var34 26 27 144 +var34 28 29 196 +var34 30 31 139 +var34 32 33 116 +var34 34 35 129 +var34 36 37 139 +var34 38 39 115 +var34 40 41 103 +var34 42 43 123 +var34 44 45 129 +var34 46 47 118 +var34 48 49 91 +var34 50 51 104 +var34 52 53 100 +var34 54 55 123 +var34 56 57 96 +var34 58 59 120 +var34 60 61 73 +var34 62 63 105 +var34 64 65 129 +var34 66 67 106 +var34 68 69 101 +var34 70 71 81 +var34 72 73 46 +var34 74 75 56 +var34 76 77 75 +var34 78 79 54 +var34 80 81 26 +var34 82 83 26 +var34 84 85 36 +var34 86 87 22 +var34 88 89 53 +var34 90 91 26 +var34 92 93 57 +var34 94 95 64 +var34 96 97 48 +var34 98 99 25 + + +var35 0 1 0 +var35 2 3 0 +var35 4 5 0 +var35 6 7 0 +var35 8 9 0 +var35 10 11 0 +var35 12 13 0 +var35 14 15 0 +var35 16 17 0 +var35 18 19 0 +var35 20 21 0 +var35 22 23 0 +var35 24 25 0 +var35 26 27 0 +var35 28 29 0 +var35 30 31 0 +var35 32 33 0 +var35 34 35 0 +var35 36 37 0 +var35 38 39 0 +var35 40 41 0 +var35 42 43 0 +var35 44 45 0 +var35 46 47 0 +var35 48 49 0 +var35 50 51 3471 +var35 52 53 0 +var35 54 55 0 +var35 56 57 0 +var35 58 59 0 +var35 60 61 0 +var35 62 63 0 +var35 64 65 0 +var35 66 67 0 +var35 68 69 0 +var35 70 71 0 +var35 72 73 0 +var35 74 75 0 +var35 76 77 0 +var35 78 79 0 +var35 80 81 0 +var35 82 83 0 +var35 84 85 0 +var35 86 87 0 +var35 88 89 0 +var35 90 91 0 +var35 92 93 0 +var35 94 95 0 +var35 96 97 0 +var35 98 99 0 + + +var36 0 3 1041 +var36 6 9 742 +var36 12 15 377 +var36 18 21 316 +var36 24 27 256 +var36 30 33 167 +var36 36 39 149 +var36 42 45 83 +var36 48 51 69 +var36 54 57 58 +var36 60 63 38 +var36 66 69 27 +var36 72 75 34 +var36 78 81 24 +var36 84 87 12 +var36 90 93 7 +var36 96 99 12 +var36 102 105 14 +var36 108 111 9 +var36 114 117 6 +var36 120 123 6 +var36 126 129 2 +var36 132 135 1 +var36 138 141 3 +var36 144 147 0 +var36 150 153 0 +var36 156 159 2 +var36 162 165 1 +var36 168 171 1 +var36 174 177 1 +var36 180 183 2 +var36 186 189 0 +var36 192 195 2 +var36 198 201 2 +var36 204 207 0 +var36 210 213 0 +var36 216 219 0 +var36 222 225 0 +var36 228 231 1 +var36 234 237 0 +var36 240 243 1 +var36 246 249 1 +var36 252 255 0 +var36 258 261 1 +var36 264 267 1 +var36 270 273 0 +var36 276 279 0 +var36 282 285 0 +var36 288 291 1 +var36 294 297 1 + + + +var37 0 2 1 +var37 4 6 0 +var37 8 10 0 +var37 12 14 0 +var37 16 18 0 +var37 20 22 0 +var37 24 26 0 +var37 28 30 0 +var37 32 34 0 +var37 36 38 0 +var37 40 42 0 +var37 44 46 0 +var37 48 50 0 +var37 52 54 0 +var37 56 58 0 +var37 60 62 0 +var37 64 66 0 +var37 68 70 0 +var37 72 74 0 +var37 76 78 0 +var37 80 82 0 +var37 84 86 0 +var37 88 90 0 +var37 92 94 0 +var37 96 98 0 +var37 100 102 0 +var37 104 106 0 +var37 108 110 0 +var37 112 114 0 +var37 116 118 0 +var37 120 122 0 +var37 124 126 0 +var37 128 130 0 +var37 132 134 0 +var37 136 138 0 +var37 140 142 0 +var37 144 146 0 +var37 148 150 0 +var37 152 154 0 +var37 156 158 0 +var37 160 162 0 +var37 164 166 0 +var37 168 170 0 +var37 172 174 0 +var37 176 178 0 +var37 180 182 0 +var37 184 186 0 +var37 188 190 0 +var37 192 194 0 +var37 196 198 3470 + + +var38 0 1 1 +var38 2 3 0 +var38 4 5 3 +var38 6 7 4 +var38 8 9 5 +var38 10 11 11 +var38 12 13 48 +var38 14 15 94 +var38 16 17 115 +var38 18 19 263 +var38 20 21 264 +var38 22 23 269 +var38 24 25 339 +var38 26 27 307 +var38 28 29 222 +var38 30 31 209 +var38 32 33 217 +var38 34 35 262 +var38 36 37 226 +var38 38 39 144 +var38 40 41 94 +var38 42 43 96 +var38 44 45 56 +var38 46 47 43 +var38 48 49 34 +var38 50 51 27 +var38 52 53 26 +var38 54 55 28 +var38 56 57 8 +var38 58 59 14 +var38 60 61 8 +var38 62 63 6 +var38 64 65 5 +var38 66 67 4 +var38 68 69 6 +var38 70 71 7 +var38 72 73 0 +var38 74 75 3 +var38 76 77 2 +var38 78 79 0 +var38 80 81 0 +var38 82 83 0 +var38 84 85 0 +var38 86 87 0 +var38 88 89 0 +var38 90 91 0 +var38 92 93 0 +var38 94 95 0 +var38 96 97 0 +var38 98 99 1 + + +var38 0 1 1 +var38 2 3 0 +var38 4 5 3 +var38 6 7 4 +var38 8 9 5 +var38 10 11 11 +var38 12 13 48 +var38 14 15 94 +var38 16 17 115 +var38 18 19 263 +var38 20 21 264 +var38 22 23 269 +var38 24 25 339 +var38 26 27 307 +var38 28 29 222 +var38 30 31 209 +var38 32 33 217 +var38 34 35 262 +var38 36 37 226 +var38 38 39 144 +var38 40 41 94 +var38 42 43 96 +var38 44 45 56 +var38 46 47 43 +var38 48 49 34 +var38 50 51 27 +var38 52 53 26 +var38 54 55 28 +var38 56 57 8 +var38 58 59 14 +var38 60 61 8 +var38 62 63 6 +var38 64 65 5 +var38 66 67 4 +var38 68 69 6 +var38 70 71 7 +var38 72 73 0 +var38 74 75 3 +var38 76 77 2 +var38 78 79 0 +var38 80 81 0 +var38 82 83 0 +var38 84 85 0 +var38 86 87 0 +var38 88 89 0 +var38 90 91 0 +var38 92 93 0 +var38 94 95 0 +var38 96 97 0 +var38 98 99 1 + +var39 0 1 1988 +var39 2 3 630 +var39 4 5 312 +var39 6 7 191 +var39 8 9 105 +var39 10 11 12 +var39 12 13 0 +var39 14 15 3 +var39 16 17 3 +var39 18 19 4 +var39 20 21 2 +var39 22 23 3 +var39 24 25 5 +var39 26 27 3 +var39 28 29 6 +var39 30 31 4 +var39 32 33 21 +var39 34 35 10 +var39 36 37 16 +var39 38 39 13 +var39 40 41 11 +var39 42 43 5 +var39 44 45 1 +var39 46 47 3 +var39 48 49 9 +var39 50 51 13 +var39 52 53 16 +var39 54 55 7 +var39 56 57 9 +var39 58 59 8 +var39 60 61 4 +var39 62 63 4 +var39 64 65 0 +var39 66 67 0 +var39 68 69 0 +var39 70 71 0 +var39 72 73 0 +var39 74 75 0 +var39 76 77 6 +var39 78 79 0 +var39 80 81 3 +var39 82 83 2 +var39 84 85 0 +var39 86 87 19 +var39 88 89 10 +var39 90 91 4 +var39 92 93 3 +var39 94 95 0 +var39 96 97 1 +var39 98 99 2 + + +var40 0 1 1 +var40 2 3 0 +var40 4 5 0 +var40 6 7 0 +var40 8 9 0 +var40 10 11 0 +var40 12 13 0 +var40 14 15 0 +var40 16 17 0 +var40 18 19 0 +var40 20 21 0 +var40 22 23 0 +var40 24 25 0 +var40 26 27 0 +var40 28 29 0 +var40 30 31 0 +var40 32 33 0 +var40 34 35 0 +var40 36 37 0 +var40 38 39 0 +var40 40 41 0 +var40 42 43 0 +var40 44 45 0 +var40 46 47 0 +var40 48 49 0 +var40 50 51 0 +var40 52 53 0 +var40 54 55 0 +var40 56 57 0 +var40 58 59 0 +var40 60 61 0 +var40 62 63 0 +var40 64 65 0 +var40 66 67 0 +var40 68 69 0 +var40 70 71 0 +var40 72 73 0 +var40 74 75 0 +var40 76 77 0 +var40 78 79 0 +var40 80 81 0 +var40 82 83 0 +var40 84 85 0 +var40 86 87 88 +var40 88 89 101 +var40 90 91 201 +var40 92 93 296 +var40 94 95 434 +var40 96 97 711 +var40 98 99 1639 + + +var41 0 1 0 +var41 2 3 0 +var41 4 5 0 +var41 6 7 0 +var41 8 9 0 +var41 10 11 0 +var41 12 13 0 +var41 14 15 0 +var41 16 17 0 +var41 18 19 0 +var41 20 21 0 +var41 22 23 0 +var41 24 25 0 +var41 26 27 0 +var41 28 29 0 +var41 30 31 0 +var41 32 33 0 +var41 34 35 0 +var41 36 37 0 +var41 38 39 0 +var41 40 41 0 +var41 42 43 0 +var41 44 45 0 +var41 46 47 0 +var41 48 49 0 +var41 50 51 3471 +var41 52 53 0 +var41 54 55 0 +var41 56 57 0 +var41 58 59 0 +var41 60 61 0 +var41 62 63 0 +var41 64 65 0 +var41 66 67 0 +var41 68 69 0 +var41 70 71 0 +var41 72 73 0 +var41 74 75 0 +var41 76 77 0 +var41 78 79 0 +var41 80 81 0 +var41 82 83 0 +var41 84 85 0 +var41 86 87 0 +var41 88 89 0 +var41 90 91 0 +var41 92 93 0 +var41 94 95 0 +var41 96 97 0 +var41 98 99 0 + + +var42 0 1 106048 +var42 2 3 9616 +var42 4 5 7346 +var42 6 7 4678 +var42 8 9 7143 +var42 10 11 1914 +var42 12 13 2011 +var42 14 15 1210 +var42 16 17 1781 +var42 18 19 809 +var42 20 21 400 +var42 22 23 402 +var42 24 25 606 +var42 26 27 234 +var42 28 29 268 +var42 30 31 261 +var42 32 33 407 +var42 34 35 145 +var42 36 37 90 +var42 38 39 94 +var42 40 41 106 +var42 42 43 34 +var42 44 45 46 +var42 46 47 35 +var42 48 49 17 +var42 50 51 32 +var42 52 53 16 +var42 54 55 9 +var42 56 57 3 +var42 58 59 5 +var42 60 61 2 +var42 62 63 1 +var42 64 65 0 +var42 66 67 6 +var42 68 69 0 +var42 70 71 0 +var42 72 73 0 +var42 74 75 3 +var42 76 77 0 +var42 78 79 0 +var42 80 81 0 +var42 82 83 1 +var42 84 85 0 +var42 86 87 1 +var42 88 89 1 +var42 90 91 0 +var42 92 93 0 +var42 94 95 0 +var42 96 97 0 +var42 98 99 1 + + +var43 0 1 643737 +var43 2 3 9400 +var43 4 5 3784 +var43 6 7 2610 +var43 8 9 1920 +var43 10 11 1411 +var43 12 13 899 +var43 14 15 676 +var43 16 17 442 +var43 18 19 326 +var43 20 21 297 +var43 22 23 240 +var43 24 25 174 +var43 26 27 127 +var43 28 29 95 +var43 30 31 68 +var43 32 33 47 +var43 34 35 42 +var43 36 37 27 +var43 38 39 13 +var43 40 41 15 +var43 42 43 14 +var43 44 45 12 +var43 46 47 8 +var43 48 49 4 +var43 50 51 5 +var43 52 53 4 +var43 54 55 9 +var43 56 57 1 +var43 58 59 0 +var43 60 61 5 +var43 62 63 2 +var43 64 65 1 +var43 66 67 0 +var43 68 69 1 +var43 70 71 2 +var43 72 73 0 +var43 74 75 0 +var43 76 77 2 +var43 78 79 3 +var43 80 81 5 +var43 82 83 0 +var43 84 85 0 +var43 86 87 1 +var43 88 89 0 +var43 90 91 0 +var43 92 93 1 +var43 94 95 0 +var43 96 97 1 +var43 98 99 1 + + +var44 0 1 4920 +var44 2 3 5242 +var44 4 5 2374 +var44 6 7 1804 +var44 8 9 843 +var44 10 11 1965 +var44 12 13 349 +var44 14 15 1289 +var44 16 17 70 +var44 18 19 0 +var44 20 21 0 +var44 22 23 0 +var44 24 25 0 +var44 26 27 230 +var44 28 29 439 +var44 30 31 0 +var44 32 33 0 +var44 34 35 0 +var44 36 37 0 +var44 38 39 0 +var44 40 41 0 +var44 42 43 0 +var44 44 45 0 +var44 46 47 0 +var44 48 49 0 +var44 50 51 0 +var44 52 53 0 +var44 54 55 0 +var44 56 57 0 +var44 58 59 0 +var44 60 61 0 +var44 62 63 75 +var44 64 65 0 +var44 66 67 0 +var44 68 69 0 +var44 70 71 0 +var44 72 73 0 +var44 74 75 0 +var44 76 77 0 +var44 78 79 0 +var44 80 81 0 +var44 82 83 0 +var44 84 85 0 +var44 86 87 0 +var44 88 89 0 +var44 90 91 0 +var44 92 93 0 +var44 94 95 0 +var44 96 97 0 +var44 98 99 24 + + +var45 0 1 80 +var45 2 3 0 +var45 4 5 0 +var45 6 7 0 +var45 8 9 0 +var45 10 11 0 +var45 12 13 0 +var45 14 15 0 +var45 16 17 0 +var45 18 19 0 +var45 20 21 0 +var45 22 23 0 +var45 24 25 0 +var45 26 27 0 +var45 28 29 0 +var45 30 31 0 +var45 32 33 0 +var45 34 35 0 +var45 36 37 0 +var45 38 39 0 +var45 40 41 0 +var45 42 43 0 +var45 44 45 0 +var45 46 47 0 +var45 48 49 0 +var45 50 51 0 +var45 52 53 0 +var45 54 55 0 +var45 56 57 0 +var45 58 59 0 +var45 60 61 0 +var45 62 63 0 +var45 64 65 0 +var45 66 67 0 +var45 68 69 0 +var45 70 71 0 +var45 72 73 0 +var45 74 75 0 +var45 76 77 0 +var45 78 79 0 +var45 80 81 0 +var45 82 83 0 +var45 84 85 0 +var45 86 87 0 +var45 88 89 0 +var45 90 91 0 +var45 92 93 0 +var45 94 95 0 +var45 96 97 0 +var45 98 99 277600 + + +var46 0 1 0 +var46 2 3 0 +var46 4 5 0 +var46 6 7 0 +var46 8 9 0 +var46 10 11 0 +var46 12 13 0 +var46 14 15 0 +var46 16 17 0 +var46 18 19 0 +var46 20 21 0 +var46 22 23 0 +var46 24 25 0 +var46 26 27 0 +var46 28 29 0 +var46 30 31 0 +var46 32 33 0 +var46 34 35 0 +var46 36 37 0 +var46 38 39 0 +var46 40 41 0 +var46 42 43 0 +var46 44 45 0 +var46 46 47 0 +var46 48 49 0 +var46 50 51 728910 +var46 52 53 0 +var46 54 55 0 +var46 56 57 0 +var46 58 59 0 +var46 60 61 0 +var46 62 63 0 +var46 64 65 0 +var46 66 67 0 +var46 68 69 0 +var46 70 71 0 +var46 72 73 0 +var46 74 75 0 +var46 76 77 0 +var46 78 79 0 +var46 80 81 0 +var46 82 83 0 +var46 84 85 0 +var46 86 87 0 +var46 88 89 0 +var46 90 91 0 +var46 92 93 0 +var46 94 95 0 +var46 96 97 0 +var46 98 99 0 + + +var47 0 1 0 +var47 2 3 0 +var47 4 5 0 +var47 6 7 0 +var47 8 9 0 +var47 10 11 0 +var47 12 13 0 +var47 14 15 0 +var47 16 17 0 +var47 18 19 0 +var47 20 21 0 +var47 22 23 0 +var47 24 25 0 +var47 26 27 0 +var47 28 29 0 +var47 30 31 0 +var47 32 33 0 +var47 34 35 0 +var47 36 37 0 +var47 38 39 0 +var47 40 41 0 +var47 42 43 0 +var47 44 45 0 +var47 46 47 0 +var47 48 49 0 +var47 50 51 777504 +var47 52 53 0 +var47 54 55 0 +var47 56 57 0 +var47 58 59 0 +var47 60 61 0 +var47 62 63 0 +var47 64 65 0 +var47 66 67 0 +var47 68 69 0 +var47 70 71 0 +var47 72 73 0 +var47 74 75 0 +var47 76 77 0 +var47 78 79 0 +var47 80 81 0 +var47 82 83 0 +var47 84 85 0 +var47 86 87 0 +var47 88 89 0 +var47 90 91 0 +var47 92 93 0 +var47 94 95 0 +var47 96 97 0 +var47 98 99 0 + + + +var48 0 1 21 +var48 2 3 0 +var48 4 5 0 +var48 6 7 0 +var48 8 9 0 +var48 10 11 0 +var48 12 13 0 +var48 14 15 0 +var48 16 17 0 +var48 18 19 0 +var48 20 21 0 +var48 22 23 0 +var48 24 25 0 +var48 26 27 0 +var48 28 29 0 +var48 30 31 0 +var48 32 33 0 +var48 34 35 0 +var48 36 37 0 +var48 38 39 0 +var48 40 41 0 +var48 42 43 0 +var48 44 45 0 +var48 46 47 0 +var48 48 49 0 +var48 50 51 0 +var48 52 53 0 +var48 54 55 0 +var48 56 57 0 +var48 58 59 0 +var48 60 61 0 +var48 62 63 0 +var48 64 65 0 +var48 66 67 0 +var48 68 69 0 +var48 70 71 0 +var48 72 73 0 +var48 74 75 0 +var48 76 77 0 +var48 78 79 0 +var48 80 81 0 +var48 82 83 0 +var48 84 85 0 +var48 86 87 0 +var48 88 89 0 +var48 90 91 0 +var48 92 93 0 +var48 94 95 0 +var48 96 97 0 +var48 98 99 395673 + + +var49 0 1 1848 +var49 2 3 0 +var49 4 5 0 +var49 6 7 0 +var49 8 9 0 +var49 10 11 0 +var49 12 13 0 +var49 14 15 0 +var49 16 17 0 +var49 18 19 0 +var49 20 21 0 +var49 22 23 0 +var49 24 25 0 +var49 26 27 0 +var49 28 29 0 +var49 30 31 0 +var49 32 33 0 +var49 34 35 0 +var49 36 37 0 +var49 38 39 0 +var49 40 41 0 +var49 42 43 0 +var49 44 45 0 +var49 46 47 0 +var49 48 49 0 +var49 50 51 0 +var49 52 53 0 +var49 54 55 0 +var49 56 57 0 +var49 58 59 0 +var49 60 61 0 +var49 62 63 0 +var49 64 65 0 +var49 66 67 0 +var49 68 69 0 +var49 70 71 0 +var49 72 73 0 +var49 74 75 0 +var49 76 77 0 +var49 78 79 0 +var49 80 81 0 +var49 82 83 0 +var49 84 85 0 +var49 86 87 0 +var49 88 89 0 +var49 90 91 0 +var49 92 93 0 +var49 94 95 0 +var49 96 97 0 +var49 98 99 945735 \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/data/labels.txt b/cricos/circos-0.69-9/bin/data/labels.txt new file mode 100644 index 0000000000000000000000000000000000000000..870427134be0df446ec4d96f66c15aef22b346bd --- /dev/null +++ b/cricos/circos-0.69-9/bin/data/labels.txt @@ -0,0 +1,6 @@ +var1 0 1 B1-0 +var2 10 12 B2-0 +var2 20 22 B2-1 +var3 9 10 B3-0 +var4 1 2 B4-0 +var4 3 4 B4-1 \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/data/link.txt b/cricos/circos-0.69-9/bin/data/link.txt new file mode 100644 index 0000000000000000000000000000000000000000..439bea8f7688a3684762f24d0acd7c94af5055b2 --- /dev/null +++ b/cricos/circos-0.69-9/bin/data/link.txt @@ -0,0 +1,95 @@ +var44 0 100 var36 0 300 color=vdgrey +var44 0 100 var20 0 100 color=vdgrey +var44 0 100 var45 0 100 color=vdgrey +var44 0 100 var47 0 100 color=vdgrey +var44 0 100 var48 0 100 color=vdgrey +var44 0 100 var49 0 100 color=vdgrey + +var10 0 100 var25 0 100 color=black +var10 0 100 var30 0 1000 color=black + + + +var34 0 100 var2 0 100 color=lpred +var34 0 100 var3 0 100 color=lpred +var34 0 100 var4 0 100 color=lpred +var34 0 100 var5 0 100 color=lpred +var34 0 100 var8 0 100 color=lpred +var34 0 100 var11 0 100 color=lpred +var34 0 100 var13 0 100 color=lpred +var34 0 100 var14 0 100 color=lpred +var34 0 100 var16 0 100 color=lpred +var34 0 100 var17 0 100 color=lpred +var34 0 100 var18 0 100 color=lpred +var34 0 100 var19 0 100 color=lpred +var34 0 100 var21 0 300 color=lpred +var34 0 100 var23 0 100 color=lpred +var34 0 100 var27 0 100 color=lpred +var34 0 100 var32 0 1100 color=lpred +var34 0 100 var33 0 1000 color=lpred +var34 0 100 var1 0 100 color=lpred +var34 0 100 var37 0 200 color=lpred +var34 0 100 var38 0 100 color=lpred +var34 0 100 var40 0 100 color=lpred +var34 0 100 var42 0 100 color=lpred + +var19 0 100 var2 0 100 color=lpblue +var19 0 100 var3 0 100 color=lpblue +var19 0 100 var4 0 100 color=lpblue +var19 0 100 var7 0 100 color=lpblue +var19 0 100 var8 0 100 color=lpblue +var19 0 100 var9 0 100 color=lpblue +var19 0 100 var12 0 100 color=lpblue +var19 0 100 var15 0 100 color=lpblue +var19 0 100 var18 0 100 color=lpblue +var19 0 100 var1 0 100 color=lpblue +var19 0 100 var23 0 100 color=lpblue +var19 0 100 var28 0 100 color=lpblue +var19 0 100 var33 0 1000 color=lpblue +var19 0 100 var34 0 100 color=lpblue +var19 0 100 var35 0 100 color=lpblue +var19 0 100 var38 0 100 color=lpblue +var19 0 100 var39 0 100 color=lpblue + +var43 0 100 var2 0 100 color=lpgreen +var43 0 100 var3 0 100 color=lpgreen +var43 0 100 var4 0 100 color=lpgreen +var43 0 100 var6 0 100 color=lpgreen +var43 0 100 var9 0 100 color=lpgreen +var43 0 100 var13 0 100 color=lpgreen +var43 0 100 var16 0 100 color=lpgreen +var43 0 100 var17 0 100 color=lpgreen +var43 0 100 var18 0 100 color=lpgreen +var43 0 100 var19 0 100 color=lpgreen +var43 0 100 var24 0 100 color=lpgreen +var43 0 100 var27 0 100 color=lpgreen +var43 0 100 var29 0 1400 color=lpgreen +var43 0 100 var31 0 1200 color=lpgreen +var43 0 100 var33 0 1000 color=lpgreen +var43 0 100 var40 0 100 color=lpgreen +var43 0 100 var41 0 100 color=lpgreen +var43 0 100 var42 0 100 color=lpgreen +var43 0 100 var1s 0 100 color=lpgreen + +var11 0 100 var2 0 100 color=vdpurple +var11 0 100 var3 0 100 color=vdpurple +var11 0 100 var4 0 100 color=vdpurple +var11 0 100 var5 0 100 color=vdpurple +var11 0 100 var9 0 100 color=vdpurple +var11 0 100 var1 0 100 color=vdpurple +var11 0 100 var12 0 100 color=vdpurple +var11 0 100 var14 0 100 color=vdpurple +var11 0 100 var17 0 100 color=vdpurple +var11 0 100 var19 0 100 color=vdpurple +var11 0 100 var21 0 300 color=vdpurple +var11 0 100 var22 0 1300 color=vdpurple +var11 0 100 var24 0 100 color=vdpurple +var11 0 100 var26 0 100 color=vdpurple +var11 0 100 var27 0 100 color=vdpurple +var11 0 100 var28 0 100 color=vdpurple +var11 0 100 var31 0 1200 color=vdpurple +var11 0 100 var34 0 100 color=vdpurple +var11 0 100 var39 0 100 color=vdpurple +var11 0 100 var40 0 100 color=vdpurple +var11 0 100 var41 0 100 color=vdpurple +var11 0 100 var46 0 100 color=vdpurple \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/data/link2.txt b/cricos/circos-0.69-9/bin/data/link2.txt new file mode 100644 index 0000000000000000000000000000000000000000..fc7ef960ce836e14800329b142d9577bb64259cf --- /dev/null +++ b/cricos/circos-0.69-9/bin/data/link2.txt @@ -0,0 +1,93 @@ +var44 0 100 var36 0 300 color=vdgrey +var44 0 100 var20 0 100 color=vdgrey +var44 0 100 var45 0 100 color=vdgrey +var44 0 100 var47 0 100 color=vdgrey +var44 0 100 var48 0 100 color=vdgrey +var44 0 100 var49 0 100 color=vdgrey + +var10 0 100 var25 0 100 color=black +var10 0 100 var30 0 1000 color=black + +var34 0 100 var2 0 100 color=lpred +var34 0 100 var3 0 100 color=lpred +var34 0 100 var4 0 100 color=lpred +var34 0 100 var5 0 100 color=lpred +var34 0 100 var8 0 100 color=lpred +var34 0 100 var11 0 100 color=lpred +var34 0 100 var13 0 100 color=lpred +var34 0 100 var14 0 100 color=lpred +var34 0 100 var16 0 100 color=lpred +var34 0 100 var17 0 100 color=lpred +var34 0 100 var18 0 100 color=lpred +var34 0 100 var19 0 100 color=lpred +var34 0 100 var21 0 300 color=lpred +var34 0 100 var23 0 100 color=lpred +var34 0 100 var27 0 100 color=lpred +var34 0 100 var32 0 1100 color=lpred +var34 0 100 var33 0 1000 color=lpred +var34 0 100 var1 0 100 color=lpred +var34 0 100 var37 0 200 color=lpred +var34 0 100 var38 0 100 color=lpred +var34 0 100 var40 0 100 color=lpred +var34 0 100 var42 0 100 color=lpred + +var19 0 100 var2 0 100 color=lpblue +var19 0 100 var3 0 100 color=lpblue +var19 0 100 var4 0 100 color=lpblue +var19 0 100 var7 0 100 color=lpblue +var19 0 100 var8 0 100 color=lpblue +var19 0 100 var9 0 100 color=lpblue +var19 0 100 var12 0 100 color=lpblue +var19 0 100 var15 0 100 color=lpblue +var19 0 100 var18 0 100 color=lpblue +var19 0 100 var1 0 100 color=lpblue +var19 0 100 var23 0 100 color=lpblue +var19 0 100 var28 0 100 color=lpblue +var19 0 100 var33 0 1000 color=lpblue +var19 0 100 var34 0 100 color=lpblue +var19 0 100 var35 0 100 color=lpblue +var19 0 100 var38 0 100 color=lpblue +var19 0 100 var39 0 100 color=lpblue + +var43 0 100 var2 0 100 color=lpgreen +var43 0 100 var3 0 100 color=lpgreen +var43 0 100 var4 0 100 color=lpgreen +var43 0 100 var6 0 100 color=lpgreen +var43 0 100 var9 0 100 color=lpgreen +var43 0 100 var13 0 100 color=lpgreen +var43 0 100 var16 0 100 color=lpgreen +var43 0 100 var17 0 100 color=lpgreen +var43 0 100 var18 0 100 color=lpgreen +var43 0 100 var19 0 100 color=lpgreen +var43 0 100 var24 0 100 color=lpgreen +var43 0 100 var27 0 100 color=lpgreen +var43 0 100 var29 0 1400 color=lpgreen +var43 0 100 var31 0 1200 color=lpgreen +var43 0 100 var33 0 1000 color=lpgreen +var43 0 100 var40 0 100 color=lpgreen +var43 0 100 var41 0 100 color=lpgreen +var43 0 100 var42 0 100 color=lpgreen +var43 0 100 var1s 0 100 color=lpgreen + +var11 0 100 var2 0 100 color=vdpurple +var11 0 100 var3 0 100 color=vdpurple +var11 0 100 var4 0 100 color=vdpurple +var11 0 100 var5 0 100 color=vdpurple +var11 0 100 var9 0 100 color=vdpurple +var11 0 100 var1 0 100 color=vdpurple +var11 0 100 var12 0 100 color=vdpurple +var11 0 100 var14 0 100 color=vdpurple +var11 0 100 var17 0 100 color=vdpurple +var11 0 100 var19 0 100 color=vdpurple +var11 0 100 var21 0 300 color=vdpurple +var11 0 100 var22 0 1300 color=vdpurple +var11 0 100 var24 0 100 color=vdpurple +var11 0 100 var26 0 100 color=vdpurple +var11 0 100 var27 0 100 color=vdpurple +var11 0 100 var28 0 100 color=vdpurple +var11 0 100 var31 0 1200 color=vdpurple +var11 0 100 var34 0 100 color=vdpurple +var11 0 100 var39 0 100 color=vdpurple +var11 0 100 var40 0 100 color=vdpurple +var11 0 100 var41 0 100 color=vdpurple +var11 0 100 var46 0 100 color=vdpurple \ No newline at end of file diff --git a/cricos/circos-0.69-9/bin/gddiag b/cricos/circos-0.69-9/bin/gddiag new file mode 100644 index 0000000000000000000000000000000000000000..dcb9ea68c32c428731693147979c285e5b637863 --- /dev/null +++ b/cricos/circos-0.69-9/bin/gddiag @@ -0,0 +1,634 @@ +#!/bin/env perl + +=pod + +=head1 NAME + +gddiag - short GD diagnostics + +=head1 SYNOPSIS + + # organize color swatches in 10 columns, each column swatch + # 20 pixels in size and color labels size 8 + gddiag -conf etc/gddiag.conf -output_file_root gdtest [-debug] [-help] [-man] + +=head1 DESCRIPTION + +This script helps diagnose any problems with gd and Perl's GD +module. It generates a matrix of colored squares, some rotated lines +(with and without antialiasing) and text for each font defined in the + block. + +=head1 LIMITATIONS + +As of the current release of gd (2.0.35), antialiasing is not +supported for lines with (a) thickness > 1 or (b) color with alpha +channel. Therefore, if you want lines with transparency (e.g. 50% +opaque), or lines whose thickness is greater than 1, you must give up +antialiasing. Antialiasing with thick lines is planned in gd 2.1.0 - +see + +http://bugs.libgd.org/?do=details&task_id=65&histring=antialias + +One way to "add" antialiasing, is to create an image that is 2x the +size of the desired final result and then shrink the image with a tool +like ImageMagick's 'convert'. + +=head1 HISTORY + +=over + +=item * 16 June 2009 v0.14 + +Removed dependence on tutorial configuration file by adding a dedicated configuration file. + +=item * 3 Mar 2009 v0.13 + +Added -alpha. + +=item * 30 Sep 2008 v0.12 + +Added column number and width + +=item * 16 Apr 2008 v0.11 + +Added labels sampling defined fonts + +=item * 25 Feb 2008 v0.10 + +Started and versioned + +=back + +=head1 BUGS + +Please report all bugs, feature requests and general comments to Martin Krzywinski (martink@bcgsc.ca). + +=head1 AUTHOR + +Martin Krzywinski +martink@bcgsc.ca +mkweb.bcgsc.ca + +=head1 CONTACT + + Martin Krzywinski + Genome Sciences Centre + Vancouver BC Canada + www.bcgsc.ca + martink@bcgsc.ca + +=cut + +################################################################ +# +# Copyright 2004-2011 Martin Krzywinski +# +# This file is part of the Genome Sciences Centre Perl code base. +# +# This script is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This script is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this script; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +# +################################################################ + +use strict; +use constant twoPI => 6.283185307; +use constant deg2rad => 0.0174532925; +use constant rad2deg => 57.29577951; +use constant PI => 3.141592654; +use constant PIover2 => 1.570796327; +use Carp; +use Config::General; +use Data::Dumper; +use File::Basename; +use FindBin; +use Getopt::Long; +use IO::File; +use Math::Round; +use Math::VecStat qw(sum min max average); +use POSIX qw(atan ceil); +use Pod::Usage; +use Set::IntSpan 1.11 qw(map_set); +use Storable; +use Time::HiRes qw(gettimeofday tv_interval); +use GD; + +use lib "$FindBin::RealBin"; +use lib "$FindBin::RealBin/../lib"; +use lib "$FindBin::RealBin/lib"; + +use Circos::Configuration qw(%CONF $DIMS); +use Circos::Colors; + +our %OPT; + +GetOptions(\%OPT, + "colsize=i", + "alpha", + "verbose+", + "output_file_root=s", + "configfile=s","help","man","debug+"); + +pod2usage() if $OPT{help}; +pod2usage(-verbose=>2) if $OPT{man}; +loadconfiguration($OPT{configfile}); +populateconfiguration(); # copy command line options to config hash +validateconfiguration(); +if($CONF{debug} > 1) { + $Data::Dumper::Pad = "debug parameters"; + $Data::Dumper::Indent = 1; + $Data::Dumper::Quotekeys = 0; + $Data::Dumper::Terse = 1; + print Dumper(\%CONF); +} + +my $dims; + +# generate rows and columns of color patches + +my $seen_color; +my $layout = get_layout(); + +my ($im,$colors) = make_image($layout); + +my ($x,$y) = ($CONF{marginx},$CONF{marginy}); +for my $row (@$layout) { + for my $data (@$row) { + if($data->{label}) { + $im->string(gdTinyFont,$x,$y,$data->{label},$colors->{black}); + $x += 6 * length($data->{label}); + } elsif ( $data->{type} eq "color") { + if($CONF{alpha}) { + for my $alpha (reverse 0..5) { + my $color = $colors->{ $data->{name} . "_a$alpha" }; + my $f = 1 - 0.8*(5-$alpha)/5; + $im->filledRectangle($x,$y, + $x+$CONF{colsize}*$f,$y+$CONF{colsize}*$f, + $color); + } + } else { + my $color = $colors->{ $data->{name} }; + $im->filledRectangle($x,$y, + $x+$CONF{colsize},$y+$CONF{colsize}, + $color); + } + $im->rectangle($x,$y, + $x+$CONF{colsize},$y+$CONF{colsize}, + $colors->{ vlgrey }); + $x += $CONF{colsize} + $CONF{colmargin}; + } elsif ($data->{type} eq "font") { + $im->stringFT($colors->{black}, + locate_file($CONF{fonts}{ $data->{font}}), + $CONF{fontsize}, + 0, + $x,$y+$CONF{fontsize}, + join("", map {chr(97+$_)} (0..25))); + $y += $CONF{fontsize} * 0.75; + } else { + $x += $CONF{colmargin}; + } + } + $x = $CONF{marginx}; + $y += $CONF{colsize} + $CONF{colmargin}; +} + +my $output_file = sprintf("%s.png",$CONF{output_file_root}); +open(PNG,">$output_file") || confess "cannot open output file $output_file"; +binmode PNG; +print PNG $im->png; +close(PNG); +printinfo("Created color diagnostic image at $output_file"); +printinfo("GD version",$GD::VERSION); + +exit; + +sub get_layout { + my $color_layout = get_color_layout(); + my $font_layout = get_font_layout(); + return [grep($_, @$color_layout,@$font_layout)]; +} + +sub get_font_layout { + my @fonts = sort keys %{$CONF{fonts}}; + my $font_layout; + for my $font (@fonts) { + push @$font_layout, [ {label=>sprintf("font %13s",$font) }, { font=>$font, type=>"font" } ]; + } + return $font_layout; + +} +sub get_color_layout { + my @colors = keys %{$CONF{colors}}; + my @layout; + # brewer palettes + my $brewer_palettes = make_brewer(@colors); + for my $type (sort keys %$brewer_palettes) { + for my $palette (sort keys %{$brewer_palettes->{$type}}) { + push @layout, [{label=>sprintf("%13s","$palette-$type")}]; + for my $ncolors (sort {$a <=> $b} keys %{$brewer_palettes->{$type}{$palette}}) { + push @{$layout[-1]}, {label=>$ncolors}; + for my $idx (sort {$a <=> $b} keys %{$brewer_palettes->{$type}{$palette}{$ncolors}}) { + my $color_data = $brewer_palettes->{$type}{$palette}{$ncolors}{$idx}; + push @{$layout[-1]}, $color_data; + $seen_color->{$color_data->{name}}++; + } + push @{$layout[-1]}, undef; + } + } + } + # chromosomes + my $chr_palettes = make_chr(@colors); + for my $type (sort keys %$chr_palettes) { + push @layout, [{label=>sprintf("%13s",$type)}]; + for my $color (sort {$a->{label} <=> $b->{label} || $a->{label} cmp $b->{label}} @{$chr_palettes->{$type}}) { + push @{$layout[-1]}, {label=>$color->{label} || "''"}; + push @{$layout[-1]}, {name=>$color->{name}, type=>"color",rgb=>$color->{rgb}}; + $seen_color->{$color->{name}}++; + } + } + # other colors + my $other_palettes = make_other_palette(@colors); + for my $type (sort keys %$other_palettes) { + push @layout, [{label=>sprintf("%13s",$type)}]; + for my $color (sort {$a->{idx} <=> $b->{idx}} @{$other_palettes->{$type}}) { + push @{$layout[-1]}, {label=>$color->{label} || "''"}; + push @{$layout[-1]}, {name=>$color->{name}, type=>"color",rgb=>$color->{rgb}}; + } + } + return \@layout; +} + +sub make_other_palette { + my $other_palettes; + for my $color (@_) { + if($color =~ /^(v*(l|d))(.+)$/) { + my ($prefix,$name) = ($1,$3); + next if $seen_color->{$color}; + next if $color =~ /-(qual|seq|div)/; + my $idx = 0; + if($color =~ /^(v*)(d|l)/) { + if($2 eq "d") { + $idx += length($1) + 10; + } else { + $idx -= length($1); + } + } + push @{$other_palettes->{$name}}, {rgb=>[split(",",$CONF{colors}{$color})], + idx=>$idx, + label=>$prefix, + name=>$color}; + } + } + return $other_palettes; +} +sub make_chr { + my $chr_palettes; + my @type = qw(chr gpos gneg gvar acen stalk); + for my $type (@type) { + for my $color (@_) { + if($color =~ /$type/) { + if($color =~ /^(.*$type)(.*)/) { + my ($palette,$label) = ($1,$2); + next unless $CONF{colors}{$color} =~ /,/; + push @{$chr_palettes->{$palette}}, {rgb=>[split(",",$CONF{colors}{$color})], + name=>$color, + label=>$label}; + } + } + } + } + return $chr_palettes; +} + +sub make_brewer { + my @types = qw(seq div qual); + my $typerx = join("|",@types); + my @colors = sort grep($_ =~ /-($typerx)-/, @_); + my $brewer_palettes; + for my $type (@types) { + my @colors_type = grep($_ =~ /-$type-/, @colors); + for my $color (@colors_type) { + if($color =~ /^(.+)-(\d+)-$type-(\d+)/) { + my ($palette,$ncolors,$idx) = ($1,$2,$3); + my @rgb = split(",",$CONF{colors}{$color}); + $brewer_palettes->{$type}{$palette}{$ncolors}{$idx} = {name=>$color,rgb=>\@rgb,type=>"color"}; + } + } + } + return $brewer_palettes; +} + +sub make_image { + my $layout = shift; + my $nrows = @$layout; + my $ncols = max( map {int(@$_)} @$layout); + my ($height,$width) = (2*$CONF{marginy},2*$CONF{marginx}); + my @widths; + for my $row (@$layout) { + $height += $CONF{colsize} + $CONF{colmargin}; + push @widths, 0; + for my $col (@$row) { + if($col->{label}) { + $widths[-1] += 6 * length($col->{label}); + } elsif ($col->{type} eq "color") { + $widths[-1] += $CONF{colsize} + $CONF{colmargin}; + } elsif ($col->{type} eq "font") { + $height += $CONF{fontsize}; + } else { + $widths[-1] += $CONF{colmargin}; + } + } + } + $width += max(@widths); + my $im = GD::Image->new($width,$height,1); + #printinfo("created image",$width,$height); + if(! $im) { + die "There was a problem creating a 24-bit image. This is a fatal error and you will not be able to use transparency in Circos. The error is likely due to a problem with Perl's GD module. Your installed version is ($GD::VERSION). See http://search.cpan.org/dist/GD/GD.pm for the latest version and upgrade, or fix your installation."; + } + $im->alphaBlending(1); + my $colors = Circos::Colors::allocate_colors($im); + printinfo("allocated",int(keys %$colors),"colors"); + $im->fill(0,0,$colors->{white}); + return ($im,$colors); +} + +exit; + +# how many colors are defined? +my $ncolors = keys %{$CONF{colors}}; +# how many fonts are defined? +my $nfonts = keys %{$CONF{fonts}}; +# how many rows of color swatches? +my $nrow = ceil($ncolors / $CONF{ncol}); +# how wide is the image? +my $width = $CONF{ncol} * 2*$CONF{colsize} + $CONF{colsize} + 2*$CONF{marginx}; +# how tall is the image? +my $height = (1+$nrow) * 2*$CONF{colsize} + $nfonts * 2.5*$CONF{labelsize} + 2*$CONF{marginy}; + +printinfo("allocating image",$width,$height); + +# try to create an 8bit image +my $im8 = GD::Image->new($width,$height); +# try to create a 24bit image +my $im = GD::Image->new($width,$height,1); +if(! $im) { + die "There was a problem creating a 24-bit image. This is a fatal error and you will not be able to use transparency in Circos. The error is likely due to a problem with Perl's GD module. Your installed version is ($GD::VERSION). See http://search.cpan.org/dist/GD/GD.pm for the latest version and upgrade, or fix your installation."; +} +$im->alphaBlending(1); +my $colors = Circos::Colors::allocate_colors($im); +printinfo("allocated",int(keys %$colors),"colors"); +$im->fill(0,0,$colors->{white}); + +my $swatch_idx = 0; +my $swatch_stroke = 1; + +map { delete $colors->{$_} if ref $colors->{$_} } keys %$colors; + +for my $color_strings (sort { (($b->[1] eq "chr") - ($a->[1] eq "chr")) || $a->[1] cmp $b->[1] || $a->[2] <=> $b->[2] } map { [$_,($_ =~ /v*[ld]*(.+?)\d*$/g),($_ =~ /(\d+)$/g)] } + grep($_ !~ /_a\d+/, keys %$colors)) { + my ($color,$color_stem,$color_dig) = @$color_strings; + next if $color =~ /(seq|div|qual)/ && $color =~ /-[a-z]$/; + #my $brushc = $colors->{"d$color_stem"} ? "d$color_stem" : "black"; + #my ($brush,$brushcolor) = init_brush($swatch_stroke,$swatch_stroke,$brushc); + my ($x,$y) = ( $CONF{marginx}+($swatch_idx % $CONF{ncol})*2*$CONF{colsize}, + $CONF{marginy}+int($swatch_idx/$CONF{ncol})*2*$CONF{colsize} ); + + for my $i (0..10) { + $im->filledRectangle($x+3*$i,$y-$CONF{colsize}/4, + $x+3*$i+2,$y-$CONF{colsize}/5, + $colors->{$color . "_a$i"}); + } + + $im->filledRectangle($x,$y, + $x+$CONF{colsize},$y+$CONF{colsize}, + $colors->{$color}); + #$im->setBrush($brush); + $im->rectangle($x,$y, + $x+$CONF{colsize},$y+$CONF{colsize}, + $colors->{black}); + my $text_size = $CONF{labelsize} || 0.4*$CONF{colsize}; + my $text = $color; + $text =~ s/-(seq|div|qual|)-/-/; + $im->stringFT($colors->{black}, + locate_file($CONF{fonts}{mono} || $CONF{fonts}{default}), + $text_size, + 0, + $x,$y + $CONF{colsize} + $text_size + 2, + $text); + $swatch_idx++; +} + +my ($x,$y) = ($CONF{marginx},$CONF{marginy}+(1+$nrow)*2*$CONF{colsize}); +for my $font (keys %{$CONF{fonts}}) { + printinfo("drawing font",$font,"from file",locate_file($CONF{fonts}{$font})); + $im->stringFT($colors->{black}, + locate_file($CONF{fonts}{$font}), + 2*$CONF{labelsize}, + 0, + $x,$y, + $font); + $y += 2.5*$CONF{labelsize}; +} + +# draw some lines + +($x,$y) = (2*$CONF{marginx},$CONF{marginy}+($nrow)*2*$CONF{colsize}); +my $len = 10; +my $step = $len*sqrt(2); +for my $i (0..36) { + $im->filledArc($x,$y,$len,$len,0,360,$colors->{red}); + $im->filledArc($x,$y+$step,$len,$len,0,360,$colors->{red}); + $im->filledArc($x,$y+2*$step,$len,$len,0,360,$colors->{red}); + $x+= $step; +} + +($x,$y) = (2*$CONF{marginx},$CONF{marginy}+($nrow)*2*$CONF{colsize}); +for my $i (0..36) { + my $angle = $i*10; + $im->setAntiAliased($colors->{black}); + $im->line($x - $len*cos($angle*deg2rad), + $y - $len*sin($angle*deg2rad), + $x + $len*cos($angle*deg2rad), + $y + $len*sin($angle*deg2rad), + gdAntiAliased); + $im->line($x - $len*cos($angle*deg2rad), + $y + $step - $len*sin($angle*deg2rad), + $x + $len*cos($angle*deg2rad), + $y + $step + $len*sin($angle*deg2rad), + $colors->{black}); + + my $alpha = $i % 11; + my $thickness = 1 + ($i % 4); + my $color = "black_a".$alpha; + + $im->setThickness($thickness); + $im->line($x - $len*cos($angle*deg2rad), + $y + 2*$step - $len*sin($angle*deg2rad), + $x + $len*cos($angle*deg2rad), + $y + 2*$step + $len*sin($angle*deg2rad), + $colors->{$color}); + $im->setThickness(1); + $x += $step; +} + +my $outputfile = $CONF{output_file}; +open(PNG,">$outputfile") || confess "cannot open output file $outputfile"; +binmode PNG; +print PNG $im->png; +close(PNG); +printinfo("created gd diagnostic image at $outputfile"); +printinfo("used GD version",$GD::VERSION); + +sub init_brush { + my ($w,$h,$brush_color) = @_; + $h ||= $w; + my $brush = new GD::Image($w,$h); + my $color = Circos::Colors::allocate_colors($brush); + if($brush_color && $color->{$brush_color}) { + $brush->fill(0,0,$color->{$brush_color}); + } + return ($brush,$color); +} + +sub locate_file { + my $file = shift; + $file =~ s/,.*//; + if(-e $file && -r _) { + return $file; + } elsif (-e $file && ! -r _) { + confess "file $file exists, but cannot be read"; + } else { + # look for the file elsewhere + for my $dir ( + "$FindBin::RealBin/", + "$FindBin::RealBin/etc", + "$FindBin::RealBin/../etc", + "$FindBin::RealBin/../", + "$FindBin::RealBin/../etc", + "$FindBin::RealBin/../../etc", + ) { + printwarning("trying $dir/$file"); + if(-e "$dir/$file" && -r "$dir/$file") { + printwarning("$file found in $dir/$file"); + return "$dir/$file"; + } + } + } + confess "could not locate $file"; +} + +################################################################ +# +# *** DO NOT EDIT BELOW THIS LINE *** +# +################################################################ +################################################################ +################################################################ +################################################################ + +sub validateconfiguration { + for my $parsekey (keys %CONF) { + if($parsekey =~ /^(__(.+)__)$/) { + if(! defined $CONF{$1}) { + confess "ERROR - problem in configuration file - you want to use variable $1 ($2) in another parameter, but this variable is not defined"; + } + my ($token,$parsevalue) = ($1,$CONF{$1}); + for my $key (keys %CONF) { + $CONF{$key} =~ s/$token/$parsevalue/g; + } + } + } + confess "error - no configuration file specified - please use -conf FILE" unless $CONF{configfile}; + + if($CONF{alpha}) { + die "value passed to -alpha must be 0-126" unless $CONF{alpha} >=0 && $CONF{alpha} <= 127; + } + $CONF{image}{pngmake} = 1; + +} + +sub populateconfiguration { + foreach my $key (keys %OPT) { + $CONF{$key} = $OPT{$key}; + } + + # any configuration fields of the form __XXX__ are parsed and replaced with eval(XXX). + # The configuration can therefore depend on itself. + # + # flag = 10 + # note = __2*$CONF{flag}__ # would become 2*10 = 20 + + repopulateconfiguration(\%CONF); + + # populate some defaults + +} + +sub repopulateconfiguration { + my $root = shift; + for my $key (keys %$root) { + my $value = $root->{$key}; + if(ref($value) eq "HASH") { + repopulateconfiguration($value); + } else { + while($value =~ /__([^_].+?)__/g) { + my $source = "__" . $1 . "__"; + my $target = eval $1; + $value =~ s/\Q$source\E/$target/g; + } + $root->{$key} = $value; + } + } +} + +sub loadconfiguration { + my $file = shift; + my ($scriptname) = fileparse($0); + if(-e $file && -r _) { + # great the file exists + } elsif (-e "/home/$ENV{LOGNAME}/.$scriptname.conf" && -r _) { + $file = "/home/$ENV{LOGNAME}/.$scriptname.conf"; + } elsif (-e "$FindBin::RealBin/$scriptname.conf" && -r _) { + $file = "$FindBin::RealBin/$scriptname.conf"; + } elsif (-e "$FindBin::RealBin/etc/$scriptname.conf" && -r _) { + $file = "$FindBin::RealBin/etc/$scriptname.conf"; + } elsif (-e "$FindBin::RealBin/../etc/$scriptname.conf" && -r _) { + $file = "$FindBin::RealBin/../etc/$scriptname.conf"; + } else { + confess "error - could not find the configuration file [$file]"; + } + $OPT{configfile} = $file; + my $conf = new Config::General(-ConfigFile=>$file, + -AllowMultiOptions=>1, + -LowerCaseNames=>1, + -ConfigPath=>["$FindBin::RealBin/etc","$FindBin::RealBin/../etc","$FindBin::RealBin/..",$FindBin::RealBin,dirname($file),"$FindBin::RealBin/../".dirname($file)], + -AutoTrue=>1); + %CONF = $conf->getall; +} + +sub printdebug { + printinfo("debug",@_) if $CONF{debug}; +} + +sub printwarning { + printinfo("warning",@_) if $CONF{warnings}; +} + +sub printinfo { + print join(" ",@_),"\n"; +} + +sub printdumper { + printinfo(Dumper(@_)); +} diff --git a/cricos/circos-0.69-9/bin/gddiag.png b/cricos/circos-0.69-9/bin/gddiag.png new file mode 100644 index 0000000000000000000000000000000000000000..ddf0d91f5c8e8cc53be3d8223d576f861d934afc --- /dev/null +++ b/cricos/circos-0.69-9/bin/gddiag.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:15e4c7b6a5343087ca23aeae92b2611453b0db5c6dc1ccf61b561c7b999cf817 +size 204587 diff --git a/cricos/circos-0.69-9/bin/list.modules b/cricos/circos-0.69-9/bin/list.modules new file mode 100644 index 0000000000000000000000000000000000000000..37a2f48e8590e59ec91d67ebc0aba1c9dacd9671 --- /dev/null +++ b/cricos/circos-0.69-9/bin/list.modules @@ -0,0 +1,5 @@ +#!/bin/bash + +# Contributed by Charles Howes +# http://groups.google.com/group/circos-data-visualization/browse_thread/thread/96e74d863a53e405?hl=en_US +awk '!/^[\t ]*use /{next};$2~/^(lib|Circos.*|base|strict|vars|warnings);?$/{next};{sub(";","",$2);print $2}' circos ../lib/Circos/*pm ../lib/Circos.pm ../lib/Circos/*/*pm | sort -u diff --git a/cricos/circos-0.69-9/bin/test.modules b/cricos/circos-0.69-9/bin/test.modules new file mode 100644 index 0000000000000000000000000000000000000000..f1bad96cd7cc2b076d2b3241d2ec39bed5bcdc07 --- /dev/null +++ b/cricos/circos-0.69-9/bin/test.modules @@ -0,0 +1,5 @@ +#!/bin/bash + +echo "Circos can now list its own modules." +echo +echo "> circos -modules" diff --git a/cricos/circos_readme.txt b/cricos/circos_readme.txt new file mode 100644 index 0000000000000000000000000000000000000000..2970ec160bac4afc91eab60f89449e226d4aa28f --- /dev/null +++ b/cricos/circos_readme.txt @@ -0,0 +1,23 @@ +# 1. Verify Strawberry Perl installation +perl --version + +# 2. Check Circos module dependencies +perl circos -modules + +# 3. Auto-install missing modules +perl -e "$output = `perl circos -modules`; while($output =~ /missing\s+(\S+)/g) { system('cpan', $1); }" + +# [Alternative: Manual module installation] +# perl -MCPAN -e shell +# install Module::Name +# exit + +# 4. Diagnose GD library +perl gddiag + +# 5. Run Circos +circos -conf circos.cnf + +# [If paranoid error occurs] +# Use this only when you get a paranoid-specific error +circos -noparanoid -conf circos.cnf \ No newline at end of file diff --git a/result/1_standard_ML/1_LogS_Frequency.png b/result/1_standard_ML/1_LogS_Frequency.png new file mode 100644 index 0000000000000000000000000000000000000000..1c0707225d344792d5a3f9a073d2446a3df37a5a --- /dev/null +++ b/result/1_standard_ML/1_LogS_Frequency.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a7f581665a7ad9313c5505d60bfb4db36a027656c75f59f02a5b7f4b78ea5133 +size 66046 diff --git a/result/1_standard_ML/1_LogS_Frequency_with_all.png b/result/1_standard_ML/1_LogS_Frequency_with_all.png new file mode 100644 index 0000000000000000000000000000000000000000..d95e1a440f842c9a3c5c279757c57f350520427f --- /dev/null +++ b/result/1_standard_ML/1_LogS_Frequency_with_all.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:de7adbf582507e3e553394d6ed251de649d7008fe0a7cce2dbed731a3579e067 +size 72641 diff --git a/result/1_standard_ML/1_LogS_Frequency_with_aq.png b/result/1_standard_ML/1_LogS_Frequency_with_aq.png new file mode 100644 index 0000000000000000000000000000000000000000..aa3dc2ae1bdcffebef6228a917b092753bae8d7f --- /dev/null +++ b/result/1_standard_ML/1_LogS_Frequency_with_aq.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:741333a0d0cfad674473c4654c3c67d81886a9ea2f79c1421223280a088e195e +size 67873 diff --git a/result/1_standard_ML/1_standard_model_compare.png b/result/1_standard_ML/1_standard_model_compare.png new file mode 100644 index 0000000000000000000000000000000000000000..939d3173d4951dc744617e6c0795307a51b0d7e5 --- /dev/null +++ b/result/1_standard_ML/1_standard_model_compare.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:10c2f6ce7b2cac6b6a467ef4782c043527a7d3319930e5b521ec9c82e8adb0af +size 1017804 diff --git a/result/1_standard_ML/1_standard_model_compare_AqSol.png b/result/1_standard_ML/1_standard_model_compare_AqSol.png new file mode 100644 index 0000000000000000000000000000000000000000..67062a6655227b45d7f11e2afc674a2000c26a59 --- /dev/null +++ b/result/1_standard_ML/1_standard_model_compare_AqSol.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c1009f1c184fba825492f90a54eda46e2ce4a24a7571c4757f13788037a86ba2 +size 1469015 diff --git a/result/1_standard_ML/1_standard_model_compare_bigdata.png b/result/1_standard_ML/1_standard_model_compare_bigdata.png new file mode 100644 index 0000000000000000000000000000000000000000..4362b5aa420928b2ece8dff461448ea483680f25 --- /dev/null +++ b/result/1_standard_ML/1_standard_model_compare_bigdata.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:835ea6e3bcb232bfb49ab5cd65cd24545771dae6e0af4dc56e219bcc9fcfc7d0 +size 1805329 diff --git a/result/1_standard_ML/LogS_Frequency_plotly.html b/result/1_standard_ML/LogS_Frequency_plotly.html new file mode 100644 index 0000000000000000000000000000000000000000..58c05e46a94e902628a52f08e043f635d1aadb5c --- /dev/null +++ b/result/1_standard_ML/LogS_Frequency_plotly.html @@ -0,0 +1,14 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result/1_standard_ML/LogS_Frequency_seaborn.png b/result/1_standard_ML/LogS_Frequency_seaborn.png new file mode 100644 index 0000000000000000000000000000000000000000..64f360c1bdc21bccc4472f490c4d6ee6478a0b33 --- /dev/null +++ b/result/1_standard_ML/LogS_Frequency_seaborn.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:029fd0bc92d03c7315ad070cf7e0d9b573fe029a95fef7561dbaeaeacecb4aff +size 136999 diff --git a/result/1_standard_ML/failed/AqSolDB/failed_smiles.csv b/result/1_standard_ML/failed/AqSolDB/failed_smiles.csv new file mode 100644 index 0000000000000000000000000000000000000000..c235f0f10a275a28482f5d1e3934934d0238e67b --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/failed_smiles.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fbb676c7f42df05a6c87fa43cbc3ad1db0c8b90161f2204d5a3ba2dc837beae2 +size 4259 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_110.png b/result/1_standard_ML/failed/AqSolDB/mol_110.png new file mode 100644 index 0000000000000000000000000000000000000000..659e1b659a1fbb450df57aa77b9c919a67f2a8cf --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_110.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:48ccd0cb82f230b4ea9d2b50625bef8574543f49bb0caf3528b399e628eb4402 +size 9874 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1192.png b/result/1_standard_ML/failed/AqSolDB/mol_1192.png new file mode 100644 index 0000000000000000000000000000000000000000..94e0d1929152b95573d8cc4367666f72749eb97b --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1192.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8a61bf4c3503fc1842a6fea132cb0a2d236ff537689d004b056b2d68275bd4b1 +size 15435 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1232.png b/result/1_standard_ML/failed/AqSolDB/mol_1232.png new file mode 100644 index 0000000000000000000000000000000000000000..d3ba791e3262abe0ed041b2c32658949d2407e15 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1232.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0751dc9aa1cf453eb43cca28158bd74fcc462a0c9867baef8326dcc728127167 +size 7431 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_131.png b/result/1_standard_ML/failed/AqSolDB/mol_131.png new file mode 100644 index 0000000000000000000000000000000000000000..b60ea4c7b30e5f6d6c33f4b68810321ff0eff828 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_131.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1ffbf9516ea2988cf797d2c78407c5804e07ac2665bb9c2f96363dcdd20496e5 +size 9885 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1328.png b/result/1_standard_ML/failed/AqSolDB/mol_1328.png new file mode 100644 index 0000000000000000000000000000000000000000..42ab91d98ba20ae957b50d760ee1929c82e92a00 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1328.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ff575797b96a7e87e55481daddf592d3299c22d3e3defc36006d37e5c18b1bd0 +size 10766 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1371.png b/result/1_standard_ML/failed/AqSolDB/mol_1371.png new file mode 100644 index 0000000000000000000000000000000000000000..1a0683ab96d731a28ace6986fc06d226dd3994da --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1371.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:101438bea32f629351b03d4a8c72dd3ac38ca4609c5a9c251d9e44051311f388 +size 9230 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1375.png b/result/1_standard_ML/failed/AqSolDB/mol_1375.png new file mode 100644 index 0000000000000000000000000000000000000000..badcabb167c6d5d9a0c04f6692e3cd11f7fe454d --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1375.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b70e34563f1400eea147529ebbb2f9b96a6dd575be890110093803f60ce1cf51 +size 12554 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1376.png b/result/1_standard_ML/failed/AqSolDB/mol_1376.png new file mode 100644 index 0000000000000000000000000000000000000000..35e47544493bb247e39b969e8cca8c1451e8eaff --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1376.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3eccaf5e549480311a8d82cd69d04120c4b5ba518ea17b7c5d3e544f250223e3 +size 13615 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1462.png b/result/1_standard_ML/failed/AqSolDB/mol_1462.png new file mode 100644 index 0000000000000000000000000000000000000000..e3bca9b32d3dc4971e764772ff7979bc42dce3e2 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1462.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:68d1787b3ea1cb2691f7c5e5ea95e5d6f43cb912e91c0ff56f10d925e56f71cf +size 18856 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1469.png b/result/1_standard_ML/failed/AqSolDB/mol_1469.png new file mode 100644 index 0000000000000000000000000000000000000000..2bac1a85deca445ad0f1a469b75d30cc59d1d297 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1469.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:32358c7c3d287a60eac45c7ca65e0ba1f9d01505cf99b1f15b10f5d81e832b25 +size 11499 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1536.png b/result/1_standard_ML/failed/AqSolDB/mol_1536.png new file mode 100644 index 0000000000000000000000000000000000000000..24d12f70cfe21753769955dccbf6828dd915cff6 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1536.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0c3319d728b15dc2ea7518e1aa5b981272c8eb715bb281ae3aef8693e461981c +size 12810 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1575.png b/result/1_standard_ML/failed/AqSolDB/mol_1575.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1575.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1578.png b/result/1_standard_ML/failed/AqSolDB/mol_1578.png new file mode 100644 index 0000000000000000000000000000000000000000..e564d12d1ebefd517b3441cfa43dcefed36e7b8a --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1578.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:caccc2e2b0e6efabe0d6ce56142fa44b46dcdd45f79e5c8f8e28c2a7bb162a83 +size 7552 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1590.png b/result/1_standard_ML/failed/AqSolDB/mol_1590.png new file mode 100644 index 0000000000000000000000000000000000000000..9a71e5eee3cefdd070bc42a100565f22bfe9dc7b --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1590.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0a42c00a325eaa5e114cf1f845b5d6c1f8e7dc37c45f4f875f2c71c477c9f193 +size 7435 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1598.png b/result/1_standard_ML/failed/AqSolDB/mol_1598.png new file mode 100644 index 0000000000000000000000000000000000000000..2e30ceab2d00abefdf0e04d72a460e46326df99d --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1598.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:191e8e64465ab371eee2c0a4f36efaea0867893c0a8e3c9fe7961cea2bddc6c4 +size 7756 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1600.png b/result/1_standard_ML/failed/AqSolDB/mol_1600.png new file mode 100644 index 0000000000000000000000000000000000000000..5d7f3b683f1c8db6ced76f4281b2436eece661c4 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1600.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3e531aacc30a949cb7534c5bd9f4e05bcb6334bcad5667856188aab5fc1f6c55 +size 7391 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1602.png b/result/1_standard_ML/failed/AqSolDB/mol_1602.png new file mode 100644 index 0000000000000000000000000000000000000000..aaa6c9f278fd43050f81169b4fafff0791e82469 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1602.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6575d85eea396c62d88c3f7e7039f9053998b60911948eb11c85249aeee7f036 +size 7978 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1604.png b/result/1_standard_ML/failed/AqSolDB/mol_1604.png new file mode 100644 index 0000000000000000000000000000000000000000..2d58ee09a92fe04e643eda2fe0d6c5d7604c6081 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1604.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bde315cd8917f36343ae366a5d2033186a4113a084b4f744ee5404682d6c6ffc +size 7159 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1612.png b/result/1_standard_ML/failed/AqSolDB/mol_1612.png new file mode 100644 index 0000000000000000000000000000000000000000..d72f78ace5e61ab17054c0368c73dd7ce1e3fa69 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1612.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:22e69ca22aec6e4272cf7cfa08de177a987df3d595c3fd8fa0cb12b7b39d50d2 +size 7845 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1616.png b/result/1_standard_ML/failed/AqSolDB/mol_1616.png new file mode 100644 index 0000000000000000000000000000000000000000..62d159e21ab9b7c70b4e58d69af369558ec55b06 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1616.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d4c9c9fafe3137ef57a7b3e67fc914c538faea7cd345ba8521a388c974d1c9cb +size 9805 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1617.png b/result/1_standard_ML/failed/AqSolDB/mol_1617.png new file mode 100644 index 0000000000000000000000000000000000000000..13c7ebac7bba49b9ab1297909abbb24415731545 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1617.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:55ed21637e1b71b618d344299da681942f11b8ebce2c46e3eadfd39f2fed4d52 +size 8313 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1618.png b/result/1_standard_ML/failed/AqSolDB/mol_1618.png new file mode 100644 index 0000000000000000000000000000000000000000..d807b0eaa13b8910d2a41c7869c330efc4af754b --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1618.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:92bda9830bdaac9810ae257be6505d29efa7a7f9895ba39a1cbbf02dd66240bf +size 9031 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_1695.png b/result/1_standard_ML/failed/AqSolDB/mol_1695.png new file mode 100644 index 0000000000000000000000000000000000000000..f28b82295c209e9affbfd82e8bf956312a9d857d --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_1695.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b17621076fdf69bd9115a4ab648e8c2c5d10b87a545acc7081640b2ab1ad980e +size 1606 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_262.png b/result/1_standard_ML/failed/AqSolDB/mol_262.png new file mode 100644 index 0000000000000000000000000000000000000000..f5b291c489ff29cca79a9ae901b62dbf891aefa4 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_262.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:978ade34ea89a89e6cbce6eb622ea430583ac3183fa6579d0cd95d84bb9af39b +size 5597 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_2850.png b/result/1_standard_ML/failed/AqSolDB/mol_2850.png new file mode 100644 index 0000000000000000000000000000000000000000..4de75af9ab6f111841ebee34db96fdeb15acf455 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_2850.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6f9a4d05030d92bbe725728b15071934fbed4d0a0d41cdf5db20f3d5d10b6409 +size 10684 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_2998.png b/result/1_standard_ML/failed/AqSolDB/mol_2998.png new file mode 100644 index 0000000000000000000000000000000000000000..ba084da9c990f1ef41f7db6db27a6ac337429176 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_2998.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:241c26a99f19f1f381e7bc51f3f02582d27256f2c90d4d6ba5d1446bca9a1565 +size 15906 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_3035.png b/result/1_standard_ML/failed/AqSolDB/mol_3035.png new file mode 100644 index 0000000000000000000000000000000000000000..8a7eb67dc3d5d05990fbefd2c255f3abbbb3f5b5 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_3035.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1b77c2b635051f2b24e2444a4051b86e06a9a96dbe8f06fa5b2fd486db055fbc +size 7247 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_3040.png b/result/1_standard_ML/failed/AqSolDB/mol_3040.png new file mode 100644 index 0000000000000000000000000000000000000000..07f2ce51ee2d5a723f5a3e2596bd34e7de796ba9 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_3040.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:20bf55286d5c0183d2e9cc1e73967abbca495d101df66a7e604f53b2b21d9f8c +size 16207 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_3069.png b/result/1_standard_ML/failed/AqSolDB/mol_3069.png new file mode 100644 index 0000000000000000000000000000000000000000..620925da5ca67629952aa4507162bb47b430dd28 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_3069.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d91e4c004c631a99430784bd174ab2af2f7febc716b4529e7e717aed5af7a5c3 +size 8947 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_3467.png b/result/1_standard_ML/failed/AqSolDB/mol_3467.png new file mode 100644 index 0000000000000000000000000000000000000000..1ea33e6ab8201c0f6ac5096e126a32aec39b877f --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_3467.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c7d4a2fe6b021f9832ca3b022e9b4fbdaa5686a9573cf7b6c7458f8c55635f0b +size 7656 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_3542.png b/result/1_standard_ML/failed/AqSolDB/mol_3542.png new file mode 100644 index 0000000000000000000000000000000000000000..86a89ccb34ef9c8ec2c5d1730cd818a6d85dcff8 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_3542.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0eb50f1440099b6748c6338fc82f5d2f552a76c4f4fe2ec5a4093a99e96cc7c0 +size 5758 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_3556.png b/result/1_standard_ML/failed/AqSolDB/mol_3556.png new file mode 100644 index 0000000000000000000000000000000000000000..c3942e8bab11c565110b29f5a0bbf50a866e4771 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_3556.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:48abbc0b94274158afdc088f7bee99961f80c5f4728d2d6d4ac706249bdad096 +size 7503 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_3578.png b/result/1_standard_ML/failed/AqSolDB/mol_3578.png new file mode 100644 index 0000000000000000000000000000000000000000..13ab35ff243a0872b669942d1d9cdc6695aa2994 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_3578.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a7dc4b13d7c27213ed5cb7a965d6106a4fe10b5d9ef8058169fc34b3b92e6624 +size 5913 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_3620.png b/result/1_standard_ML/failed/AqSolDB/mol_3620.png new file mode 100644 index 0000000000000000000000000000000000000000..54d655d873a8fbb88d205da93886baa8cb174e1f --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_3620.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c6296afaae14fadf647d36aee68c04f3c3294d250b3d82eb8b0c4864173b9d74 +size 7177 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_3630.png b/result/1_standard_ML/failed/AqSolDB/mol_3630.png new file mode 100644 index 0000000000000000000000000000000000000000..cfff1e04200e2a3761f53031fd4011a3a490cfc6 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_3630.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3775abdbb6e52e38910948995e6b82975274eba46a174a635b530e46946be9aa +size 7177 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_3649.png b/result/1_standard_ML/failed/AqSolDB/mol_3649.png new file mode 100644 index 0000000000000000000000000000000000000000..4a47c5b6f6b9a041948b32a601ac172f6dd2fcdc --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_3649.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:cbefc418977a89719a3c2280b092f39e7614b75a2eff9c623654450e7df358f0 +size 12861 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_4279.png b/result/1_standard_ML/failed/AqSolDB/mol_4279.png new file mode 100644 index 0000000000000000000000000000000000000000..d9a1ac5b62dd320edffcf5a1bd0aa5fc07d162f5 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_4279.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2821a4373480cbe674aa1d8385536262a286b3dbbf52bd6c3c68853951710346 +size 11261 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_4308.png b/result/1_standard_ML/failed/AqSolDB/mol_4308.png new file mode 100644 index 0000000000000000000000000000000000000000..81e8db897cc341fb6e5330fdbc639c67a5462a84 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_4308.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:06a4458c28a5de3ea27e0c1896d5df4dde9d036b593ef17884cf0b42398e334e +size 11198 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_5577.png b/result/1_standard_ML/failed/AqSolDB/mol_5577.png new file mode 100644 index 0000000000000000000000000000000000000000..20f2f86df0596772422af974698c6ae8df15eb2e --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_5577.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4bf1427c538c43f758138b657bd961ccaedd2708e0abad1f8b28df3a78011be1 +size 4085 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_64.png b/result/1_standard_ML/failed/AqSolDB/mol_64.png new file mode 100644 index 0000000000000000000000000000000000000000..982fbf403a9686d4fc6364761a255fbaf2b02356 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_64.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4cb7160de6a4d3bfb921eb8e7c1702392d61987ca8b584c8abfc83cf37199e0c +size 7510 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_8270.png b/result/1_standard_ML/failed/AqSolDB/mol_8270.png new file mode 100644 index 0000000000000000000000000000000000000000..94a6229f9371d6bb6ca9286238922f9f39925e40 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_8270.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2c80f9aad55c4a203c137f8dedb2aa79e0257d2f96aa1ae6a319181195550895 +size 9915 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_8612.png b/result/1_standard_ML/failed/AqSolDB/mol_8612.png new file mode 100644 index 0000000000000000000000000000000000000000..bc94c71c78b9ba7859cc5eace46dd2b1485aa353 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_8612.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:95205e6bf11350fd42ed25c33a242531e24f4ea379e2c37ce5af7b16bf5535d3 +size 9975 diff --git a/result/1_standard_ML/failed/AqSolDB/mol_91.png b/result/1_standard_ML/failed/AqSolDB/mol_91.png new file mode 100644 index 0000000000000000000000000000000000000000..d6fc4754dd0f8796b3297ff02b1718aad8726c17 --- /dev/null +++ b/result/1_standard_ML/failed/AqSolDB/mol_91.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:5496eea88a07245bc2b89f2e734305850d522c8df049123e6d72c9dfe3ab8cee +size 10498 diff --git a/result/1_standard_ML/failed/BigSolDB/failed_smiles.csv b/result/1_standard_ML/failed/BigSolDB/failed_smiles.csv new file mode 100644 index 0000000000000000000000000000000000000000..f78fd77de56a46e12c10d64f857381678ad01f3b --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/failed_smiles.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b259ef9cf32436f70c3c8b3bfceb31cbbbdc5aca9446af6c68eb6c63d0b1a86b +size 4721 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_2615.png b/result/1_standard_ML/failed/BigSolDB/mol_2615.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_2615.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_2616.png b/result/1_standard_ML/failed/BigSolDB/mol_2616.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_2616.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_2617.png b/result/1_standard_ML/failed/BigSolDB/mol_2617.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_2617.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_2618.png b/result/1_standard_ML/failed/BigSolDB/mol_2618.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_2618.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_2619.png b/result/1_standard_ML/failed/BigSolDB/mol_2619.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_2619.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_2620.png b/result/1_standard_ML/failed/BigSolDB/mol_2620.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_2620.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_2621.png b/result/1_standard_ML/failed/BigSolDB/mol_2621.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_2621.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_2622.png b/result/1_standard_ML/failed/BigSolDB/mol_2622.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_2622.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_2623.png b/result/1_standard_ML/failed/BigSolDB/mol_2623.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_2623.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_29441.png b/result/1_standard_ML/failed/BigSolDB/mol_29441.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_29441.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_29442.png b/result/1_standard_ML/failed/BigSolDB/mol_29442.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_29442.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_29443.png b/result/1_standard_ML/failed/BigSolDB/mol_29443.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_29443.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_29444.png b/result/1_standard_ML/failed/BigSolDB/mol_29444.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_29444.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_29445.png b/result/1_standard_ML/failed/BigSolDB/mol_29445.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_29445.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_29446.png b/result/1_standard_ML/failed/BigSolDB/mol_29446.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_29446.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_29447.png b/result/1_standard_ML/failed/BigSolDB/mol_29447.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_29447.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_29448.png b/result/1_standard_ML/failed/BigSolDB/mol_29448.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_29448.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_29449.png b/result/1_standard_ML/failed/BigSolDB/mol_29449.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_29449.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_7478.png b/result/1_standard_ML/failed/BigSolDB/mol_7478.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_7478.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_7479.png b/result/1_standard_ML/failed/BigSolDB/mol_7479.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_7479.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_7480.png b/result/1_standard_ML/failed/BigSolDB/mol_7480.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_7480.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_7481.png b/result/1_standard_ML/failed/BigSolDB/mol_7481.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_7481.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_7482.png b/result/1_standard_ML/failed/BigSolDB/mol_7482.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_7482.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_7483.png b/result/1_standard_ML/failed/BigSolDB/mol_7483.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_7483.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_7484.png b/result/1_standard_ML/failed/BigSolDB/mol_7484.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_7484.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_7485.png b/result/1_standard_ML/failed/BigSolDB/mol_7485.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_7485.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/BigSolDB/mol_7486.png b/result/1_standard_ML/failed/BigSolDB/mol_7486.png new file mode 100644 index 0000000000000000000000000000000000000000..df92e0e19c8d076c298fc98aa35f8232700cec98 --- /dev/null +++ b/result/1_standard_ML/failed/BigSolDB/mol_7486.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b156fe029446ad629269e7147964b2e0e127dd95d4e3f3331c283d7acb6b076 +size 15181 diff --git a/result/1_standard_ML/failed/Lovric2020_logS0/failed_smiles.csv b/result/1_standard_ML/failed/Lovric2020_logS0/failed_smiles.csv new file mode 100644 index 0000000000000000000000000000000000000000..935612774e742c602638c7832c66cfb1f7c2fd04 --- /dev/null +++ b/result/1_standard_ML/failed/Lovric2020_logS0/failed_smiles.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:274dbe195d685fb43c9d4b0922d32ab4e6040ecf56a9c8d519df1036f651da1d +size 152 diff --git a/result/1_standard_ML/failed/Lovric2020_logS0/mol_461.png b/result/1_standard_ML/failed/Lovric2020_logS0/mol_461.png new file mode 100644 index 0000000000000000000000000000000000000000..55692c6accef84e85b20cfc76e8b15aed353b2be --- /dev/null +++ b/result/1_standard_ML/failed/Lovric2020_logS0/mol_461.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8c83de338b5a413138cb9e3551f1535106277fc54ebb691c166c4be71ed59a73 +size 11204 diff --git a/result/1_standard_ML/failed/Lovric2020_logS0/mol_462.png b/result/1_standard_ML/failed/Lovric2020_logS0/mol_462.png new file mode 100644 index 0000000000000000000000000000000000000000..f0df4745bec58e541491d1143c470ab6fefdac28 --- /dev/null +++ b/result/1_standard_ML/failed/Lovric2020_logS0/mol_462.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:acfd5ab93a734d2b3591fb5e032b3c7f4dbada3682ba8a2adfdb05cc69c5b1a6 +size 11252 diff --git a/result/1_standard_ML/histogram/AqSolDb_histogram_kde.png b/result/1_standard_ML/histogram/AqSolDb_histogram_kde.png new file mode 100644 index 0000000000000000000000000000000000000000..185e4c0f3363cb7161894e403cb1ea1198427e9c --- /dev/null +++ b/result/1_standard_ML/histogram/AqSolDb_histogram_kde.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:76385e50400893f5148703b819013a6308ad3a1c28517425e1f40bf2ee40b6dc +size 157564 diff --git a/result/1_standard_ML/histogram/AqSolDb_outliers_info.txt b/result/1_standard_ML/histogram/AqSolDb_outliers_info.txt new file mode 100644 index 0000000000000000000000000000000000000000..b7af1ab11d3dc88cf6c4ab2eda559a2b933f9ed4 --- /dev/null +++ b/result/1_standard_ML/histogram/AqSolDb_outliers_info.txt @@ -0,0 +1,83 @@ +Outliers for AqSolDb: +Index: 1337, SMILES: CC(C)CCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC(C)C, Value: -9.4195398078 +Index: 1362, SMILES: [Cu++].CCCCCCCC\C=C/CCCCCCCC([O-])=O.CCCCCCCC\C=C/CCCCCCCC([O-])=O, Value: -11.9989378619 +Index: 1694, SMILES: CCCCCCOc1ccc(c(O)c1)c2nc(nc(n2)c3ccccc3)c4ccccc4, Value: -9.1518109699 +Index: 1695, SMILES: CCCCCCCCCCCCCCCCCCCC\C=C\C\C=C\CCCCCCCCCCCNCCCCCCCCCCCCCCCCCCCC\C=C\C\C=C\CCCCCCCCCCC, Value: -9.7071062552 +Index: 1696, SMILES: CCCCCC(CCC)COC(=O)c1ccccc1C(=O)OCC(CCC)CCCCC, Value: -9.6499887292 +Index: 3057, SMILES: CC(C(C)(C)C)C(C)(C)SSSC(C)(C)C(C)C(C)(C)C, Value: -9.129966133 +Index: 3381, SMILES: Clc1c(Cl)c(Br)c2C3=NC(=Nc4n5[Cu]N6C(=N3)c7c(Cl)c(Br)c(Cl)c(Br)c7C6=NC8=NC(=Nc5c9c(Br)c(Cl)c(Br)c(Cl)c49)c%10c(Cl)c(Cl)c(Br)c(Cl)c8%10)c2c1Cl, Value: -9.1442341106 +Index: 3382, SMILES: Clc1cc(Cl)c2C3N=C(N=C4N5[Cu]N6C(N=C7N=C(N=C5c8c(Cl)c(Cl)c(Cl)c(Cl)c48)c9c(Cl)c(Cl)c(Cl)c(Cl)c79)c%10c(Cl)c(Cl)c(Cl)c(Cl)c%10C6=N3)c2c1Cl, Value: -9.039324078 +Index: 3383, SMILES: Brc1c(Br)c(Br)c(CCc2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c1Br, Value: -9.1299878036 +Index: 3385, SMILES: [Cr], Value: -10.0169999307 +Index: 3492, SMILES: COc1cc(NC(=O)C(N=Nc2ccc(cc2Cl)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccc(C)cc4C)c(Cl)c3)C(C)=O)c(OC)cc1Cl.COc5cc(NC(=O)C(N=Nc6ccc(cc6Cl)c7ccc(N=NC(C(C)=O)C(=O)Nc8cc(OC)c(Cl)cc8OC)c(Cl)c7)C(C)=O)c(OC)cc5Cl.CC(=O)C(N=Nc9ccc(cc9Cl)c%10ccc(N=NC(C(C)=O)C(=O)Nc%11ccc(C)cc%11C)c(Cl)c%10)C(=O)Nc%12ccc(C)cc%12C, Value: -9.052340862 +Index: 3550, SMILES: Clc1cccc(N\N=C2/C(=O)C(=Cc3ccccc23)C(=O)Nc4cccc5c(NC(=O)C6=Cc7ccccc7C(=N/Nc8cccc(Cl)c8Cl)\C6=O)cccc45)c1Cl, Value: -9.227651248 +Index: 3551, SMILES: [S--].[S--].[S--].[Bi+3].[Bi+3], Value: -9.0983152748 +Index: 3552, SMILES: CC(=O)C(N=Nc1ccc(cc1Cl)c2ccc(N=NC(C(C)=O)C(=O)Nc3ccccc3)c(Cl)c2)C(=O)Nc4ccccc4, Value: -9.1969385027 +Index: 3553, SMILES: FC(F)(F)C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F, Value: -9.1359660934 +Index: 3554, SMILES: CC(=O)C(N=Nc1ccc(cc1Cl)c2ccc(N=NC(C(C)=O)C(=O)Nc3ccc(C)cc3C)c(Cl)c2)C(=O)Nc4ccc(C)cc4C, Value: -9.2920103659 +Index: 3555, SMILES: CCOC(=O)OCCOc1cc(O)c2C(=O)c3ccccc3C(=O)c2c1N, Value: -9.2195295624 +Index: 3556, SMILES: C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C, Value: -9.4071737246 +Index: 3557, SMILES: CC(C)(c1cc(Br)c(OCC(Br)CBr)c(Br)c1)c2cc(Br)c(OCC(Br)CBr)c(Br)c2, Value: -9.8164351053 +Index: 3558, SMILES: [Ir], Value: -9.9827617991 +Index: 3564, SMILES: C1CO[Sb]2OCCO[Sb](O1)OCCO2, Value: -9.0249738719 +Index: 3649, SMILES: CCCCC(CC)C(=O)OCC(COC(=O)C(CC)CCCC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC, Value: -9.2047594175 +Index: 3651, SMILES: CCCCCCCC/C=C/CCCCCCCCO[P+](=O)OCCCCCCCC\C=C\CCCCCCCC, Value: -9.5344195865 +Index: 3652, SMILES: O=[Ce]=O, Value: -9.1459110865 +Index: 3653, SMILES: Brc1c(Br)c(Br)c(Oc2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c1Br, Value: -9.9818960396 +Index: 3654, SMILES: CCCCCCCCCCCCCCCCCCC1CC(=O)N(CCNCCNCCNCCN2C(=O)CC(CCCCCCCCCCCCCCCCCC)C2=O)C1=O, Value: -10.2347171749 +Index: 3655, SMILES: ClCc1ccc(cc1)c2ccc(CCl)cc2, Value: -10.098913562 +Index: 3839, SMILES: CCCCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCCC, Value: -9.3076 +Index: 3856, SMILES: Brc1c(Br)c(Br)c(Br)c(Br)c1Br, Value: -9.5374 +Index: 4201, SMILES: c1ccc2c(c1)c3ccc4ccc5cccc6cc2c3c4c56, Value: -9.1627 +Index: 4669, SMILES: CCCCCCCCCCCCCCC, Value: -9.4464 +Index: 5009, SMILES: Clc1c(Cl)c(Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2c1Cl, Value: -9.703 +Index: 5528, SMILES: ClC1=C(Cl)C2(Cl)C3CCC4C(CCC3C1(Cl)C2(Cl)Cl)C5(Cl)C(=C(Cl)C4(Cl)C5(Cl)Cl)Cl, Value: -13.1719 +Index: 5788, SMILES: Brc1ccc(c(Br)c1Br)c2c(Br)c(Br)c(Br)c(Br)c2Br, Value: -9.351 +Index: 5846, SMILES: Clc1cc(Cl)c(c(Cl)c1Cl)c2c(Cl)cc(Cl)c(Cl)c2Cl, Value: -9.1 +Index: 5904, SMILES: Clc1cc2Oc3c(Cl)c(Cl)c(Cl)c(Cl)c3Oc2c(Cl)c1Cl, Value: -11.4795 +Index: 5928, SMILES: Clc1c(Cl)c(Cl)c2c(oc3c(Cl)c(Cl)c(Cl)c(Cl)c23)c1Cl, Value: -11.5827 +Index: 5944, SMILES: Clc1cc(Cl)c(c(Cl)c1Cl)c2c(Cl)c(Cl)cc(Cl)c2Cl, Value: -9.1999 +Index: 5964, SMILES: Clc1cc(Cl)c(c(Cl)c1Cl)c2cc(Cl)c(Cl)c(Cl)c2Cl, Value: -9.42 +Index: 6009, SMILES: Clc1ccc(Cl)c(c1Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -9.1 +Index: 6010, SMILES: Clc1cc(Cl)c(Cl)c(c1)c2cc(Cl)c(Cl)c(Cl)c2Cl, Value: -9.1 +Index: 6011, SMILES: Clc1cc(c(Cl)c(Cl)c1Cl)c2c(Cl)c(Cl)cc(Cl)c2Cl, Value: -9.29 +Index: 6012, SMILES: Clc1cc(Cl)c(cc1Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -9.5 +Index: 6013, SMILES: Clc1cc(Cl)c(Cl)c(c1Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -10.4115 +Index: 6014, SMILES: Clc1ccc(c(Cl)c1Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -9.29 +Index: 6015, SMILES: Clc1cc(Cl)c(c(Cl)c1Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -10.1035 +Index: 6072, SMILES: Clc1cc2oc3c(Cl)c(Cl)c(Cl)cc3c2cc1Cl, Value: -9.1609 +Index: 6166, SMILES: Clc1cc2c(oc3c(Cl)c(Cl)c(Cl)c(Cl)c23)c(Cl)c1Cl, Value: -11.4817 +Index: 6171, SMILES: Brc1ccc(Br)c(c1)c2cc(Br)c(Br)cc2Br, Value: -9.7256 +Index: 6183, SMILES: Clc1cc(Cl)c(Cl)c(c1)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -9.42 +Index: 6196, SMILES: Clc1cc(Cl)cc(c1)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -9.1 +Index: 6243, SMILES: Clc1cc(Cl)c(c2cc(Cl)c(Cl)c(Cl)c2)c(Cl)c1Cl, Value: -9.1 +Index: 6244, SMILES: Clc1cc(Cl)c(c(Cl)c1)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -9.48 +Index: 6245, SMILES: Clc1cc(cc(Cl)c1Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -9.6997 +Index: 6445, SMILES: CC(C)(COCc1cccc(Oc2ccccc2)c1)c3ccc(OC(F)(F)Br)cc3, Value: -9.9799 +Index: 6573, SMILES: c1cc2ccc3ccc4ccc5cccc6c(c1)c2c3c4c56, Value: -9.0265 +Index: 7057, SMILES: Clc1cc2Oc3cc(Cl)c(Cl)cc3Oc2cc1Cl, Value: -9.2068 +Index: 7058, SMILES: Clc1c(Cl)c(Cl)c2Oc3c(Cl)c(Cl)c(Cl)c(Cl)c3Oc2c1Cl, Value: -12.0605 +Index: 7059, SMILES: Clc1cc(Cl)c2Oc3cc(Cl)cc(Cl)c3Oc2c1, Value: -9.0027 +Index: 7061, SMILES: Clc1cc2Oc3c(Cl)c(Cl)c(Cl)c(Cl)c3Oc2cc1Cl, Value: -10.9486 +Index: 7062, SMILES: Clc1ccc2Oc3c(Cl)c(Cl)c(Cl)c(Cl)c3Oc2c1, Value: -9.4728 +Index: 7489, SMILES: ClC1=CC=C(C2=CC(=C(Cl)C(=C2)Cl)Cl)C(=C1Cl)Cl, Value: -9.1 +Index: 7548, SMILES: ClC1=CC(=C(Cl)C(=C1Cl)Cl)C2=CC(=C(Cl)C(=C2Cl)Cl)Cl, Value: -9.16 +Index: 7555, SMILES: ClC1=C(Cl)C(=C(Cl)C(=C1)Cl)C2=C(Cl)C(=CC(=C2Cl)Cl)Cl, Value: -9.38 +Index: 7567, SMILES: ClC1=C(Cl)C(=C(Cl)C(=C1)C2=C(Cl)C(=C(Cl)C(=C2Cl)Cl)Cl)Cl, Value: -9.62 +Index: 7787, SMILES: ClC1=C(Cl)C=C(OC2=C(Cl)C(=C(Cl)C(=C2)Cl)Cl)C(=C1)Cl, Value: -9.5 +Index: 7788, SMILES: ClC1=CC=C(OC2=C(Cl)C(=C(Cl)C(=C2Cl)Cl)Cl)C=C1Cl, Value: -9.46 +Index: 7790, SMILES: ClC1=C(Cl)C=C(OC2=C(Cl)C(=CC(=C2Cl)Cl)Cl)C(=C1)Cl, Value: -9.05 +Index: 7791, SMILES: ClC1=CC=C(OC2=C(Cl)C(=CC(=C2Cl)Cl)Cl)C(=C1Cl)Cl, Value: -9.09 +Index: 7795, SMILES: ClC1=C(Cl)C=C(OC2=C(Cl)C(=C(Cl)C(=C2Cl)Cl)Cl)C(=C1)Cl, Value: -10.1 +Index: 7796, SMILES: ClC1=C(Cl)C(=C(OC2=C(Cl)C(=C(Cl)C(=C2Cl)Cl)Cl)C=C1)Cl, Value: -10.6 +Index: 7797, SMILES: ClC1=C(Cl)C(=C(Cl)C(=C1)Cl)OC2=C(Cl)C(=C(Cl)C(=C2)Cl)Cl, Value: -10.1 +Index: 8339, SMILES: ClC1=CC(=C(Cl)C(=C1Cl)C2=CC(=C(Cl)C(=C2)Cl)Cl)Cl, Value: -9.1 +Index: 8344, SMILES: ClC1=CC(=CC(=C1Cl)Cl)OC2=C(Cl)C(=C(Cl)C(=C2)Cl)Cl, Value: -9.54 +Index: 8352, SMILES: ClC1=CC=C(OC2=C(Cl)C(=C(Cl)C(=C2Cl)Cl)Cl)C(=C1)Cl, Value: -9.64 +Index: 8373, SMILES: ClC1=CC(=C(Cl)C(=C1Cl)Cl)OC2=CC(=C(Cl)C(=C2Cl)Cl)Cl, Value: -10.1 +Index: 8382, SMILES: ClC1=CC2=C(C(=C1Cl)Cl)C3=C(O2)C(=C(Cl)C(=C3)Cl)Cl, Value: -10.3 +Index: 9740, SMILES: Clc1c(Cl)c(Cl)c(c(Cl)c1Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl , Value: -11.6 +Index: 9875, SMILES: ClC1=C(Cl)C(Cl)=C(OC2=C(Cl)C(Cl)=C(Cl)C(Cl)=C2Cl)C(Cl)=C1Cl, Value: -12.95 +Index: 9882, SMILES: ClC1=CC=C(OC2=CC(Cl)=C(Cl)C(Cl)=C2Cl)C(Cl)=C1Cl, Value: -9.12 +Index: 9886, SMILES: ClC1=C(Cl)C=C2C(=C1)OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C21, Value: -10.66 +Index: 9923, SMILES: ClC1=C(Cl)C(Cl)=C(Cl)C(OC2=C(Cl)C(Cl)=C(Cl)C(Cl)=C2Cl)=C1, Value: -10.55 diff --git a/result/1_standard_ML/histogram/BigSolDB_histogram_kde.png b/result/1_standard_ML/histogram/BigSolDB_histogram_kde.png new file mode 100644 index 0000000000000000000000000000000000000000..1997d049dae3d84b284941605ed8080f851e95e4 --- /dev/null +++ b/result/1_standard_ML/histogram/BigSolDB_histogram_kde.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d60d1671c72df7b7213a3f5147ac336678596c80fe1d7bb9b27bb3ab25a736ae +size 145981 diff --git a/result/1_standard_ML/histogram/BigSolDB_outliers_info.txt b/result/1_standard_ML/histogram/BigSolDB_outliers_info.txt new file mode 100644 index 0000000000000000000000000000000000000000..8469bde7a90545f2ff2fe7754e387c20475151b3 --- /dev/null +++ b/result/1_standard_ML/histogram/BigSolDB_outliers_info.txt @@ -0,0 +1,7557 @@ +Outliers for BigSolDB: +Index: 15, SMILES: COC(=O)[C@@H](N)CS.Cl, Value: 0.1268 +Index: 16, SMILES: COC(=O)[C@@H](N)CS.Cl, Value: 0.13888 +Index: 17, SMILES: COC(=O)[C@@H](N)CS.Cl, Value: 0.15454 +Index: 18, SMILES: COC(=O)[C@@H](N)CS.Cl, Value: 0.16817 +Index: 19, SMILES: COC(=O)[C@@H](N)CS.Cl, Value: 0.18671 +Index: 20, SMILES: COC(=O)[C@@H](N)CS.Cl, Value: 0.21191 +Index: 21, SMILES: COC(=O)[C@@H](N)CS.Cl, Value: 0.25724 +Index: 28, SMILES: CC1(C)NC(=O)NC1=O, Value: 0.1224 +Index: 29, SMILES: CC1(C)NC(=O)NC1=O, Value: 0.1354 +Index: 30, SMILES: CC1(C)NC(=O)NC1=O, Value: 0.1498 +Index: 176, SMILES: CSCCC(NC(C)=O)C(=O)O, Value: 0.14101 +Index: 177, SMILES: CSCCC(NC(C)=O)C(=O)O, Value: 0.18661 +Index: 178, SMILES: CSCCC(NC(C)=O)C(=O)O, Value: 0.26161 +Index: 229, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1166 +Index: 230, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1476 +Index: 231, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1753 +Index: 232, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2366 +Index: 233, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2928 +Index: 234, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3586 +Index: 235, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.4424 +Index: 287, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2278 +Index: 288, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2383 +Index: 289, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2501 +Index: 290, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2622 +Index: 291, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2772 +Index: 292, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2927 +Index: 293, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3102 +Index: 294, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3303 +Index: 295, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3512 +Index: 296, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3719 +Index: 327, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1197 +Index: 328, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1398 +Index: 329, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1635 +Index: 348, SMILES: CCOC(=O)[C@@H]1CSCN1.Cl, Value: 0.141648 +Index: 350, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.149947 +Index: 351, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.195917 +Index: 352, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.240239 +Index: 353, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.297314 +Index: 386, SMILES: O=C(N[C@H](C(=O)O)c1ccccc1)OCc1ccccc1, Value: 0.146271 +Index: 405, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1874 +Index: 406, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1901 +Index: 407, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1939 +Index: 408, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1975 +Index: 409, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2017 +Index: 410, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2066 +Index: 411, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2119 +Index: 412, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2174 +Index: 413, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2229 +Index: 471, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.12232 +Index: 472, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.16571 +Index: 473, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.20965 +Index: 474, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.29147 +Index: 475, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.4055 +Index: 482, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1159 +Index: 483, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1437 +Index: 484, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1728 +Index: 485, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2033 +Index: 486, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2333 +Index: 487, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2656 +Index: 488, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3069 +Index: 489, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3826 +Index: 517, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.1171 +Index: 518, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.1337 +Index: 526, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1247 +Index: 527, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1367 +Index: 528, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1546 +Index: 529, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1736 +Index: 530, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1946 +Index: 531, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.2183 +Index: 532, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.2451 +Index: 533, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.2738 +Index: 534, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.3054 +Index: 535, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.3407 +Index: 547, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.1356 +Index: 596, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1223 +Index: 597, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1821 +Index: 598, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2479 +Index: 599, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3639 +Index: 600, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4825 +Index: 601, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6265 +Index: 781, SMILES: O=P(O)(O)c1ccccc1, Value: 0.29018 +Index: 782, SMILES: O=P(O)(O)c1ccccc1, Value: 0.29885 +Index: 783, SMILES: O=P(O)(O)c1ccccc1, Value: 0.30707 +Index: 784, SMILES: O=P(O)(O)c1ccccc1, Value: 0.31526 +Index: 785, SMILES: O=P(O)(O)c1ccccc1, Value: 0.32435 +Index: 786, SMILES: O=P(O)(O)c1ccccc1, Value: 0.33482 +Index: 787, SMILES: O=P(O)(O)c1ccccc1, Value: 0.34665 +Index: 788, SMILES: O=P(O)(O)c1ccccc1, Value: 0.35716 +Index: 789, SMILES: O=P(O)(O)c1ccccc1, Value: 0.36891 +Index: 790, SMILES: O=P(O)(O)c1ccccc1, Value: 0.38029 +Index: 795, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1531 +Index: 796, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.206 +Index: 797, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2714 +Index: 798, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.3519 +Index: 799, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.4456 +Index: 946, SMILES: NC(=O)c1ccccc1N, Value: 0.1231 +Index: 947, SMILES: NC(=O)c1ccccc1N, Value: 0.1484 +Index: 948, SMILES: NC(=O)c1ccccc1N, Value: 0.1702 +Index: 949, SMILES: NC(=O)c1ccccc1N, Value: 0.1896 +Index: 950, SMILES: NC(=O)c1ccccc1N, Value: 0.2291 +Index: 1183, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.11922 +Index: 1184, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.14257 +Index: 1185, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.16166 +Index: 1186, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.19381 +Index: 1187, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.22208 +Index: 1188, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.26223 +Index: 1189, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.29622 +Index: 1190, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.34215 +Index: 1254, SMILES: CC[C@@H](C(N)=O)N1CCCC1=O, Value: 0.1153 +Index: 1255, SMILES: CC[C@@H](C(N)=O)N1CCCC1=O, Value: 0.1356 +Index: 1256, SMILES: CC[C@@H](C(N)=O)N1CCCC1=O, Value: 0.1578 +Index: 1257, SMILES: CC[C@@H](C(N)=O)N1CCCC1=O, Value: 0.1824 +Index: 1258, SMILES: CC[C@@H](C(N)=O)N1CCCC1=O, Value: 0.2094 +Index: 1259, SMILES: CC[C@@H](C(N)=O)N1CCCC1=O, Value: 0.2388 +Index: 1260, SMILES: CC[C@@H](C(N)=O)N1CCCC1=O, Value: 0.2702 +Index: 1328, SMILES: N#Cc1cccnc1, Value: 0.153 +Index: 1329, SMILES: N#Cc1cccnc1, Value: 0.267 +Index: 1330, SMILES: N#Cc1cccnc1, Value: 0.404 +Index: 1331, SMILES: N#Cc1cccnc1, Value: 0.541 +Index: 1332, SMILES: N#Cc1cccnc1, Value: 0.726 +Index: 1338, SMILES: N#Cc1ccncc1, Value: 0.173 +Index: 1339, SMILES: N#Cc1ccncc1, Value: 0.304 +Index: 1354, SMILES: NC(=O)c1cccnc1, Value: 0.1208701 +Index: 1355, SMILES: NC(=O)c1cccnc1, Value: 0.1413067 +Index: 1356, SMILES: NC(=O)c1cccnc1, Value: 0.1655405 +Index: 1357, SMILES: NC(=O)c1cccnc1, Value: 0.1917295 +Index: 1386, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.19966 +Index: 1387, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.21374 +Index: 1388, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.22653 +Index: 1389, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.2471 +Index: 1390, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.26061 +Index: 1391, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.27568 +Index: 1392, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.28369 +Index: 1393, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.3004 +Index: 1394, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.31383 +Index: 1455, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.13 +Index: 1456, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.14 +Index: 1457, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.151 +Index: 1458, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.162 +Index: 1459, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.173 +Index: 1460, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.183 +Index: 1461, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.192 +Index: 1462, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.2 +Index: 1463, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.213 +Index: 1544, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1299 +Index: 1545, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2085 +Index: 1546, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3017 +Index: 1547, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.455 +Index: 1557, SMILES: O=C(O)c1ccccc1O, Value: 0.12324 +Index: 1558, SMILES: O=C(O)c1ccccc1O, Value: 0.13718 +Index: 1559, SMILES: O=C(O)c1ccccc1O, Value: 0.15007 +Index: 1560, SMILES: O=C(O)c1ccccc1O, Value: 0.16333 +Index: 1561, SMILES: O=C(O)c1ccccc1O, Value: 0.17234 +Index: 1562, SMILES: OC/C=C/c1ccccc1, Value: 0.222 +Index: 1563, SMILES: OC/C=C/c1ccccc1, Value: 0.24 +Index: 1564, SMILES: OC/C=C/c1ccccc1, Value: 0.269 +Index: 1565, SMILES: OC/C=C/c1ccccc1, Value: 0.307 +Index: 1566, SMILES: OC/C=C/c1ccccc1, Value: 0.351 +Index: 1567, SMILES: OC/C=C/c1ccccc1, Value: 0.401 +Index: 1568, SMILES: OC/C=C/c1ccccc1, Value: 0.466 +Index: 1569, SMILES: OC/C=C/c1ccccc1, Value: 0.536 +Index: 1570, SMILES: OC/C=C/c1ccccc1, Value: 0.61 +Index: 1621, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1328 +Index: 1622, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1749 +Index: 1623, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.2288 +Index: 1650, SMILES: CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1, Value: 0.1178 +Index: 1727, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1202 +Index: 1728, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1415 +Index: 1729, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1675 +Index: 1730, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1997 +Index: 1731, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2271 +Index: 1732, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2594 +Index: 1733, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2956 +Index: 1734, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.3347 +Index: 1770, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.129 +Index: 1771, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1511 +Index: 1772, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1782 +Index: 1773, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.2115 +Index: 1803, SMILES: O=C(O)c1ccccc1, Value: 0.1285 +Index: 1804, SMILES: O=C(O)c1ccccc1, Value: 0.1454 +Index: 1805, SMILES: O=C(O)c1ccccc1, Value: 0.1637 +Index: 1806, SMILES: O=C(O)c1ccccc1, Value: 0.1804 +Index: 1807, SMILES: O=C(O)c1ccccc1, Value: 0.2044 +Index: 1808, SMILES: O=C(O)c1ccccc1, Value: 0.227 +Index: 1809, SMILES: O=C(O)c1ccccc1, Value: 0.2412 +Index: 1831, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1157 +Index: 1832, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1261 +Index: 1833, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1443 +Index: 1834, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1613 +Index: 1837, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1179 +Index: 1838, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1356 +Index: 1839, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1671 +Index: 1840, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1955 +Index: 1841, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.228 +Index: 1842, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2658 +Index: 1843, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.3086 +Index: 1844, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.3563 +Index: 1863, SMILES: O=Cc1ccc2ccccc2c1, Value: 0.1187 +Index: 1864, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.1272 +Index: 1865, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.1572 +Index: 1866, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.187 +Index: 1867, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.2191 +Index: 1868, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.2585 +Index: 1869, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.3004 +Index: 1870, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.3472 +Index: 1871, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.4025 +Index: 1904, SMILES: C=C1C[C@]23C[C@H]1CC[C@H]2[C@@]12CC[C@H](O)[C@@](C)(C(=O)O1)[C@H]2[C@@H]3C(=O)O, Value: 0.120779 +Index: 1912, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.12532 +Index: 1913, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.16642 +Index: 1935, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.2629 +Index: 1936, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.3022 +Index: 1937, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.3553 +Index: 1938, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.4216 +Index: 1939, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.4708 +Index: 1940, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.4958 +Index: 1941, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.5434 +Index: 1981, SMILES: O=C(O)c1ccc(O)c(O)c1, Value: 0.12611 +Index: 1982, SMILES: O=C(O)c1ccc(O)c(O)c1, Value: 0.16721 +Index: 2027, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1231 +Index: 2028, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1607 +Index: 2029, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2077 +Index: 2030, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2643 +Index: 2031, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3411 +Index: 2032, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4328 +Index: 2047, SMILES: C[N+](C)(C)C[C@H](O)CC(=O)[O-], Value: 0.118964 +Index: 2048, SMILES: C[N+](C)(C)C[C@H](O)CC(=O)[O-], Value: 0.127123 +Index: 2049, SMILES: C[N+](C)(C)C[C@H](O)CC(=O)[O-], Value: 0.135565 +Index: 2050, SMILES: C[N+](C)(C)C[C@H](O)CC(=O)[O-], Value: 0.144165 +Index: 2051, SMILES: C[N+](C)(C)C[C@H](O)CC(=O)[O-], Value: 0.154137 +Index: 2052, SMILES: C[N+](C)(C)C[C@H](O)CC(=O)[O-], Value: 0.165167 +Index: 2053, SMILES: C[N+](C)(C)C[C@H](O)CC(=O)[O-], Value: 0.177535 +Index: 2054, SMILES: C[N+](C)(C)C[C@H](O)CC(=O)[O-], Value: 0.189346 +Index: 2102, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.11848 +Index: 2103, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.13514 +Index: 2104, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.15912 +Index: 2105, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.18873 +Index: 2106, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.22962 +Index: 2117, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1247 +Index: 2184, SMILES: CC(=O)N1CN(C(C)=O)CN(C(C)=O)C1, Value: 0.20433 +Index: 2185, SMILES: CC(=O)N1CN(C(C)=O)CN(C(C)=O)C1, Value: 0.23793 +Index: 2186, SMILES: CC(=O)N1CN(C(C)=O)CN(C(C)=O)C1, Value: 0.28282 +Index: 2187, SMILES: CC(=O)N1CN(C(C)=O)CN(C(C)=O)C1, Value: 0.33546 +Index: 2188, SMILES: CC(=O)N1CN(C(C)=O)CN(C(C)=O)C1, Value: 0.39451 +Index: 2192, SMILES: O=P(CCCO)(CCCO)CCCO, Value: 0.11501 +Index: 2193, SMILES: O=P(CCCO)(CCCO)CCCO, Value: 0.14427 +Index: 2194, SMILES: O=P(CCCO)(CCCO)CCCO, Value: 0.17565 +Index: 2195, SMILES: O=P(CCCO)(CCCO)CCCO, Value: 0.20979 +Index: 2204, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.1164 +Index: 2205, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.1261 +Index: 2206, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.2042 +Index: 2207, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.2818 +Index: 2208, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.3367 +Index: 2240, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1171 +Index: 2241, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1215 +Index: 2242, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1261 +Index: 2243, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1308 +Index: 2244, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1355 +Index: 2262, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.1209 +Index: 2271, SMILES: Cl.Nc1ccccc1, Value: 0.144 +Index: 2272, SMILES: Cl.Nc1ccccc1, Value: 0.165 +Index: 2273, SMILES: Cl.Nc1ccccc1, Value: 0.188 +Index: 2274, SMILES: Cl.Nc1ccccc1, Value: 0.208 +Index: 2275, SMILES: Cl.Nc1ccccc1, Value: 0.23 +Index: 2362, SMILES: O=[PH](O)c1ccccc1, Value: 0.1726 +Index: 2363, SMILES: O=[PH](O)c1ccccc1, Value: 0.2154 +Index: 2364, SMILES: O=[PH](O)c1ccccc1, Value: 0.2795 +Index: 2365, SMILES: O=[PH](O)c1ccccc1, Value: 0.3437 +Index: 2366, SMILES: O=[PH](O)c1ccccc1, Value: 0.4292 +Index: 2367, SMILES: O=[PH](O)c1ccccc1, Value: 0.5256 +Index: 2368, SMILES: O=[PH](O)c1ccccc1, Value: 0.6554 +Index: 2369, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3172 +Index: 2370, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3432 +Index: 2371, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3718 +Index: 2372, SMILES: CP(=O)(O)c1ccccc1, Value: 0.406 +Index: 2373, SMILES: CP(=O)(O)c1ccccc1, Value: 0.4392 +Index: 2374, SMILES: CP(=O)(O)c1ccccc1, Value: 0.4708 +Index: 2375, SMILES: CP(=O)(O)c1ccccc1, Value: 0.4987 +Index: 2504, SMILES: CN/C(=C\[N+](=O)[O-])NCCSCc1csc(CN(C)C)n1, Value: 0.14694 +Index: 2505, SMILES: CN/C(=C\[N+](=O)[O-])NCCSCc1csc(CN(C)C)n1, Value: 0.20253 +Index: 2577, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1297 +Index: 2578, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1458 +Index: 2579, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1628 +Index: 2580, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1815 +Index: 2581, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.2023 +Index: 2582, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1425 +Index: 2583, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1521 +Index: 2584, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1588 +Index: 2585, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1708 +Index: 2586, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1798 +Index: 2587, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1873 +Index: 2588, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2048 +Index: 2589, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2176 +Index: 2590, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2457 +Index: 2591, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2699 +Index: 2592, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2931 +Index: 2593, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.3088 +Index: 2594, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.3239 +Index: 2595, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.3416 +Index: 2656, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.11623 +Index: 2657, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.1492 +Index: 2658, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.18654 +Index: 2659, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.22244 +Index: 2660, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.29735 +Index: 2661, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.3552 +Index: 2673, SMILES: N#C[S-].[NH4+], Value: 0.1693 +Index: 2674, SMILES: N#C[S-].[NH4+], Value: 0.1794 +Index: 2675, SMILES: N#C[S-].[NH4+], Value: 0.1895 +Index: 2676, SMILES: N#C[S-].[NH4+], Value: 0.1988 +Index: 2677, SMILES: N#C[S-].[NH4+], Value: 0.2199 +Index: 2678, SMILES: N#C[S-].[NH4+], Value: 0.2334 +Index: 2679, SMILES: N#C[S-].[NH4+], Value: 0.2491 +Index: 2680, SMILES: N#C[S-].[NH4+], Value: 0.2769 +Index: 2681, SMILES: N#C[S-].[NH4+], Value: 0.3089 +Index: 2722, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.274 +Index: 2723, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.6939 +Index: 2741, SMILES: O=C(O)c1ccccc1O, Value: 0.1223 +Index: 2750, SMILES: O=C(Oc1ccccc1)Oc1ccccc1, Value: 0.1209 +Index: 2770, SMILES: C1CN2CCN1CC2, Value: 0.284 +Index: 2771, SMILES: C1CN2CCN1CC2, Value: 0.319 +Index: 2772, SMILES: C1CN2CCN1CC2, Value: 0.361 +Index: 2773, SMILES: C1CN2CCN1CC2, Value: 0.389 +Index: 2774, SMILES: C1CN2CCN1CC2, Value: 0.434 +Index: 2775, SMILES: C1CN2CCN1CC2, Value: 0.479 +Index: 2776, SMILES: C1CN2CCN1CC2, Value: 0.534 +Index: 2777, SMILES: C1CN2CCN1CC2, Value: 0.305 +Index: 2778, SMILES: C1CN2CCN1CC2, Value: 0.344 +Index: 2779, SMILES: C1CN2CCN1CC2, Value: 0.377 +Index: 2780, SMILES: C1CN2CCN1CC2, Value: 0.413 +Index: 2781, SMILES: C1CN2CCN1CC2, Value: 0.456 +Index: 2782, SMILES: C1CN2CCN1CC2, Value: 0.51 +Index: 2882, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.1184 +Index: 2883, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.2482 +Index: 2885, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.1644 +Index: 2886, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.2727 +Index: 2888, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.2016 +Index: 2889, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.3005 +Index: 2890, SMILES: O=C(O)Cn1cnnn1, Value: 0.1455 +Index: 2891, SMILES: O=C(O)Cn1cnnn1, Value: 0.1555 +Index: 2892, SMILES: O=C(O)Cn1cnnn1, Value: 0.1732 +Index: 2893, SMILES: O=C(O)Cn1cnnn1, Value: 0.1991 +Index: 2894, SMILES: O=C(O)Cn1cnnn1, Value: 0.2333 +Index: 2895, SMILES: O=C(O)Cn1cnnn1, Value: 0.2764 +Index: 2896, SMILES: O=C(O)Cn1cnnn1, Value: 0.3255 +Index: 2897, SMILES: O=C(O)Cn1cnnn1, Value: 0.3834 +Index: 2904, SMILES: Nc1cccc(N)n1, Value: 0.12519 +Index: 2905, SMILES: Nc1cccc(N)n1, Value: 0.14964 +Index: 2906, SMILES: Nc1cccc(N)n1, Value: 0.16484 +Index: 2907, SMILES: Nc1cccc(N)n1, Value: 0.17823 +Index: 2908, SMILES: Nc1cccc(N)n1, Value: 0.18758 +Index: 2909, SMILES: Nc1cccc(N)n1, Value: 0.20739 +Index: 2910, SMILES: Nc1cccc(N)n1, Value: 0.23324 +Index: 2969, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.1229 +Index: 2970, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.1378 +Index: 2971, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.1521 +Index: 2972, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.1678 +Index: 2973, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.1852 +Index: 3110, SMILES: O=C(O)CCCC(=O)O, Value: 0.2038 +Index: 3111, SMILES: O=C(O)CCCC(=O)O, Value: 0.2387 +Index: 3112, SMILES: O=C(O)CCCC(=O)O, Value: 0.2555 +Index: 3113, SMILES: O=C(O)CCCC(=O)O, Value: 0.2736 +Index: 3114, SMILES: O=C(O)CCCC(=O)O, Value: 0.2941 +Index: 3115, SMILES: O=C(O)CCCC(=O)O, Value: 0.3155 +Index: 3116, SMILES: O=C(O)CCCC(=O)O, Value: 0.3398 +Index: 3117, SMILES: O=C(O)CCCC(=O)O, Value: 0.3696 +Index: 3118, SMILES: O=C(O)CCCC(=O)O, Value: 0.4027 +Index: 3119, SMILES: O=C(O)CCCC(=O)O, Value: 0.4356 +Index: 3120, SMILES: O=C(O)CCCC(=O)O, Value: 0.4725 +Index: 3131, SMILES: O=C(O)CCC(=O)O, Value: 0.1224 +Index: 3310, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.147 +Index: 3311, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.181 +Index: 3312, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.214 +Index: 3313, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.257 +Index: 3314, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.307 +Index: 3315, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.358 +Index: 3316, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.418 +Index: 3358, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.1163 +Index: 3359, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.1362 +Index: 3360, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.1585 +Index: 3361, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.1834 +Index: 3362, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.2078 +Index: 3363, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.2376 +Index: 3364, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.2736 +Index: 3365, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.3128 +Index: 3366, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.3538 +Index: 3395, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1845 +Index: 3396, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1907 +Index: 3397, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1966 +Index: 3398, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2042 +Index: 3399, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2103 +Index: 3400, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2166 +Index: 3576, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.123 +Index: 3577, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1363 +Index: 3578, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1505 +Index: 3579, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1652 +Index: 3580, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1818 +Index: 3637, SMILES: Brc1cn[nH]c1, Value: 0.2031 +Index: 3638, SMILES: Brc1cn[nH]c1, Value: 0.2183 +Index: 3639, SMILES: Brc1cn[nH]c1, Value: 0.2335 +Index: 3640, SMILES: Brc1cn[nH]c1, Value: 0.2517 +Index: 3641, SMILES: Brc1cn[nH]c1, Value: 0.2698 +Index: 3642, SMILES: Brc1cn[nH]c1, Value: 0.2922 +Index: 3643, SMILES: Brc1cn[nH]c1, Value: 0.3116 +Index: 3644, SMILES: Brc1cn[nH]c1, Value: 0.3328 +Index: 3645, SMILES: Brc1cn[nH]c1, Value: 0.3553 +Index: 3646, SMILES: Brc1cn[nH]c1, Value: 0.3789 +Index: 3647, SMILES: Brc1cn[nH]c1, Value: 0.4024 +Index: 3648, SMILES: Brc1cn[nH]c1, Value: 0.4258 +Index: 3649, SMILES: Brc1cn[nH]c1, Value: 0.452 +Index: 3650, SMILES: Brc1cn[nH]c1, Value: 0.4793 +Index: 3651, SMILES: Brc1cn[nH]c1, Value: 0.503 +Index: 3703, SMILES: Cc1cc(C)[nH]n1, Value: 0.1179 +Index: 3704, SMILES: Cc1cc(C)[nH]n1, Value: 0.1235 +Index: 3705, SMILES: Cc1cc(C)[nH]n1, Value: 0.1308 +Index: 3706, SMILES: Cc1cc(C)[nH]n1, Value: 0.1372 +Index: 3707, SMILES: Cc1cc(C)[nH]n1, Value: 0.1434 +Index: 3708, SMILES: Cc1cc(C)[nH]n1, Value: 0.1503 +Index: 3709, SMILES: Cc1cc(C)[nH]n1, Value: 0.1582 +Index: 3710, SMILES: Cc1cc(C)[nH]n1, Value: 0.1653 +Index: 3711, SMILES: Cc1cc(C)[nH]n1, Value: 0.1727 +Index: 3712, SMILES: Cc1cc(C)[nH]n1, Value: 0.1804 +Index: 3713, SMILES: Cc1cc(C)[nH]n1, Value: 0.1902 +Index: 3744, SMILES: CC(C)c1ncc[nH]1, Value: 0.2238 +Index: 3745, SMILES: CC(C)c1ncc[nH]1, Value: 0.233 +Index: 3746, SMILES: CC(C)c1ncc[nH]1, Value: 0.2422 +Index: 3747, SMILES: CC(C)c1ncc[nH]1, Value: 0.2524 +Index: 3748, SMILES: CC(C)c1ncc[nH]1, Value: 0.2626 +Index: 3749, SMILES: CC(C)c1ncc[nH]1, Value: 0.2744 +Index: 3750, SMILES: CC(C)c1ncc[nH]1, Value: 0.2854 +Index: 3751, SMILES: CC(C)c1ncc[nH]1, Value: 0.2974 +Index: 3752, SMILES: CC(C)c1ncc[nH]1, Value: 0.3102 +Index: 3753, SMILES: CC(C)c1ncc[nH]1, Value: 0.3222 +Index: 3754, SMILES: CC(C)c1ncc[nH]1, Value: 0.3342 +Index: 3755, SMILES: CC(C)c1ncc[nH]1, Value: 0.348 +Index: 3756, SMILES: CC(C)c1ncc[nH]1, Value: 0.361 +Index: 3757, SMILES: CC(C)c1ncc[nH]1, Value: 0.3756 +Index: 3758, SMILES: CC(C)c1ncc[nH]1, Value: 0.3902 +Index: 3836, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1184 +Index: 3837, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1361 +Index: 3838, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1559 +Index: 3839, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.178 +Index: 3840, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2028 +Index: 3841, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2303 +Index: 3842, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2609 +Index: 3843, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2947 +Index: 3844, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3321 +Index: 3845, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3733 +Index: 3846, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.4187 +Index: 3894, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1304 +Index: 3948, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.4388 +Index: 3949, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.4728 +Index: 3950, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.5232 +Index: 3951, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.5886 +Index: 3952, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.6708 +Index: 3953, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.7377 +Index: 3954, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.806 +Index: 3955, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.8512 +Index: 4037, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.122 +Index: 4038, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.138 +Index: 4039, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.147 +Index: 4040, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.156 +Index: 4041, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.162 +Index: 4042, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.167 +Index: 4043, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.173 +Index: 4044, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.18 +Index: 4045, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.191 +Index: 4046, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.195 +Index: 4231, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1253 +Index: 4232, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1449 +Index: 4233, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1719 +Index: 4234, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1947 +Index: 4235, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2333 +Index: 4236, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2718 +Index: 4237, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2978 +Index: 4305, SMILES: O=c1ccc2ccccc2o1, Value: 0.1221 +Index: 4306, SMILES: O=c1ccc2ccccc2o1, Value: 0.1989 +Index: 4307, SMILES: O=c1ccc2ccccc2o1, Value: 0.3198 +Index: 4308, SMILES: O=c1ccc2ccccc2o1, Value: 0.4836 +Index: 4384, SMILES: O=C1C=CC(=O)O1, Value: 0.13199 +Index: 4385, SMILES: O=C1C=CC(=O)O1, Value: 0.15877 +Index: 4411, SMILES: C/C=C/C(=O)O, Value: 0.1633 +Index: 4412, SMILES: C/C=C/C(=O)O, Value: 0.1928 +Index: 4413, SMILES: C/C=C/C(=O)O, Value: 0.2221 +Index: 4414, SMILES: C/C=C/C(=O)O, Value: 0.2619 +Index: 4415, SMILES: C/C=C/C(=O)O, Value: 0.2973 +Index: 4416, SMILES: C/C=C/C(=O)O, Value: 0.3323 +Index: 4603, SMILES: CSCCC(NC(C)=O)C(=O)O, Value: 0.13455 +Index: 4604, SMILES: CSCCC(NC(C)=O)C(=O)O, Value: 0.18418 +Index: 4656, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1215 +Index: 4657, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.146 +Index: 4658, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2014 +Index: 4659, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2598 +Index: 4660, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3245 +Index: 4661, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3947 +Index: 4734, SMILES: c1cnc2[nH]ccc2c1, Value: 0.1522 +Index: 4735, SMILES: c1cnc2[nH]ccc2c1, Value: 0.1721 +Index: 4736, SMILES: c1cnc2[nH]ccc2c1, Value: 0.1911 +Index: 4737, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2109 +Index: 4738, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2321 +Index: 4739, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2521 +Index: 4740, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2752 +Index: 4741, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2994 +Index: 4742, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3262 +Index: 4743, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3564 +Index: 4760, SMILES: Nc1cccc(Cl)c1C(=O)O, Value: 0.1194 +Index: 4761, SMILES: Nc1cccc(Cl)c1C(=O)O, Value: 0.1408 +Index: 4796, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1255 +Index: 4797, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1455 +Index: 4819, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.13251 +Index: 4820, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.17241 +Index: 4821, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.215472 +Index: 4843, SMILES: O=C(N[C@H](C(=O)O)c1ccccc1)OCc1ccccc1, Value: 0.141382 +Index: 4870, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1238 +Index: 4871, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1399 +Index: 4881, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2099 +Index: 4882, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.215 +Index: 4883, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2213 +Index: 4884, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.227 +Index: 4885, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2325 +Index: 4886, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2396 +Index: 4887, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2462 +Index: 4888, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2531 +Index: 4889, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2597 +Index: 4954, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.1564 +Index: 4955, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.21854 +Index: 4956, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.27762 +Index: 4964, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1391 +Index: 4965, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1666 +Index: 4966, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1988 +Index: 4967, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2344 +Index: 4968, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2753 +Index: 4969, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3245 +Index: 4970, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3896 +Index: 4999, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.1229 +Index: 5011, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.128 +Index: 5012, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1477 +Index: 5013, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1697 +Index: 5014, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1956 +Index: 5015, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.2225 +Index: 5016, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.2541 +Index: 5077, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.12051 +Index: 5081, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.12321 +Index: 5082, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.15202 +Index: 5083, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.18294 +Index: 5084, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.21908 +Index: 5085, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.2571 +Index: 5086, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.29721 +Index: 5087, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.33694 +Index: 5088, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.38902 +Index: 5098, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1235 +Index: 5099, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1701 +Index: 5100, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2382 +Index: 5101, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3291 +Index: 5102, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4806 +Index: 5103, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6247 +Index: 5283, SMILES: O=P(O)(O)c1ccccc1, Value: 0.2882 +Index: 5284, SMILES: O=P(O)(O)c1ccccc1, Value: 0.29536 +Index: 5285, SMILES: O=P(O)(O)c1ccccc1, Value: 0.30543 +Index: 5286, SMILES: O=P(O)(O)c1ccccc1, Value: 0.31395 +Index: 5287, SMILES: O=P(O)(O)c1ccccc1, Value: 0.32613 +Index: 5288, SMILES: O=P(O)(O)c1ccccc1, Value: 0.33411 +Index: 5289, SMILES: O=P(O)(O)c1ccccc1, Value: 0.34676 +Index: 5290, SMILES: O=P(O)(O)c1ccccc1, Value: 0.35696 +Index: 5291, SMILES: O=P(O)(O)c1ccccc1, Value: 0.37054 +Index: 5292, SMILES: O=P(O)(O)c1ccccc1, Value: 0.38253 +Index: 5293, SMILES: O=P(O)(O)c1ccccc1, Value: 0.39381 +Index: 5294, SMILES: O=P(O)(O)c1ccccc1, Value: 0.4071 +Index: 5309, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1279 +Index: 5310, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1729 +Index: 5311, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2318 +Index: 5312, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.3063 +Index: 5484, SMILES: NC(=O)c1ccccc1N, Value: 0.1168 +Index: 5485, SMILES: NC(=O)c1ccccc1N, Value: 0.1432 +Index: 5503, SMILES: Cc1c(C(=O)O)cc([N+](=O)[O-])cc1[N+](=O)[O-], Value: 0.12261 +Index: 5504, SMILES: Cc1c(C(=O)O)cc([N+](=O)[O-])cc1[N+](=O)[O-], Value: 0.1342 +Index: 5597, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1161 +Index: 5598, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1197 +Index: 5599, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1246 +Index: 5600, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.133 +Index: 5601, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1369 +Index: 5602, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1447 +Index: 5603, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1513 +Index: 5604, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1591 +Index: 5605, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1703 +Index: 5606, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1858 +Index: 5607, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3631 +Index: 5608, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3687 +Index: 5609, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3844 +Index: 5610, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3859 +Index: 5611, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3943 +Index: 5612, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4001 +Index: 5613, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4062 +Index: 5614, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4194 +Index: 5615, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4231 +Index: 5616, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.442 +Index: 5617, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4427 +Index: 5618, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4561 +Index: 5619, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4876 +Index: 5620, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4988 +Index: 5621, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.5138 +Index: 5622, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.3655 +Index: 5623, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.3958 +Index: 5624, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.4123 +Index: 5625, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.4509 +Index: 5626, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.5084 +Index: 5627, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.5376 +Index: 5628, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.5876 +Index: 5629, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6304 +Index: 5630, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6992 +Index: 5768, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.12844 +Index: 5769, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.1616 +Index: 5770, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.1864 +Index: 5771, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.21625 +Index: 5772, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.2553 +Index: 5841, SMILES: CC[C@@H](C(N)=O)N1CCCC1=O, Value: 0.1197 +Index: 5842, SMILES: CC[C@@H](C(N)=O)N1CCCC1=O, Value: 0.1383 +Index: 5919, SMILES: N#Cc1cccnc1, Value: 0.201 +Index: 5920, SMILES: N#Cc1cccnc1, Value: 0.339 +Index: 5921, SMILES: N#Cc1cccnc1, Value: 0.491 +Index: 5922, SMILES: N#Cc1cccnc1, Value: 0.627 +Index: 5928, SMILES: N#Cc1ccncc1, Value: 0.136 +Index: 5929, SMILES: N#Cc1ccncc1, Value: 0.273 +Index: 5988, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.22095 +Index: 5989, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.23441 +Index: 5990, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.24541 +Index: 5991, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.25768 +Index: 5992, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.27253 +Index: 5993, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.28595 +Index: 5994, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.29377 +Index: 5995, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.30576 +Index: 5996, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.31762 +Index: 6048, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1215 +Index: 6049, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1399 +Index: 6050, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1583 +Index: 6051, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1765 +Index: 6052, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1943 +Index: 6053, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.2115 +Index: 6063, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.118 +Index: 6064, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.134 +Index: 6065, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.15 +Index: 6159, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1389 +Index: 6160, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2082 +Index: 6161, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2899 +Index: 6162, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3909 +Index: 6163, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.5733 +Index: 6182, SMILES: OC/C=C/c1ccccc1, Value: 0.22 +Index: 6183, SMILES: OC/C=C/c1ccccc1, Value: 0.256 +Index: 6184, SMILES: OC/C=C/c1ccccc1, Value: 0.298 +Index: 6185, SMILES: OC/C=C/c1ccccc1, Value: 0.342 +Index: 6186, SMILES: OC/C=C/c1ccccc1, Value: 0.404 +Index: 6187, SMILES: OC/C=C/c1ccccc1, Value: 0.456 +Index: 6188, SMILES: OC/C=C/c1ccccc1, Value: 0.52 +Index: 6189, SMILES: OC/C=C/c1ccccc1, Value: 0.59 +Index: 6190, SMILES: OC/C=C/c1ccccc1, Value: 0.652 +Index: 6248, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1157 +Index: 6249, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1405 +Index: 6250, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1797 +Index: 6251, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.2156 +Index: 6305, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1179 +Index: 6306, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1361 +Index: 6307, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.166 +Index: 6308, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.2 +Index: 6356, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1149 +Index: 6357, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1349 +Index: 6358, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1599 +Index: 6359, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.191 +Index: 6360, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2208 +Index: 6361, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2512 +Index: 6362, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2887 +Index: 6363, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.3275 +Index: 6393, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1249 +Index: 6394, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1469 +Index: 6395, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1733 +Index: 6469, SMILES: O=Cc1ccc2ccccc2c1, Value: 0.1906 +Index: 6470, SMILES: O=Cc1ccc2ccccc2c1, Value: 0.3138 +Index: 6496, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.1502 +Index: 6497, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.1979 +Index: 6498, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.2674 +Index: 6514, SMILES: Cc1ccc2ccccc2c1, Value: 0.1476 +Index: 6515, SMILES: Cc1ccc2ccccc2c1, Value: 0.2874 +Index: 6516, SMILES: Cc1ccc2ccccc2c1, Value: 0.4581 +Index: 6542, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.4042 +Index: 6543, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.4627 +Index: 6544, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.5062 +Index: 6545, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.5525 +Index: 6546, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.611 +Index: 6547, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.667 +Index: 6548, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.694 +Index: 6554, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.15383 +Index: 6555, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.26004 +Index: 6632, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1186 +Index: 6633, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1508 +Index: 6634, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1938 +Index: 6635, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2436 +Index: 6636, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3053 +Index: 6637, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3857 +Index: 6638, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4825 +Index: 6721, SMILES: O=C(O)c1ccco1, Value: 0.1522 +Index: 6722, SMILES: O=C(O)c1ccco1, Value: 0.1623 +Index: 6723, SMILES: O=C(O)c1ccco1, Value: 0.176 +Index: 6724, SMILES: O=C(O)c1ccco1, Value: 0.1982 +Index: 6725, SMILES: O=C(O)c1ccco1, Value: 0.2081 +Index: 6726, SMILES: O=C(O)c1ccco1, Value: 0.2251 +Index: 6727, SMILES: O=C(O)c1ccco1, Value: 0.2496 +Index: 6728, SMILES: O=C(O)c1ccco1, Value: 0.268 +Index: 6729, SMILES: O=C(O)c1ccco1, Value: 0.2903 +Index: 6730, SMILES: O=C(O)c1ccco1, Value: 0.3113 +Index: 6772, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.11633 +Index: 6773, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.11975 +Index: 6774, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.13495 +Index: 6775, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.14766 +Index: 6776, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.15445 +Index: 6777, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.16517 +Index: 6788, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1192 +Index: 6898, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.1147 +Index: 6899, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.1611 +Index: 6900, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.2578 +Index: 6901, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.337 +Index: 6952, SMILES: C=C1CC[C@H](O)C/C1=C/C=C1\CCC[C@@]2(C)[C@H]1CC[C@@H]2[C@H](C)CCCC(C)C, Value: 0.1157 +Index: 6953, SMILES: C=C1CC[C@H](O)C/C1=C/C=C1\CCC[C@@]2(C)[C@H]1CC[C@@H]2[C@H](C)CCCC(C)C, Value: 0.1399 +Index: 6976, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1341 +Index: 6977, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1971 +Index: 6978, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.2831 +Index: 6979, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.3341 +Index: 6986, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1445 +Index: 6987, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.2074 +Index: 6988, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.2923 +Index: 6989, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.4087 +Index: 6990, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.5479 +Index: 6993, SMILES: Cl.Nc1ccccc1, Value: 0.115 +Index: 6994, SMILES: Cl.Nc1ccccc1, Value: 0.134 +Index: 6995, SMILES: Cl.Nc1ccccc1, Value: 0.155 +Index: 7082, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.1841 +Index: 7083, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.1961 +Index: 7084, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2132 +Index: 7085, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2328 +Index: 7086, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2492 +Index: 7087, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.258 +Index: 7088, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2678 +Index: 7089, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2775 +Index: 7116, SMILES: O=[PH](O)c1ccccc1, Value: 0.1357 +Index: 7117, SMILES: O=[PH](O)c1ccccc1, Value: 0.1675 +Index: 7118, SMILES: O=[PH](O)c1ccccc1, Value: 0.2046 +Index: 7119, SMILES: O=[PH](O)c1ccccc1, Value: 0.2454 +Index: 7120, SMILES: O=[PH](O)c1ccccc1, Value: 0.2969 +Index: 7121, SMILES: O=[PH](O)c1ccccc1, Value: 0.3559 +Index: 7122, SMILES: O=[PH](O)c1ccccc1, Value: 0.4198 +Index: 7123, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2055 +Index: 7124, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2658 +Index: 7125, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3325 +Index: 7126, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3901 +Index: 7127, SMILES: CP(=O)(O)c1ccccc1, Value: 0.4861 +Index: 7128, SMILES: CP(=O)(O)c1ccccc1, Value: 0.6142 +Index: 7129, SMILES: CP(=O)(O)c1ccccc1, Value: 0.7336 +Index: 7130, SMILES: CP(=O)(O)c1ccccc1, Value: 0.8716 +Index: 7136, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1464 +Index: 7137, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1943 +Index: 7138, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.3163 +Index: 7147, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1242 +Index: 7148, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1287 +Index: 7149, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1391 +Index: 7150, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1404 +Index: 7151, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1541 +Index: 7152, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1622 +Index: 7153, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1691 +Index: 7184, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2462 +Index: 7185, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2588 +Index: 7186, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2708 +Index: 7187, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2826 +Index: 7188, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2895 +Index: 7189, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2962 +Index: 7190, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3027 +Index: 7191, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3091 +Index: 7192, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3149 +Index: 7193, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3201 +Index: 7194, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3253 +Index: 7195, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3297 +Index: 7196, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3341 +Index: 7197, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3369 +Index: 7198, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3407 +Index: 7199, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3458 +Index: 7200, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3492 +Index: 7201, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3506 +Index: 7202, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3509 +Index: 7259, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1232 +Index: 7260, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1445 +Index: 7261, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1669 +Index: 7262, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1979 +Index: 7263, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2319 +Index: 7264, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2698 +Index: 7265, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3158 +Index: 7266, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3657 +Index: 7342, SMILES: CN/C(=C\[N+](=O)[O-])NCCSCc1csc(CN(C)C)n1, Value: 0.1793 +Index: 7426, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1254 +Index: 7427, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1411 +Index: 7428, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1577 +Index: 7429, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1208 +Index: 7430, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1309 +Index: 7431, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1444 +Index: 7432, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1506 +Index: 7433, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1581 +Index: 7434, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.172 +Index: 7435, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1867 +Index: 7436, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2022 +Index: 7437, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2065 +Index: 7438, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2192 +Index: 7439, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2352 +Index: 7440, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2485 +Index: 7441, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2673 +Index: 7442, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2805 +Index: 7443, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2938 +Index: 7472, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.158 +Index: 7473, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.181 +Index: 7474, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.199 +Index: 7475, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.228 +Index: 7476, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.252 +Index: 7477, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.278 +Index: 7534, SMILES: Clc1ccc2c(Cl)ccnc2c1, Value: 0.1352752 +Index: 7535, SMILES: Clc1ccc2c(Cl)ccnc2c1, Value: 0.2082549 +Index: 7582, SMILES: O=C(O)c1ccc(Cl)cc1Cl, Value: 0.1179 +Index: 7591, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.11651 +Index: 7592, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.13285 +Index: 7593, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.16443 +Index: 7594, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.1995 +Index: 7595, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.25143 +Index: 7596, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.31532 +Index: 7597, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.38692 +Index: 7598, SMILES: CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3, Value: 0.44177 +Index: 7614, SMILES: CCc1occc(=O)c1O, Value: 0.1329 +Index: 7615, SMILES: CCc1occc(=O)c1O, Value: 0.1739 +Index: 7616, SMILES: CCc1occc(=O)c1O, Value: 0.2272 +Index: 7617, SMILES: CCc1occc(=O)c1O, Value: 0.2907 +Index: 7618, SMILES: CCc1occc(=O)c1O, Value: 0.3669 +Index: 7619, SMILES: CCc1occc(=O)c1O, Value: 0.4594 +Index: 7626, SMILES: N#C[S-].[NH4+], Value: 0.1175 +Index: 7627, SMILES: N#C[S-].[NH4+], Value: 0.125 +Index: 7628, SMILES: N#C[S-].[NH4+], Value: 0.1318 +Index: 7629, SMILES: N#C[S-].[NH4+], Value: 0.1431 +Index: 7630, SMILES: N#C[S-].[NH4+], Value: 0.148 +Index: 7631, SMILES: N#C[S-].[NH4+], Value: 0.1578 +Index: 7632, SMILES: N#C[S-].[NH4+], Value: 0.1689 +Index: 7633, SMILES: N#C[S-].[NH4+], Value: 0.182 +Index: 7634, SMILES: N#C[S-].[NH4+], Value: 0.191 +Index: 7635, SMILES: N#C[S-].[NH4+], Value: 0.202 +Index: 7646, SMILES: Nc1ccccn1, Value: 0.4955 +Index: 7647, SMILES: Nc1ccccn1, Value: 0.541 +Index: 7648, SMILES: Nc1ccccn1, Value: 0.5929 +Index: 7649, SMILES: Nc1ccccn1, Value: 0.6506 +Index: 7650, SMILES: Nc1ccccn1, Value: 0.7133 +Index: 7651, SMILES: Nc1ccccn1, Value: 0.7783 +Index: 7652, SMILES: Nc1ccccn1, Value: 0.8445 +Index: 7663, SMILES: c1ccc2ccccc2c1, Value: 0.1162 +Index: 7664, SMILES: c1ccc2ccccc2c1, Value: 0.1285 +Index: 7665, SMILES: c1ccc2ccccc2c1, Value: 0.1395 +Index: 7666, SMILES: c1ccc2ccccc2c1, Value: 0.1539 +Index: 7667, SMILES: c1ccc2ccccc2c1, Value: 0.1742 +Index: 7668, SMILES: c1ccc2ccccc2c1, Value: 0.2036 +Index: 7669, SMILES: c1ccc2ccccc2c1, Value: 0.2382 +Index: 7670, SMILES: c1ccc2ccccc2c1, Value: 0.2935 +Index: 7671, SMILES: c1ccc2ccccc2c1, Value: 0.3815 +Index: 7695, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.1272 +Index: 7696, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.2893 +Index: 7697, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.715 +Index: 7707, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.121 +Index: 7708, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.1425 +Index: 7709, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.1642 +Index: 7710, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.2053 +Index: 7711, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.2513 +Index: 7712, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.3241 +Index: 7713, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.395 +Index: 7733, SMILES: O=C(O)c1ccccc1O, Value: 0.145 +Index: 7754, SMILES: O=C(Oc1ccccc1)Oc1ccccc1, Value: 0.1205 +Index: 7755, SMILES: O=C(Oc1ccccc1)Oc1ccccc1, Value: 0.2349 +Index: 7804, SMILES: C1CN2CCN1CC2, Value: 0.27 +Index: 7805, SMILES: C1CN2CCN1CC2, Value: 0.318 +Index: 7806, SMILES: C1CN2CCN1CC2, Value: 0.352 +Index: 7807, SMILES: C1CN2CCN1CC2, Value: 0.385 +Index: 7808, SMILES: C1CN2CCN1CC2, Value: 0.433 +Index: 7809, SMILES: C1CN2CCN1CC2, Value: 0.482 +Index: 7810, SMILES: C1CN2CCN1CC2, Value: 0.543 +Index: 7811, SMILES: C1CN2CCN1CC2, Value: 0.609 +Index: 7812, SMILES: C1CN2CCN1CC2, Value: 0.294 +Index: 7813, SMILES: C1CN2CCN1CC2, Value: 0.337 +Index: 7814, SMILES: C1CN2CCN1CC2, Value: 0.372 +Index: 7815, SMILES: C1CN2CCN1CC2, Value: 0.408 +Index: 7816, SMILES: C1CN2CCN1CC2, Value: 0.451 +Index: 7817, SMILES: C1CN2CCN1CC2, Value: 0.509 +Index: 7818, SMILES: C1CN2CCN1CC2, Value: 0.571 +Index: 7924, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1241 +Index: 7925, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1546 +Index: 7948, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.133 +Index: 7949, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.152 +Index: 7950, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.17 +Index: 7951, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.187 +Index: 7952, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.204 +Index: 7967, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.1644 +Index: 7968, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.2895 +Index: 7970, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.2141 +Index: 7971, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.3539 +Index: 7972, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.1227 +Index: 7973, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.2556 +Index: 7974, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.3876 +Index: 8030, SMILES: O=C(O)Cn1cnnn1, Value: 0.1291 +Index: 8031, SMILES: O=C(O)Cn1cnnn1, Value: 0.1565 +Index: 8032, SMILES: O=C(O)Cn1cnnn1, Value: 0.1893 +Index: 8033, SMILES: O=C(O)Cn1cnnn1, Value: 0.2291 +Index: 8038, SMILES: Nc1cccc(N)n1, Value: 0.12261 +Index: 8039, SMILES: Nc1cccc(N)n1, Value: 0.14793 +Index: 8040, SMILES: Nc1cccc(N)n1, Value: 0.16553 +Index: 8041, SMILES: Nc1cccc(N)n1, Value: 0.18231 +Index: 8042, SMILES: Nc1cccc(N)n1, Value: 0.20355 +Index: 8043, SMILES: Nc1cccc(N)n1, Value: 0.22557 +Index: 8044, SMILES: Nc1cccc(N)n1, Value: 0.23644 +Index: 8045, SMILES: Nc1cccc(N)n1, Value: 0.26611 +Index: 8046, SMILES: Nc1cccc(N)n1, Value: 0.28172 +Index: 8047, SMILES: Nc1cccc(N)n1, Value: 0.31865 +Index: 8048, SMILES: Nc1cccc(N)n1, Value: 0.34208 +Index: 8115, SMILES: c1nc[nH]n1, Value: 0.1314 +Index: 8116, SMILES: c1nc[nH]n1, Value: 0.1471 +Index: 8117, SMILES: c1nc[nH]n1, Value: 0.1643 +Index: 8118, SMILES: c1nc[nH]n1, Value: 0.1836 +Index: 8119, SMILES: c1nc[nH]n1, Value: 0.2047 +Index: 8120, SMILES: c1nc[nH]n1, Value: 0.2278 +Index: 8121, SMILES: c1nc[nH]n1, Value: 0.2531 +Index: 8122, SMILES: c1nc[nH]n1, Value: 0.2799 +Index: 8123, SMILES: c1nc[nH]n1, Value: 0.3084 +Index: 8124, SMILES: c1nc[nH]n1, Value: 0.3389 +Index: 8125, SMILES: c1nc[nH]n1, Value: 0.3709 +Index: 8175, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1238 +Index: 8176, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1399 +Index: 8177, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.1557 +Index: 8178, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.1711 +Index: 8179, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.1872 +Index: 8180, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.2033 +Index: 8181, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.2188 +Index: 8182, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.2392 +Index: 8183, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.2585 +Index: 8184, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.2769 +Index: 8185, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.2943 +Index: 8186, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.3123 +Index: 8195, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.1229 +Index: 8196, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.1364 +Index: 8417, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.1222651 +Index: 8418, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.1413479 +Index: 8538, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.1406 +Index: 8539, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.1858 +Index: 8540, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.2623 +Index: 8541, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.3633 +Index: 8542, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.4763 +Index: 8543, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.6205 +Index: 8544, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.8311 +Index: 8658, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.141 +Index: 8659, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.183 +Index: 8660, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.224 +Index: 8661, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.283 +Index: 8662, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.34 +Index: 8708, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.1282 +Index: 8709, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.1457 +Index: 8710, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.1645 +Index: 8711, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.1843 +Index: 8712, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.2071 +Index: 8713, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.2351 +Index: 8714, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.2638 +Index: 8715, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.2947 +Index: 8716, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.3321 +Index: 8717, SMILES: Nc1cc(Cl)cc(Cl)c1, Value: 0.3767 +Index: 8764, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1519 +Index: 8765, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1558 +Index: 8766, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1618 +Index: 8767, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1687 +Index: 8768, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1768 +Index: 8769, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1856 +Index: 8801, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1173 +Index: 8802, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1414 +Index: 8803, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1671 +Index: 8804, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1918 +Index: 8805, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2232 +Index: 8806, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.255 +Index: 8807, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2918 +Index: 8817, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.30786 +Index: 8818, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.29401 +Index: 8819, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.27259 +Index: 8820, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.25448 +Index: 8821, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.23629 +Index: 8822, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.22246 +Index: 8823, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.21169 +Index: 8824, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.19778 +Index: 8825, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.18831 +Index: 8826, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.1794 +Index: 8964, SMILES: COc1cccc(C=O)c1O, Value: 0.1376 +Index: 8965, SMILES: COc1cccc(C=O)c1O, Value: 0.226 +Index: 8966, SMILES: COc1cccc(C=O)c1O, Value: 0.3797 +Index: 8967, SMILES: COc1cccc(C=O)c1O, Value: 0.6146 +Index: 9071, SMILES: Brc1cn[nH]c1, Value: 0.2646 +Index: 9072, SMILES: Brc1cn[nH]c1, Value: 0.2754 +Index: 9073, SMILES: Brc1cn[nH]c1, Value: 0.2875 +Index: 9074, SMILES: Brc1cn[nH]c1, Value: 0.2992 +Index: 9075, SMILES: Brc1cn[nH]c1, Value: 0.3109 +Index: 9076, SMILES: Brc1cn[nH]c1, Value: 0.3249 +Index: 9077, SMILES: Brc1cn[nH]c1, Value: 0.3388 +Index: 9078, SMILES: Brc1cn[nH]c1, Value: 0.3538 +Index: 9079, SMILES: Brc1cn[nH]c1, Value: 0.3716 +Index: 9080, SMILES: Brc1cn[nH]c1, Value: 0.3895 +Index: 9081, SMILES: Brc1cn[nH]c1, Value: 0.4088 +Index: 9082, SMILES: Brc1cn[nH]c1, Value: 0.4315 +Index: 9083, SMILES: Brc1cn[nH]c1, Value: 0.4568 +Index: 9084, SMILES: Brc1cn[nH]c1, Value: 0.4815 +Index: 9085, SMILES: Brc1cn[nH]c1, Value: 0.5063 +Index: 9116, SMILES: Cc1cc(C)[nH]n1, Value: 0.1201 +Index: 9117, SMILES: Cc1cc(C)[nH]n1, Value: 0.1265 +Index: 9118, SMILES: Cc1cc(C)[nH]n1, Value: 0.1334 +Index: 9119, SMILES: Cc1cc(C)[nH]n1, Value: 0.1402 +Index: 9120, SMILES: Cc1cc(C)[nH]n1, Value: 0.1478 +Index: 9121, SMILES: Cc1cc(C)[nH]n1, Value: 0.1551 +Index: 9122, SMILES: Cc1cc(C)[nH]n1, Value: 0.1626 +Index: 9123, SMILES: Cc1cc(C)[nH]n1, Value: 0.1705 +Index: 9124, SMILES: Cc1cc(C)[nH]n1, Value: 0.1787 +Index: 9125, SMILES: Cc1cc(C)[nH]n1, Value: 0.1869 +Index: 9126, SMILES: Cc1cc(C)[nH]n1, Value: 0.1957 +Index: 9127, SMILES: Cc1cc(C)[nH]n1, Value: 0.2054 +Index: 9128, SMILES: Cc1cc(C)[nH]n1, Value: 0.2172 +Index: 9159, SMILES: CC(C)c1ncc[nH]1, Value: 0.1886 +Index: 9160, SMILES: CC(C)c1ncc[nH]1, Value: 0.1958 +Index: 9161, SMILES: CC(C)c1ncc[nH]1, Value: 0.2025 +Index: 9162, SMILES: CC(C)c1ncc[nH]1, Value: 0.2101 +Index: 9163, SMILES: CC(C)c1ncc[nH]1, Value: 0.2164 +Index: 9164, SMILES: CC(C)c1ncc[nH]1, Value: 0.226 +Index: 9165, SMILES: CC(C)c1ncc[nH]1, Value: 0.2346 +Index: 9166, SMILES: CC(C)c1ncc[nH]1, Value: 0.2433 +Index: 9167, SMILES: CC(C)c1ncc[nH]1, Value: 0.2528 +Index: 9168, SMILES: CC(C)c1ncc[nH]1, Value: 0.2625 +Index: 9169, SMILES: CC(C)c1ncc[nH]1, Value: 0.2726 +Index: 9170, SMILES: CC(C)c1ncc[nH]1, Value: 0.282 +Index: 9171, SMILES: CC(C)c1ncc[nH]1, Value: 0.2937 +Index: 9172, SMILES: CC(C)c1ncc[nH]1, Value: 0.304 +Index: 9173, SMILES: CC(C)c1ncc[nH]1, Value: 0.3146 +Index: 9177, SMILES: COc1cc(CO)ccc1O, Value: 0.142 +Index: 9178, SMILES: COc1cc(CO)ccc1O, Value: 0.205 +Index: 9179, SMILES: COc1cc(CO)ccc1O, Value: 0.317 +Index: 9279, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1254 +Index: 9280, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1408 +Index: 9281, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1608 +Index: 9282, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1834 +Index: 9401, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.4339 +Index: 9402, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.4726 +Index: 9403, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.5083 +Index: 9404, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.5574 +Index: 9405, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.6361 +Index: 9406, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.6898 +Index: 9407, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.7568 +Index: 9408, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.8503 +Index: 9500, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.1204 +Index: 9501, SMILES: CN(C)CCOC(c1ccccc1)c1ccccc1.Cl, Value: 0.1373 +Index: 9553, SMILES: C/C=C/C=C/C(=O)O, Value: 0.12071 +Index: 9554, SMILES: C/C=C/C=C/C(=O)O, Value: 0.14325 +Index: 9642, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1331 +Index: 9643, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1585 +Index: 9644, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1844 +Index: 9645, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2151 +Index: 9646, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2492 +Index: 9647, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.287 +Index: 9740, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1298 +Index: 9741, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1542 +Index: 9742, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1843 +Index: 9743, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2178 +Index: 9744, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2658 +Index: 9753, SMILES: CCCCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](O)[C@H]2O)cc1F, Value: 0.1271 +Index: 9754, SMILES: CCCCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](O)[C@H]2O)cc1F, Value: 0.166 +Index: 9843, SMILES: O=c1ccc2ccccc2o1, Value: 0.1378 +Index: 9844, SMILES: O=c1ccc2ccccc2o1, Value: 0.2216 +Index: 9845, SMILES: O=c1ccc2ccccc2o1, Value: 0.3568 +Index: 9846, SMILES: CP(=O)(O)O, Value: 0.4127 +Index: 9847, SMILES: CP(=O)(O)O, Value: 0.4443 +Index: 9848, SMILES: CP(=O)(O)O, Value: 0.4778 +Index: 9849, SMILES: CP(=O)(O)O, Value: 0.5085 +Index: 9850, SMILES: CP(=O)(O)O, Value: 0.5409 +Index: 9851, SMILES: CP(=O)(O)O, Value: 0.5754 +Index: 9852, SMILES: CP(=O)(O)O, Value: 0.605 +Index: 9897, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.12 +Index: 9898, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.136 +Index: 9899, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.148 +Index: 9900, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.165 +Index: 9901, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.184 +Index: 9902, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.207 +Index: 9903, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.227 +Index: 9951, SMILES: C/C=C/C(=O)O, Value: 0.2229 +Index: 9952, SMILES: C/C=C/C(=O)O, Value: 0.2525 +Index: 9953, SMILES: C/C=C/C(=O)O, Value: 0.288 +Index: 9954, SMILES: C/C=C/C(=O)O, Value: 0.319 +Index: 9955, SMILES: C/C=C/C(=O)O, Value: 0.37 +Index: 9956, SMILES: C/C=C/C(=O)O, Value: 0.4034 +Index: 9969, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2482 +Index: 9970, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.27 +Index: 9971, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2806 +Index: 10083, SMILES: CN(C)CCC=C1c2ccccc2CCc2ccccc21.Cl, Value: 0.1157029 +Index: 10084, SMILES: CN(C)CCC=C1c2ccccc2CCc2ccccc21.Cl, Value: 0.1303625 +Index: 10126, SMILES: CSCCC(NC(C)=O)C(=O)O, Value: 0.11503 +Index: 10127, SMILES: CSCCC(NC(C)=O)C(=O)O, Value: 0.15049 +Index: 10180, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1292 +Index: 10181, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1748 +Index: 10182, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2338 +Index: 10183, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3024 +Index: 10184, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.389 +Index: 10217, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.12984 +Index: 10218, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.15994 +Index: 10219, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.20437 +Index: 10220, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.2592 +Index: 10221, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.3276 +Index: 10250, SMILES: c1cnc2[nH]ccc2c1, Value: 0.1902 +Index: 10251, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2021 +Index: 10252, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2153 +Index: 10253, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2333 +Index: 10254, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2528 +Index: 10255, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2724 +Index: 10256, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2912 +Index: 10257, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3122 +Index: 10258, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3326 +Index: 10259, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3592 +Index: 10313, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1162 +Index: 10314, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1309 +Index: 10336, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.131652 +Index: 10337, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.15988 +Index: 10338, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.189564 +Index: 10400, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1756 +Index: 10401, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1805 +Index: 10402, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1877 +Index: 10403, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1947 +Index: 10404, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2004 +Index: 10405, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2068 +Index: 10406, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2137 +Index: 10407, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2196 +Index: 10408, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2254 +Index: 10463, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.13963 +Index: 10464, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.19475 +Index: 10465, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.26731 +Index: 10466, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.33394 +Index: 10469, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1381 +Index: 10470, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1682 +Index: 10471, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1977 +Index: 10472, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2303 +Index: 10473, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2773 +Index: 10474, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3326 +Index: 10475, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3903 +Index: 10511, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1245 +Index: 10512, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1447 +Index: 10513, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1678 +Index: 10514, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1928 +Index: 10565, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.13415 +Index: 10566, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.14532 +Index: 10567, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.15826 +Index: 10568, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.17159 +Index: 10569, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.18611 +Index: 10570, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.20131 +Index: 10571, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.21724 +Index: 10572, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.23442 +Index: 10573, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.25321 +Index: 10574, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.27264 +Index: 10575, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.29364 +Index: 10585, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1249 +Index: 10586, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1734 +Index: 10587, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2498 +Index: 10588, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3517 +Index: 10589, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4696 +Index: 10590, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6108 +Index: 10748, SMILES: O=P(O)(O)c1ccccc1, Value: 0.23611 +Index: 10749, SMILES: O=P(O)(O)c1ccccc1, Value: 0.24837 +Index: 10750, SMILES: O=P(O)(O)c1ccccc1, Value: 0.26222 +Index: 10751, SMILES: O=P(O)(O)c1ccccc1, Value: 0.27101 +Index: 10752, SMILES: O=P(O)(O)c1ccccc1, Value: 0.28587 +Index: 10753, SMILES: O=P(O)(O)c1ccccc1, Value: 0.29625 +Index: 10754, SMILES: O=P(O)(O)c1ccccc1, Value: 0.31074 +Index: 10755, SMILES: O=P(O)(O)c1ccccc1, Value: 0.32078 +Index: 10756, SMILES: O=P(O)(O)c1ccccc1, Value: 0.33199 +Index: 10757, SMILES: O=P(O)(O)c1ccccc1, Value: 0.34671 +Index: 10758, SMILES: O=P(O)(O)c1ccccc1, Value: 0.36081 +Index: 10759, SMILES: O=P(O)(O)c1ccccc1, Value: 0.37518 +Index: 10774, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1265 +Index: 10775, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1698 +Index: 10776, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2243 +Index: 10777, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2917 +Index: 11084, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1211 +Index: 11085, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1421 +Index: 11086, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1659 +Index: 11157, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.13787 +Index: 11158, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.15812 +Index: 11159, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.18534 +Index: 11160, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.21261 +Index: 11161, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.24466 +Index: 11162, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.29971 +Index: 11163, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.34745 +Index: 11280, SMILES: N#Cc1cccnc1, Value: 0.214 +Index: 11281, SMILES: N#Cc1cccnc1, Value: 0.348 +Index: 11282, SMILES: N#Cc1cccnc1, Value: 0.5 +Index: 11283, SMILES: N#Cc1cccnc1, Value: 0.643 +Index: 11288, SMILES: N#Cc1ccncc1, Value: 0.129 +Index: 11289, SMILES: N#Cc1ccncc1, Value: 0.19 +Index: 11290, SMILES: N#Cc1ccncc1, Value: 0.298 +Index: 11402, SMILES: Cc1cc(C)nc(Nc2ccccc2)n1, Value: 0.1313 +Index: 11431, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1599 +Index: 11432, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1838 +Index: 11433, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2098 +Index: 11434, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2373 +Index: 11435, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2682 +Index: 11436, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2993 +Index: 11437, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3323 +Index: 11438, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3682 +Index: 11439, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4049 +Index: 11440, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4464 +Index: 11464, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.123 +Index: 11465, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1639 +Index: 11466, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2186 +Index: 11467, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3132 +Index: 11468, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.4194 +Index: 11469, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.5376 +Index: 11470, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.7076 +Index: 11480, SMILES: OC/C=C/c1ccccc1, Value: 0.174 +Index: 11481, SMILES: OC/C=C/c1ccccc1, Value: 0.213 +Index: 11482, SMILES: OC/C=C/c1ccccc1, Value: 0.266 +Index: 11483, SMILES: OC/C=C/c1ccccc1, Value: 0.313 +Index: 11484, SMILES: OC/C=C/c1ccccc1, Value: 0.373 +Index: 11485, SMILES: OC/C=C/c1ccccc1, Value: 0.433 +Index: 11486, SMILES: OC/C=C/c1ccccc1, Value: 0.496 +Index: 11487, SMILES: OC/C=C/c1ccccc1, Value: 0.567 +Index: 11488, SMILES: OC/C=C/c1ccccc1, Value: 0.634 +Index: 11530, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1173 +Index: 11531, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1417 +Index: 11532, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1653 +Index: 11578, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1332 +Index: 11579, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1673 +Index: 11580, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1976 +Index: 11618, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1215 +Index: 11619, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1482 +Index: 11620, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1794 +Index: 11621, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2108 +Index: 11622, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2451 +Index: 11623, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2843 +Index: 11624, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.3259 +Index: 11648, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1164 +Index: 11649, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1386 +Index: 11650, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1624 +Index: 11674, SMILES: O=C(O)c1ccccc1, Value: 0.1186 +Index: 11675, SMILES: O=C(O)c1ccccc1, Value: 0.1327 +Index: 11676, SMILES: O=C(O)c1ccccc1, Value: 0.1478 +Index: 11677, SMILES: O=C(O)c1ccccc1, Value: 0.1641 +Index: 11678, SMILES: O=C(O)c1ccccc1, Value: 0.1816 +Index: 11679, SMILES: O=C(O)c1ccccc1, Value: 0.2003 +Index: 11680, SMILES: O=C(O)c1ccccc1, Value: 0.2205 +Index: 11681, SMILES: O=C(O)c1ccccc1, Value: 0.2423 +Index: 11682, SMILES: O=C(O)c1ccccc1, Value: 0.2657 +Index: 11683, SMILES: O=C(O)c1ccccc1, Value: 0.291 +Index: 11694, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.1208 +Index: 11709, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1216 +Index: 11710, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1379 +Index: 11711, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1576 +Index: 11739, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1352 +Index: 11740, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1685 +Index: 11741, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2103 +Index: 11742, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2611 +Index: 11743, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3189 +Index: 11744, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3992 +Index: 11745, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4882 +Index: 11755, SMILES: O=C(O)c1ccco1, Value: 0.1384 +Index: 11756, SMILES: O=C(O)c1ccco1, Value: 0.1577 +Index: 11757, SMILES: O=C(O)c1ccco1, Value: 0.1762 +Index: 11758, SMILES: O=C(O)c1ccco1, Value: 0.1946 +Index: 11759, SMILES: O=C(O)c1ccco1, Value: 0.2082 +Index: 11760, SMILES: O=C(O)c1ccco1, Value: 0.2259 +Index: 11761, SMILES: O=C(O)c1ccco1, Value: 0.2436 +Index: 11762, SMILES: O=C(O)c1ccco1, Value: 0.2583 +Index: 11763, SMILES: O=C(O)c1ccco1, Value: 0.2725 +Index: 11764, SMILES: O=C(O)c1ccco1, Value: 0.2997 +Index: 11773, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1152 +Index: 11774, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1388 +Index: 11775, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.173 +Index: 11801, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.11483 +Index: 11802, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.12751 +Index: 11803, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.13794 +Index: 11804, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.15092 +Index: 11805, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.1616 +Index: 11806, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.17621 +Index: 11807, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.17963 +Index: 11855, SMILES: O=C(O)c1ccccc1O, Value: 0.132 +Index: 11856, SMILES: O=C(O)c1ccccc1O, Value: 0.15 +Index: 11857, SMILES: O=C(O)c1ccccc1O, Value: 0.163 +Index: 11858, SMILES: O=C(O)c1ccccc1O, Value: 0.179 +Index: 11859, SMILES: O=C(O)c1ccccc1O, Value: 0.195 +Index: 11893, SMILES: C=C1CC[C@H](O)C/C1=C/C=C1\CCC[C@@]2(C)[C@H]1CC[C@@H]2[C@H](C)CCCC(C)C, Value: 0.1363 +Index: 11894, SMILES: C=C1CC[C@H](O)C/C1=C/C=C1\CCC[C@@]2(C)[C@H]1CC[C@@H]2[C@H](C)CCCC(C)C, Value: 0.1631 +Index: 11895, SMILES: C=C1CC[C@H](O)C/C1=C/C=C1\CCC[C@@]2(C)[C@H]1CC[C@@H]2[C@H](C)CCCC(C)C, Value: 0.1933 +Index: 11958, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1161 +Index: 11959, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1288 +Index: 11960, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.138 +Index: 11961, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1452 +Index: 11962, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1581 +Index: 11963, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1642 +Index: 11964, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1724 +Index: 12038, SMILES: COC(=O)/C=C/C(=O)OC, Value: 0.1361 +Index: 12039, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1279 +Index: 12040, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1522 +Index: 12041, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1774 +Index: 12042, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2484 +Index: 12043, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2887 +Index: 12044, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3386 +Index: 12045, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3992 +Index: 12103, SMILES: O=C(O)CCC(=O)O, Value: 0.12944 +Index: 12123, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1298 +Index: 12124, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1533 +Index: 12125, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.192 +Index: 12126, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2254 +Index: 12127, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2747 +Index: 12128, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3175 +Index: 12129, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3527 +Index: 12130, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4057 +Index: 12131, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4403 +Index: 12132, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5088 +Index: 12133, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5406 +Index: 12134, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5969 +Index: 12135, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.6444 +Index: 12136, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.6903 +Index: 12137, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.7491 +Index: 12138, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.8178 +Index: 12139, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.873 +Index: 12169, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.118 +Index: 12170, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1333 +Index: 12171, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1425 +Index: 12172, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1548 +Index: 12176, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.152 +Index: 12177, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.3298 +Index: 12178, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.718 +Index: 12206, SMILES: O=C(Oc1ccccc1)Oc1ccccc1, Value: 0.1648 +Index: 12259, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.1677 +Index: 12260, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.3443 +Index: 12262, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.223 +Index: 12263, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.3867 +Index: 12264, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.1208 +Index: 12265, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.2791 +Index: 12284, SMILES: O=C(O)Cn1cnnn1, Value: 0.1354 +Index: 12300, SMILES: c1nc[nH]n1, Value: 0.1205 +Index: 12301, SMILES: c1nc[nH]n1, Value: 0.1345 +Index: 12302, SMILES: c1nc[nH]n1, Value: 0.1504 +Index: 12303, SMILES: c1nc[nH]n1, Value: 0.1675 +Index: 12304, SMILES: c1nc[nH]n1, Value: 0.1867 +Index: 12305, SMILES: c1nc[nH]n1, Value: 0.2078 +Index: 12306, SMILES: c1nc[nH]n1, Value: 0.231 +Index: 12307, SMILES: c1nc[nH]n1, Value: 0.2557 +Index: 12308, SMILES: c1nc[nH]n1, Value: 0.283 +Index: 12309, SMILES: c1nc[nH]n1, Value: 0.3127 +Index: 12310, SMILES: c1nc[nH]n1, Value: 0.3437 +Index: 12311, SMILES: c1nc[nH]n1, Value: 0.378 +Index: 12312, SMILES: c1nc[nH]n1, Value: 0.4149 +Index: 12318, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.125 +Index: 12319, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.1368 +Index: 12320, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.1482 +Index: 12321, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.1594 +Index: 12322, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.1693 +Index: 12400, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.1181909 +Index: 12550, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1309 +Index: 12551, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1524 +Index: 12552, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1792 +Index: 12553, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2068 +Index: 12554, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2363 +Index: 12555, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.33266 +Index: 12556, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.31155 +Index: 12557, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.28694 +Index: 12558, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.26719 +Index: 12559, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.24877 +Index: 12560, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.23039 +Index: 12561, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.21524 +Index: 12562, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.20198 +Index: 12563, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.18915 +Index: 12564, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.17925 +Index: 12703, SMILES: COc1cccc(C=O)c1O, Value: 0.1337 +Index: 12704, SMILES: COc1cccc(C=O)c1O, Value: 0.2988 +Index: 12705, SMILES: COc1cccc(C=O)c1O, Value: 0.5545 +Index: 12825, SMILES: Cc1cc(C)[nH]n1, Value: 0.1231 +Index: 12826, SMILES: Cc1cc(C)[nH]n1, Value: 0.13 +Index: 12827, SMILES: Cc1cc(C)[nH]n1, Value: 0.1365 +Index: 12828, SMILES: Cc1cc(C)[nH]n1, Value: 0.1447 +Index: 12829, SMILES: Cc1cc(C)[nH]n1, Value: 0.1521 +Index: 12830, SMILES: Cc1cc(C)[nH]n1, Value: 0.1596 +Index: 12831, SMILES: Cc1cc(C)[nH]n1, Value: 0.1672 +Index: 12832, SMILES: Cc1cc(C)[nH]n1, Value: 0.1753 +Index: 12833, SMILES: Cc1cc(C)[nH]n1, Value: 0.1842 +Index: 12834, SMILES: Cc1cc(C)[nH]n1, Value: 0.194 +Index: 12835, SMILES: Cc1cc(C)[nH]n1, Value: 0.2034 +Index: 12836, SMILES: Cc1cc(C)[nH]n1, Value: 0.2132 +Index: 12837, SMILES: Cc1cc(C)[nH]n1, Value: 0.2259 +Index: 12872, SMILES: CC(C)c1ncc[nH]1, Value: 0.1172 +Index: 12873, SMILES: CC(C)c1ncc[nH]1, Value: 0.1212 +Index: 12874, SMILES: CC(C)c1ncc[nH]1, Value: 0.1264 +Index: 12875, SMILES: CC(C)c1ncc[nH]1, Value: 0.1329 +Index: 12876, SMILES: CC(C)c1ncc[nH]1, Value: 0.1389 +Index: 12877, SMILES: CC(C)c1ncc[nH]1, Value: 0.1459 +Index: 12878, SMILES: CC(C)c1ncc[nH]1, Value: 0.1531 +Index: 12879, SMILES: CC(C)c1ncc[nH]1, Value: 0.1594 +Index: 12880, SMILES: CC(C)c1ncc[nH]1, Value: 0.1663 +Index: 12881, SMILES: CC(C)c1ncc[nH]1, Value: 0.1733 +Index: 12882, SMILES: CC(C)c1ncc[nH]1, Value: 0.1803 +Index: 12970, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1199 +Index: 13097, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.3427 +Index: 13098, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.4183 +Index: 13099, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.4575 +Index: 13100, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.5051 +Index: 13101, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.5577 +Index: 13102, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.6557 +Index: 13103, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.7061 +Index: 13104, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.8068 +Index: 13235, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1171 +Index: 13236, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1392 +Index: 13237, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1653 +Index: 13238, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1899 +Index: 13239, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2195 +Index: 13240, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2536 +Index: 13241, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2905 +Index: 13295, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1179 +Index: 13296, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1394 +Index: 13297, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1681 +Index: 13298, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1956 +Index: 13299, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2262 +Index: 13300, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2624 +Index: 13342, SMILES: O=c1ccc2ccccc2o1, Value: 0.1241 +Index: 13343, SMILES: O=c1ccc2ccccc2o1, Value: 0.2021 +Index: 13344, SMILES: O=c1ccc2ccccc2o1, Value: 0.3302 +Index: 13345, SMILES: CP(=O)(O)O, Value: 0.4031 +Index: 13346, SMILES: CP(=O)(O)O, Value: 0.4259 +Index: 13347, SMILES: CP(=O)(O)O, Value: 0.4533 +Index: 13348, SMILES: CP(=O)(O)O, Value: 0.4792 +Index: 13349, SMILES: CP(=O)(O)O, Value: 0.5085 +Index: 13350, SMILES: CP(=O)(O)O, Value: 0.5304 +Index: 13351, SMILES: CP(=O)(O)O, Value: 0.5647 +Index: 13396, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2743 +Index: 13397, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2794 +Index: 13398, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2859 +Index: 13573, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.1669 +Index: 13574, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.1725 +Index: 13575, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.1835 +Index: 13576, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.199 +Index: 13577, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2181 +Index: 13578, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2373 +Index: 13579, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2563 +Index: 13580, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2752 +Index: 13581, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2948 +Index: 13582, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.3155 +Index: 13583, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.3377 +Index: 13603, SMILES: CSCCC(NC(C)=O)C(=O)O, Value: 0.12734 +Index: 13647, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1185 +Index: 13648, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1654 +Index: 13649, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2202 +Index: 13650, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2863 +Index: 13651, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3648 +Index: 13802, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.125638 +Index: 13803, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.149333 +Index: 13804, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.177573 +Index: 13866, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.12 +Index: 13867, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.136 +Index: 13868, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1488 +Index: 13869, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1631 +Index: 13870, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.181 +Index: 13922, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.13311 +Index: 13923, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.19857 +Index: 13942, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1337 +Index: 13943, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1579 +Index: 13944, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1835 +Index: 13945, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2084 +Index: 13946, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2362 +Index: 13947, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2638 +Index: 13948, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2947 +Index: 13949, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3302 +Index: 13950, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3696 +Index: 13986, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1165 +Index: 13987, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.135 +Index: 13988, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.156 +Index: 13989, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1781 +Index: 14035, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.125 +Index: 14036, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.15303 +Index: 14037, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.18601 +Index: 14038, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.22503 +Index: 14039, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.27 +Index: 14040, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.31901 +Index: 14041, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.36103 +Index: 14051, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1234 +Index: 14052, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1805 +Index: 14053, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2505 +Index: 14054, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3295 +Index: 14055, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4863 +Index: 14056, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6303 +Index: 14200, SMILES: O=P(O)(O)c1ccccc1, Value: 0.19259 +Index: 14201, SMILES: O=P(O)(O)c1ccccc1, Value: 0.20402 +Index: 14202, SMILES: O=P(O)(O)c1ccccc1, Value: 0.21954 +Index: 14203, SMILES: O=P(O)(O)c1ccccc1, Value: 0.23168 +Index: 14204, SMILES: O=P(O)(O)c1ccccc1, Value: 0.24774 +Index: 14205, SMILES: O=P(O)(O)c1ccccc1, Value: 0.26001 +Index: 14206, SMILES: O=P(O)(O)c1ccccc1, Value: 0.27323 +Index: 14207, SMILES: O=P(O)(O)c1ccccc1, Value: 0.28987 +Index: 14208, SMILES: O=P(O)(O)c1ccccc1, Value: 0.3042 +Index: 14209, SMILES: O=P(O)(O)c1ccccc1, Value: 0.3206 +Index: 14210, SMILES: O=P(O)(O)c1ccccc1, Value: 0.33664 +Index: 14211, SMILES: O=P(O)(O)c1ccccc1, Value: 0.35427 +Index: 14596, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.12621 +Index: 14597, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.15206 +Index: 14598, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.17481 +Index: 14599, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.20544 +Index: 14600, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.23543 +Index: 14601, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.2618 +Index: 14602, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.3018 +Index: 14603, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.35143 +Index: 14702, SMILES: N#Cc1cccnc1, Value: 0.164 +Index: 14703, SMILES: N#Cc1cccnc1, Value: 0.275 +Index: 14704, SMILES: N#Cc1cccnc1, Value: 0.427 +Index: 14705, SMILES: N#Cc1cccnc1, Value: 0.577 +Index: 14711, SMILES: N#Cc1ccncc1, Value: 0.151 +Index: 14712, SMILES: N#Cc1ccncc1, Value: 0.284 +Index: 14741, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.30617 +Index: 14742, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.29042 +Index: 14743, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.27494 +Index: 14744, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.25975 +Index: 14745, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.24488 +Index: 14746, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.2302 +Index: 14747, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.21608 +Index: 14748, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.2022 +Index: 14749, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.18871 +Index: 14798, SMILES: Cc1cc(C)nc(Nc2ccccc2)n1, Value: 0.1449 +Index: 14799, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1416 +Index: 14800, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1642 +Index: 14801, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1899 +Index: 14802, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2175 +Index: 14803, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2474 +Index: 14804, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2803 +Index: 14805, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3143 +Index: 14806, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3488 +Index: 14807, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3872 +Index: 14808, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4249 +Index: 14838, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1313 +Index: 14839, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1587 +Index: 14840, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1913 +Index: 14841, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2359 +Index: 14842, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2846 +Index: 14843, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3538 +Index: 14844, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.4327 +Index: 14845, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.5768 +Index: 14846, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.7657 +Index: 14865, SMILES: OC/C=C/c1ccccc1, Value: 0.125 +Index: 14866, SMILES: OC/C=C/c1ccccc1, Value: 0.162 +Index: 14867, SMILES: OC/C=C/c1ccccc1, Value: 0.214 +Index: 14868, SMILES: OC/C=C/c1ccccc1, Value: 0.269 +Index: 14869, SMILES: OC/C=C/c1ccccc1, Value: 0.342 +Index: 14870, SMILES: OC/C=C/c1ccccc1, Value: 0.412 +Index: 14871, SMILES: OC/C=C/c1ccccc1, Value: 0.479 +Index: 14872, SMILES: OC/C=C/c1ccccc1, Value: 0.553 +Index: 14873, SMILES: OC/C=C/c1ccccc1, Value: 0.608 +Index: 14898, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1255 +Index: 14899, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1523 +Index: 14926, SMILES: CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1, Value: 0.1155 +Index: 14953, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1153 +Index: 14954, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1354 +Index: 14955, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.158 +Index: 14956, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.192 +Index: 14978, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.318233 +Index: 14979, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.348024 +Index: 14980, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.38667 +Index: 14981, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.41096 +Index: 14982, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.444008 +Index: 14983, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.48914 +Index: 14984, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.528106 +Index: 14985, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.586047 +Index: 14986, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.648253 +Index: 14993, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1181 +Index: 14994, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.146 +Index: 14995, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1763 +Index: 14996, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2072 +Index: 14997, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2408 +Index: 14998, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2815 +Index: 14999, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.3233 +Index: 15024, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1258 +Index: 15025, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1541 +Index: 15051, SMILES: O=C(O)c1ccccc1, Value: 0.1158 +Index: 15052, SMILES: O=C(O)c1ccccc1, Value: 0.1295 +Index: 15053, SMILES: O=C(O)c1ccccc1, Value: 0.1596 +Index: 15054, SMILES: O=C(O)c1ccccc1, Value: 0.176 +Index: 15055, SMILES: O=C(O)c1ccccc1, Value: 0.1936 +Index: 15056, SMILES: O=C(O)c1ccccc1, Value: 0.2337 +Index: 15057, SMILES: O=C(O)c1ccccc1, Value: 0.2558 +Index: 15058, SMILES: O=C(O)c1ccccc1, Value: 0.2794 +Index: 15059, SMILES: O=C(O)c1ccccc1, Value: 0.3056 +Index: 15081, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1221 +Index: 15082, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1355 +Index: 15083, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1499 +Index: 15084, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1655 +Index: 15085, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1855 +Index: 15086, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2072 +Index: 15087, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2334 +Index: 15108, SMILES: O=Cc1ccc2ccccc2c1, Value: 0.1169 +Index: 15109, SMILES: O=Cc1ccc2ccccc2c1, Value: 0.164 +Index: 15149, SMILES: C=C1C[C@]23C[C@H]1CC[C@H]2[C@@]12CC[C@H](O)[C@@](C)(C(=O)O1)[C@H]2[C@@H]3C(=O)O, Value: 0.119046 +Index: 15152, SMILES: Cc1ccc2ccccc2c1, Value: 0.1304 +Index: 15153, SMILES: Cc1ccc2ccccc2c1, Value: 0.2233 +Index: 15154, SMILES: Cc1ccc2ccccc2c1, Value: 0.3705 +Index: 15155, SMILES: Cc1ccc2ccccc2c1, Value: 0.6799 +Index: 15203, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.123 +Index: 15204, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1509 +Index: 15205, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1882 +Index: 15206, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2293 +Index: 15207, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2833 +Index: 15208, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3377 +Index: 15209, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4179 +Index: 15210, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5101 +Index: 15235, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1178 +Index: 15236, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1357 +Index: 15273, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.12473 +Index: 15274, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.14014 +Index: 15275, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.14253 +Index: 15276, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.15983 +Index: 15277, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.17375 +Index: 15278, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.19011 +Index: 15370, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1664 +Index: 15371, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.2301 +Index: 15372, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.3638 +Index: 15373, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.5141 +Index: 15380, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1261 +Index: 15381, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1622 +Index: 15382, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.2362 +Index: 15383, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.3108 +Index: 15384, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.3998 +Index: 15430, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1223 +Index: 15431, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1323 +Index: 15432, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1424 +Index: 15433, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1534 +Index: 15434, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1651 +Index: 15435, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1773 +Index: 15436, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1908 +Index: 15437, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.221 +Index: 15438, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2538 +Index: 15439, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.283 +Index: 15440, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3126 +Index: 15470, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1394 +Index: 15471, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1562 +Index: 15472, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1912 +Index: 15473, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2251 +Index: 15474, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2652 +Index: 15475, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3114 +Index: 15476, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3607 +Index: 15477, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.4155 +Index: 15514, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1152 +Index: 15515, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.239 +Index: 15516, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.263 +Index: 15517, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.282 +Index: 15518, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.302 +Index: 15519, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.321 +Index: 15520, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.349 +Index: 15551, SMILES: c1ccc2ccccc2c1, Value: 0.1195 +Index: 15552, SMILES: c1ccc2ccccc2c1, Value: 0.1388 +Index: 15553, SMILES: c1ccc2ccccc2c1, Value: 0.159 +Index: 15554, SMILES: c1ccc2ccccc2c1, Value: 0.1828 +Index: 15555, SMILES: c1ccc2ccccc2c1, Value: 0.2046 +Index: 15556, SMILES: c1ccc2ccccc2c1, Value: 0.2279 +Index: 15557, SMILES: c1ccc2ccccc2c1, Value: 0.2524 +Index: 15558, SMILES: c1ccc2ccccc2c1, Value: 0.2937 +Index: 15559, SMILES: c1ccc2ccccc2c1, Value: 0.3326 +Index: 15560, SMILES: c1ccc2ccccc2c1, Value: 0.3749 +Index: 15561, SMILES: c1ccc2ccccc2c1, Value: 0.4363 +Index: 15562, SMILES: c1ccc2ccccc2c1, Value: 0.4766 +Index: 15563, SMILES: c1ccc2ccccc2c1, Value: 0.5265 +Index: 15564, SMILES: c1ccc2ccccc2c1, Value: 0.5674 +Index: 15565, SMILES: c1ccc2ccccc2c1, Value: 0.6197 +Index: 15566, SMILES: c1ccc2ccccc2c1, Value: 0.6605 +Index: 15570, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.1817 +Index: 15571, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.3404 +Index: 15572, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.7495 +Index: 15592, SMILES: O=C(Oc1ccccc1)Oc1ccccc1, Value: 0.1889 +Index: 15593, SMILES: O=C(Oc1ccccc1)Oc1ccccc1, Value: 0.3642 +Index: 15632, SMILES: C1CN2CCN1CC2, Value: 0.373 +Index: 15633, SMILES: C1CN2CCN1CC2, Value: 0.409 +Index: 15634, SMILES: C1CN2CCN1CC2, Value: 0.454 +Index: 15635, SMILES: C1CN2CCN1CC2, Value: 0.495 +Index: 15636, SMILES: C1CN2CCN1CC2, Value: 0.548 +Index: 15637, SMILES: C1CN2CCN1CC2, Value: 0.622 +Index: 15638, SMILES: C1CN2CCN1CC2, Value: 0.673 +Index: 15639, SMILES: C1CN2CCN1CC2, Value: 0.707 +Index: 15640, SMILES: C1CN2CCN1CC2, Value: 0.393 +Index: 15641, SMILES: C1CN2CCN1CC2, Value: 0.431 +Index: 15642, SMILES: C1CN2CCN1CC2, Value: 0.474 +Index: 15643, SMILES: C1CN2CCN1CC2, Value: 0.526 +Index: 15644, SMILES: C1CN2CCN1CC2, Value: 0.587 +Index: 15645, SMILES: C1CN2CCN1CC2, Value: 0.653 +Index: 15646, SMILES: C1CN2CCN1CC2, Value: 0.69 +Index: 15702, SMILES: CCOc1ccc(NC(C)=O)cc1, Value: 0.11991 +Index: 15764, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.1184 +Index: 15765, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.1401 +Index: 15766, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.1835 +Index: 15767, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.2285 +Index: 15768, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.2838 +Index: 15769, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.3453 +Index: 15770, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.4215 +Index: 15771, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.5102 +Index: 15803, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1272 +Index: 15804, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.146 +Index: 15805, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1701 +Index: 15806, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1982 +Index: 15807, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2305 +Index: 15808, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2701 +Index: 15809, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.33667 +Index: 15810, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.31296 +Index: 15811, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.28776 +Index: 15812, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.26842 +Index: 15813, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.254 +Index: 15814, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.23568 +Index: 15815, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.22061 +Index: 15816, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.20744 +Index: 15817, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.19673 +Index: 15818, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.18463 +Index: 15951, SMILES: Cc1cc(C)[nH]n1, Value: 0.1333 +Index: 15952, SMILES: Cc1cc(C)[nH]n1, Value: 0.14 +Index: 15953, SMILES: Cc1cc(C)[nH]n1, Value: 0.1488 +Index: 15954, SMILES: Cc1cc(C)[nH]n1, Value: 0.1576 +Index: 15955, SMILES: Cc1cc(C)[nH]n1, Value: 0.1664 +Index: 15956, SMILES: Cc1cc(C)[nH]n1, Value: 0.1763 +Index: 15957, SMILES: Cc1cc(C)[nH]n1, Value: 0.1869 +Index: 15958, SMILES: Cc1cc(C)[nH]n1, Value: 0.1989 +Index: 15959, SMILES: Cc1cc(C)[nH]n1, Value: 0.2114 +Index: 15960, SMILES: Cc1cc(C)[nH]n1, Value: 0.2236 +Index: 15961, SMILES: Cc1cc(C)[nH]n1, Value: 0.237 +Index: 15962, SMILES: Cc1cc(C)[nH]n1, Value: 0.2512 +Index: 15963, SMILES: Cc1cc(C)[nH]n1, Value: 0.2654 +Index: 15983, SMILES: COc1cc(CO)ccc1O, Value: 0.134 +Index: 15984, SMILES: COc1cc(CO)ccc1O, Value: 0.182 +Index: 16070, SMILES: CC(C)C(=O)OCC(=O)[C@@]12O[C@H](C3CCCCC3)O[C@@H]1C[C@H]1[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]12C, Value: 0.118 +Index: 16071, SMILES: CC(C)C(=O)OCC(=O)[C@@]12O[C@H](C3CCCCC3)O[C@@H]1C[C@H]1[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]12C, Value: 0.124 +Index: 16072, SMILES: CC(C)C(=O)OCC(=O)[C@@]12O[C@H](C3CCCCC3)O[C@@H]1C[C@H]1[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]12C, Value: 0.131 +Index: 16145, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.3295 +Index: 16146, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.3907 +Index: 16147, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.4433 +Index: 16148, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.4987 +Index: 16149, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.5471 +Index: 16150, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.6133 +Index: 16151, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.6761 +Index: 16152, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.7908 +Index: 16253, SMILES: C/C=C/C=C/C(=O)O, Value: 0.12066 +Index: 16254, SMILES: C/C=C/C=C/C(=O)O, Value: 0.13536 +Index: 16255, SMILES: C/C=C/C=C/C(=O)O, Value: 0.154 +Index: 16256, SMILES: C/C=C/C=C/C(=O)O, Value: 0.17338 +Index: 16326, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1321 +Index: 16327, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.156 +Index: 16328, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1805 +Index: 16329, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2093 +Index: 16330, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2432 +Index: 16331, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2824 +Index: 16390, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1156 +Index: 16391, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.139 +Index: 16392, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1621 +Index: 16393, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2002 +Index: 16394, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.236 +Index: 16395, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2706 +Index: 16455, SMILES: C/C=C/C(=O)O, Value: 0.2058 +Index: 16456, SMILES: C/C=C/C(=O)O, Value: 0.2342 +Index: 16457, SMILES: C/C=C/C(=O)O, Value: 0.2684 +Index: 16458, SMILES: C/C=C/C(=O)O, Value: 0.3031 +Index: 16459, SMILES: C/C=C/C(=O)O, Value: 0.346 +Index: 16460, SMILES: C/C=C/C(=O)O, Value: 0.3773 +Index: 16509, SMILES: O=C(O)c1ccccc1O, Value: 0.122 +Index: 16510, SMILES: O=C(O)c1ccccc1O, Value: 0.1379 +Index: 16511, SMILES: O=C(O)c1ccccc1O, Value: 0.143 +Index: 16607, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1339 +Index: 16608, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1639 +Index: 16609, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2112 +Index: 16610, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2774 +Index: 16611, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3417 +Index: 16612, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.4066 +Index: 16613, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.4747 +Index: 16634, SMILES: O=C(O)c1cccc(O)c1O, Value: 0.116 +Index: 16635, SMILES: O=C(O)c1cccc(O)c1O, Value: 0.121 +Index: 16636, SMILES: O=C(O)c1cccc(O)c1O, Value: 0.1272 +Index: 16641, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.13297 +Index: 16642, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.15439 +Index: 16643, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.17663 +Index: 16644, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.19966 +Index: 16645, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.22463 +Index: 16646, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.25187 +Index: 16666, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2619 +Index: 16667, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2822 +Index: 16668, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3012 +Index: 16669, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3222 +Index: 16670, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3407 +Index: 16671, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3613 +Index: 16672, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3831 +Index: 16673, SMILES: c1cnc2[nH]ccc2c1, Value: 0.4019 +Index: 16674, SMILES: c1cnc2[nH]ccc2c1, Value: 0.4233 +Index: 16675, SMILES: c1cnc2[nH]ccc2c1, Value: 0.4427 +Index: 16742, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.129106 +Index: 16765, SMILES: O=C(N[C@H](C(=O)O)c1ccccc1)OCc1ccccc1, Value: 0.128976 +Index: 16766, SMILES: O=C(N[C@H](C(=O)O)c1ccccc1)OCc1ccccc1, Value: 0.159198 +Index: 16784, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2929 +Index: 16785, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.3007 +Index: 16786, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.3112 +Index: 16787, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.3207 +Index: 16808, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.122376 +Index: 16809, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.145776 +Index: 16810, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.172912 +Index: 16811, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.199762 +Index: 16839, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2264 +Index: 16840, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2426 +Index: 16841, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2643 +Index: 16842, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2878 +Index: 16843, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3089 +Index: 16844, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3386 +Index: 16845, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.365 +Index: 16846, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3959 +Index: 16847, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.4298 +Index: 16867, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.23445 +Index: 16868, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.2603 +Index: 16869, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.32147 +Index: 16870, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.38368 +Index: 16871, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.43948 +Index: 16872, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.53603 +Index: 16873, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.64536 +Index: 16915, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.9006 +Index: 16916, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.872 +Index: 16917, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.8229 +Index: 16918, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.7998 +Index: 16919, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.7369 +Index: 16920, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.6948 +Index: 16921, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.6389 +Index: 16922, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.6114 +Index: 16923, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.5332 +Index: 16924, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4674 +Index: 16925, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4109 +Index: 16926, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.372 +Index: 16927, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3385 +Index: 16928, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.314 +Index: 16929, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.2805 +Index: 16930, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.2183 +Index: 16931, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.2039 +Index: 16932, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1898 +Index: 16933, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1711 +Index: 16934, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1604 +Index: 16935, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.149 +Index: 16936, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.139 +Index: 16937, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1324 +Index: 16938, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.127 +Index: 16940, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.14152 +Index: 16941, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.18751 +Index: 16942, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.24362 +Index: 16943, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.29709 +Index: 16944, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.37266 +Index: 16945, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.44931 +Index: 16946, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.53089 +Index: 16947, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.60287 +Index: 16948, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.67627 +Index: 16949, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.74043 +Index: 16953, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1356 +Index: 16954, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1706 +Index: 16955, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2007 +Index: 16956, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2762 +Index: 16957, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3078 +Index: 16958, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3519 +Index: 16959, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3945 +Index: 16960, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4536 +Index: 16961, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5239 +Index: 16962, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5906 +Index: 16963, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6568 +Index: 16964, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.734 +Index: 17055, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1243 +Index: 17056, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1342 +Index: 17057, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1459 +Index: 17058, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1582 +Index: 17072, SMILES: O=P(O)(O)c1ccccc1, Value: 0.12965 +Index: 17073, SMILES: O=P(O)(O)c1ccccc1, Value: 0.14392 +Index: 17074, SMILES: O=P(O)(O)c1ccccc1, Value: 0.16157 +Index: 17075, SMILES: O=P(O)(O)c1ccccc1, Value: 0.17815 +Index: 17076, SMILES: O=P(O)(O)c1ccccc1, Value: 0.20114 +Index: 17077, SMILES: O=P(O)(O)c1ccccc1, Value: 0.22305 +Index: 17078, SMILES: O=P(O)(O)c1ccccc1, Value: 0.24931 +Index: 17088, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1574 +Index: 17089, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1843 +Index: 17090, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2187 +Index: 17091, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2594 +Index: 17092, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.3038 +Index: 17093, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.3536 +Index: 17094, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.4103 +Index: 17095, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.4738 +Index: 17096, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.5438 +Index: 17145, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1248 +Index: 17146, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1437 +Index: 17147, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1637 +Index: 17148, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1899 +Index: 17149, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2225 +Index: 17150, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2626 +Index: 17151, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.3063 +Index: 17152, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.3561 +Index: 17160, SMILES: O=C1Cc2ccccc2N1, Value: 0.1223 +Index: 17161, SMILES: O=C1Cc2ccccc2N1, Value: 0.1267 +Index: 17220, SMILES: NC(=O)c1ccccc1N, Value: 0.1642 +Index: 17221, SMILES: NC(=O)c1ccccc1N, Value: 0.1814 +Index: 17222, SMILES: NC(=O)c1ccccc1N, Value: 0.1934 +Index: 17223, SMILES: NC(=O)c1ccccc1N, Value: 0.2078 +Index: 17224, SMILES: NC(=O)c1ccccc1N, Value: 0.2227 +Index: 17225, SMILES: NC(=O)c1ccccc1N, Value: 0.243 +Index: 17226, SMILES: NC(=O)c1ccccc1N, Value: 0.2653 +Index: 17227, SMILES: NC(=O)c1ccccc1N, Value: 0.2919 +Index: 17228, SMILES: NC(=O)c1ccccc1N, Value: 0.313 +Index: 17229, SMILES: NC(=O)c1ccccc1N, Value: 0.3408 +Index: 17230, SMILES: NC(=O)c1ccccc1N, Value: 0.3863 +Index: 17241, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.1177 +Index: 17242, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.1379 +Index: 17243, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.162 +Index: 17244, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.1905 +Index: 17245, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.2263 +Index: 17246, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.2637 +Index: 17247, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.303 +Index: 17248, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.3465 +Index: 17260, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1166 +Index: 17261, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1234 +Index: 17262, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1295 +Index: 17263, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1383 +Index: 17264, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1451 +Index: 17265, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1559 +Index: 17266, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1648 +Index: 17267, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1759 +Index: 17268, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1883 +Index: 17269, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.2007 +Index: 17270, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.2171 +Index: 17311, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1296 +Index: 17312, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1472 +Index: 17313, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1709 +Index: 17314, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1935 +Index: 17315, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2265 +Index: 17316, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.259 +Index: 17317, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2951 +Index: 17318, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.3415 +Index: 17319, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.3854 +Index: 17320, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.4385 +Index: 17321, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.5061 +Index: 17324, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1196 +Index: 17325, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1568 +Index: 17326, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.2167 +Index: 17327, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.2696 +Index: 17328, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.3574 +Index: 17329, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3369 +Index: 17330, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3428 +Index: 17331, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3684 +Index: 17332, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3798 +Index: 17333, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3975 +Index: 17334, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4242 +Index: 17335, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4532 +Index: 17336, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4773 +Index: 17337, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.5529 +Index: 17338, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.5707 +Index: 17339, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.594 +Index: 17340, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6138 +Index: 17341, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6266 +Index: 17344, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1225 +Index: 17345, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1332 +Index: 17346, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1444 +Index: 17347, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1561 +Index: 17348, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1682 +Index: 17349, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1818 +Index: 17350, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1969 +Index: 17375, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1206 +Index: 17376, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1317 +Index: 17377, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1429 +Index: 17378, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1544 +Index: 17444, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.1337 +Index: 17450, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.13234 +Index: 17451, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.15632 +Index: 17452, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.18513 +Index: 17453, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.20924 +Index: 17470, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.126 +Index: 17471, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1432 +Index: 17472, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1618 +Index: 17473, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1831 +Index: 17474, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.2064 +Index: 17526, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.127114 +Index: 17527, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.145288 +Index: 17528, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.176061 +Index: 17529, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.208791 +Index: 17530, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.236422 +Index: 17544, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1232 +Index: 17545, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1425 +Index: 17546, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1641 +Index: 17547, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1871 +Index: 17548, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.2133 +Index: 17549, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.2416 +Index: 17550, SMILES: N#Cc1cccnc1, Value: 0.247 +Index: 17551, SMILES: N#Cc1cccnc1, Value: 0.29 +Index: 17552, SMILES: N#Cc1cccnc1, Value: 0.329 +Index: 17553, SMILES: N#Cc1cccnc1, Value: 0.438 +Index: 17554, SMILES: N#Cc1cccnc1, Value: 0.541 +Index: 17555, SMILES: N#Cc1cccnc1, Value: 0.664 +Index: 17556, SMILES: N#Cc1cccnc1, Value: 0.833 +Index: 17557, SMILES: N#Cc1ccncc1, Value: 0.117 +Index: 17558, SMILES: N#Cc1ccncc1, Value: 0.134 +Index: 17559, SMILES: N#Cc1ccncc1, Value: 0.155 +Index: 17560, SMILES: N#Cc1ccncc1, Value: 0.213 +Index: 17561, SMILES: N#Cc1ccncc1, Value: 0.275 +Index: 17562, SMILES: N#Cc1ccncc1, Value: 0.356 +Index: 17563, SMILES: N#Cc1ccncc1, Value: 0.46 +Index: 17658, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.162 +Index: 17659, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.18 +Index: 17660, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.205 +Index: 17661, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.232 +Index: 17662, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.243 +Index: 17663, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.258 +Index: 17664, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.273 +Index: 17665, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.286 +Index: 17666, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.301 +Index: 17667, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.317 +Index: 17668, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.332 +Index: 17669, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.358 +Index: 17693, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.1208 +Index: 17694, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.1462 +Index: 17695, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.1791 +Index: 17696, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.2178 +Index: 17697, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.2637 +Index: 17698, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.3185 +Index: 17699, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.3838 +Index: 17700, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.4575 +Index: 17701, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1338 +Index: 17702, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1576 +Index: 17703, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1849 +Index: 17704, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.2156 +Index: 17705, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.2499 +Index: 17706, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.2872 +Index: 17707, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.3301 +Index: 17708, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.3764 +Index: 17709, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.4283 +Index: 17720, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.209 +Index: 17721, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2247 +Index: 17722, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2418 +Index: 17723, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2613 +Index: 17724, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2805 +Index: 17725, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3031 +Index: 17726, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3261 +Index: 17727, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3518 +Index: 17728, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3803 +Index: 17729, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4117 +Index: 17735, SMILES: Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1, Value: 0.1156 +Index: 17736, SMILES: Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1, Value: 0.1312 +Index: 17737, SMILES: Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1, Value: 0.1475 +Index: 17738, SMILES: Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1, Value: 0.1652 +Index: 17739, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.31 +Index: 17740, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3503 +Index: 17741, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3812 +Index: 17742, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.4271 +Index: 17743, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.4908 +Index: 17744, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.5618 +Index: 17745, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.6686 +Index: 17746, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.7554 +Index: 17747, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.9063 +Index: 17766, SMILES: O=C(O)c1ccccc1O, Value: 0.17501 +Index: 17767, SMILES: O=C(O)c1ccccc1O, Value: 0.19589 +Index: 17768, SMILES: O=C(O)c1ccccc1O, Value: 0.20314 +Index: 17769, SMILES: O=C(O)c1ccccc1O, Value: 0.21814 +Index: 17770, SMILES: O=C(O)c1ccccc1O, Value: 0.23071 +Index: 17771, SMILES: OC/C=C/c1ccccc1, Value: 0.28 +Index: 17772, SMILES: OC/C=C/c1ccccc1, Value: 0.322 +Index: 17773, SMILES: OC/C=C/c1ccccc1, Value: 0.363 +Index: 17774, SMILES: OC/C=C/c1ccccc1, Value: 0.414 +Index: 17775, SMILES: OC/C=C/c1ccccc1, Value: 0.47 +Index: 17776, SMILES: OC/C=C/c1ccccc1, Value: 0.526 +Index: 17777, SMILES: OC/C=C/c1ccccc1, Value: 0.579 +Index: 17778, SMILES: OC/C=C/c1ccccc1, Value: 0.625 +Index: 17779, SMILES: OC/C=C/c1ccccc1, Value: 0.674 +Index: 17807, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.13258 +Index: 17808, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.15325 +Index: 17809, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.17631 +Index: 17810, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.20117 +Index: 17811, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.22616 +Index: 17824, SMILES: CC(=O)Oc1ccc(C2CC(=O)c3c(OC(C)=O)cc(OC(C)=O)cc3O2)cc1, Value: 0.128623 +Index: 17825, SMILES: CC(=O)Oc1ccc(C2CC(=O)c3c(OC(C)=O)cc(OC(C)=O)cc3O2)cc1, Value: 0.165852 +Index: 17826, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1631 +Index: 17827, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1659 +Index: 17828, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1718 +Index: 17829, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1805 +Index: 17830, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1913 +Index: 17831, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.208 +Index: 17917, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1159 +Index: 17918, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1288 +Index: 17919, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1403 +Index: 17920, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1537 +Index: 17921, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1714 +Index: 17922, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1919 +Index: 17923, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2131 +Index: 17971, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.11992 +Index: 17972, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.12339 +Index: 17973, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.1357 +Index: 17974, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.14847 +Index: 17975, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.16064 +Index: 17992, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.12221 +Index: 17993, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.15434 +Index: 17994, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.1983 +Index: 17995, SMILES: Cc1ccc2ccccc2c1, Value: 0.2183 +Index: 17996, SMILES: Cc1ccc2ccccc2c1, Value: 0.2864 +Index: 17997, SMILES: Cc1ccc2ccccc2c1, Value: 0.3678 +Index: 17998, SMILES: Cc1ccc2ccccc2c1, Value: 0.4841 +Index: 17999, SMILES: Cc1ccc2ccccc2c1, Value: 0.5876 +Index: 18000, SMILES: Cc1ccc2ccccc2c1, Value: 0.7413 +Index: 18017, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.12623 +Index: 18018, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.16747 +Index: 18019, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.21937 +Index: 18020, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.2662 +Index: 18021, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.31946 +Index: 18022, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.3578 +Index: 18023, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.3833 +Index: 18024, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.41727 +Index: 18111, SMILES: O=C(O)c1ccco1, Value: 0.1531 +Index: 18112, SMILES: O=C(O)c1ccco1, Value: 0.1591 +Index: 18113, SMILES: O=C(O)c1ccco1, Value: 0.1717 +Index: 18114, SMILES: O=C(O)c1ccco1, Value: 0.1888 +Index: 18115, SMILES: O=C(O)c1ccco1, Value: 0.2059 +Index: 18116, SMILES: O=C(O)c1ccco1, Value: 0.218 +Index: 18117, SMILES: O=C(O)c1ccco1, Value: 0.2371 +Index: 18118, SMILES: O=C(O)c1ccco1, Value: 0.2654 +Index: 18119, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.2259 +Index: 18120, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.2823 +Index: 18121, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.3306 +Index: 18204, SMILES: Clc1ccc(SSc2ccc(Cl)cc2)cc1, Value: 0.145 +Index: 18205, SMILES: Clc1ccc(SSc2ccc(Cl)cc2)cc1, Value: 0.208 +Index: 18213, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.217 +Index: 18214, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.2473 +Index: 18215, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.2645 +Index: 18216, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.283 +Index: 18217, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.3071 +Index: 18218, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.3346 +Index: 18219, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.3602 +Index: 18220, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.3939 +Index: 18221, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.4227 +Index: 18222, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.4552 +Index: 18223, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.4897 +Index: 18224, SMILES: O=C(O)c1ccccc1O, Value: 0.137 +Index: 18225, SMILES: O=C(O)c1ccccc1O, Value: 0.139 +Index: 18226, SMILES: O=C(O)c1ccccc1O, Value: 0.156 +Index: 18227, SMILES: O=C(O)c1ccccc1O, Value: 0.196 +Index: 18251, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.2375 +Index: 18252, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.2643 +Index: 18253, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.3 +Index: 18254, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.3272 +Index: 18255, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.3608 +Index: 18256, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.4074 +Index: 18257, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.4562 +Index: 18258, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.5134 +Index: 18259, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.2543 +Index: 18260, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.3058 +Index: 18261, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.3431 +Index: 18262, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.3808 +Index: 18263, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.4384 +Index: 18264, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.4996 +Index: 18265, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.5513 +Index: 18266, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.6434 +Index: 18288, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.117 +Index: 18289, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.131 +Index: 18290, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.146 +Index: 18291, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.163 +Index: 18292, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.182 +Index: 18293, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.203 +Index: 18294, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.226 +Index: 18295, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.253 +Index: 18296, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.1928 +Index: 18297, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2026 +Index: 18298, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2244 +Index: 18299, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2361 +Index: 18300, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2487 +Index: 18301, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2564 +Index: 18302, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2691 +Index: 18303, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.2874 +Index: 18323, SMILES: O=[PH](O)c1ccccc1, Value: 0.1243 +Index: 18324, SMILES: O=[PH](O)c1ccccc1, Value: 0.1862 +Index: 18325, SMILES: O=[PH](O)c1ccccc1, Value: 0.2559 +Index: 18330, SMILES: CP(=O)(O)c1ccccc1, Value: 0.1268 +Index: 18331, SMILES: CP(=O)(O)c1ccccc1, Value: 0.1649 +Index: 18332, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2041 +Index: 18347, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.1166 +Index: 18370, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1155 +Index: 18371, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1254 +Index: 18372, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1363 +Index: 18373, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1478 +Index: 18374, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1605 +Index: 18375, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.174 +Index: 18376, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1887 +Index: 18377, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2044 +Index: 18378, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2395 +Index: 18379, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.28 +Index: 18380, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3145 +Index: 18381, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.3527 +Index: 18437, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1437 +Index: 18438, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1684 +Index: 18439, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1996 +Index: 18440, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.233 +Index: 18441, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2732 +Index: 18442, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3114 +Index: 18443, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3516 +Index: 18444, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.4051 +Index: 18556, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.3477 +Index: 18557, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.3677 +Index: 18558, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.3861 +Index: 18559, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.4034 +Index: 18560, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.4201 +Index: 18561, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.4358 +Index: 18562, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.4504 +Index: 18563, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.4659 +Index: 18564, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.481 +Index: 18565, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.4923 +Index: 18573, SMILES: C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O, Value: 0.1149 +Index: 18596, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.253 +Index: 18597, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.272 +Index: 18598, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.309 +Index: 18599, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.33 +Index: 18600, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.351 +Index: 18601, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.373 +Index: 18649, SMILES: Nc1ccc(S(N)(=O)=O)cc1, Value: 0.1156 +Index: 18652, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1457 +Index: 18653, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1465 +Index: 18654, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2242 +Index: 18655, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2835 +Index: 18656, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3395 +Index: 18657, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.389 +Index: 18658, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4489 +Index: 18659, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5679 +Index: 18660, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5123 +Index: 18661, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.678 +Index: 18662, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.7349 +Index: 18663, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.795 +Index: 18664, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.8571 +Index: 18665, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.8955 +Index: 18666, SMILES: Nc1cccnc1, Value: 0.1548 +Index: 18667, SMILES: Nc1cccnc1, Value: 0.1937 +Index: 18668, SMILES: Nc1cccnc1, Value: 0.2436 +Index: 18669, SMILES: Nc1cccnc1, Value: 0.3048 +Index: 18670, SMILES: Nc1cccnc1, Value: 0.3798 +Index: 18671, SMILES: Nc1cccnc1, Value: 0.4677 +Index: 18672, SMILES: Nc1cccnc1, Value: 0.5648 +Index: 18673, SMILES: Nc1cccnc1, Value: 0.6684 +Index: 18680, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1669 +Index: 18681, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1824 +Index: 18682, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2022 +Index: 18683, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2184 +Index: 18684, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2344 +Index: 18685, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2612 +Index: 18686, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2915 +Index: 18687, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.3198 +Index: 18688, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.3569 +Index: 18689, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2012 +Index: 18690, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2223 +Index: 18691, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2456 +Index: 18692, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.287 +Index: 18693, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.3155 +Index: 18694, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.369 +Index: 18695, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.4274 +Index: 18696, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.4735 +Index: 18697, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.5219 +Index: 18698, SMILES: N#C[S-].[NH4+], Value: 0.2358 +Index: 18699, SMILES: N#C[S-].[NH4+], Value: 0.2705 +Index: 18700, SMILES: N#C[S-].[NH4+], Value: 0.3008 +Index: 18701, SMILES: N#C[S-].[NH4+], Value: 0.3616 +Index: 18702, SMILES: N#C[S-].[NH4+], Value: 0.4169 +Index: 18703, SMILES: N#C[S-].[NH4+], Value: 0.4895 +Index: 18704, SMILES: N#C[S-].[NH4+], Value: 0.5567 +Index: 18705, SMILES: N#C[S-].[NH4+], Value: 0.6141 +Index: 18706, SMILES: N#C[S-].[NH4+], Value: 0.7006 +Index: 18707, SMILES: N#C[S-].[NH4+], Value: 0.7411 +Index: 18708, SMILES: N#C[S-].[NH4+], Value: 0.8111 +Index: 18719, SMILES: Nc1ccccn1, Value: 0.4205 +Index: 18720, SMILES: Nc1ccccn1, Value: 0.4387 +Index: 18721, SMILES: Nc1ccccn1, Value: 0.4624 +Index: 18722, SMILES: Nc1ccccn1, Value: 0.4839 +Index: 18723, SMILES: Nc1ccccn1, Value: 0.5048 +Index: 18724, SMILES: Nc1ccccn1, Value: 0.5277 +Index: 18725, SMILES: Nc1ccccn1, Value: 0.5501 +Index: 18726, SMILES: Nc1ccccn1, Value: 0.574 +Index: 18727, SMILES: Nc1ccccn1, Value: 0.5981 +Index: 18728, SMILES: Nc1ccccn1, Value: 0.6232 +Index: 18729, SMILES: Nc1ccccn1, Value: 0.6489 +Index: 18730, SMILES: Nc1ccccn1, Value: 0.6761 +Index: 18731, SMILES: Nc1ccccn1, Value: 0.7028 +Index: 18732, SMILES: Nc1ccccn1, Value: 0.7166 +Index: 18733, SMILES: c1ccc2ccccc2c1, Value: 0.2106 +Index: 18734, SMILES: c1ccc2ccccc2c1, Value: 0.2185 +Index: 18735, SMILES: c1ccc2ccccc2c1, Value: 0.2329 +Index: 18736, SMILES: c1ccc2ccccc2c1, Value: 0.246 +Index: 18737, SMILES: c1ccc2ccccc2c1, Value: 0.2589 +Index: 18738, SMILES: c1ccc2ccccc2c1, Value: 0.2724 +Index: 18739, SMILES: c1ccc2ccccc2c1, Value: 0.2846 +Index: 18740, SMILES: c1ccc2ccccc2c1, Value: 0.2972 +Index: 18741, SMILES: c1ccc2ccccc2c1, Value: 0.3101 +Index: 18742, SMILES: c1ccc2ccccc2c1, Value: 0.323 +Index: 18743, SMILES: c1ccc2ccccc2c1, Value: 0.3346 +Index: 18744, SMILES: c1ccc2ccccc2c1, Value: 0.3468 +Index: 18745, SMILES: c1ccc2ccccc2c1, Value: 0.3608 +Index: 18746, SMILES: c1ccc2ccccc2c1, Value: 0.3762 +Index: 18747, SMILES: c1ccc2ccccc2c1, Value: 0.3942 +Index: 18748, SMILES: c1ccc2ccccc2c1, Value: 0.4154 +Index: 18749, SMILES: c1ccc2ccccc2c1, Value: 0.4397 +Index: 18750, SMILES: c1ccc2ccccc2c1, Value: 0.4586 +Index: 18777, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.1649 +Index: 18778, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.2221 +Index: 18779, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.3115 +Index: 18780, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.3768 +Index: 18788, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.1358 +Index: 18789, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.1726 +Index: 18797, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1198 +Index: 18798, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1398 +Index: 18819, SMILES: c1ccc2ccccc2c1, Value: 0.1237 +Index: 18820, SMILES: c1ccc2ccccc2c1, Value: 0.1433 +Index: 18821, SMILES: c1ccc2ccccc2c1, Value: 0.1707 +Index: 18822, SMILES: c1ccc2ccccc2c1, Value: 0.1941 +Index: 18823, SMILES: c1ccc2ccccc2c1, Value: 0.226 +Index: 18824, SMILES: c1ccc2ccccc2c1, Value: 0.2681 +Index: 18825, SMILES: c1ccc2ccccc2c1, Value: 0.3073 +Index: 18826, SMILES: c1ccc2ccccc2c1, Value: 0.3606 +Index: 18827, SMILES: c1ccc2ccccc2c1, Value: 0.4175 +Index: 18828, SMILES: c1ccc2ccccc2c1, Value: 0.4771 +Index: 18930, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.126 +Index: 18931, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1475 +Index: 18954, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.127 +Index: 18955, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.139 +Index: 18956, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.151 +Index: 18957, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.162 +Index: 19010, SMILES: O=C(O)Cn1cnnn1, Value: 0.1148 +Index: 19011, SMILES: O=C(O)Cn1cnnn1, Value: 0.1254 +Index: 19012, SMILES: O=C(O)Cn1cnnn1, Value: 0.1363 +Index: 19013, SMILES: O=C(O)Cn1cnnn1, Value: 0.1486 +Index: 19014, SMILES: O=C(O)Cn1cnnn1, Value: 0.1616 +Index: 19015, SMILES: O=C(O)Cn1cnnn1, Value: 0.1752 +Index: 19047, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.11931 +Index: 19048, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.13105 +Index: 19049, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.14924 +Index: 19050, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.16717 +Index: 19068, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.12 +Index: 19069, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.14 +Index: 19070, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.19 +Index: 19071, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.25 +Index: 19072, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.33 +Index: 19073, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.42 +Index: 19083, SMILES: O=C1OC(=O)C2C3C=CC(O3)C12, Value: 0.12635 +Index: 19100, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.1263608 +Index: 19101, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.1377764 +Index: 19102, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.1565142 +Index: 19153, SMILES: Cc1ccc(NC(=O)C(C)Cl)cc1, Value: 0.13568 +Index: 19154, SMILES: Cc1ccc(NC(=O)C(C)Cl)cc1, Value: 0.15009 +Index: 19155, SMILES: Cc1ccc(NC(=O)C(C)Cl)cc1, Value: 0.15507 +Index: 19156, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.199 +Index: 19157, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.216 +Index: 19158, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.237 +Index: 19159, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.271 +Index: 19160, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.3 +Index: 19161, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.33 +Index: 19162, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.369 +Index: 19163, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.416 +Index: 19164, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.459 +Index: 19176, SMILES: CC(C)OC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1, Value: 0.120461 +Index: 19177, SMILES: CC(C)OC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1, Value: 0.1474556 +Index: 19178, SMILES: CC(C)OC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1, Value: 0.1802957 +Index: 19188, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1162 +Index: 19189, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1269 +Index: 19190, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1374 +Index: 19191, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1498 +Index: 19192, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1626 +Index: 19193, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1758 +Index: 19194, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1906 +Index: 19195, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2051 +Index: 19196, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2219 +Index: 19197, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.47719 +Index: 19198, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.46412 +Index: 19199, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.44944 +Index: 19200, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.43733 +Index: 19201, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.42476 +Index: 19202, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.41438 +Index: 19203, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.40052 +Index: 19204, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.38715 +Index: 19205, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.37935 +Index: 19206, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.37073 +Index: 19265, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1182 +Index: 19266, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.136 +Index: 19267, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1581 +Index: 19268, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1814 +Index: 19269, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2068 +Index: 19270, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2367 +Index: 19271, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2686 +Index: 19272, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3073 +Index: 19273, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3494 +Index: 19314, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1204 +Index: 19315, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1358 +Index: 19316, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1556 +Index: 19317, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1793 +Index: 19318, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2168 +Index: 19319, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2608 +Index: 19320, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.319 +Index: 19321, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.3721 +Index: 19343, SMILES: Cc1cc(C)[nH]n1, Value: 0.1164 +Index: 19344, SMILES: Cc1cc(C)[nH]n1, Value: 0.1293 +Index: 19345, SMILES: Cc1cc(C)[nH]n1, Value: 0.1433 +Index: 19346, SMILES: Cc1cc(C)[nH]n1, Value: 0.1596 +Index: 19347, SMILES: Cc1cc(C)[nH]n1, Value: 0.1754 +Index: 19348, SMILES: Cc1cc(C)[nH]n1, Value: 0.1943 +Index: 19349, SMILES: Cc1cc(C)[nH]n1, Value: 0.2131 +Index: 19356, SMILES: CC(C)c1ncc[nH]1, Value: 0.1155 +Index: 19357, SMILES: CC(C)c1ncc[nH]1, Value: 0.1209 +Index: 19358, SMILES: CC(C)c1ncc[nH]1, Value: 0.1267 +Index: 19359, SMILES: CC(C)c1ncc[nH]1, Value: 0.1328 +Index: 19360, SMILES: CC(C)c1ncc[nH]1, Value: 0.1396 +Index: 19361, SMILES: CC(C)c1ncc[nH]1, Value: 0.146 +Index: 19362, SMILES: CC(C)c1ncc[nH]1, Value: 0.1526 +Index: 19363, SMILES: CC(C)c1ncc[nH]1, Value: 0.1588 +Index: 19364, SMILES: CC(C)c1ncc[nH]1, Value: 0.1662 +Index: 19432, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1198 +Index: 19433, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1266 +Index: 19434, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1346 +Index: 19435, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1422 +Index: 19436, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1506 +Index: 19437, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1637 +Index: 19438, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1841 +Index: 19439, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2065 +Index: 19440, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.231 +Index: 19441, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2576 +Index: 19442, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2888 +Index: 19443, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3217 +Index: 19444, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.359 +Index: 19445, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.401 +Index: 19446, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.4449 +Index: 19447, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.487 +Index: 19448, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.5343 +Index: 19449, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.5854 +Index: 19494, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1344 +Index: 19495, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1661 +Index: 19496, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.2024 +Index: 19497, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.2441 +Index: 19539, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1257 +Index: 19540, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.145 +Index: 19594, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1219 +Index: 19595, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1315 +Index: 19596, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1423 +Index: 19597, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1533 +Index: 19598, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1652 +Index: 19599, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1769 +Index: 19600, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1899 +Index: 19601, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2033 +Index: 19602, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2174 +Index: 19603, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2334 +Index: 19604, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2494 +Index: 19605, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2651 +Index: 19606, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2828 +Index: 19607, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.301 +Index: 19613, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1174 +Index: 19614, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1203 +Index: 19615, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1236 +Index: 19616, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1268 +Index: 19617, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1298 +Index: 19618, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.133 +Index: 19619, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1358 +Index: 19620, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1388 +Index: 19621, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1421 +Index: 19622, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.146 +Index: 19672, SMILES: N=C(Nc1ccccc1)Nc1ccccc1, Value: 0.1205 +Index: 19673, SMILES: N=C(Nc1ccccc1)Nc1ccccc1, Value: 0.1283 +Index: 19674, SMILES: N=C(Nc1ccccc1)Nc1ccccc1, Value: 0.1372 +Index: 19681, SMILES: C/C=C/C=C/C(=O)O, Value: 0.1154 +Index: 19682, SMILES: C/C=C/C=C/C(=O)O, Value: 0.13951 +Index: 19683, SMILES: C/C=C/C=C/C(=O)O, Value: 0.15636 +Index: 19744, SMILES: CCOC(=O)Cc1c(C(=O)OCC)sc(N)c1C#N, Value: 0.1257 +Index: 19842, SMILES: Cn1cc([N+](=O)[O-])cn1, Value: 0.140664 +Index: 19851, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1201 +Index: 19852, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1434 +Index: 19853, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1688 +Index: 19854, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1968 +Index: 19855, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2317 +Index: 19883, SMILES: CP(=O)(O)O, Value: 0.1623 +Index: 19884, SMILES: CP(=O)(O)O, Value: 0.2409 +Index: 19885, SMILES: CP(=O)(O)O, Value: 0.2959 +Index: 19886, SMILES: CP(=O)(O)O, Value: 0.3359 +Index: 19887, SMILES: CP(=O)(O)O, Value: 0.4195 +Index: 19888, SMILES: CP(=O)(O)O, Value: 0.4638 +Index: 19938, SMILES: O=C1C=CC(=O)O1, Value: 0.1242 +Index: 20142, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.1346 +Index: 20143, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.1632 +Index: 20144, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2104 +Index: 20145, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2626 +Index: 20204, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1186 +Index: 20205, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1704 +Index: 20206, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2399 +Index: 20207, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3213 +Index: 20208, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.4092 +Index: 20249, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.12137 +Index: 20250, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.15445 +Index: 20281, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.1152 +Index: 20282, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.1227 +Index: 20283, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.1338 +Index: 20284, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.1465 +Index: 20285, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.162 +Index: 20286, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.1775 +Index: 20287, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.1962 +Index: 20288, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.2226 +Index: 20289, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.2543 +Index: 20290, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.2874 +Index: 20291, SMILES: c1cnc2[nH]ccc2c1, Value: 0.21 +Index: 20292, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2166 +Index: 20293, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2263 +Index: 20294, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2372 +Index: 20295, SMILES: c1cnc2[nH]ccc2c1, Value: 0.251 +Index: 20296, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2653 +Index: 20297, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2831 +Index: 20298, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3019 +Index: 20299, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3236 +Index: 20300, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3463 +Index: 20318, SMILES: Nc1cccc(Cl)c1C(=O)O, Value: 0.1222 +Index: 20361, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1296 +Index: 20362, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1493 +Index: 20363, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1701 +Index: 20402, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.13104 +Index: 20403, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.15353 +Index: 20404, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.18115 +Index: 20405, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.20932 +Index: 20406, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.24154 +Index: 20430, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1224 +Index: 20440, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2348 +Index: 20441, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2366 +Index: 20442, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2398 +Index: 20443, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.243 +Index: 20444, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2463 +Index: 20445, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2506 +Index: 20446, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.255 +Index: 20447, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2601 +Index: 20448, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2654 +Index: 20474, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.121597 +Index: 20475, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.146835 +Index: 20476, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.170839 +Index: 20487, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1647 +Index: 20488, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1806 +Index: 20489, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2017 +Index: 20490, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2229 +Index: 20491, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2469 +Index: 20492, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2697 +Index: 20493, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2975 +Index: 20494, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3285 +Index: 20495, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3755 +Index: 20516, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.13117 +Index: 20517, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.17001 +Index: 20518, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.2093 +Index: 20519, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.28524 +Index: 20520, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.30974 +Index: 20521, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.33364 +Index: 20522, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.36189 +Index: 20531, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1162 +Index: 20532, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.137 +Index: 20539, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.1294 +Index: 20540, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.201 +Index: 20541, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.293 +Index: 20542, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.3994 +Index: 20543, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.5195 +Index: 20544, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.6316 +Index: 20595, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.13629 +Index: 20596, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.17342 +Index: 20597, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.2166 +Index: 20598, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.2656 +Index: 20599, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.3198 +Index: 20600, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.37829 +Index: 20601, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.43988 +Index: 20602, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.50328 +Index: 20603, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.56718 +Index: 20604, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.63041 +Index: 20607, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1344 +Index: 20608, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1457 +Index: 20609, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1855 +Index: 20610, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2462 +Index: 20611, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3078 +Index: 20612, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3415 +Index: 20613, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3889 +Index: 20614, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4326 +Index: 20615, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4917 +Index: 20616, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5579 +Index: 20617, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6113 +Index: 20618, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6685 +Index: 20619, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.7442 +Index: 20696, SMILES: Nc1ccc(Cl)cc1[N+](=O)[O-], Value: 0.1434 +Index: 20697, SMILES: Nc1ccc(Cl)cc1[N+](=O)[O-], Value: 0.1766 +Index: 20784, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1279 +Index: 20785, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1513 +Index: 20786, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1806 +Index: 20787, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2151 +Index: 20788, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2542 +Index: 20789, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.3008 +Index: 20790, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.3568 +Index: 20791, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.4234 +Index: 20840, SMILES: O=C1Cc2ccccc2N1, Value: 0.1405 +Index: 20841, SMILES: O=C1Cc2ccccc2N1, Value: 0.1559 +Index: 20842, SMILES: O=C1Cc2ccccc2N1, Value: 0.1689 +Index: 20843, SMILES: O=C1Cc2ccccc2N1, Value: 0.1836 +Index: 20844, SMILES: O=C1Cc2ccccc2N1, Value: 0.1977 +Index: 20845, SMILES: O=C1Cc2ccccc2N1, Value: 0.2151 +Index: 20846, SMILES: O=C1Cc2ccccc2N1, Value: 0.2327 +Index: 20847, SMILES: O=C1Cc2ccccc2N1, Value: 0.2475 +Index: 20848, SMILES: O=C1Cc2ccccc2N1, Value: 0.2703 +Index: 20849, SMILES: O=C1Cc2ccccc2N1, Value: 0.2874 +Index: 20850, SMILES: O=C1Cc2ccccc2N1, Value: 0.3202 +Index: 20933, SMILES: NC(=O)c1ccccc1N, Value: 0.1233 +Index: 20934, SMILES: NC(=O)c1ccccc1N, Value: 0.1344 +Index: 20935, SMILES: NC(=O)c1ccccc1N, Value: 0.1536 +Index: 20936, SMILES: NC(=O)c1ccccc1N, Value: 0.1691 +Index: 21004, SMILES: CC(=O)c1c(C)c([N+](=O)[O-])c(C(C)(C)C)c([N+](=O)[O-])c1C, Value: 0.1218 +Index: 21005, SMILES: CC(=O)c1c(C)c([N+](=O)[O-])c(C(C)(C)C)c([N+](=O)[O-])c1C, Value: 0.1393 +Index: 21006, SMILES: CC(=O)c1c(C)c([N+](=O)[O-])c(C(C)(C)C)c([N+](=O)[O-])c1C, Value: 0.156 +Index: 21055, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1296 +Index: 21056, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1425 +Index: 21057, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1598 +Index: 21058, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1767 +Index: 21059, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1987 +Index: 21060, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2193 +Index: 21061, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2464 +Index: 21062, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2775 +Index: 21063, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.3132 +Index: 21064, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.3566 +Index: 21065, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.4067 +Index: 21066, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.4663 +Index: 21072, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1157 +Index: 21073, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1256 +Index: 21074, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1354 +Index: 21075, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.145 +Index: 21119, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.123 +Index: 21120, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.1577 +Index: 21121, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.1996 +Index: 21122, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.2563 +Index: 21144, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1269 +Index: 21145, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1517 +Index: 21146, SMILES: Nc1cccc2cccc(N)c12, Value: 0.179 +Index: 21147, SMILES: Nc1cccc2cccc(N)c12, Value: 0.2116 +Index: 21148, SMILES: Nc1cccc2cccc(N)c12, Value: 0.2519 +Index: 21149, SMILES: Nc1cccc2cccc(N)c12, Value: 0.2947 +Index: 21203, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.1157 +Index: 21204, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.1358 +Index: 21205, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.1595 +Index: 21206, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.1872 +Index: 21209, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.1356 +Index: 21210, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.1595 +Index: 21211, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.1808 +Index: 21212, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.2121 +Index: 21213, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.244 +Index: 21214, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.2842 +Index: 21215, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.3398 +Index: 21235, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.122 +Index: 21236, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1304 +Index: 21237, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1395 +Index: 21238, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1486 +Index: 21239, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1588 +Index: 21240, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1698 +Index: 21241, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1823 +Index: 21242, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1959 +Index: 21243, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.2104 +Index: 21244, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.2277 +Index: 21245, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.2462 +Index: 21246, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.268 +Index: 21309, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.118661 +Index: 21310, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.144477 +Index: 21311, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.174608 +Index: 21312, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.206436 +Index: 21329, SMILES: Cc1ccc(S(N)(=O)=O)cc1, Value: 0.1235 +Index: 21330, SMILES: Cc1ccc(S(N)(=O)=O)cc1, Value: 0.1329 +Index: 21345, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1347 +Index: 21346, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1661 +Index: 21347, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.2027 +Index: 21348, SMILES: N#Cc1cccnc1, Value: 0.209 +Index: 21349, SMILES: N#Cc1cccnc1, Value: 0.247 +Index: 21350, SMILES: N#Cc1cccnc1, Value: 0.282 +Index: 21351, SMILES: N#Cc1cccnc1, Value: 0.375 +Index: 21352, SMILES: N#Cc1cccnc1, Value: 0.478 +Index: 21353, SMILES: N#Cc1cccnc1, Value: 0.63 +Index: 21354, SMILES: N#Cc1cccnc1, Value: 0.803 +Index: 21356, SMILES: N#Cc1ccncc1, Value: 0.121 +Index: 21357, SMILES: N#Cc1ccncc1, Value: 0.142 +Index: 21358, SMILES: N#Cc1ccncc1, Value: 0.203 +Index: 21359, SMILES: N#Cc1ccncc1, Value: 0.261 +Index: 21360, SMILES: N#Cc1ccncc1, Value: 0.343 +Index: 21361, SMILES: N#Cc1ccncc1, Value: 0.437 +Index: 21459, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.125 +Index: 21460, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.14 +Index: 21461, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.154 +Index: 21462, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.17 +Index: 21463, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.186 +Index: 21464, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.203 +Index: 21478, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.1316 +Index: 21479, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.1589 +Index: 21480, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.1908 +Index: 21481, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.2301 +Index: 21482, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.2769 +Index: 21483, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.3408 +Index: 21485, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.117 +Index: 21486, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1368 +Index: 21487, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1609 +Index: 21488, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1875 +Index: 21489, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.2196 +Index: 21490, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.257 +Index: 21491, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.2996 +Index: 21492, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.3455 +Index: 21503, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1748 +Index: 21504, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1932 +Index: 21505, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2137 +Index: 21506, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2369 +Index: 21507, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2582 +Index: 21508, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2844 +Index: 21509, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3119 +Index: 21510, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3416 +Index: 21511, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3721 +Index: 21512, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4071 +Index: 21527, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.281 +Index: 21528, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3275 +Index: 21529, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3582 +Index: 21530, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3992 +Index: 21531, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.4547 +Index: 21532, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.5327 +Index: 21533, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.6066 +Index: 21534, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.6916 +Index: 21535, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.8283 +Index: 21563, SMILES: O=C(O)c1ccccc1O, Value: 0.12998 +Index: 21564, SMILES: O=C(O)c1ccccc1O, Value: 0.14009 +Index: 21565, SMILES: O=C(O)c1ccccc1O, Value: 0.15413 +Index: 21566, SMILES: O=C(O)c1ccccc1O, Value: 0.16518 +Index: 21567, SMILES: O=C(O)c1ccccc1O, Value: 0.17861 +Index: 21568, SMILES: OC/C=C/c1ccccc1, Value: 0.208 +Index: 21569, SMILES: OC/C=C/c1ccccc1, Value: 0.243 +Index: 21570, SMILES: OC/C=C/c1ccccc1, Value: 0.29 +Index: 21571, SMILES: OC/C=C/c1ccccc1, Value: 0.351 +Index: 21572, SMILES: OC/C=C/c1ccccc1, Value: 0.416 +Index: 21573, SMILES: OC/C=C/c1ccccc1, Value: 0.486 +Index: 21574, SMILES: OC/C=C/c1ccccc1, Value: 0.547 +Index: 21575, SMILES: OC/C=C/c1ccccc1, Value: 0.61 +Index: 21576, SMILES: OC/C=C/c1ccccc1, Value: 0.659 +Index: 21620, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.12177 +Index: 21621, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.14333 +Index: 21622, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.16904 +Index: 21623, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.1949 +Index: 21624, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.22301 +Index: 21663, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.132 +Index: 21664, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1431 +Index: 21665, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1542 +Index: 21666, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1693 +Index: 21667, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1861 +Index: 21668, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.2081 +Index: 21745, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1212 +Index: 21746, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1403 +Index: 21747, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1636 +Index: 21748, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1879 +Index: 21768, SMILES: O=C(O)c1ccccc1, Value: 0.1206 +Index: 21769, SMILES: O=C(O)c1ccccc1, Value: 0.1329 +Index: 21770, SMILES: O=C(O)c1ccccc1, Value: 0.1465 +Index: 21771, SMILES: O=C(O)c1ccccc1, Value: 0.1667 +Index: 21772, SMILES: O=C(O)c1ccccc1, Value: 0.1857 +Index: 21773, SMILES: O=C(O)c1ccccc1, Value: 0.2062 +Index: 21774, SMILES: O=C(O)c1ccccc1, Value: 0.2284 +Index: 21775, SMILES: O=C(O)c1ccccc1, Value: 0.2523 +Index: 21776, SMILES: O=C(O)c1ccccc1, Value: 0.278 +Index: 21777, SMILES: O=C(O)c1ccccc1, Value: 0.3057 +Index: 21797, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1234 +Index: 21798, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.137 +Index: 21799, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1508 +Index: 21800, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1641 +Index: 21801, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1795 +Index: 21802, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1948 +Index: 21803, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2128 +Index: 21804, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2338 +Index: 21805, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2527 +Index: 21806, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2741 +Index: 21807, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2978 +Index: 21808, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.3249 +Index: 21809, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.3519 +Index: 21810, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.3798 +Index: 21865, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.14441 +Index: 21866, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.14464 +Index: 21867, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.14603 +Index: 21868, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.14788 +Index: 21869, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.14819 +Index: 21870, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.14977 +Index: 21871, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.15137 +Index: 21872, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.15288 +Index: 21873, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.15495 +Index: 21874, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.15676 +Index: 21875, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.15834 +Index: 21876, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.16055 +Index: 21877, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.16272 +Index: 21878, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.16555 +Index: 21879, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.16879 +Index: 21880, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.17033 +Index: 21881, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.1735 +Index: 21882, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.17654 +Index: 21883, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.18034 +Index: 21884, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.18279 +Index: 21885, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.18574 +Index: 21886, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.18824 +Index: 21887, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.19356 +Index: 21888, SMILES: CC(C)(C)c1cc(O)c(C(C)(C)C)cc1O, Value: 0.19542 +Index: 21908, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.1369 +Index: 21909, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.18152 +Index: 21918, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.2903 +Index: 21919, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.3452 +Index: 21920, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.3854 +Index: 21921, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.446 +Index: 21922, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.5012 +Index: 21923, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.6071 +Index: 21924, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.665 +Index: 21943, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.19228 +Index: 21944, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.23957 +Index: 21945, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.28273 +Index: 21946, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.32452 +Index: 21947, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.35454 +Index: 21948, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.40932 +Index: 21949, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.46103 +Index: 21950, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.51127 +Index: 22043, SMILES: O=C(O)c1ccco1, Value: 0.1241 +Index: 22044, SMILES: O=C(O)c1ccco1, Value: 0.1372 +Index: 22045, SMILES: O=C(O)c1ccco1, Value: 0.1474 +Index: 22046, SMILES: O=C(O)c1ccco1, Value: 0.1569 +Index: 22047, SMILES: O=C(O)c1ccco1, Value: 0.1711 +Index: 22048, SMILES: O=C(O)c1ccco1, Value: 0.191 +Index: 22049, SMILES: O=C(O)c1ccco1, Value: 0.2165 +Index: 22050, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.2486 +Index: 22051, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.3318 +Index: 22052, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.4051 +Index: 22053, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.4626 +Index: 22054, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.5413 +Index: 22055, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.6016 +Index: 22056, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.6682 +Index: 22057, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.7189 +Index: 22058, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.7782 +Index: 22059, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.8219 +Index: 22060, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.8662 +Index: 22061, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.2124 +Index: 22062, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.2688 +Index: 22063, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.3305 +Index: 22064, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.3878 +Index: 22065, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.4355 +Index: 22066, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.4863 +Index: 22067, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.5207 +Index: 22068, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.5693 +Index: 22069, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.5917 +Index: 22070, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.6446 +Index: 22071, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.6818 +Index: 22072, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.1886 +Index: 22073, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.2299 +Index: 22074, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.2778 +Index: 22075, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.3496 +Index: 22116, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.11644 +Index: 22117, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.1214 +Index: 22118, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.12774 +Index: 22119, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.13389 +Index: 22120, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.14002 +Index: 22140, SMILES: O=[N+]([O-])c1nonc1-c1no[n+]([O-])c1-c1nonc1[N+](=O)[O-], Value: 0.138312 +Index: 22141, SMILES: O=[N+]([O-])c1nonc1-c1no[n+]([O-])c1-c1nonc1[N+](=O)[O-], Value: 0.179883 +Index: 22146, SMILES: c1ccc(CSSCc2ccccc2)cc1, Value: 0.1308 +Index: 22147, SMILES: c1ccc(CSSCc2ccccc2)cc1, Value: 0.164 +Index: 22191, SMILES: O=C(O)[C@@H](O)CCc1ccccc1, Value: 0.117 +Index: 22192, SMILES: O=C(O)[C@@H](O)CCc1ccccc1, Value: 0.128 +Index: 22193, SMILES: O=C(O)[C@@H](O)CCc1ccccc1, Value: 0.14 +Index: 22194, SMILES: O=C(O)[C@@H](O)CCc1ccccc1, Value: 0.15 +Index: 22195, SMILES: O=C(O)[C@@H](O)CCc1ccccc1, Value: 0.16 +Index: 22196, SMILES: O=C(O)[C@@H](O)CCc1ccccc1, Value: 0.174 +Index: 22197, SMILES: O=C(O)[C@@H](O)CCc1ccccc1, Value: 0.182 +Index: 22211, SMILES: Clc1ccc(SSc2ccc(Cl)cc2)cc1, Value: 0.117 +Index: 22222, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.115 +Index: 22223, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.1308 +Index: 22224, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.1469 +Index: 22225, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.1784 +Index: 22226, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.1993 +Index: 22227, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.2211 +Index: 22228, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.242 +Index: 22229, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.2718 +Index: 22230, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.3107 +Index: 22231, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.3693 +Index: 22232, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.4359 +Index: 22233, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.4914 +Index: 22242, SMILES: Cc1cc(C)c(C(=O)P(=O)(C(=O)c2c(C)cc(C)cc2C)c2ccccc2)c(C)c1, Value: 0.12684 +Index: 22243, SMILES: Cc1cc(C)c(C(=O)P(=O)(C(=O)c2c(C)cc(C)cc2C)c2ccccc2)c(C)c1, Value: 0.16019 +Index: 22268, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.195 +Index: 22269, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.2246 +Index: 22270, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.2538 +Index: 22271, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.2831 +Index: 22272, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.3288 +Index: 22273, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.3661 +Index: 22274, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.4075 +Index: 22275, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.4423 +Index: 22276, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.5003 +Index: 22277, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.5432 +Index: 22278, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.2309 +Index: 22279, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.281 +Index: 22280, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.311 +Index: 22281, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.3573 +Index: 22282, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.4033 +Index: 22283, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.4522 +Index: 22284, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.5163 +Index: 22285, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.5732 +Index: 22286, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.6435 +Index: 22287, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.7112 +Index: 22298, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1455 +Index: 22299, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1679 +Index: 22300, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1989 +Index: 22301, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.2315 +Index: 22302, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.2685 +Index: 22303, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.3277 +Index: 22304, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.3872 +Index: 22305, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.4411 +Index: 22306, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.5017 +Index: 22307, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.5651 +Index: 22308, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.6249 +Index: 22309, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1235 +Index: 22310, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1418 +Index: 22311, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1731 +Index: 22312, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.2214 +Index: 22313, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.2436 +Index: 22314, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.2843 +Index: 22315, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.3351 +Index: 22316, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.3951 +Index: 22317, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.4652 +Index: 22318, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.5479 +Index: 22319, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.6301 +Index: 22368, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.3069 +Index: 22369, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.3304 +Index: 22370, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.3424 +Index: 22371, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.354 +Index: 22372, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.3686 +Index: 22373, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.3793 +Index: 22374, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.397 +Index: 22375, SMILES: COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O, Value: 0.4155 +Index: 22387, SMILES: O=[PH](O)c1ccccc1, Value: 0.1356 +Index: 22388, SMILES: O=[PH](O)c1ccccc1, Value: 0.1739 +Index: 22393, SMILES: CP(=O)(O)c1ccccc1, Value: 0.1516 +Index: 22394, SMILES: CP(=O)(O)c1ccccc1, Value: 0.1818 +Index: 22395, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2654 +Index: 22396, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3042 +Index: 22397, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3593 +Index: 22398, SMILES: CP(=O)(O)c1ccccc1, Value: 0.4277 +Index: 22402, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.116 +Index: 22403, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1442 +Index: 22404, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1635 +Index: 22405, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1848 +Index: 22406, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.2149 +Index: 22412, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.1194 +Index: 22413, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.1364 +Index: 22414, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.1588 +Index: 22415, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1507 +Index: 22416, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1687 +Index: 22417, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1883 +Index: 22418, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.2014 +Index: 22419, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.2202 +Index: 22420, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.2399 +Index: 22421, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.2452 +Index: 22456, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1267 +Index: 22457, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1584 +Index: 22458, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1935 +Index: 22459, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2254 +Index: 22460, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2713 +Index: 22461, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3195 +Index: 22462, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3762 +Index: 22463, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.4388 +Index: 22509, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.2883 +Index: 22510, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.2949 +Index: 22511, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.3111 +Index: 22512, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.3301 +Index: 22513, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.3473 +Index: 22514, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.3645 +Index: 22515, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.3818 +Index: 22516, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.4007 +Index: 22517, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.4216 +Index: 22518, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.4435 +Index: 22519, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.4675 +Index: 22520, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.4904 +Index: 22521, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.5128 +Index: 22535, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.2172 +Index: 22536, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.2468 +Index: 22537, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.2792 +Index: 22538, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.3049 +Index: 22539, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.3339 +Index: 22540, SMILES: COC(=O)/C=C/c1cc(OC)c(O)c(OC)c1, Value: 0.1169 +Index: 22541, SMILES: COC(=O)/C=C/c1cc(OC)c(O)c(OC)c1, Value: 0.1276 +Index: 22542, SMILES: COC(=O)/C=C/c1cc(OC)c(O)c(OC)c1, Value: 0.1466 +Index: 22543, SMILES: COC(=O)/C=C/c1cc(OC)c(O)c(OC)c1, Value: 0.1569 +Index: 22544, SMILES: COC(=O)/C=C/c1cc(OC)c(O)c(OC)c1, Value: 0.1678 +Index: 22545, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.236 +Index: 22546, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.299 +Index: 22547, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.323 +Index: 22548, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.352 +Index: 22549, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.38 +Index: 22567, SMILES: CP(=O)(c1ccccc1)c1ccccc1, Value: 0.12836 +Index: 22568, SMILES: CP(=O)(c1ccccc1)c1ccccc1, Value: 0.1498 +Index: 22604, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1213 +Index: 22605, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1328 +Index: 22606, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1544 +Index: 22607, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1688 +Index: 22608, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1909 +Index: 22609, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2246 +Index: 22610, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.265 +Index: 22611, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1777 +Index: 22612, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1843 +Index: 22613, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2056 +Index: 22614, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2275 +Index: 22615, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2607 +Index: 22616, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2929 +Index: 22617, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.3261 +Index: 22618, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.3773 +Index: 22619, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.4366 +Index: 22630, SMILES: Nc1ccccn1, Value: 0.3444 +Index: 22631, SMILES: Nc1ccccn1, Value: 0.3633 +Index: 22632, SMILES: Nc1ccccn1, Value: 0.3835 +Index: 22633, SMILES: Nc1ccccn1, Value: 0.4048 +Index: 22634, SMILES: Nc1ccccn1, Value: 0.4265 +Index: 22635, SMILES: Nc1ccccn1, Value: 0.4497 +Index: 22636, SMILES: Nc1ccccn1, Value: 0.4745 +Index: 22637, SMILES: Nc1ccccn1, Value: 0.4994 +Index: 22638, SMILES: Nc1ccccn1, Value: 0.5252 +Index: 22639, SMILES: Nc1ccccn1, Value: 0.5529 +Index: 22640, SMILES: Nc1ccccn1, Value: 0.5809 +Index: 22641, SMILES: Nc1ccccn1, Value: 0.611 +Index: 22642, SMILES: Nc1ccccn1, Value: 0.6419 +Index: 22643, SMILES: Nc1ccccn1, Value: 0.6744 +Index: 22644, SMILES: Nc1ccccn1, Value: 0.7082 +Index: 22645, SMILES: Nc1ccccn1, Value: 0.7432 +Index: 22646, SMILES: Nc1ccccn1, Value: 0.7801 +Index: 22647, SMILES: Nc1ccccn1, Value: 0.8383 +Index: 22658, SMILES: c1ccc2ccccc2c1, Value: 0.1744 +Index: 22659, SMILES: c1ccc2ccccc2c1, Value: 0.191 +Index: 22660, SMILES: c1ccc2ccccc2c1, Value: 0.2174 +Index: 22661, SMILES: c1ccc2ccccc2c1, Value: 0.233 +Index: 22662, SMILES: c1ccc2ccccc2c1, Value: 0.2764 +Index: 22663, SMILES: c1ccc2ccccc2c1, Value: 0.3139 +Index: 22664, SMILES: c1ccc2ccccc2c1, Value: 0.3571 +Index: 22665, SMILES: c1ccc2ccccc2c1, Value: 0.406 +Index: 22666, SMILES: c1ccc2ccccc2c1, Value: 0.4651 +Index: 22667, SMILES: c1ccc2ccccc2c1, Value: 0.5257 +Index: 22668, SMILES: O=C(O)c1ccccc1O, Value: 0.1383 +Index: 22670, SMILES: C1CN2CCN1CC2, Value: 0.217 +Index: 22671, SMILES: C1CN2CCN1CC2, Value: 0.259 +Index: 22672, SMILES: C1CN2CCN1CC2, Value: 0.337 +Index: 22673, SMILES: C1CN2CCN1CC2, Value: 0.421 +Index: 22674, SMILES: C1CN2CCN1CC2, Value: 0.141 +Index: 22675, SMILES: C1CN2CCN1CC2, Value: 0.24 +Index: 22676, SMILES: C1CN2CCN1CC2, Value: 0.304 +Index: 22677, SMILES: C1CN2CCN1CC2, Value: 0.377 +Index: 22678, SMILES: C1CN2CCN1CC2, Value: 0.482 +Index: 22814, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.1185 +Index: 22881, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.122 +Index: 22882, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1304 +Index: 22883, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1395 +Index: 22884, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1486 +Index: 22885, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1587 +Index: 22886, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1698 +Index: 22887, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1823 +Index: 22888, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1959 +Index: 22889, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.2104 +Index: 22890, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.2277 +Index: 22891, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.2462 +Index: 22892, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.268 +Index: 22893, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.3063 +Index: 22894, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.3499 +Index: 22895, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.3991 +Index: 22896, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.4546 +Index: 22897, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.5084 +Index: 22898, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.5826 +Index: 22899, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.6517 +Index: 22900, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.7388 +Index: 22901, SMILES: FC(F)(F)c1cccnc1Cl, Value: 0.8237 +Index: 22918, SMILES: N#Cc1ccc([N+](=O)[O-])cc1, Value: 0.1192 +Index: 22919, SMILES: N#Cc1ccc([N+](=O)[O-])cc1, Value: 0.1422 +Index: 22935, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1347 +Index: 22936, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1661 +Index: 22937, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.2027 +Index: 22971, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1261 +Index: 22972, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1395 +Index: 22973, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1548 +Index: 23044, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1182 +Index: 23045, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.14 +Index: 23046, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1657 +Index: 23047, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.187 +Index: 23048, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2166 +Index: 23049, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2474 +Index: 23050, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2816 +Index: 23051, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3215 +Index: 23098, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.1151 +Index: 23099, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.1359 +Index: 23100, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.1582 +Index: 23101, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.1816 +Index: 23102, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.2067 +Index: 23103, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.2333 +Index: 23104, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.2617 +Index: 23162, SMILES: Cc1cc(C)[nH]n1, Value: 0.1279 +Index: 23163, SMILES: Cc1cc(C)[nH]n1, Value: 0.1437 +Index: 23164, SMILES: Cc1cc(C)[nH]n1, Value: 0.161 +Index: 23165, SMILES: Cc1cc(C)[nH]n1, Value: 0.1799 +Index: 23166, SMILES: Cc1cc(C)[nH]n1, Value: 0.199 +Index: 23167, SMILES: Cc1cc(C)[nH]n1, Value: 0.2228 +Index: 23175, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1205 +Index: 23176, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.128 +Index: 23177, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.136 +Index: 23178, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1443 +Index: 23179, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1531 +Index: 23180, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.162 +Index: 23181, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1715 +Index: 23182, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1817 +Index: 23212, SMILES: CC(C)c1ncc[nH]1, Value: 0.1179 +Index: 23218, SMILES: COc1cc(CO)ccc1O, Value: 0.163 +Index: 23288, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1172 +Index: 23289, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1251 +Index: 23290, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1334 +Index: 23291, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.142 +Index: 23292, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.151 +Index: 23293, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1602 +Index: 23294, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1462 +Index: 23295, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1641 +Index: 23296, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1853 +Index: 23297, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.206 +Index: 23298, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.229 +Index: 23299, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2559 +Index: 23300, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2846 +Index: 23301, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3159 +Index: 23302, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3476 +Index: 23303, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3848 +Index: 23304, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.4246 +Index: 23305, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.4653 +Index: 23306, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.5106 +Index: 23333, SMILES: CC(C)C(=O)OCC(=O)[C@@]12O[C@H](C3CCCCC3)O[C@@H]1C[C@H]1[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]12C, Value: 0.116 +Index: 23334, SMILES: CC(C)C(=O)OCC(=O)[C@@]12O[C@H](C3CCCCC3)O[C@@H]1C[C@H]1[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]12C, Value: 0.124 +Index: 23335, SMILES: CC(C)C(=O)OCC(=O)[C@@]12O[C@H](C3CCCCC3)O[C@@H]1C[C@H]1[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]12C, Value: 0.133 +Index: 23336, SMILES: CC(C)C(=O)OCC(=O)[C@@]12O[C@H](C3CCCCC3)O[C@@H]1C[C@H]1[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]12C, Value: 0.141 +Index: 23355, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1263 +Index: 23356, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1511 +Index: 23443, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1212 +Index: 23444, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1311 +Index: 23445, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1424 +Index: 23446, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1547 +Index: 23447, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1675 +Index: 23448, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1817 +Index: 23449, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1962 +Index: 23450, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2121 +Index: 23451, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2284 +Index: 23452, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2462 +Index: 23453, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2654 +Index: 23695, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1259 +Index: 23696, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1603 +Index: 23697, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1935 +Index: 23747, SMILES: COc1ccc2nc(SCc3ncc(C)c(OC)c3C)[nH]c2c1, Value: 0.12946 +Index: 23748, SMILES: COc1ccc2nc(SCc3ncc(C)c(OC)c3C)[nH]c2c1, Value: 0.15966 +Index: 23749, SMILES: COc1ccc2nc(SCc3ncc(C)c(OC)c3C)[nH]c2c1, Value: 0.20345 +Index: 23750, SMILES: COc1ccc2nc(SCc3ncc(C)c(OC)c3C)[nH]c2c1, Value: 0.25556 +Index: 23795, SMILES: C/C=C/C(=O)O, Value: 0.3206 +Index: 23796, SMILES: C/C=C/C(=O)O, Value: 0.3618 +Index: 23797, SMILES: C/C=C/C(=O)O, Value: 0.4056 +Index: 23798, SMILES: C/C=C/C(=O)O, Value: 0.4595 +Index: 23799, SMILES: C/C=C/C(=O)O, Value: 0.5018 +Index: 23882, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.116329 +Index: 23883, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.125493 +Index: 23893, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.12289 +Index: 23922, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.20513 +Index: 23923, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.36731 +Index: 23924, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.44816 +Index: 23925, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.51453 +Index: 23931, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2684 +Index: 23932, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2812 +Index: 23933, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2961 +Index: 23934, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3207 +Index: 23935, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3521 +Index: 23936, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3847 +Index: 23937, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4127 +Index: 23938, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4513 +Index: 23939, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4932 +Index: 23940, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.513 +Index: 23941, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5523 +Index: 23942, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5915 +Index: 23943, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6272 +Index: 23944, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6702 +Index: 23945, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.73 +Index: 23965, SMILES: c1cc(-n2c3ccccc3c3ccccc32)cc(-n2c3ccccc3c3ccccc32)c1, Value: 0.139 +Index: 23991, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1213 +Index: 23992, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1271 +Index: 23993, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1322 +Index: 23994, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1375 +Index: 23995, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1438 +Index: 23996, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.149 +Index: 23997, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1555 +Index: 24012, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.12551 +Index: 24013, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.15709 +Index: 24074, SMILES: CP(=O)(O)c1ccccc1, Value: 0.164 +Index: 24075, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2347 +Index: 24077, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1331 +Index: 24078, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1435 +Index: 24079, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1554 +Index: 24080, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1653 +Index: 24081, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1795 +Index: 24084, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.1385 +Index: 24085, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.1583 +Index: 24086, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.179 +Index: 24087, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.2194 +Index: 24158, SMILES: CC(C)(C)C(=O)OCOP(=O)(COCCn1cnc2c(N)ncnc21)OCOC(=O)C(C)(C)C, Value: 0.17513285 +Index: 24175, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.1758 +Index: 24176, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.19002 +Index: 24177, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.20333 +Index: 24178, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.21045 +Index: 24179, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.21741 +Index: 24180, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.22608 +Index: 24181, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.23333 +Index: 24182, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.24053 +Index: 24195, SMILES: CC(C)Oc1ccc2c(=O)c(-c3ccccc3)coc2c1, Value: 0.119326 +Index: 24385, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.1239 +Index: 24458, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.11603 +Index: 24459, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.12696 +Index: 24460, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.13752 +Index: 24461, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.14781 +Index: 24499, SMILES: c1cnc2[nH]ccc2c1, Value: 0.1161 +Index: 24500, SMILES: c1cnc2[nH]ccc2c1, Value: 0.1242 +Index: 24501, SMILES: c1cnc2[nH]ccc2c1, Value: 0.1341 +Index: 24502, SMILES: c1cnc2[nH]ccc2c1, Value: 0.1453 +Index: 24503, SMILES: c1cnc2[nH]ccc2c1, Value: 0.1592 +Index: 24504, SMILES: c1cnc2[nH]ccc2c1, Value: 0.1744 +Index: 24505, SMILES: c1cnc2[nH]ccc2c1, Value: 0.1929 +Index: 24506, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2143 +Index: 24507, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2425 +Index: 24551, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1224 +Index: 24593, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.13406 +Index: 24594, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.16085 +Index: 24638, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1352 +Index: 24639, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1411 +Index: 24640, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1498 +Index: 24641, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1601 +Index: 24642, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1689 +Index: 24643, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1762 +Index: 24644, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1854 +Index: 24645, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1956 +Index: 24646, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2067 +Index: 24680, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.13108 +Index: 24681, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.25542 +Index: 24692, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1249 +Index: 24693, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1612 +Index: 24694, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2071 +Index: 24695, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2755 +Index: 24716, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.18151 +Index: 24717, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.25756 +Index: 24718, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.31361 +Index: 24719, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.35966 +Index: 24720, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.45571 +Index: 24721, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.51917 +Index: 24722, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.55781 +Index: 24744, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.1247 +Index: 24787, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.13036 +Index: 24788, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.17416 +Index: 24789, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.22006 +Index: 24790, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.27649 +Index: 24791, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.33958 +Index: 24792, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.41105 +Index: 24793, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.48764 +Index: 24794, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.55906 +Index: 24799, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1369 +Index: 24800, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1798 +Index: 24801, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.238 +Index: 24802, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2777 +Index: 24803, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3226 +Index: 24804, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3687 +Index: 24805, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4324 +Index: 24806, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4936 +Index: 24807, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5572 +Index: 24808, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6376 +Index: 24809, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.702 +Index: 24889, SMILES: Nc1ccc(Cl)cc1[N+](=O)[O-], Value: 0.1241 +Index: 24890, SMILES: Nc1ccc(Cl)cc1[N+](=O)[O-], Value: 0.1452 +Index: 24971, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1406 +Index: 24972, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1709 +Index: 24973, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2074 +Index: 24974, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2469 +Index: 24975, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2989 +Index: 24976, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.3587 +Index: 24977, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.4281 +Index: 24978, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.5018 +Index: 25023, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.121 +Index: 25024, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1393 +Index: 25030, SMILES: O=C1Cc2ccccc2N1, Value: 0.1234 +Index: 25031, SMILES: O=C1Cc2ccccc2N1, Value: 0.1457 +Index: 25032, SMILES: O=C1Cc2ccccc2N1, Value: 0.1708 +Index: 25033, SMILES: O=C1Cc2ccccc2N1, Value: 0.1959 +Index: 25034, SMILES: O=C1Cc2ccccc2N1, Value: 0.227 +Index: 25035, SMILES: O=C1Cc2ccccc2N1, Value: 0.2848 +Index: 25110, SMILES: NC(=O)c1ccccc1N, Value: 0.1514 +Index: 25111, SMILES: NC(=O)c1ccccc1N, Value: 0.1828 +Index: 25152, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.118 +Index: 25193, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1241 +Index: 25194, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1435 +Index: 25195, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1675 +Index: 25196, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1954 +Index: 25197, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2276 +Index: 25198, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2641 +Index: 25199, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.31 +Index: 25200, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.3624 +Index: 25201, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.4242 +Index: 25202, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.4979 +Index: 25272, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1159 +Index: 25273, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1392 +Index: 25274, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1664 +Index: 25275, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1967 +Index: 25276, SMILES: Nc1cccc2cccc(N)c12, Value: 0.2313 +Index: 25332, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.1474 +Index: 25350, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1244 +Index: 25351, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1449 +Index: 25352, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1693 +Index: 25353, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1964 +Index: 25354, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.2279 +Index: 25427, SMILES: Cc1ccc(S(N)(=O)=O)cc1, Value: 0.118 +Index: 25428, SMILES: Cc1ccc(S(N)(=O)=O)cc1, Value: 0.1301 +Index: 25429, SMILES: Cc1ccc(S(N)(=O)=O)cc1, Value: 0.1433 +Index: 25430, SMILES: Cc1ccc(S(N)(=O)=O)cc1, Value: 0.1588 +Index: 25444, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1164 +Index: 25445, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1382 +Index: 25446, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1635 +Index: 25447, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1964 +Index: 25509, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.121 +Index: 25510, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.138 +Index: 25511, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.173 +Index: 25541, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.1347 +Index: 25542, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.1658 +Index: 25545, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.1156 +Index: 25546, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.1466 +Index: 25547, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.1846 +Index: 25548, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.233 +Index: 25549, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.292 +Index: 25550, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.3673 +Index: 25551, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.4539 +Index: 25553, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1231 +Index: 25554, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1461 +Index: 25555, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1744 +Index: 25556, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.2062 +Index: 25557, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.2437 +Index: 25558, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.287 +Index: 25559, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.336 +Index: 25560, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.3891 +Index: 25565, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1394 +Index: 25566, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1677 +Index: 25567, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1993 +Index: 25568, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2341 +Index: 25569, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2724 +Index: 25570, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3141 +Index: 25597, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3009 +Index: 25598, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3304 +Index: 25599, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3682 +Index: 25600, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.4192 +Index: 25601, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.4746 +Index: 25602, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.5426 +Index: 25603, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.6328 +Index: 25604, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.7216 +Index: 25605, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.8483 +Index: 25649, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.13645 +Index: 25650, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.16405 +Index: 25651, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.19414 +Index: 25652, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.2254 +Index: 25747, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1228 +Index: 25748, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1423 +Index: 25749, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1654 +Index: 25750, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1928 +Index: 25751, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2252 +Index: 25752, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2631 +Index: 25754, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1209 +Index: 25755, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.143 +Index: 25756, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1674 +Index: 25757, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1936 +Index: 25758, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2211 +Index: 25759, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2491 +Index: 25760, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2771 +Index: 25761, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.3044 +Index: 25762, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.3306 +Index: 25789, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.12174 +Index: 25790, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.15484 +Index: 25896, SMILES: CC(=O)N1CN(C(C)=O)CN(C(C)=O)C1, Value: 0.14227 +Index: 25897, SMILES: CC(=O)N1CN(C(C)=O)CN(C(C)=O)C1, Value: 0.20179 +Index: 26082, SMILES: Clc1ccc2c(Cl)ccnc2c1, Value: 0.129711 +Index: 26235, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.38679 +Index: 26236, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.36486 +Index: 26237, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.33558 +Index: 26238, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.30238 +Index: 26239, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.26683 +Index: 26240, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.24477 +Index: 26241, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.2161 +Index: 26242, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.19667 +Index: 26243, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.1757 +Index: 26244, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.15646 +Index: 26323, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.12 +Index: 26324, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1435 +Index: 26325, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1728 +Index: 26326, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.203 +Index: 26327, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2434 +Index: 26328, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2834 +Index: 26329, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3303 +Index: 26439, SMILES: Cc1cc(C)[nH]n1, Value: 0.1158 +Index: 26489, SMILES: COc1cc(CO)ccc1O, Value: 0.127 +Index: 26490, SMILES: COc1cc(CO)ccc1O, Value: 0.22 +Index: 26577, SMILES: Nc1ccccc1N, Value: 0.1205 +Index: 26578, SMILES: Nc1ccccc1N, Value: 0.1283 +Index: 26579, SMILES: Nc1ccccc1N, Value: 0.1345 +Index: 26580, SMILES: Nc1ccccc1N, Value: 0.1434 +Index: 26581, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1645 +Index: 26582, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1833 +Index: 26583, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2036 +Index: 26584, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2256 +Index: 26585, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2505 +Index: 26586, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2769 +Index: 26587, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3067 +Index: 26588, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3382 +Index: 26589, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3714 +Index: 26590, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.4092 +Index: 26591, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.4494 +Index: 26592, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.4903 +Index: 26593, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.5324 +Index: 26631, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1297 +Index: 26632, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.161 +Index: 26633, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1989 +Index: 26717, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.5213 +Index: 26718, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.5454 +Index: 26719, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.6034 +Index: 26720, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.6833 +Index: 26721, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.7535 +Index: 26722, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.7923 +Index: 26723, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.8319 +Index: 26724, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.8828 +Index: 26777, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1186 +Index: 26778, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1325 +Index: 26779, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1477 +Index: 26780, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1646 +Index: 26781, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.183 +Index: 26782, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2027 +Index: 26953, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1442 +Index: 26954, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1968 +Index: 26955, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2707 +Index: 26983, SMILES: O=C1C=CC(=O)O1, Value: 0.13901 +Index: 26993, SMILES: C/C=C/C(=O)O, Value: 0.136 +Index: 26994, SMILES: C/C=C/C(=O)O, Value: 0.1681 +Index: 26995, SMILES: C/C=C/C(=O)O, Value: 0.2141 +Index: 26996, SMILES: C/C=C/C(=O)O, Value: 0.2597 +Index: 27175, SMILES: CSCCC(NC(C)=O)C(=O)O, Value: 0.14014 +Index: 27269, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.12536 +Index: 27270, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.15276 +Index: 27271, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.18953 +Index: 27272, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.22958 +Index: 27273, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.27988 +Index: 27274, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.35453 +Index: 27315, SMILES: c1cnc2[nH]ccc2c1, Value: 0.204 +Index: 27316, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2174 +Index: 27317, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2312 +Index: 27318, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2466 +Index: 27319, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2621 +Index: 27320, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2791 +Index: 27321, SMILES: c1cnc2[nH]ccc2c1, Value: 0.2976 +Index: 27322, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3152 +Index: 27323, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3358 +Index: 27324, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3602 +Index: 27401, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.13372 +Index: 27402, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.168331 +Index: 27403, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.207924 +Index: 27471, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1234 +Index: 27472, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1389 +Index: 27473, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1528 +Index: 27539, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.14266 +Index: 27540, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.17737 +Index: 27546, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1195 +Index: 27547, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1278 +Index: 27548, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1423 +Index: 27549, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1753 +Index: 27550, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2075 +Index: 27551, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2482 +Index: 27552, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2928 +Index: 27553, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3403 +Index: 27554, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.4062 +Index: 27593, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1306 +Index: 27605, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.1163 +Index: 27648, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.1231 +Index: 27649, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.15598 +Index: 27650, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.19615 +Index: 27651, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.24487 +Index: 27652, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.30359 +Index: 27653, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.39393 +Index: 27654, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.46664 +Index: 27664, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1367 +Index: 27665, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1885 +Index: 27666, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2602 +Index: 27667, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3454 +Index: 27668, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5001 +Index: 27669, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6271 +Index: 27840, SMILES: O=P(O)(O)c1ccccc1, Value: 0.24043 +Index: 27841, SMILES: O=P(O)(O)c1ccccc1, Value: 0.25142 +Index: 27842, SMILES: O=P(O)(O)c1ccccc1, Value: 0.26466 +Index: 27843, SMILES: O=P(O)(O)c1ccccc1, Value: 0.2768 +Index: 27844, SMILES: O=P(O)(O)c1ccccc1, Value: 0.29077 +Index: 27845, SMILES: O=P(O)(O)c1ccccc1, Value: 0.30691 +Index: 27846, SMILES: O=P(O)(O)c1ccccc1, Value: 0.31735 +Index: 27847, SMILES: O=P(O)(O)c1ccccc1, Value: 0.33093 +Index: 27848, SMILES: O=P(O)(O)c1ccccc1, Value: 0.34574 +Index: 27849, SMILES: O=P(O)(O)c1ccccc1, Value: 0.36074 +Index: 27850, SMILES: O=P(O)(O)c1ccccc1, Value: 0.37647 +Index: 27851, SMILES: O=P(O)(O)c1ccccc1, Value: 0.39357 +Index: 27867, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.1197 +Index: 27868, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.165 +Index: 27869, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2243 +Index: 28273, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.11513 +Index: 28274, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.14234 +Index: 28275, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.16554 +Index: 28276, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.1963 +Index: 28277, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.2489 +Index: 28478, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.3231 +Index: 28479, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.31491 +Index: 28480, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.30328 +Index: 28481, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.29229 +Index: 28482, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.27985 +Index: 28483, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.2681 +Index: 28484, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.25356 +Index: 28485, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.23999 +Index: 28486, SMILES: O=C(O)c1c(O)cccc1O, Value: 0.22486 +Index: 28512, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1165 +Index: 28513, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1338 +Index: 28514, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1504 +Index: 28515, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1669 +Index: 28516, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1832 +Index: 28517, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1992 +Index: 28518, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.2148 +Index: 28519, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.2298 +Index: 28555, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.1416 +Index: 28556, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.1691 +Index: 28557, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.1982 +Index: 28558, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.2275 +Index: 28559, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.2581 +Index: 28560, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.2886 +Index: 28561, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.3227 +Index: 28562, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.3509 +Index: 28600, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1801 +Index: 28601, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2062 +Index: 28602, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.235 +Index: 28603, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2656 +Index: 28604, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2978 +Index: 28605, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3359 +Index: 28606, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3689 +Index: 28607, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4067 +Index: 28608, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4459 +Index: 28609, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4858 +Index: 28637, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1552 +Index: 28638, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2128 +Index: 28639, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2836 +Index: 28640, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.391 +Index: 28641, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.5016 +Index: 28642, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.6717 +Index: 28670, SMILES: OC/C=C/c1ccccc1, Value: 0.195 +Index: 28671, SMILES: OC/C=C/c1ccccc1, Value: 0.242 +Index: 28672, SMILES: OC/C=C/c1ccccc1, Value: 0.288 +Index: 28673, SMILES: OC/C=C/c1ccccc1, Value: 0.33 +Index: 28674, SMILES: OC/C=C/c1ccccc1, Value: 0.394 +Index: 28675, SMILES: OC/C=C/c1ccccc1, Value: 0.446 +Index: 28676, SMILES: OC/C=C/c1ccccc1, Value: 0.512 +Index: 28677, SMILES: OC/C=C/c1ccccc1, Value: 0.582 +Index: 28678, SMILES: OC/C=C/c1ccccc1, Value: 0.649 +Index: 28723, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1215 +Index: 28724, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1518 +Index: 28725, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1364 +Index: 28726, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1593 +Index: 28769, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1202 +Index: 28770, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1421 +Index: 28771, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1696 +Index: 28772, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.2061 +Index: 28804, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.388071 +Index: 28805, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.412868 +Index: 28806, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.4413 +Index: 28807, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.471754 +Index: 28808, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.50875 +Index: 28809, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.546851 +Index: 28810, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.587709 +Index: 28811, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.64182 +Index: 28812, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.70018 +Index: 28902, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1265 +Index: 28923, SMILES: O=Cc1ccc2ccccc2c1, Value: 0.1439 +Index: 28924, SMILES: O=Cc1ccc2ccccc2c1, Value: 0.2369 +Index: 28961, SMILES: C=C1C[C@]23C[C@H]1CC[C@H]2[C@@]12CC[C@H](O)[C@@](C)(C(=O)O1)[C@H]2[C@@H]3C(=O)O, Value: 0.119738 +Index: 28962, SMILES: C=C1C[C@]23C[C@H]1CC[C@H]2[C@@]12CC[C@H](O)[C@@](C)(C(=O)O1)[C@H]2[C@@H]3C(=O)O, Value: 0.123285 +Index: 28963, SMILES: C=C1C[C@]23C[C@H]1CC[C@H]2[C@@]12CC[C@H](O)[C@@](C)(C(=O)O1)[C@H]2[C@@H]3C(=O)O, Value: 0.131368 +Index: 28964, SMILES: C=C1C[C@]23C[C@H]1CC[C@H]2[C@@]12CC[C@H](O)[C@@](C)(C(=O)O1)[C@H]2[C@@H]3C(=O)O, Value: 0.140276 +Index: 28968, SMILES: Cc1ccc2ccccc2c1, Value: 0.1333 +Index: 28969, SMILES: Cc1ccc2ccccc2c1, Value: 0.2334 +Index: 28970, SMILES: Cc1ccc2ccccc2c1, Value: 0.43 +Index: 29120, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1236 +Index: 29155, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.11857 +Index: 29156, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.13118 +Index: 29157, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.14896 +Index: 29158, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.16058 +Index: 29159, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.17133 +Index: 29160, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.1905 +Index: 29161, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.20088 +Index: 29162, SMILES: O=C(O)c1cc2ccccc2[nH]1, Value: 0.21883 +Index: 29215, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.1269 +Index: 29216, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.1775 +Index: 29227, SMILES: O=C(O)c1ccccc1O, Value: 0.144 +Index: 29228, SMILES: O=C(O)c1ccccc1O, Value: 0.161 +Index: 29229, SMILES: O=C(O)c1ccccc1O, Value: 0.173 +Index: 29230, SMILES: O=C(O)c1ccccc1O, Value: 0.195 +Index: 29231, SMILES: O=C(O)c1ccccc1O, Value: 0.214 +Index: 29301, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1279 +Index: 29302, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1441 +Index: 29303, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1581 +Index: 29304, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1694 +Index: 29305, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1897 +Index: 29306, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.2012 +Index: 29307, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.2088 +Index: 29362, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1273 +Index: 29363, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1528 +Index: 29364, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1876 +Index: 29365, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2219 +Index: 29366, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2645 +Index: 29367, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3051 +Index: 29368, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3505 +Index: 29369, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.4051 +Index: 29421, SMILES: C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O, Value: 0.1291 +Index: 29422, SMILES: C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O, Value: 0.1575 +Index: 29436, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1162 +Index: 29437, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1282 +Index: 29438, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1372 +Index: 29439, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1461 +Index: 29440, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1613 +Index: 29509, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1301 +Index: 29510, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1638 +Index: 29511, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2199 +Index: 29512, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2832 +Index: 29513, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.361 +Index: 29514, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4089 +Index: 29515, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4581 +Index: 29516, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5135 +Index: 29517, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5679 +Index: 29518, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.6477 +Index: 29519, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.7116 +Index: 29520, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.7774 +Index: 29521, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.8417 +Index: 29522, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.8959 +Index: 29549, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.2751 +Index: 29550, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.7019 +Index: 29558, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.1525 +Index: 29559, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.2103 +Index: 29560, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.2617 +Index: 29561, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.3168 +Index: 29562, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.3801 +Index: 29582, SMILES: O=C(Oc1ccccc1)Oc1ccccc1, Value: 0.1396 +Index: 29604, SMILES: C1CN2CCN1CC2, Value: 0.259 +Index: 29605, SMILES: C1CN2CCN1CC2, Value: 0.307 +Index: 29606, SMILES: C1CN2CCN1CC2, Value: 0.353 +Index: 29607, SMILES: C1CN2CCN1CC2, Value: 0.39 +Index: 29608, SMILES: C1CN2CCN1CC2, Value: 0.438 +Index: 29609, SMILES: C1CN2CCN1CC2, Value: 0.489 +Index: 29610, SMILES: C1CN2CCN1CC2, Value: 0.546 +Index: 29611, SMILES: C1CN2CCN1CC2, Value: 0.602 +Index: 29612, SMILES: C1CN2CCN1CC2, Value: 0.284 +Index: 29613, SMILES: C1CN2CCN1CC2, Value: 0.333 +Index: 29614, SMILES: C1CN2CCN1CC2, Value: 0.363 +Index: 29615, SMILES: C1CN2CCN1CC2, Value: 0.412 +Index: 29616, SMILES: C1CN2CCN1CC2, Value: 0.459 +Index: 29617, SMILES: C1CN2CCN1CC2, Value: 0.515 +Index: 29618, SMILES: C1CN2CCN1CC2, Value: 0.574 +Index: 29619, SMILES: C1CN2CCN1CC2, Value: 0.644 +Index: 29667, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1223 +Index: 29668, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1435 +Index: 29669, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1789 +Index: 29670, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.2101 +Index: 29676, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.118 +Index: 29677, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.128 +Index: 29678, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.143 +Index: 29679, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.153 +Index: 29680, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.167 +Index: 29717, SMILES: O=C(O)Cn1cnnn1, Value: 0.1195 +Index: 29718, SMILES: O=C(O)Cn1cnnn1, Value: 0.1432 +Index: 29731, SMILES: Nc1cccc(N)n1, Value: 0.12011 +Index: 29732, SMILES: Nc1cccc(N)n1, Value: 0.14734 +Index: 29733, SMILES: Nc1cccc(N)n1, Value: 0.15935 +Index: 29760, SMILES: c1nc[nH]n1, Value: 0.1294 +Index: 29761, SMILES: c1nc[nH]n1, Value: 0.1441 +Index: 29762, SMILES: c1nc[nH]n1, Value: 0.1592 +Index: 29763, SMILES: c1nc[nH]n1, Value: 0.1756 +Index: 29764, SMILES: c1nc[nH]n1, Value: 0.193 +Index: 29765, SMILES: c1nc[nH]n1, Value: 0.2114 +Index: 29766, SMILES: c1nc[nH]n1, Value: 0.2318 +Index: 29767, SMILES: c1nc[nH]n1, Value: 0.2537 +Index: 29768, SMILES: c1nc[nH]n1, Value: 0.2779 +Index: 29769, SMILES: c1nc[nH]n1, Value: 0.3036 +Index: 29770, SMILES: c1nc[nH]n1, Value: 0.332 +Index: 29771, SMILES: c1nc[nH]n1, Value: 0.3629 +Index: 29772, SMILES: c1nc[nH]n1, Value: 0.3972 +Index: 29776, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.11816 +Index: 29777, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.13717 +Index: 29778, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.16263 +Index: 29779, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.19257 +Index: 29780, SMILES: COP(=O)(NC(C)=O)SC, Value: 0.2241 +Index: 30107, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.124 +Index: 30108, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.166 +Index: 30109, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.221 +Index: 30110, SMILES: CCOc1cc(C=O)ccc1O, Value: 0.294 +Index: 30120, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1267 +Index: 30121, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1358 +Index: 30122, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1451 +Index: 30123, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1522 +Index: 30124, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1594 +Index: 30125, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1676 +Index: 30160, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1322 +Index: 30161, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1531 +Index: 30162, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1764 +Index: 30163, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2013 +Index: 30362, SMILES: Cc1cc(C)[nH]n1, Value: 0.1148 +Index: 30363, SMILES: Cc1cc(C)[nH]n1, Value: 0.1208 +Index: 30364, SMILES: Cc1cc(C)[nH]n1, Value: 0.1276 +Index: 30365, SMILES: Cc1cc(C)[nH]n1, Value: 0.1343 +Index: 30366, SMILES: Cc1cc(C)[nH]n1, Value: 0.1418 +Index: 30367, SMILES: Cc1cc(C)[nH]n1, Value: 0.1495 +Index: 30368, SMILES: Cc1cc(C)[nH]n1, Value: 0.1567 +Index: 30369, SMILES: Cc1cc(C)[nH]n1, Value: 0.1643 +Index: 30370, SMILES: Cc1cc(C)[nH]n1, Value: 0.1712 +Index: 30371, SMILES: Cc1cc(C)[nH]n1, Value: 0.1804 +Index: 30372, SMILES: Cc1cc(C)[nH]n1, Value: 0.1901 +Index: 30373, SMILES: Cc1cc(C)[nH]n1, Value: 0.1994 +Index: 30374, SMILES: Cc1cc(C)[nH]n1, Value: 0.211 +Index: 30416, SMILES: CC(C)c1ncc[nH]1, Value: 0.1153 +Index: 30417, SMILES: CC(C)c1ncc[nH]1, Value: 0.1211 +Index: 30418, SMILES: CC(C)c1ncc[nH]1, Value: 0.1262 +Index: 30419, SMILES: CC(C)c1ncc[nH]1, Value: 0.1316 +Index: 30424, SMILES: COc1cc(CO)ccc1O, Value: 0.149 +Index: 30425, SMILES: COc1cc(CO)ccc1O, Value: 0.237 +Index: 30642, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.3685 +Index: 30643, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.4303 +Index: 30644, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.4717 +Index: 30645, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.5538 +Index: 30646, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.6106 +Index: 30647, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.6837 +Index: 30648, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.7555 +Index: 30649, SMILES: Cc1ccc(C(C)C)c(O)c1, Value: 0.8487 +Index: 30888, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1581 +Index: 30889, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2103 +Index: 30890, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.276 +Index: 30950, SMILES: O=c1ccc2ccccc2o1, Value: 0.1705 +Index: 30951, SMILES: O=c1ccc2ccccc2o1, Value: 0.2824 +Index: 30952, SMILES: CP(=O)(O)O, Value: 0.4588 +Index: 30953, SMILES: CP(=O)(O)O, Value: 0.4698 +Index: 30954, SMILES: CP(=O)(O)O, Value: 0.4948 +Index: 30955, SMILES: CP(=O)(O)O, Value: 0.5162 +Index: 30956, SMILES: CP(=O)(O)O, Value: 0.5384 +Index: 30957, SMILES: CP(=O)(O)O, Value: 0.5614 +Index: 30958, SMILES: CP(=O)(O)O, Value: 0.5899 +Index: 31014, SMILES: C/C=C/C(=O)O, Value: 0.2458 +Index: 31015, SMILES: C/C=C/C(=O)O, Value: 0.2812 +Index: 31016, SMILES: C/C=C/C(=O)O, Value: 0.3104 +Index: 31017, SMILES: C/C=C/C(=O)O, Value: 0.3509 +Index: 31018, SMILES: C/C=C/C(=O)O, Value: 0.3948 +Index: 31019, SMILES: C/C=C/C(=O)O, Value: 0.439 +Index: 31115, SMILES: O=P(O)(O)c1ccccc1, Value: 0.12326 +Index: 31116, SMILES: O=P(O)(O)c1ccccc1, Value: 0.13426 +Index: 31117, SMILES: O=P(O)(O)c1ccccc1, Value: 0.14748 +Index: 31118, SMILES: O=P(O)(O)c1ccccc1, Value: 0.16079 +Index: 31119, SMILES: O=P(O)(O)c1ccccc1, Value: 0.17665 +Index: 31120, SMILES: O=P(O)(O)c1ccccc1, Value: 0.18938 +Index: 31121, SMILES: O=P(O)(O)c1ccccc1, Value: 0.20167 +Index: 31122, SMILES: O=P(O)(O)c1ccccc1, Value: 0.2176 +Index: 31123, SMILES: O=P(O)(O)c1ccccc1, Value: 0.23399 +Index: 31124, SMILES: O=P(O)(O)c1ccccc1, Value: 0.25236 +Index: 31177, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1151 +Index: 31178, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1256 +Index: 31179, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1374 +Index: 31180, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1475 +Index: 31181, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1585 +Index: 31182, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1702 +Index: 31183, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1816 +Index: 31184, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1928 +Index: 31185, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1391 +Index: 31186, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1686 +Index: 31187, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.209 +Index: 31188, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2558 +Index: 31189, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3046 +Index: 31190, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3838 +Index: 31191, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.4827 +Index: 31192, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.6168 +Index: 31193, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.8056 +Index: 31194, SMILES: Cc1ccc(N=C2SCC3CCCN2C3)cc1, Value: 0.145 +Index: 31195, SMILES: Cc1ccc(N=C2SCC3CCCN2C3)cc1, Value: 0.157 +Index: 31196, SMILES: Cc1ccc(N=C2SCC3CCCN2C3)cc1, Value: 0.171 +Index: 31197, SMILES: Cc1ccc(N=C2SCC3CCCN2C3)cc1, Value: 0.193 +Index: 31198, SMILES: Cc1ccc(N=C2SCC3CCCN2C3)cc1, Value: 0.209 +Index: 31204, SMILES: CC(C)c1ccc(N=C2SCC3CCCN2C3)cc1, Value: 0.143 +Index: 31205, SMILES: CC(C)c1ccc(N=C2SCC3CCCN2C3)cc1, Value: 0.154 +Index: 31206, SMILES: CC(C)c1ccc(N=C2SCC3CCCN2C3)cc1, Value: 0.164 +Index: 31207, SMILES: CC(C)c1ccc(N=C2SCC3CCCN2C3)cc1, Value: 0.182 +Index: 31208, SMILES: CC(C)c1ccc(N=C2SCC3CCCN2C3)cc1, Value: 0.194 +Index: 31246, SMILES: O=[N+]([O-])c1ccc(S(=O)(=O)Nc2nccs2)cc1, Value: 0.809 +Index: 31396, SMILES: O=C(O)c1ccccc1, Value: 0.1665 +Index: 31397, SMILES: O=C(O)c1ccccc1, Value: 0.1801 +Index: 31398, SMILES: O=C(O)c1ccccc1, Value: 0.1922 +Index: 31399, SMILES: O=C(O)c1ccccc1, Value: 0.2033 +Index: 31400, SMILES: O=C(O)c1ccccc1, Value: 0.2114 +Index: 31401, SMILES: O=C(O)c1ccccc1, Value: 0.2194 +Index: 31402, SMILES: O=C(O)c1ccccc1, Value: 0.2274 +Index: 31411, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.1741 +Index: 31412, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.1788 +Index: 31413, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.1856 +Index: 31414, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.1937 +Index: 31415, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.1989 +Index: 31416, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.2094 +Index: 31417, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.2194 +Index: 31418, SMILES: Cc1ccccc1C(=O)O, Value: 0.1548 +Index: 31419, SMILES: Cc1ccccc1C(=O)O, Value: 0.1646 +Index: 31420, SMILES: Cc1ccccc1C(=O)O, Value: 0.1805 +Index: 31421, SMILES: Cc1ccccc1C(=O)O, Value: 0.1895 +Index: 31422, SMILES: Cc1ccccc1C(=O)O, Value: 0.1956 +Index: 31423, SMILES: Cc1ccccc1C(=O)O, Value: 0.1967 +Index: 31424, SMILES: Cc1ccccc1C(=O)O, Value: 0.2002 +Index: 31425, SMILES: Cc1ccccc1C(=O)O, Value: 0.2076 +Index: 31426, SMILES: Cc1ccccc1C(=O)O, Value: 0.2194 +Index: 31434, SMILES: O=C(O)c1ccc(O)cc1, Value: 0.1159 +Index: 31444, SMILES: O=C(O)c1ccccc1, Value: 0.235 +Index: 31445, SMILES: O=C(O)c1ccccc1, Value: 0.2499 +Index: 31446, SMILES: O=C(O)c1ccccc1, Value: 0.2655 +Index: 31447, SMILES: O=C(O)c1ccccc1, Value: 0.2793 +Index: 31448, SMILES: O=C(O)c1ccccc1, Value: 0.2897 +Index: 31449, SMILES: O=C(O)c1ccccc1, Value: 0.3 +Index: 31457, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.2313 +Index: 31458, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.247 +Index: 31459, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.2621 +Index: 31460, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.2749 +Index: 31461, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.2867 +Index: 31462, SMILES: Cc1cccc(C(=O)O)c1, Value: 0.3055 +Index: 31463, SMILES: Cc1ccccc1C(=O)O, Value: 0.2296 +Index: 31464, SMILES: Cc1ccccc1C(=O)O, Value: 0.2394 +Index: 31465, SMILES: Cc1ccccc1C(=O)O, Value: 0.2499 +Index: 31466, SMILES: Cc1ccccc1C(=O)O, Value: 0.2601 +Index: 31467, SMILES: Cc1ccccc1C(=O)O, Value: 0.2705 +Index: 31468, SMILES: Cc1ccccc1C(=O)O, Value: 0.2807 +Index: 31469, SMILES: Cc1ccccc1C(=O)O, Value: 0.294 +Index: 31470, SMILES: Cc1ccccc1C(=O)O, Value: 0.3046 +Index: 31471, SMILES: O=C(O)c1ccc(O)cc1, Value: 0.1172 +Index: 31472, SMILES: O=C(O)c1ccc(O)cc1, Value: 0.1188 +Index: 31473, SMILES: O=C(O)c1ccc(O)cc1, Value: 0.1206 +Index: 31474, SMILES: O=C(O)c1ccc(O)cc1, Value: 0.1224 +Index: 31475, SMILES: O=C(O)c1ccc(O)cc1, Value: 0.1243 +Index: 31476, SMILES: O=C(O)c1ccc(O)cc1, Value: 0.126 +Index: 31477, SMILES: O=C(O)c1ccc(O)cc1, Value: 0.1279 +Index: 31478, SMILES: O=C(O)c1ccc(O)cc1, Value: 0.1299 +Index: 31479, SMILES: O=C(O)c1ccccc1[N+](=O)[O-], Value: 0.1172 +Index: 31480, SMILES: O=C(O)c1ccccc1[N+](=O)[O-], Value: 0.1219 +Index: 31481, SMILES: O=C(O)c1ccccc1[N+](=O)[O-], Value: 0.129 +Index: 31482, SMILES: O=C(O)c1ccccc1[N+](=O)[O-], Value: 0.1351 +Index: 31483, SMILES: O=C(O)c1ccccc1[N+](=O)[O-], Value: 0.1415 +Index: 31484, SMILES: O=C(O)c1ccccc1[N+](=O)[O-], Value: 0.1475 +Index: 31485, SMILES: O=C(O)c1ccccc1[N+](=O)[O-], Value: 0.1541 +Index: 31486, SMILES: O=C(O)c1ccccc1[N+](=O)[O-], Value: 0.1607 +Index: 31541, SMILES: ON(Cc1ccccc1)Cc1ccccc1, Value: 0.119 +Index: 31598, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1261 +Index: 31599, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1424 +Index: 31600, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.158 +Index: 31601, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1764 +Index: 31602, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1945 +Index: 31603, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2147 +Index: 31604, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2355 +Index: 31640, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1221 +Index: 31641, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1331 +Index: 31642, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1426 +Index: 31643, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1558 +Index: 31644, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1683 +Index: 31664, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1201 +Index: 31665, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1264 +Index: 31666, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1339 +Index: 31667, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.142 +Index: 31668, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1512 +Index: 31669, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1605 +Index: 31670, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1713 +Index: 31671, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.181 +Index: 31672, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1951 +Index: 31673, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.2096 +Index: 31683, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.15862 +Index: 31684, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.159 +Index: 31685, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.1594 +Index: 31686, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.15991 +Index: 31687, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.16031 +Index: 31688, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.16055 +Index: 31689, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.16079 +Index: 31690, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.16094 +Index: 31691, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.16125 +Index: 31692, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.16163 +Index: 31693, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.16201 +Index: 31823, SMILES: O=C(O)CCCC(=O)O, Value: 0.1698 +Index: 31824, SMILES: O=C(O)CCCC(=O)O, Value: 0.1836 +Index: 31825, SMILES: O=C(O)CCCC(=O)O, Value: 0.1979 +Index: 31826, SMILES: O=C(O)CCCC(=O)O, Value: 0.2281 +Index: 31827, SMILES: O=C(O)CCCC(=O)O, Value: 0.2508 +Index: 31842, SMILES: O=C(O)c1ccccc1, Value: 0.1742 +Index: 31843, SMILES: O=C(O)c1ccccc1, Value: 0.1811 +Index: 31844, SMILES: O=C(O)c1ccccc1, Value: 0.1967 +Index: 31845, SMILES: O=C(O)c1ccccc1, Value: 0.2206 +Index: 31846, SMILES: O=C(O)c1ccccc1, Value: 0.2421 +Index: 31847, SMILES: O=C(O)c1ccccc1, Value: 0.2648 +Index: 31848, SMILES: O=C(O)c1ccccc1, Value: 0.2898 +Index: 31849, SMILES: O=C(O)c1ccccc1, Value: 0.3146 +Index: 31850, SMILES: O=C(O)c1ccccc1, Value: 0.3366 +Index: 31851, SMILES: O=C(O)c1ccccc1, Value: 0.3619 +Index: 32018, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1188 +Index: 32019, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1405 +Index: 32020, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1614 +Index: 32021, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1844 +Index: 32022, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2368 +Index: 32023, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2864 +Index: 32024, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3264 +Index: 32025, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3667 +Index: 32026, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4097 +Index: 32027, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4699 +Index: 32028, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5455 +Index: 32029, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5969 +Index: 32030, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6696 +Index: 32031, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.7313 +Index: 32174, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1233 +Index: 32175, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1528 +Index: 32176, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1951 +Index: 32177, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2407 +Index: 32178, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.3035 +Index: 32179, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.3765 +Index: 32230, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1169 +Index: 32231, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1379 +Index: 32232, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1627 +Index: 32233, SMILES: Nc1cccc2cccc(N)c12, Value: 0.1891 +Index: 32248, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.1283 +Index: 32249, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.1498 +Index: 32250, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.1724 +Index: 32251, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.1981 +Index: 32252, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.2271 +Index: 32261, SMILES: CC(C)(C)NSc1nc2ccccc2s1, Value: 0.122 +Index: 32301, SMILES: N#Cc1cccc([N+](=O)[O-])c1, Value: 0.1187 +Index: 32391, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.1281 +Index: 32392, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.1606 +Index: 32393, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.2 +Index: 32394, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.2535 +Index: 32395, SMILES: CC(=O)c1cccc([N+](=O)[O-])c1, Value: 0.3282 +Index: 32400, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1368 +Index: 32401, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1638 +Index: 32402, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1952 +Index: 32403, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.2316 +Index: 32404, SMILES: CC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.2746 +Index: 32422, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1222 +Index: 32423, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1529 +Index: 32424, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1909 +Index: 32506, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1687 +Index: 32507, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1845 +Index: 32508, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1992 +Index: 32509, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2184 +Index: 32510, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2399 +Index: 32511, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2601 +Index: 32512, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2866 +Index: 32513, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.3107 +Index: 32514, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.3372 +Index: 32515, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.3683 +Index: 32516, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.3993 +Index: 32517, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.4272 +Index: 32518, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.4627 +Index: 32519, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.5001 +Index: 32520, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.5386 +Index: 32521, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.5749 +Index: 32522, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.6187 +Index: 32540, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.14637 +Index: 32541, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.18715 +Index: 32542, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.24296 +Index: 32544, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.33192 +Index: 32545, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.37372 +Index: 32546, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.41228 +Index: 32547, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.45331 +Index: 32548, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.48891 +Index: 32549, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.52597 +Index: 32569, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.1248 +Index: 32597, SMILES: c1ccc(CSSCc2ccccc2)cc1, Value: 0.1619 +Index: 32598, SMILES: c1ccc(CSSCc2ccccc2)cc1, Value: 0.1978 +Index: 32599, SMILES: c1ccc(CSSCc2ccccc2)cc1, Value: 0.2484 +Index: 32608, SMILES: O=C(O)c1cccc(Cl)c1C(=O)c1ccccc1, Value: 0.2812 +Index: 32609, SMILES: O=C(O)c1cccc(Cl)c1C(=O)c1ccccc1, Value: 0.3034 +Index: 32610, SMILES: O=C(O)c1cccc(Cl)c1C(=O)c1ccccc1, Value: 0.3257 +Index: 32611, SMILES: O=C(O)c1cccc(Cl)c1C(=O)c1ccccc1, Value: 0.3501 +Index: 32612, SMILES: O=C(O)c1cccc(Cl)c1C(=O)c1ccccc1, Value: 0.3795 +Index: 32613, SMILES: O=C(O)c1cccc(Cl)c1C(=O)c1ccccc1, Value: 0.4114 +Index: 32614, SMILES: O=C(O)c1cccc(Cl)c1C(=O)c1ccccc1, Value: 0.4492 +Index: 32615, SMILES: O=C(O)c1cccc(Cl)c1C(=O)c1ccccc1, Value: 0.4869 +Index: 32616, SMILES: O=C(O)c1cccc(Cl)c1C(=O)c1ccccc1, Value: 0.5297 +Index: 32617, SMILES: O=C(O)c1cccc(Cl)c1C(=O)c1ccccc1, Value: 0.5763 +Index: 32652, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.1346 +Index: 32653, SMILES: C[C@@H]1OC(=O)[C@H](C)OC1=O, Value: 0.157 +Index: 32664, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1577 +Index: 32665, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1855 +Index: 32666, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.2231 +Index: 32667, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.2656 +Index: 32668, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.3013 +Index: 32669, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.3437 +Index: 32670, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.3991 +Index: 32671, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.4547 +Index: 32672, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.5145 +Index: 32673, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.5817 +Index: 32674, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.6238 +Index: 32675, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1202 +Index: 32676, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1422 +Index: 32677, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1636 +Index: 32678, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1974 +Index: 32679, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.2281 +Index: 32680, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.2639 +Index: 32681, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.3153 +Index: 32682, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.3707 +Index: 32683, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.4101 +Index: 32684, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.4855 +Index: 32685, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.5498 +Index: 32721, SMILES: O=[PH](O)c1ccccc1, Value: 0.1247 +Index: 32722, SMILES: O=[PH](O)c1ccccc1, Value: 0.1615 +Index: 32723, SMILES: O=[PH](O)c1ccccc1, Value: 0.1985 +Index: 32724, SMILES: O=[PH](O)c1ccccc1, Value: 0.2545 +Index: 32725, SMILES: O=[PH](O)c1ccccc1, Value: 0.3158 +Index: 32726, SMILES: O=[PH](O)c1ccccc1, Value: 0.413 +Index: 32727, SMILES: CP(=O)(O)c1ccccc1, Value: 0.1201 +Index: 32728, SMILES: CP(=O)(O)c1ccccc1, Value: 0.147 +Index: 32729, SMILES: CP(=O)(O)c1ccccc1, Value: 0.1675 +Index: 32730, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2043 +Index: 32731, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2292 +Index: 32732, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3271 +Index: 32733, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3768 +Index: 32734, SMILES: CP(=O)(O)c1ccccc1, Value: 0.4182 +Index: 32735, SMILES: CP(=O)(O)c1ccccc1, Value: 0.4792 +Index: 32736, SMILES: CP(=O)(O)c1ccccc1, Value: 0.5643 +Index: 32744, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1298 +Index: 32750, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.1233 +Index: 32751, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.1499 +Index: 32752, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.1734 +Index: 32753, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.2089 +Index: 32754, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.2461 +Index: 32772, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1203 +Index: 32773, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1265 +Index: 32855, SMILES: C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4, Value: 0.13085 +Index: 32857, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.118879 +Index: 32858, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.15363 +Index: 32859, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.191764 +Index: 32860, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.234827 +Index: 32861, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.282491 +Index: 32862, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.333137 +Index: 32863, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.380972 +Index: 32864, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.431157 +Index: 32865, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.474974 +Index: 32890, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.122 +Index: 32891, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.14 +Index: 32892, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.16 +Index: 32893, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.186 +Index: 32894, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.228 +Index: 32895, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.262 +Index: 32911, SMILES: CP(=O)(c1ccccc1)c1ccccc1, Value: 0.13478 +Index: 32927, SMILES: c1ccc2ccccc2c1, Value: 0.2395 +Index: 32928, SMILES: c1ccc2ccccc2c1, Value: 0.3103 +Index: 32929, SMILES: c1ccc2ccccc2c1, Value: 0.3396 +Index: 32930, SMILES: c1ccc2ccccc2c1, Value: 0.3739 +Index: 32931, SMILES: c1ccc2ccccc2c1, Value: 0.4055 +Index: 32932, SMILES: c1ccc2ccccc2c1, Value: 0.4387 +Index: 32933, SMILES: c1ccc2ccccc2c1, Value: 0.4717 +Index: 32934, SMILES: c1ccc2ccccc2c1, Value: 0.5027 +Index: 32935, SMILES: c1ccc2ccccc2c1, Value: 0.5371 +Index: 32936, SMILES: c1ccc2ccccc2c1, Value: 0.5889 +Index: 32937, SMILES: c1ccc2ccccc2c1, Value: 0.6374 +Index: 32938, SMILES: c1ccc2ccccc2c1, Value: 0.6773 +Index: 32947, SMILES: C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4, Value: 0.12242806 +Index: 32951, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1239 +Index: 32952, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1525 +Index: 32953, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1952 +Index: 32954, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.2497 +Index: 32955, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.2999 +Index: 32956, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.3696 +Index: 32993, SMILES: O=C1C=CC(=O)c2ccccc21, Value: 0.11622 +Index: 32994, SMILES: O=C1C=CC(=O)c2ccccc21, Value: 0.11793 +Index: 32995, SMILES: O=C1C=CC(=O)c2ccccc21, Value: 0.13293 +Index: 32996, SMILES: O=C1C=CC(=O)c2ccccc21, Value: 0.14503 +Index: 32997, SMILES: O=C1C=CC(=O)c2ccccc21, Value: 0.15332 +Index: 33006, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1194 +Index: 33007, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1428 +Index: 33008, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1655 +Index: 33009, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1893 +Index: 33010, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2157 +Index: 33011, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2463 +Index: 33012, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2768 +Index: 33013, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3114 +Index: 33014, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3507 +Index: 33015, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.4036 +Index: 33017, SMILES: C1=Cc2cccc3cccc1c23, Value: 0.12178 +Index: 33018, SMILES: C1=Cc2cccc3cccc1c23, Value: 0.14175 +Index: 33019, SMILES: C1=Cc2cccc3cccc1c23, Value: 0.16702 +Index: 33020, SMILES: C1=Cc2cccc3cccc1c23, Value: 0.19355 +Index: 33021, SMILES: C1=Cc2cccc3cccc1c23, Value: 0.22391 +Index: 33022, SMILES: C1=Cc2cccc3cccc1c23, Value: 0.2559 +Index: 33023, SMILES: C1=Cc2cccc3cccc1c23, Value: 0.29854 +Index: 33024, SMILES: C1=Cc2cccc3cccc1c23, Value: 0.34574 +Index: 33025, SMILES: C1=Cc2cccc3cccc1c23, Value: 0.39835 +Index: 33051, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1295 +Index: 33052, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1545 +Index: 33053, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.2005 +Index: 33054, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.2521 +Index: 33055, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.3077 +Index: 33056, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.3671 +Index: 33064, SMILES: O=C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21, Value: 0.1346 +Index: 33065, SMILES: O=C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21, Value: 0.161 +Index: 33080, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.13 +Index: 33081, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.18 +Index: 33082, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.24 +Index: 33083, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.32 +Index: 33184, SMILES: Cc1cc(C)[nH]n1, Value: 0.1329 +Index: 33185, SMILES: Cc1cc(C)[nH]n1, Value: 0.1515 +Index: 33186, SMILES: Cc1cc(C)[nH]n1, Value: 0.171 +Index: 33301, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1258 +Index: 33302, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.144 +Index: 33303, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1665 +Index: 33304, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1878 +Index: 33305, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2153 +Index: 33306, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2447 +Index: 33307, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2763 +Index: 33308, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.31 +Index: 33309, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3473 +Index: 33310, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3849 +Index: 33311, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.4278 +Index: 33694, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.1325 +Index: 33695, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.153 +Index: 33696, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.1727 +Index: 33697, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.1927 +Index: 33698, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2091 +Index: 33699, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2266 +Index: 33700, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2434 +Index: 33760, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.122 +Index: 33761, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1706 +Index: 33762, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2344 +Index: 33763, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3126 +Index: 33834, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.119962 +Index: 33835, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.143082 +Index: 33836, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.16631 +Index: 33926, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.14578 +Index: 33927, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.20014 +Index: 33929, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1184 +Index: 33930, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.139 +Index: 33931, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.163 +Index: 33932, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1909 +Index: 33933, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2232 +Index: 33934, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2607 +Index: 33935, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3041 +Index: 33936, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3542 +Index: 34000, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1218 +Index: 34001, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1938 +Index: 34002, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2793 +Index: 34003, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3548 +Index: 34004, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.521 +Index: 34005, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6431 +Index: 34270, SMILES: N#Cc1cccnc1, Value: 0.17 +Index: 34271, SMILES: N#Cc1cccnc1, Value: 0.3 +Index: 34272, SMILES: N#Cc1cccnc1, Value: 0.435 +Index: 34273, SMILES: N#Cc1cccnc1, Value: 0.6 +Index: 34279, SMILES: N#Cc1ccncc1, Value: 0.172 +Index: 34280, SMILES: N#Cc1ccncc1, Value: 0.304 +Index: 34298, SMILES: Cc1cc(C)nc(Nc2ccccc2)n1, Value: 0.13 +Index: 34299, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.15 +Index: 34300, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1716 +Index: 34301, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1985 +Index: 34302, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2263 +Index: 34303, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2562 +Index: 34304, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.288 +Index: 34305, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3215 +Index: 34306, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3574 +Index: 34307, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3942 +Index: 34308, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4328 +Index: 34335, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1351 +Index: 34336, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1606 +Index: 34337, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.1983 +Index: 34338, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2445 +Index: 34339, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2946 +Index: 34340, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3783 +Index: 34341, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.4527 +Index: 34342, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.5968 +Index: 34343, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.7856 +Index: 34355, SMILES: OC/C=C/c1ccccc1, Value: 0.165 +Index: 34356, SMILES: OC/C=C/c1ccccc1, Value: 0.217 +Index: 34357, SMILES: OC/C=C/c1ccccc1, Value: 0.287 +Index: 34358, SMILES: OC/C=C/c1ccccc1, Value: 0.366 +Index: 34359, SMILES: OC/C=C/c1ccccc1, Value: 0.431 +Index: 34360, SMILES: OC/C=C/c1ccccc1, Value: 0.498 +Index: 34361, SMILES: OC/C=C/c1ccccc1, Value: 0.576 +Index: 34430, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1404 +Index: 34431, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1681 +Index: 34432, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2045 +Index: 34433, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2496 +Index: 34434, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.3035 +Index: 34472, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.117 +Index: 34473, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1306 +Index: 34474, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1471 +Index: 34475, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1664 +Index: 34476, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1906 +Index: 34503, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1277 +Index: 34504, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1576 +Index: 34505, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1945 +Index: 34506, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.238 +Index: 34507, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2889 +Index: 34508, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3514 +Index: 34509, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4224 +Index: 34510, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5138 +Index: 34529, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1343 +Index: 34530, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.166 +Index: 34531, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2022 +Index: 34532, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.241 +Index: 34533, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2918 +Index: 34534, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3483 +Index: 34535, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.4027 +Index: 34546, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.2787 +Index: 34547, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.7086 +Index: 34575, SMILES: O=C(Oc1ccccc1)Oc1ccccc1, Value: 0.191 +Index: 34576, SMILES: O=C(Oc1ccccc1)Oc1ccccc1, Value: 0.4252 +Index: 34603, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1354 +Index: 34604, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1609 +Index: 34605, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1904 +Index: 34735, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1328 +Index: 34736, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.159 +Index: 34737, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1872 +Index: 34738, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.22 +Index: 34739, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2558 +Index: 34814, SMILES: CN(C)CCC=C1c2ccccc2CCc2ccccc21.Cl, Value: 0.1166868 +Index: 34815, SMILES: CN(C)CCC=C1c2ccccc2CCc2ccccc21.Cl, Value: 0.1332118 +Index: 34941, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.15806 +Index: 34996, SMILES: O=P(O)(O)c1ccccc1, Value: 0.16133 +Index: 34997, SMILES: O=P(O)(O)c1ccccc1, Value: 0.17457 +Index: 34998, SMILES: O=P(O)(O)c1ccccc1, Value: 0.1865 +Index: 34999, SMILES: O=P(O)(O)c1ccccc1, Value: 0.19913 +Index: 35000, SMILES: O=P(O)(O)c1ccccc1, Value: 0.21177 +Index: 35001, SMILES: O=P(O)(O)c1ccccc1, Value: 0.22607 +Index: 35002, SMILES: O=P(O)(O)c1ccccc1, Value: 0.24178 +Index: 35003, SMILES: O=P(O)(O)c1ccccc1, Value: 0.25755 +Index: 35004, SMILES: O=P(O)(O)c1ccccc1, Value: 0.27264 +Index: 35005, SMILES: O=P(O)(O)c1ccccc1, Value: 0.28749 +Index: 35006, SMILES: O=P(O)(O)c1ccccc1, Value: 0.30767 +Index: 35007, SMILES: O=P(O)(O)c1ccccc1, Value: 0.32275 +Index: 35055, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1291 +Index: 35073, SMILES: CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1, Value: 0.12221 +Index: 35089, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1231 +Index: 35090, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1485 +Index: 35091, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1748 +Index: 35092, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.2037 +Index: 35109, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1372 +Index: 35110, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1668 +Index: 35111, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2037 +Index: 35112, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2467 +Index: 35113, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3015 +Index: 35114, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3685 +Index: 35115, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4354 +Index: 35116, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5298 +Index: 35156, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1336 +Index: 35157, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1579 +Index: 35158, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1902 +Index: 35159, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2219 +Index: 35160, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2636 +Index: 35161, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3103 +Index: 35162, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3578 +Index: 35163, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.4215 +Index: 35188, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.123 +Index: 35189, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1337 +Index: 35190, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1436 +Index: 35261, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.131 +Index: 35262, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.155 +Index: 35263, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1825 +Index: 35264, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2106 +Index: 35265, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2434 +Index: 35266, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2814 +Index: 35267, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.34153 +Index: 35268, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.32537 +Index: 35269, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.30269 +Index: 35270, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.28092 +Index: 35271, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.26424 +Index: 35272, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.24875 +Index: 35273, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.23075 +Index: 35274, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.21601 +Index: 35275, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.20549 +Index: 35276, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.19672 +Index: 35375, SMILES: COc1cc(CO)ccc1O, Value: 0.155 +Index: 35421, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1265 +Index: 35422, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1501 +Index: 35423, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1739 +Index: 35424, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.204 +Index: 35425, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2379 +Index: 35426, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2732 +Index: 35497, SMILES: ON(Cc1ccccc1)Cc1ccccc1, Value: 0.1231 +Index: 35498, SMILES: ON(Cc1ccccc1)Cc1ccccc1, Value: 0.1366 +Index: 35499, SMILES: ON(Cc1ccccc1)Cc1ccccc1, Value: 0.1524 +Index: 35500, SMILES: ON(Cc1ccccc1)Cc1ccccc1, Value: 0.1689 +Index: 35524, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1905 +Index: 35525, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2101 +Index: 35526, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.241 +Index: 35527, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2682 +Index: 35528, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3069 +Index: 35529, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3594 +Index: 35530, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.4102 +Index: 35531, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.4605 +Index: 35532, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.5135 +Index: 35537, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.12941 +Index: 35538, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.15594 +Index: 35539, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.1888 +Index: 35540, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.2281 +Index: 35541, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.28732 +Index: 35542, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.3624 +Index: 35553, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3431 +Index: 35554, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3614 +Index: 35555, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3766 +Index: 35556, SMILES: c1cnc2[nH]ccc2c1, Value: 0.3968 +Index: 35557, SMILES: c1cnc2[nH]ccc2c1, Value: 0.4187 +Index: 35558, SMILES: c1cnc2[nH]ccc2c1, Value: 0.4364 +Index: 35559, SMILES: c1cnc2[nH]ccc2c1, Value: 0.4582 +Index: 35560, SMILES: c1cnc2[nH]ccc2c1, Value: 0.4789 +Index: 35561, SMILES: c1cnc2[nH]ccc2c1, Value: 0.5 +Index: 35562, SMILES: c1cnc2[nH]ccc2c1, Value: 0.5233 +Index: 35574, SMILES: C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3C(=C)C[C@@]21CC, Value: 0.125 +Index: 35575, SMILES: C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3C(=C)C[C@@]21CC, Value: 0.148 +Index: 35576, SMILES: C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3C(=C)C[C@@]21CC, Value: 0.173 +Index: 35577, SMILES: C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3C(=C)C[C@@]21CC, Value: 0.2 +Index: 35578, SMILES: C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3C(=C)C[C@@]21CC, Value: 0.223 +Index: 35579, SMILES: C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3C(=C)C[C@@]21CC, Value: 0.263 +Index: 35580, SMILES: C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3C(=C)C[C@@]21CC, Value: 0.299 +Index: 35581, SMILES: C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3C(=C)C[C@@]21CC, Value: 0.332 +Index: 35594, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.11919 +Index: 35595, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.13 +Index: 35596, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.14382 +Index: 35597, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.1593 +Index: 35598, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.17409 +Index: 35599, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.1936 +Index: 35600, SMILES: CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1, Value: 0.21441 +Index: 35611, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.16878 +Index: 35612, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.18291 +Index: 35613, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.19597 +Index: 35614, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.20913 +Index: 35615, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.22217 +Index: 35616, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.23584 +Index: 35617, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.24762 +Index: 35618, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.25953 +Index: 35619, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.27092 +Index: 35620, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.28183 +Index: 35621, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.29278 +Index: 35622, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.22862 +Index: 35623, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.26361 +Index: 35624, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.29662 +Index: 35625, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.33859 +Index: 35626, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.37405 +Index: 35627, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.41144 +Index: 35628, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.45175 +Index: 35629, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.49233 +Index: 35630, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.52769 +Index: 35631, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.56328 +Index: 35632, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.60393 +Index: 35633, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1298 +Index: 35634, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1561 +Index: 35635, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1746 +Index: 35636, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1935 +Index: 35637, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2239 +Index: 35638, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2625 +Index: 35639, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3258 +Index: 35640, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3638 +Index: 35641, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4042 +Index: 35642, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4426 +Index: 35643, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4972 +Index: 35644, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5614 +Index: 35645, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6137 +Index: 35646, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6745 +Index: 35647, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.7497 +Index: 35657, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2132 +Index: 35658, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2433 +Index: 35659, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.2736 +Index: 35660, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.312 +Index: 35661, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.3504 +Index: 35662, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.3959 +Index: 35663, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.4457 +Index: 35664, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.5021 +Index: 35665, SMILES: O=[N+]([O-])c1ncccc1O, Value: 0.5698 +Index: 35698, SMILES: NC(=O)c1ccccc1N, Value: 0.2263 +Index: 35699, SMILES: NC(=O)c1ccccc1N, Value: 0.2369 +Index: 35700, SMILES: NC(=O)c1ccccc1N, Value: 0.2451 +Index: 35701, SMILES: NC(=O)c1ccccc1N, Value: 0.2547 +Index: 35702, SMILES: NC(=O)c1ccccc1N, Value: 0.2631 +Index: 35703, SMILES: NC(=O)c1ccccc1N, Value: 0.275 +Index: 35704, SMILES: NC(=O)c1ccccc1N, Value: 0.2839 +Index: 35705, SMILES: NC(=O)c1ccccc1N, Value: 0.2964 +Index: 35706, SMILES: NC(=O)c1ccccc1N, Value: 0.3097 +Index: 35707, SMILES: NC(=O)c1ccccc1N, Value: 0.3255 +Index: 35708, SMILES: NC(=O)c1ccccc1N, Value: 0.3389 +Index: 35719, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.123 +Index: 35780, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.311 +Index: 35781, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.32 +Index: 35782, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.333 +Index: 35783, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.346 +Index: 35784, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.357 +Index: 35785, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.37 +Index: 35786, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.382 +Index: 35787, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.393 +Index: 35788, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.403 +Index: 35789, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.416 +Index: 35793, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.1185 +Index: 35794, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.1333 +Index: 35795, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.1536 +Index: 35796, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.1706 +Index: 35797, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.1946 +Index: 35798, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.2178 +Index: 35813, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.2676 +Index: 35814, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.276 +Index: 35815, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.2885 +Index: 35816, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.3009 +Index: 35817, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.3154 +Index: 35818, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.3319 +Index: 35833, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1258 +Index: 35834, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1425 +Index: 35835, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1649 +Index: 35838, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1164 +Index: 35839, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1291 +Index: 35840, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1445 +Index: 35841, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1633 +Index: 35842, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.1869 +Index: 35843, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.2147 +Index: 35844, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.2445 +Index: 35845, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.2792 +Index: 35846, SMILES: CC(C)(C)OC(=O)N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F, Value: 0.322 +Index: 35866, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.11528 +Index: 35867, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.13202 +Index: 35868, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.15703 +Index: 35869, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.18269 +Index: 35870, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.2083 +Index: 35871, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.23954 +Index: 35922, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1772 +Index: 35923, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1991 +Index: 35924, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.215 +Index: 35925, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.2381 +Index: 35926, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.2592 +Index: 35927, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.2867 +Index: 35928, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.31 +Index: 35929, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.3374 +Index: 35930, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.151 +Index: 35931, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.1746 +Index: 35932, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.2001 +Index: 35933, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.2225 +Index: 35934, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.2526 +Index: 35935, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.2852 +Index: 35936, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.3151 +Index: 35937, SMILES: c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1, Value: 0.3461 +Index: 35984, SMILES: Nc1ccc(O)c(C(=O)O)c1, Value: 0.815521 +Index: 35985, SMILES: Nc1ccc(O)c(C(=O)O)c1, Value: 0.819627 +Index: 35986, SMILES: Nc1ccc(O)c(C(=O)O)c1, Value: 0.823619 +Index: 35987, SMILES: Nc1ccc(O)c(C(=O)O)c1, Value: 0.827622 +Index: 35988, SMILES: Nc1ccc(O)c(C(=O)O)c1, Value: 0.831734 +Index: 35989, SMILES: Nc1ccc(O)c(C(=O)O)c1, Value: 0.835734 +Index: 35990, SMILES: Nc1ccc(O)c(C(=O)O)c1, Value: 0.83972 +Index: 35991, SMILES: Nc1ccc(O)c(C(=O)O)c1, Value: 0.843804 +Index: 35992, SMILES: Nc1ccc(O)c(C(=O)O)c1, Value: 0.847909 +Index: 35993, SMILES: Nc1ccc(O)c(C(=O)O)c1, Value: 0.852012 +Index: 35994, SMILES: Nc1ccc(O)c(C(=O)O)c1, Value: 0.856024 +Index: 35995, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1911 +Index: 35996, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.1978 +Index: 35997, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2045 +Index: 35998, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2109 +Index: 35999, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2185 +Index: 36000, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2309 +Index: 36001, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2347 +Index: 36002, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2496 +Index: 36003, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2591 +Index: 36004, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.271 +Index: 36005, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.282 +Index: 36006, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.2959 +Index: 36007, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.3061 +Index: 36008, SMILES: O=C(O)CCCCCC(=O)O, Value: 0.3164 +Index: 36038, SMILES: Clc1ccc2c(Cl)ccnc2c1, Value: 0.1190639 +Index: 36039, SMILES: Clc1ccc2c(Cl)ccnc2c1, Value: 0.1400418 +Index: 36040, SMILES: c1ccc2ccccc2c1, Value: 0.2412 +Index: 36041, SMILES: c1ccc2ccccc2c1, Value: 0.2726 +Index: 36042, SMILES: c1ccc2ccccc2c1, Value: 0.2918 +Index: 36043, SMILES: c1ccc2ccccc2c1, Value: 0.3242 +Index: 36044, SMILES: c1ccc2ccccc2c1, Value: 0.3516 +Index: 36045, SMILES: c1ccc2ccccc2c1, Value: 0.3849 +Index: 36046, SMILES: c1ccc2ccccc2c1, Value: 0.4284 +Index: 36047, SMILES: c1ccc2ccccc2c1, Value: 0.4685 +Index: 36048, SMILES: c1ccc2ccccc2c1, Value: 0.5102 +Index: 36049, SMILES: c1ccc2ccccc2c1, Value: 0.5657 +Index: 36050, SMILES: c1ccc2ccccc2c1, Value: 0.5999 +Index: 36051, SMILES: c1ccc2ccccc2c1, Value: 0.6292 +Index: 36099, SMILES: CCOc1ccc(NC(C)=O)cc1, Value: 0.12277 +Index: 36100, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.2034 +Index: 36101, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.2038 +Index: 36102, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.2043 +Index: 36103, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.205 +Index: 36104, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.2057 +Index: 36105, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.2066 +Index: 36106, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.2076 +Index: 36107, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.2088 +Index: 36108, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.21 +Index: 36109, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.2114 +Index: 36110, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.2129 +Index: 36111, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.2145 +Index: 36116, SMILES: O=C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21, Value: 0.1242 +Index: 36117, SMILES: O=C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21, Value: 0.1402 +Index: 36118, SMILES: O=C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21, Value: 0.1619 +Index: 36119, SMILES: O=C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21, Value: 0.1868 +Index: 36145, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.1257 +Index: 36146, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.1393 +Index: 36147, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.156 +Index: 36148, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.1732 +Index: 36181, SMILES: O=C1CCC(=O)O1, Value: 0.115 +Index: 36182, SMILES: O=C1CCC(=O)O1, Value: 0.129 +Index: 36183, SMILES: O=C1CCC(=O)O1, Value: 0.145 +Index: 36184, SMILES: O=C1CCC(=O)O1, Value: 0.164 +Index: 36216, SMILES: O=C1C(=Cc2ccco2)CCC1=Cc1ccco1, Value: 0.124832 +Index: 36217, SMILES: O=C1C(=Cc2ccco2)CCC1=Cc1ccco1, Value: 0.142022 +Index: 36218, SMILES: O=C1C(=Cc2ccco2)CCC1=Cc1ccco1, Value: 0.165593 +Index: 36373, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.125438 +Index: 36416, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.125402 +Index: 36417, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.148852 +Index: 36418, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.177193 +Index: 36419, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.208023 +Index: 36515, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.128 +Index: 36516, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.151 +Index: 36517, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.173 +Index: 36518, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1966 +Index: 36519, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2351 +Index: 36520, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2688 +Index: 36521, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.3117 +Index: 36522, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.357 +Index: 36523, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.4222 +Index: 36524, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.4748 +Index: 36525, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.5434 +Index: 36529, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1186 +Index: 36530, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1296 +Index: 36531, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1409 +Index: 36532, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1529 +Index: 36533, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.165 +Index: 36534, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1787 +Index: 36542, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1238 +Index: 36543, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1343 +Index: 36602, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1256 +Index: 36603, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1438 +Index: 36604, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1655 +Index: 36605, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1894 +Index: 36606, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.2161 +Index: 36653, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.2536 +Index: 36654, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.282 +Index: 36655, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3148 +Index: 36656, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.351 +Index: 36657, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.3887 +Index: 36658, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4262 +Index: 36659, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4622 +Index: 36660, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.4963 +Index: 36661, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.5284 +Index: 36662, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.5673 +Index: 36671, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.1346 +Index: 36688, SMILES: O=C(O)c1ccccc1, Value: 0.1314 +Index: 36689, SMILES: O=C(O)c1ccccc1, Value: 0.1479 +Index: 36690, SMILES: O=C(O)c1ccccc1, Value: 0.1657 +Index: 36691, SMILES: O=C(O)c1ccccc1, Value: 0.1856 +Index: 36692, SMILES: O=C(O)c1ccccc1, Value: 0.2064 +Index: 36693, SMILES: O=C(O)c1ccccc1, Value: 0.2293 +Index: 36694, SMILES: O=C(O)c1ccccc1, Value: 0.2543 +Index: 36695, SMILES: O=C(O)c1ccccc1, Value: 0.2813 +Index: 36696, SMILES: O=C(O)c1ccccc1, Value: 0.3106 +Index: 36797, SMILES: C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4, Value: 0.11716 +Index: 36877, SMILES: Cc1ccc(NC(=O)C(C)Cl)cc1, Value: 0.11545 +Index: 36878, SMILES: Cc1ccc(NC(=O)C(C)Cl)cc1, Value: 0.12804 +Index: 36879, SMILES: Cc1ccc(NC(=O)C(C)Cl)cc1, Value: 0.13038 +Index: 36880, SMILES: Cc1ccc(NC(=O)C(C)Cl)cc1, Value: 0.14888 +Index: 36881, SMILES: Cc1ccc(NC(=O)C(C)Cl)cc1, Value: 0.17349 +Index: 36882, SMILES: Cc1ccc(NC(=O)C(C)Cl)cc1, Value: 0.20785 +Index: 36886, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1227 +Index: 36887, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1335 +Index: 36888, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1437 +Index: 36889, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1559 +Index: 36890, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1687 +Index: 36891, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1838 +Index: 36892, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2011 +Index: 36933, SMILES: S=c1[nH]c2ccccc2s1, Value: 0.1164 +Index: 36934, SMILES: S=c1[nH]c2ccccc2s1, Value: 0.1202 +Index: 36935, SMILES: S=c1[nH]c2ccccc2s1, Value: 0.1242 +Index: 36936, SMILES: S=c1[nH]c2ccccc2s1, Value: 0.1278 +Index: 36937, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1202 +Index: 36938, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1278 +Index: 36939, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1358 +Index: 36940, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1443 +Index: 36941, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1528 +Index: 36942, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1619 +Index: 36943, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1714 +Index: 36944, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.181 +Index: 36945, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1911 +Index: 36946, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.2018 +Index: 36947, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.213 +Index: 36948, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.2242 +Index: 36949, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.236 +Index: 36950, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.2487 +Index: 36951, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.2614 +Index: 36953, SMILES: CC(C)c1ncc[nH]1, Value: 0.1157 +Index: 36954, SMILES: CC(C)c1ncc[nH]1, Value: 0.1206 +Index: 36955, SMILES: CC(C)c1ncc[nH]1, Value: 0.1266 +Index: 36956, SMILES: CC(C)c1ncc[nH]1, Value: 0.1326 +Index: 36957, SMILES: CC(C)c1ncc[nH]1, Value: 0.1387 +Index: 36958, SMILES: CC(C)c1ncc[nH]1, Value: 0.1449 +Index: 36959, SMILES: CC(C)c1ncc[nH]1, Value: 0.1516 +Index: 36960, SMILES: CC(C)c1ncc[nH]1, Value: 0.1592 +Index: 36961, SMILES: CC(C)c1ncc[nH]1, Value: 0.167 +Index: 36962, SMILES: CC(C)c1ncc[nH]1, Value: 0.1767 +Index: 36963, SMILES: CC(C)c1ncc[nH]1, Value: 0.1852 +Index: 36964, SMILES: CC(C)c1ncc[nH]1, Value: 0.1942 +Index: 36965, SMILES: CC(C)c1ncc[nH]1, Value: 0.2027 +Index: 36966, SMILES: CC(C)c1ncc[nH]1, Value: 0.2127 +Index: 37018, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1201 +Index: 37019, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1266 +Index: 37020, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1339 +Index: 37021, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1412 +Index: 37022, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1486 +Index: 37023, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1566 +Index: 37024, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1649 +Index: 37025, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.1737 +Index: 37026, SMILES: Cc1cc([N+](=O)[O-])ccc1N, Value: 0.183 +Index: 37048, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1223 +Index: 37049, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.147 +Index: 37050, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1744 +Index: 37083, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1174 +Index: 37084, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.134 +Index: 37085, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1558 +Index: 37103, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1154 +Index: 37104, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1176 +Index: 37105, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1197 +Index: 37106, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1224 +Index: 37107, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1249 +Index: 37108, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1274 +Index: 37109, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1304 +Index: 37110, SMILES: O=S(=O)(c1ccc(O)cc1)c1ccccc1O, Value: 0.1341 +Index: 37124, SMILES: CP(=O)(O)O, Value: 0.1224 +Index: 37125, SMILES: CP(=O)(O)O, Value: 0.1926 +Index: 37126, SMILES: CP(=O)(O)O, Value: 0.335 +Index: 37204, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.1848 +Index: 37205, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.1993 +Index: 37206, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2254 +Index: 37207, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2528 +Index: 37208, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2801 +Index: 37209, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.3053 +Index: 37210, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.3292 +Index: 37211, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.3517 +Index: 37212, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.3721 +Index: 37217, SMILES: CSCCC(NC(C)=O)C(=O)O, Value: 0.12098 +Index: 37251, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1247 +Index: 37252, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1679 +Index: 37253, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2276 +Index: 37254, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.293 +Index: 37255, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3768 +Index: 37291, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.12745 +Index: 37292, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.156581 +Index: 37293, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.19252 +Index: 37294, SMILES: CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)O, Value: 0.232208 +Index: 37364, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.13221 +Index: 37365, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.1887 +Index: 37451, SMILES: OC/C=C/c1ccccc1, Value: 0.142 +Index: 37452, SMILES: OC/C=C/c1ccccc1, Value: 0.191 +Index: 37453, SMILES: OC/C=C/c1ccccc1, Value: 0.255 +Index: 37454, SMILES: OC/C=C/c1ccccc1, Value: 0.321 +Index: 37455, SMILES: OC/C=C/c1ccccc1, Value: 0.395 +Index: 37456, SMILES: OC/C=C/c1ccccc1, Value: 0.459 +Index: 37457, SMILES: OC/C=C/c1ccccc1, Value: 0.53 +Index: 37458, SMILES: OC/C=C/c1ccccc1, Value: 0.592 +Index: 37557, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1155 +Index: 37578, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.2011 +Index: 37579, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.3976 +Index: 37580, SMILES: O=C(Oc1ccccc1)c1ccccc1O, Value: 0.752 +Index: 37590, SMILES: O=C(Oc1ccccc1)Oc1ccccc1, Value: 0.2018 +Index: 37591, SMILES: O=C(Oc1ccccc1)Oc1ccccc1, Value: 0.43 +Index: 37641, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.117 +Index: 37642, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1391 +Index: 37643, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1615 +Index: 37644, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1857 +Index: 37645, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.2126 +Index: 37791, SMILES: O=C(O)COc1ccc(Cl)cc1, Value: 0.124 +Index: 37792, SMILES: O=C(O)COc1ccc(Cl)cc1, Value: 0.135 +Index: 37793, SMILES: O=C(O)COc1ccc(Cl)cc1, Value: 0.1464 +Index: 37794, SMILES: O=C(O)COc1ccc(Cl)cc1, Value: 0.1599 +Index: 37795, SMILES: O=C(O)COc1ccc(Cl)cc1, Value: 0.1763 +Index: 37796, SMILES: O=C(O)COc1ccc(Cl)cc1, Value: 0.1938 +Index: 37797, SMILES: O=C(O)COc1ccc(Cl)cc1, Value: 0.2116 +Index: 37798, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.1297 +Index: 37799, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.1472 +Index: 37800, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.1649 +Index: 37801, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.1856 +Index: 37802, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2113 +Index: 37803, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.244 +Index: 37804, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2836 +Index: 37805, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.3432 +Index: 37810, SMILES: CSCCC(NC(C)=O)C(=O)O, Value: 0.16733 +Index: 37839, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1412 +Index: 37840, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1622 +Index: 37841, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1876 +Index: 37842, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2173 +Index: 37843, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2574 +Index: 37844, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3159 +Index: 37845, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3683 +Index: 37846, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.4268 +Index: 37847, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.4865 +Index: 37868, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.2062 +Index: 37869, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.2171 +Index: 37870, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.2361 +Index: 37871, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.258 +Index: 37872, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.2853 +Index: 37873, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.3195 +Index: 37874, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.354 +Index: 37875, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.394 +Index: 37876, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.443 +Index: 37949, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2054 +Index: 37950, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2244 +Index: 37951, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2454 +Index: 37952, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2636 +Index: 37953, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2854 +Index: 37954, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.3066 +Index: 37990, SMILES: CC(=O)N1CCC[C@H]1C(=O)O, Value: 0.12974 +Index: 38011, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.1182 +Index: 38012, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.1386 +Index: 38013, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.1621 +Index: 38014, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.19109 +Index: 38015, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.24454 +Index: 38016, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.3183 +Index: 38017, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.37144 +Index: 38018, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.42489 +Index: 38019, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.48834 +Index: 38020, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.56179 +Index: 38027, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.1312 +Index: 38028, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.19 +Index: 38029, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.2582 +Index: 38030, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.3418 +Index: 38031, SMILES: Oc1ccc(OCc2ccccc2)cc1, Value: 0.435 +Index: 38067, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.1328 +Index: 38089, SMILES: Nc1ccc(Cl)cc1[N+](=O)[O-], Value: 0.1331 +Index: 38136, SMILES: O=P(O)(O)c1ccccc1, Value: 0.18599 +Index: 38137, SMILES: O=P(O)(O)c1ccccc1, Value: 0.20771 +Index: 38138, SMILES: O=P(O)(O)c1ccccc1, Value: 0.22377 +Index: 38139, SMILES: O=P(O)(O)c1ccccc1, Value: 0.2431 +Index: 38140, SMILES: O=P(O)(O)c1ccccc1, Value: 0.26391 +Index: 38141, SMILES: O=P(O)(O)c1ccccc1, Value: 0.28571 +Index: 38142, SMILES: O=P(O)(O)c1ccccc1, Value: 0.30693 +Index: 38143, SMILES: O=P(O)(O)c1ccccc1, Value: 0.33582 +Index: 38144, SMILES: O=P(O)(O)c1ccccc1, Value: 0.36008 +Index: 38145, SMILES: O=P(O)(O)c1ccccc1, Value: 0.38761 +Index: 38172, SMILES: O=C1Cc2ccccc2N1, Value: 0.2755 +Index: 38173, SMILES: O=C1Cc2ccccc2N1, Value: 0.3094 +Index: 38174, SMILES: O=C1Cc2ccccc2N1, Value: 0.3357 +Index: 38175, SMILES: O=C1Cc2ccccc2N1, Value: 0.3634 +Index: 38176, SMILES: O=C1Cc2ccccc2N1, Value: 0.3936 +Index: 38177, SMILES: O=C1Cc2ccccc2N1, Value: 0.421 +Index: 38178, SMILES: O=C1Cc2ccccc2N1, Value: 0.4479 +Index: 38179, SMILES: O=C1Cc2ccccc2N1, Value: 0.4754 +Index: 38180, SMILES: O=C1Cc2ccccc2N1, Value: 0.502 +Index: 38181, SMILES: O=C1Cc2ccccc2N1, Value: 0.5286 +Index: 38182, SMILES: O=C1Cc2ccccc2N1, Value: 0.5672 +Index: 38219, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.1323 +Index: 38220, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.1535 +Index: 38221, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.1752 +Index: 38254, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2159 +Index: 38255, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2262 +Index: 38256, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2408 +Index: 38257, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2568 +Index: 38258, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2778 +Index: 38259, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.3033 +Index: 38260, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.3339 +Index: 38261, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.3707 +Index: 38262, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.4145 +Index: 38263, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.4685 +Index: 38265, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1194 +Index: 38266, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1297 +Index: 38267, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1417 +Index: 38268, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.154 +Index: 38269, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1689 +Index: 38284, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1168 +Index: 38285, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1267 +Index: 38286, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1369 +Index: 38287, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1477 +Index: 38288, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1587 +Index: 38289, SMILES: Cc1cccc(C(=O)O)c1N, Value: 0.1706 +Index: 38338, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1341 +Index: 38339, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.1606 +Index: 38340, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.193 +Index: 38341, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.2321 +Index: 38342, SMILES: N#CCc1ccc([N+](=O)[O-])cc1, Value: 0.2835 +Index: 38398, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.256 +Index: 38399, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.273 +Index: 38400, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.296 +Index: 38401, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.32 +Index: 38402, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.332 +Index: 38403, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.346 +Index: 38404, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.357 +Index: 38405, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.367 +Index: 38406, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.379 +Index: 38407, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.391 +Index: 38408, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.403 +Index: 38409, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.424 +Index: 38431, SMILES: Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1, Value: 0.1163 +Index: 38432, SMILES: Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1, Value: 0.1287 +Index: 38433, SMILES: Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1, Value: 0.1433 +Index: 38434, SMILES: Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1, Value: 0.1589 +Index: 38435, SMILES: Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1, Value: 0.1788 +Index: 38436, SMILES: Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1, Value: 0.2037 +Index: 38437, SMILES: Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1, Value: 0.2347 +Index: 38461, SMILES: Cc1ccc2ccccc2c1, Value: 0.4677 +Index: 38462, SMILES: Cc1ccc2ccccc2c1, Value: 0.5081 +Index: 38463, SMILES: Cc1ccc2ccccc2c1, Value: 0.5746 +Index: 38464, SMILES: Cc1ccc2ccccc2c1, Value: 0.6499 +Index: 38465, SMILES: Cc1ccc2ccccc2c1, Value: 0.7258 +Index: 38466, SMILES: Cc1ccc2ccccc2c1, Value: 0.8168 +Index: 38467, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.33971 +Index: 38468, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.38075 +Index: 38469, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.42936 +Index: 38470, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.4746 +Index: 38471, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.51244 +Index: 38472, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.54318 +Index: 38473, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.58893 +Index: 38474, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.63689 +Index: 38631, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.185 +Index: 38632, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2256 +Index: 38633, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2681 +Index: 38634, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.296 +Index: 38635, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.3281 +Index: 38636, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.3672 +Index: 38637, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.3959 +Index: 38638, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.4202 +Index: 38639, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.4393 +Index: 38642, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1237 +Index: 38643, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.142 +Index: 38644, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1664 +Index: 38645, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2052 +Index: 38646, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2502 +Index: 38647, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2978 +Index: 38648, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.359 +Index: 38649, SMILES: O=C(O)c1ccccc1O, Value: 0.261 +Index: 38671, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.1156 +Index: 38672, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.124 +Index: 38673, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.1319 +Index: 38674, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.1393 +Index: 38675, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.1459 +Index: 38676, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.1521 +Index: 38677, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.1578 +Index: 38678, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.1627 +Index: 38679, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.1673 +Index: 38680, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O, Value: 0.1712 +Index: 38688, SMILES: O=C1OC(=O)C2C3C=CC(O3)C12, Value: 0.13125 +Index: 38692, SMILES: CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2, Value: 0.12698 +Index: 38693, SMILES: CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2, Value: 0.14152 +Index: 38694, SMILES: CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2, Value: 0.157 +Index: 38695, SMILES: CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2, Value: 0.17313 +Index: 38696, SMILES: CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2, Value: 0.19009 +Index: 38726, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1745 +Index: 38727, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.197 +Index: 38728, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2212 +Index: 38729, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2559 +Index: 38730, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2826 +Index: 38731, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3248 +Index: 38732, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3581 +Index: 38733, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.4059 +Index: 38803, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1212 +Index: 38804, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1342 +Index: 38805, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1486 +Index: 38916, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1799 +Index: 38917, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.1899 +Index: 38918, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2006 +Index: 38919, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2115 +Index: 38920, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2231 +Index: 38921, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.236 +Index: 38922, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2491 +Index: 38923, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2624 +Index: 38924, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2765 +Index: 38925, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.2912 +Index: 38926, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.3064 +Index: 38927, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.3229 +Index: 38928, SMILES: Cc1cccc([N+](=O)[O-])c1N, Value: 0.339 +Index: 39066, SMILES: N=C(N)NCCC[C@H](N)C(=O)O.O=C1CC[C@@H](C(=O)O)N1, Value: 0.1399 +Index: 39067, SMILES: N=C(N)NCCC[C@H](N)C(=O)O.O=C1CC[C@@H](C(=O)O)N1, Value: 0.1779 +Index: 39068, SMILES: N=C(N)NCCC[C@H](N)C(=O)O.O=C1CC[C@@H](C(=O)O)N1, Value: 0.22085 +Index: 39069, SMILES: N=C(N)NCCC[C@H](N)C(=O)O.O=C1CC[C@@H](C(=O)O)N1, Value: 0.27208 +Index: 39200, SMILES: Cl.N=C(N=C(N)N)N1CCOCC1, Value: 0.127157 +Index: 39223, SMILES: CCOC(=O)[C@@H]1CSCN1.Cl, Value: 0.123918 +Index: 39224, SMILES: CCOC(=O)[C@@H]1CSCN1.Cl, Value: 0.14845 +Index: 39225, SMILES: CCOC(=O)[C@@H]1CSCN1.Cl, Value: 0.188202 +Index: 39424, SMILES: O=C(O)[C@@H]1CCCN1, Value: 0.187581 +Index: 39425, SMILES: O=C(O)[C@@H]1CCCN1, Value: 0.204063 +Index: 39426, SMILES: O=C(O)[C@@H]1CCCN1, Value: 0.224323 +Index: 39427, SMILES: O=C(O)[C@@H]1CCCN1, Value: 0.240593 +Index: 39428, SMILES: O=C(O)[C@@H]1CCCN1, Value: 0.260345 +Index: 39449, SMILES: NCCCCCC(=O)O, Value: 0.118255 +Index: 39450, SMILES: NCCCCCC(=O)O, Value: 0.126015 +Index: 39451, SMILES: NCCCCCC(=O)O, Value: 0.130329 +Index: 39452, SMILES: NCCCCCC(=O)O, Value: 0.136888 +Index: 39453, SMILES: NCCCCCC(=O)O, Value: 0.144929 +Index: 39454, SMILES: NCCCCCC(=O)O, Value: 0.151655 +Index: 39455, SMILES: NCCCCCC(=O)O, Value: 0.154923 +Index: 39456, SMILES: NCCCCCC(=O)O, Value: 0.159781 +Index: 39457, SMILES: NCCCCCC(=O)O, Value: 0.167312 +Index: 39516, SMILES: N[C@@H](CO)C(=O)O, Value: 0.12354 +Index: 39794, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.1251 +Index: 39795, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.144067 +Index: 39796, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.1614 +Index: 39797, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.1767 +Index: 39798, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.1938 +Index: 39838, SMILES: O=C(O)CS.[Na], Value: 0.1471 +Index: 39839, SMILES: O=C(O)CS.[Na], Value: 0.16085 +Index: 39840, SMILES: O=C(O)CS.[Na], Value: 0.1765 +Index: 39841, SMILES: O=C(O)CS.[Na], Value: 0.19505 +Index: 39842, SMILES: O=C(O)CS.[Na], Value: 0.21327 +Index: 39843, SMILES: O=C(O)CS.[Na], Value: 0.23257 +Index: 39844, SMILES: O=C(O)CS.[Na], Value: 0.25294 +Index: 39845, SMILES: O=C(O)CS.[Na], Value: 0.2759 +Index: 39846, SMILES: O=C(O)CS.[Na], Value: 0.30047 +Index: 39905, SMILES: OC[C@H](O)[C@@H](O)[C@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)CO, Value: 0.125382 +Index: 39995, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.1413 +Index: 39996, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.2381 +Index: 39997, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.3137 +Index: 39998, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.3928 +Index: 39999, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.4629 +Index: 40000, SMILES: CC1(C)COC(=O)[C@@H]1O, Value: 0.5528 +Index: 40247, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1845 +Index: 40248, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1894 +Index: 40249, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1943 +Index: 40250, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1999 +Index: 40251, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.2056 +Index: 40303, SMILES: O=[PH](O)c1ccccc1, Value: 0.1606 +Index: 40304, SMILES: O=[PH](O)c1ccccc1, Value: 0.2076 +Index: 40315, SMILES: CP(=O)(O)c1ccccc1, Value: 0.1197 +Index: 40335, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1169 +Index: 40336, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1235 +Index: 40337, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1301 +Index: 40338, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1347 +Index: 40339, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1393 +Index: 40340, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1445 +Index: 40341, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1495 +Index: 40342, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1545 +Index: 40343, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1594 +Index: 40344, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1648 +Index: 40345, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.17 +Index: 40346, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1754 +Index: 40347, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1808 +Index: 40348, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1865 +Index: 40349, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1977 +Index: 40350, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2094 +Index: 40351, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2184 +Index: 40352, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2275 +Index: 40391, SMILES: O=P(O)(CO)c1ccccc1, Value: 0.1166 +Index: 40392, SMILES: O=P(O)(CO)c1ccccc1, Value: 0.1662 +Index: 40393, SMILES: O=P(O)(CO)c1ccccc1, Value: 0.2474 +Index: 40394, SMILES: O=P(O)(CO)c1ccccc1, Value: 0.312 +Index: 40474, SMILES: CN/C(=C\[N+](=O)[O-])NCCSCc1csc(CN(C)C)n1, Value: 0.16353 +Index: 40506, SMILES: CC(N)=O, Value: 0.3087 +Index: 40507, SMILES: CC(N)=O, Value: 0.3424 +Index: 40508, SMILES: CC(N)=O, Value: 0.3709 +Index: 40509, SMILES: CC(N)=O, Value: 0.4017 +Index: 40510, SMILES: CC(N)=O, Value: 0.4431 +Index: 40511, SMILES: CC(N)=O, Value: 0.4775 +Index: 40512, SMILES: CC(N)=O, Value: 0.5149 +Index: 40513, SMILES: CC(N)=O, Value: 0.5563 +Index: 40514, SMILES: CC(N)=O, Value: 0.5913 +Index: 40515, SMILES: CC(N)=O, Value: 0.6308 +Index: 40516, SMILES: CC(N)=O, Value: 0.6773 +Index: 40517, SMILES: CC(N)=O, Value: 0.7213 +Index: 40518, SMILES: CCC(N)=O, Value: 0.1336 +Index: 40519, SMILES: CCC(N)=O, Value: 0.1629 +Index: 40520, SMILES: CCC(N)=O, Value: 0.1945 +Index: 40521, SMILES: CCC(N)=O, Value: 0.2315 +Index: 40522, SMILES: CCC(N)=O, Value: 0.2757 +Index: 40523, SMILES: CCC(N)=O, Value: 0.3153 +Index: 40524, SMILES: CCC(N)=O, Value: 0.3708 +Index: 40525, SMILES: CCC(N)=O, Value: 0.3999 +Index: 40526, SMILES: CCC(N)=O, Value: 0.4503 +Index: 40527, SMILES: CCC(N)=O, Value: 0.4859 +Index: 40528, SMILES: CCC(N)=O, Value: 0.527 +Index: 40529, SMILES: CCC(N)=O, Value: 0.5678 +Index: 40539, SMILES: CCCC(N)=O, Value: 0.1305 +Index: 40540, SMILES: CCCC(N)=O, Value: 0.1524 +Index: 40541, SMILES: CCCC(N)=O, Value: 0.1748 +Index: 40595, SMILES: CP1(=O)OCC2(CO1)COP(C)(=O)OC2, Value: 0.12864 +Index: 40596, SMILES: CP1(=O)OCC2(CO1)COP(C)(=O)OC2, Value: 0.16065 +Index: 40597, SMILES: CP1(=O)OCC2(CO1)COP(C)(=O)OC2, Value: 0.19717 +Index: 40598, SMILES: CP1(=O)OCC2(CO1)COP(C)(=O)OC2, Value: 0.24227 +Index: 40599, SMILES: CP1(=O)OCC2(CO1)COP(C)(=O)OC2, Value: 0.26109 +Index: 40708, SMILES: O=C(O)c1ccc(Cl)cc1C(=O)O, Value: 0.125 +Index: 40709, SMILES: O=C(O)c1ccc(Cl)cc1C(=O)O, Value: 0.1451 +Index: 40710, SMILES: O=C(O)c1ccc(Cl)cc1C(=O)O, Value: 0.1686 +Index: 40711, SMILES: O=C(O)c1ccc(Cl)cc1C(=O)O, Value: 0.1996 +Index: 40712, SMILES: O=C(O)c1ccc(Cl)cc1C(=O)O, Value: 0.2262 +Index: 40713, SMILES: O=C(O)c1ccc(Cl)cc1C(=O)O, Value: 0.2615 +Index: 40714, SMILES: O=C(O)c1ccc(Cl)cc1C(=O)O, Value: 0.2987 +Index: 40715, SMILES: O=C(O)c1ccc(Cl)cc1C(=O)O, Value: 0.3494 +Index: 40716, SMILES: N#C[S-].[NH4+], Value: 0.237 +Index: 40717, SMILES: N#C[S-].[NH4+], Value: 0.2676 +Index: 40718, SMILES: N#C[S-].[NH4+], Value: 0.2982 +Index: 40719, SMILES: N#C[S-].[NH4+], Value: 0.3262 +Index: 40720, SMILES: N#C[S-].[NH4+], Value: 0.3526 +Index: 40721, SMILES: N#C[S-].[NH4+], Value: 0.3773 +Index: 40722, SMILES: N#C[S-].[NH4+], Value: 0.4118 +Index: 40723, SMILES: N#C[S-].[NH4+], Value: 0.438 +Index: 40724, SMILES: N#C[S-].[NH4+], Value: 0.4687 +Index: 40725, SMILES: N#C[S-].[NH4+], Value: 0.4919 +Index: 40726, SMILES: N#C[S-].[NH4+], Value: 0.5225 +Index: 40760, SMILES: NC(N)=S, Value: 0.1162 +Index: 40761, SMILES: NC(N)=S, Value: 0.1256 +Index: 40762, SMILES: NC(N)=S, Value: 0.1354 +Index: 40763, SMILES: NC(N)=S, Value: 0.1498 +Index: 40764, SMILES: NC(N)=S, Value: 0.1614 +Index: 40765, SMILES: NC(N)=S, Value: 0.1827 +Index: 40766, SMILES: NC(N)=S, Value: 0.1977 +Index: 40767, SMILES: NC(N)=S, Value: 0.2176 +Index: 40768, SMILES: NC(N)=S, Value: 0.2386 +Index: 40769, SMILES: NC(N)=S, Value: 0.2509 +Index: 40770, SMILES: NC(N)=S, Value: 0.2653 +Index: 40851, SMILES: CC(O)(P(=O)(O)O)P(=O)(O)O.O, Value: 0.17408 +Index: 40852, SMILES: CC(O)(P(=O)(O)O)P(=O)(O)O.O, Value: 0.18167 +Index: 40853, SMILES: CC(O)(P(=O)(O)O)P(=O)(O)O.O, Value: 0.18981 +Index: 40854, SMILES: CC(O)(P(=O)(O)O)P(=O)(O)O.O, Value: 0.1977 +Index: 40855, SMILES: CC(O)(P(=O)(O)O)P(=O)(O)O.O, Value: 0.20693 +Index: 40856, SMILES: CC(O)(P(=O)(O)O)P(=O)(O)O.O, Value: 0.21518 +Index: 40857, SMILES: CC(O)(P(=O)(O)O)P(=O)(O)O.O, Value: 0.22458 +Index: 40858, SMILES: CC(O)(P(=O)(O)O)P(=O)(O)O.O, Value: 0.23475 +Index: 41029, SMILES: C1CN2CN3CCN(CN1C3)C2, Value: 0.1189 +Index: 41030, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.17608 +Index: 41031, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.17986 +Index: 41032, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.18589 +Index: 41033, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.19957 +Index: 41034, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.20292 +Index: 41035, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.20942 +Index: 41036, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.21665 +Index: 41037, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.22286 +Index: 41038, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.22787 +Index: 41039, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.23177 +Index: 41040, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.23495 +Index: 41041, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.24071 +Index: 41042, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.25187 +Index: 41043, SMILES: CCC[C@@H]1C[C@@H](C(=O)N[C@H]([C@H](C)Cl)[C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)N(C)C1, Value: 0.29239 +Index: 41057, SMILES: O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O, Value: 0.1175 +Index: 41058, SMILES: O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O, Value: 0.1372 +Index: 41059, SMILES: O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O, Value: 0.1532 +Index: 41060, SMILES: O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O, Value: 0.1715 +Index: 41061, SMILES: O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O, Value: 0.1877 +Index: 41062, SMILES: O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O, Value: 0.1996 +Index: 41063, SMILES: O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O, Value: 0.2111 +Index: 41064, SMILES: O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O, Value: 0.218 +Index: 41065, SMILES: O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O, Value: 0.2223 +Index: 41073, SMILES: O=C(O)Cn1cnnn1, Value: 0.1219 +Index: 41074, SMILES: O=C(O)Cn1cnnn1, Value: 0.1726 +Index: 41156, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1174 +Index: 41157, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1264 +Index: 41158, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1336 +Index: 41159, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1402 +Index: 41160, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1467 +Index: 41161, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1542 +Index: 41162, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1581 +Index: 41163, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1639 +Index: 41164, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1699 +Index: 41165, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1799 +Index: 41166, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1836 +Index: 41167, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.188 +Index: 41168, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1958 +Index: 41169, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.1982 +Index: 41170, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2002 +Index: 41171, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2025 +Index: 41172, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2054 +Index: 41173, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2084 +Index: 41174, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.214 +Index: 41175, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2206 +Index: 41176, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2257 +Index: 41177, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2309 +Index: 41178, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2403 +Index: 41179, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2445 +Index: 41180, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.249 +Index: 41181, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2523 +Index: 41182, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2575 +Index: 41183, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2718 +Index: 41184, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2882 +Index: 41185, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.2963 +Index: 41186, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.3101 +Index: 41187, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.3183 +Index: 41188, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.332 +Index: 41189, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.3489 +Index: 41190, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.3608 +Index: 41191, SMILES: NC(N)=O.O=P(O)(O)O, Value: 0.3722 +Index: 41220, SMILES: OC[C@H](O)C(O)[C@H](O)CO, Value: 0.1619 +Index: 41221, SMILES: OC[C@H](O)C(O)[C@H](O)CO, Value: 0.1797 +Index: 41222, SMILES: OC[C@H](O)C(O)[C@H](O)CO, Value: 0.2031 +Index: 41223, SMILES: OC[C@H](O)C(O)[C@H](O)CO, Value: 0.2324 +Index: 41224, SMILES: OC[C@H](O)C(O)[C@H](O)CO, Value: 0.2661 +Index: 41225, SMILES: OC[C@H](O)C(O)[C@H](O)CO, Value: 0.3017 +Index: 41226, SMILES: OC[C@H](O)C(O)[C@H](O)CO, Value: 0.3391 +Index: 41227, SMILES: OC[C@H](O)C(O)[C@H](O)CO, Value: 0.3766 +Index: 41584, SMILES: C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C=O, Value: 0.12898 +Index: 41585, SMILES: C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C=O, Value: 0.17422 +Index: 41678, SMILES: NC(CO)(CO)CO, Value: 0.1228 +Index: 41727, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1177 +Index: 41728, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.129 +Index: 41729, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1383 +Index: 41730, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1526 +Index: 41842, SMILES: Cl.c1ccc([C@H]2CN3CCSC3=N2)cc1, Value: 0.1197 +Index: 41843, SMILES: Cl.c1ccc([C@H]2CN3CCSC3=N2)cc1, Value: 0.1269 +Index: 41954, SMILES: NCCCC(=O)O, Value: 0.1687 +Index: 41955, SMILES: NCCCC(=O)O, Value: 0.1733 +Index: 41956, SMILES: NCCCC(=O)O, Value: 0.176 +Index: 41957, SMILES: NCCCC(=O)O, Value: 0.1806 +Index: 41958, SMILES: NCCCC(=O)O, Value: 0.1832 +Index: 41959, SMILES: NCCCC(=O)O, Value: 0.1878 +Index: 41960, SMILES: NCCCC(=O)O, Value: 0.1904 +Index: 41961, SMILES: NCCCC(=O)O, Value: 0.195 +Index: 41962, SMILES: NCCCC(=O)O, Value: 0.1987 +Index: 41986, SMILES: O=C(O)C1=C[C@@H](O)[C@@H](O)[C@H](O)C1, Value: 0.12531 +Index: 42139, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.15 +Index: 42140, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.161 +Index: 42141, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.178 +Index: 42142, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.196 +Index: 42143, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.213 +Index: 42144, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.229 +Index: 42145, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.249 +Index: 42146, SMILES: O=C(O)CC(O)C(=O)O, Value: 0.271 +Index: 42181, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1224 +Index: 42182, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.151 +Index: 42183, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1712 +Index: 42184, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.1864 +Index: 42185, SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O, Value: 0.2061 +Index: 42227, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1325 +Index: 42228, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2027 +Index: 42229, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2678 +Index: 42230, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3613 +Index: 42284, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.128609 +Index: 42316, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.1267 +Index: 42317, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.1593 +Index: 42318, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.2059 +Index: 42319, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.2454 +Index: 42320, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.2891 +Index: 42356, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.34902 +Index: 42357, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.35964 +Index: 42358, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.36785 +Index: 42359, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.37667 +Index: 42360, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.38921 +Index: 42361, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.39846 +Index: 42362, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.41369 +Index: 42363, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.42852 +Index: 42364, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.44583 +Index: 42365, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.46328 +Index: 42399, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1282 +Index: 42400, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1486 +Index: 42401, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1761 +Index: 42402, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2042 +Index: 42403, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2352 +Index: 42404, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2696 +Index: 42405, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3099 +Index: 42475, SMILES: O=C(Nc1ccccc1)c1ccccc1, Value: 0.121602 +Index: 42476, SMILES: O=C(Nc1ccccc1)c1ccccc1, Value: 0.131568 +Index: 42477, SMILES: O=C(Nc1ccccc1)c1ccccc1, Value: 0.148361 +Index: 42478, SMILES: O=C(Nc1ccccc1)c1ccccc1, Value: 0.162159 +Index: 42479, SMILES: O=C(Nc1ccccc1)c1ccccc1, Value: 0.179277 +Index: 42499, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.1668 +Index: 42500, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.1778 +Index: 42501, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.1921 +Index: 42502, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2131 +Index: 42503, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2384 +Index: 42504, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2656 +Index: 42505, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2955 +Index: 42506, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.3272 +Index: 42507, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.3727 +Index: 42508, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.4262 +Index: 42513, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.1201 +Index: 42514, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.1324 +Index: 42515, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.1465 +Index: 42516, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.1621 +Index: 42517, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.181 +Index: 42518, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.1998 +Index: 42526, SMILES: CN1COCN(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-], Value: 0.1229 +Index: 42527, SMILES: CN1COCN(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-], Value: 0.1366 +Index: 42528, SMILES: CN1COCN(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-], Value: 0.1522 +Index: 42544, SMILES: CCOc1ccccc1C(N)=O, Value: 0.116925 +Index: 42545, SMILES: CCOc1ccccc1C(N)=O, Value: 0.132853 +Index: 42546, SMILES: CCOc1ccccc1C(N)=O, Value: 0.150537 +Index: 42551, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.1233 +Index: 42552, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.15599 +Index: 42553, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.19427 +Index: 42554, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.23792 +Index: 42555, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.28793 +Index: 42556, SMILES: NC(=O)[C@@H]1CCCN1, Value: 0.34693 +Index: 42567, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.3065 +Index: 42568, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.3156 +Index: 42569, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.3296 +Index: 42570, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.347 +Index: 42571, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.3727 +Index: 42572, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.3957 +Index: 42573, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.4252 +Index: 42574, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.4619 +Index: 42575, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.502 +Index: 42576, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.5454 +Index: 42587, SMILES: C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3C(=C)C[C@@]21CC, Value: 0.115 +Index: 42607, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1275 +Index: 42608, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1485 +Index: 42609, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1713 +Index: 42610, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.197 +Index: 42611, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.2264 +Index: 42615, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1193 +Index: 42616, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1345 +Index: 42617, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1523 +Index: 42618, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1707 +Index: 42619, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1901 +Index: 42620, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.2142 +Index: 42621, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.2411 +Index: 42622, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2985 +Index: 42623, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.3085 +Index: 42624, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.3236 +Index: 42625, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.3417 +Index: 42626, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.3611 +Index: 42627, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.3832 +Index: 42628, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.4094 +Index: 42629, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.4298 +Index: 42630, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.4519 +Index: 42640, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.1799 +Index: 42641, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.202 +Index: 42642, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.2222 +Index: 42643, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.2486 +Index: 42644, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.2768 +Index: 42645, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.3079 +Index: 42646, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.3378 +Index: 42647, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.3712 +Index: 42648, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.4056 +Index: 42649, SMILES: O=C(O)Cc1ccccc1[N+](=O)[O-], Value: 0.4451 +Index: 42650, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1613 +Index: 42651, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1782 +Index: 42652, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1997 +Index: 42653, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.2246 +Index: 42654, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.251 +Index: 42655, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.2796 +Index: 42656, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.3108 +Index: 42657, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.3417 +Index: 42658, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.3767 +Index: 42659, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.4171 +Index: 42678, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.12582 +Index: 42679, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.15179 +Index: 42680, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.18118 +Index: 42681, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.21615 +Index: 42682, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.25807 +Index: 42683, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.30491 +Index: 42684, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.36068 +Index: 42685, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.4238 +Index: 42686, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.49967 +Index: 42687, SMILES: Cc1c(Br)cccc1C(=O)O, Value: 0.58437 +Index: 42720, SMILES: O=C(O)c1cccnc1Cl, Value: 0.124 +Index: 42721, SMILES: O=C(O)c1cccnc1Cl, Value: 0.1491 +Index: 42722, SMILES: O=C(O)c1cccnc1Cl, Value: 0.1748 +Index: 42723, SMILES: O=C(O)c1cccnc1Cl, Value: 0.1996 +Index: 42724, SMILES: O=C(O)c1cccnc1Cl, Value: 0.2282 +Index: 42725, SMILES: O=C(O)c1cccnc1Cl, Value: 0.2595 +Index: 42726, SMILES: O=C(O)c1cccnc1Cl, Value: 0.2911 +Index: 42727, SMILES: O=C(O)c1cccnc1Cl, Value: 0.3274 +Index: 42728, SMILES: O=C(O)c1cccnc1Cl, Value: 0.3671 +Index: 42739, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1536 +Index: 42740, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1758 +Index: 42741, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.2005 +Index: 42742, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.2277 +Index: 42743, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.2576 +Index: 42744, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.2903 +Index: 42745, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.3261 +Index: 42746, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.3652 +Index: 42747, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.4175 +Index: 42757, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1406 +Index: 42758, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1627 +Index: 42759, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1892 +Index: 42760, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2194 +Index: 42761, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2525 +Index: 42762, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2841 +Index: 42763, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.3177 +Index: 42764, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.3627 +Index: 42765, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.4115 +Index: 42766, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.4732 +Index: 42825, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.1755 +Index: 42826, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.2005 +Index: 42827, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.2292 +Index: 42828, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.2685 +Index: 42829, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.3176 +Index: 42830, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.3685 +Index: 42831, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.421 +Index: 42832, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.4769 +Index: 42833, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.5419 +Index: 42834, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.149 +Index: 42835, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.161 +Index: 42836, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.177 +Index: 42837, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.195 +Index: 42838, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.215 +Index: 42839, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.236 +Index: 42840, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.259 +Index: 42841, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.283 +Index: 42842, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.309 +Index: 42843, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.337 +Index: 42844, SMILES: Cc1n[nH]c2cc([N+](=O)[O-])ccc12, Value: 0.371 +Index: 42847, SMILES: CN(C)/C=C/C(=O)c1cccnc1, Value: 0.14178 +Index: 42848, SMILES: CN(C)/C=C/C(=O)c1cccnc1, Value: 0.17468 +Index: 42849, SMILES: CN(C)/C=C/C(=O)c1cccnc1, Value: 0.20851 +Index: 42850, SMILES: CN(C)/C=C/C(=O)c1cccnc1, Value: 0.24859 +Index: 42851, SMILES: CN(C)/C=C/C(=O)c1cccnc1, Value: 0.29252 +Index: 42852, SMILES: CN(C)/C=C/C(=O)c1cccnc1, Value: 0.34751 +Index: 42853, SMILES: CN(C)/C=C/C(=O)c1cccnc1, Value: 0.40818 +Index: 42854, SMILES: CN(C)/C=C/C(=O)c1cccnc1, Value: 0.48156 +Index: 42855, SMILES: CN(C)/C=C/C(=O)c1cccnc1, Value: 0.58755 +Index: 42894, SMILES: N#CCC(N)=O, Value: 0.2535 +Index: 42895, SMILES: N#CCC(N)=O, Value: 0.2624 +Index: 42896, SMILES: N#CCC(N)=O, Value: 0.2712 +Index: 42897, SMILES: N#CCC(N)=O, Value: 0.2827 +Index: 42898, SMILES: N#CCC(N)=O, Value: 0.2948 +Index: 42899, SMILES: N#CCC(N)=O, Value: 0.3095 +Index: 42900, SMILES: N#CCC(N)=O, Value: 0.325 +Index: 42901, SMILES: N#CCC(N)=O, Value: 0.3425 +Index: 42902, SMILES: N#CCC(N)=O, Value: 0.3601 +Index: 42903, SMILES: N#CCC(N)=O, Value: 0.3815 +Index: 42912, SMILES: NC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1233 +Index: 42913, SMILES: NC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1391 +Index: 42940, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.122 +Index: 42941, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.1407 +Index: 42942, SMILES: CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C, Value: 0.1618 +Index: 43014, SMILES: On1nnc2ccccc21, Value: 0.1213 +Index: 43015, SMILES: On1nnc2ccccc21, Value: 0.1343 +Index: 43016, SMILES: On1nnc2ccccc21, Value: 0.1485 +Index: 43017, SMILES: On1nnc2ccccc21, Value: 0.1637 +Index: 43018, SMILES: On1nnc2ccccc21, Value: 0.1798 +Index: 43065, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.11623 +Index: 43066, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.11965 +Index: 43068, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.13047 +Index: 43069, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.1474 +Index: 43070, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.16646 +Index: 43071, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.18687 +Index: 43072, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.20844 +Index: 43073, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.23254 +Index: 43074, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.25974 +Index: 43075, SMILES: CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O, Value: 0.28688 +Index: 43085, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.4355 +Index: 43086, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.4462 +Index: 43087, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.4591 +Index: 43088, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.4691 +Index: 43089, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.4862 +Index: 43090, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.4984 +Index: 43103, SMILES: O=C1NC(=O)c2cc([N+](=O)[O-])ccc21, Value: 0.1198 +Index: 43104, SMILES: O=C1NC(=O)c2cc([N+](=O)[O-])ccc21, Value: 0.1279 +Index: 43105, SMILES: O=C1NC(=O)c2cc([N+](=O)[O-])ccc21, Value: 0.1367 +Index: 43106, SMILES: O=C1NC(=O)c2cc([N+](=O)[O-])ccc21, Value: 0.1546 +Index: 43114, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1503 +Index: 43115, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1632 +Index: 43116, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1795 +Index: 43117, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.1957 +Index: 43118, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.2112 +Index: 43119, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.2235 +Index: 43120, SMILES: O=C1OC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1, Value: 0.2417 +Index: 43149, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.1174 +Index: 43150, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.1379 +Index: 43151, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.1656 +Index: 43160, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.1265 +Index: 43161, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.13495 +Index: 43162, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.14289 +Index: 43163, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.15142 +Index: 43164, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.16049 +Index: 43165, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.17032 +Index: 43166, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.1788 +Index: 43167, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.18984 +Index: 43168, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.19803 +Index: 43169, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.20876 +Index: 43170, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.21757 +Index: 43313, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1186 +Index: 43314, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1286 +Index: 43315, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.137 +Index: 43316, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1477 +Index: 43317, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1624 +Index: 43332, SMILES: c1ccc2ccccc2c1, Value: 0.1615 +Index: 43333, SMILES: c1ccc2ccccc2c1, Value: 0.1852 +Index: 43334, SMILES: c1ccc2ccccc2c1, Value: 0.215 +Index: 43335, SMILES: c1ccc2ccccc2c1, Value: 0.2444 +Index: 43336, SMILES: c1ccc2ccccc2c1, Value: 0.2814 +Index: 43337, SMILES: c1ccc2ccccc2c1, Value: 0.3071 +Index: 43338, SMILES: c1ccc2ccccc2c1, Value: 0.3539 +Index: 43339, SMILES: c1ccc2ccccc2c1, Value: 0.4059 +Index: 43340, SMILES: c1ccc2ccccc2c1, Value: 0.4649 +Index: 43362, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.3433 +Index: 43363, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.42 +Index: 43364, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.5073 +Index: 43365, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.3674 +Index: 43366, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.4513 +Index: 43367, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.5318 +Index: 43368, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.3822 +Index: 43369, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.4704 +Index: 43416, SMILES: O=C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21, Value: 0.129 +Index: 43417, SMILES: O=C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21, Value: 0.1555 +Index: 43424, SMILES: OC[C@H](O)C(O)[C@H](O)CO, Value: 0.1344 +Index: 43425, SMILES: OC[C@H](O)C(O)[C@H](O)CO, Value: 0.1656 +Index: 43426, SMILES: OC[C@H](O)C(O)[C@H](O)CO, Value: 0.2037 +Index: 43430, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1193 +Index: 43431, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1345 +Index: 43432, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1523 +Index: 43433, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1707 +Index: 43434, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1901 +Index: 43435, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.2142 +Index: 43436, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.2411 +Index: 43437, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.2177 +Index: 43438, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.2356 +Index: 43439, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.2568 +Index: 43440, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.2769 +Index: 43441, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.2959 +Index: 43442, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.3186 +Index: 43443, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.3415 +Index: 43444, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.3648 +Index: 43445, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.3849 +Index: 43446, SMILES: CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O, Value: 0.4075 +Index: 43447, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.1994 +Index: 43448, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.2212 +Index: 43449, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.2448 +Index: 43450, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.2694 +Index: 43451, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.2976 +Index: 43452, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.3242 +Index: 43453, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.3568 +Index: 43454, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.386 +Index: 43455, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.4158 +Index: 43456, SMILES: CNc1nc(C)nc(OC)n1, Value: 0.4557 +Index: 43479, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.11505 +Index: 43480, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.13049 +Index: 43481, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.14387 +Index: 43482, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.15525 +Index: 43484, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1169 +Index: 43485, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1204 +Index: 43486, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1257 +Index: 43487, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.132 +Index: 43488, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1391 +Index: 43489, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1456 +Index: 43490, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1525 +Index: 43491, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1607 +Index: 43529, SMILES: O=C1NC(=O)c2cc([N+](=O)[O-])ccc21, Value: 0.1198 +Index: 43530, SMILES: O=C1NC(=O)c2cc([N+](=O)[O-])ccc21, Value: 0.1367 +Index: 43531, SMILES: O=C1NC(=O)c2cc([N+](=O)[O-])ccc21, Value: 0.1546 +Index: 43572, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1536 +Index: 43573, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1758 +Index: 43574, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.2005 +Index: 43575, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.2277 +Index: 43576, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.2576 +Index: 43577, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.2903 +Index: 43578, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.3261 +Index: 43579, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.3652 +Index: 43580, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.4175 +Index: 43585, SMILES: Cc1cc(=O)oc2cc(N)ccc12, Value: 0.1311 +Index: 43586, SMILES: Cc1cc(=O)oc2cc(N)ccc12, Value: 0.156 +Index: 43587, SMILES: Cc1cc(=O)oc2cc(N)ccc12, Value: 0.1892 +Index: 43588, SMILES: Cc1cc(=O)oc2cc(N)ccc12, Value: 0.2187 +Index: 43589, SMILES: Cc1cc(=O)oc2cc(N)ccc12, Value: 0.251 +Index: 43590, SMILES: Cc1cc(=O)oc2cc(N)ccc12, Value: 0.2916 +Index: 43614, SMILES: COC(=O)Nc1nc2ccc(Sc3ccccc3)cc2[nH]1, Value: 0.1344 +Index: 43615, SMILES: COC(=O)Nc1nc2ccc(Sc3ccccc3)cc2[nH]1, Value: 0.1755 +Index: 43616, SMILES: COC(=O)Nc1nc2ccc(Sc3ccccc3)cc2[nH]1, Value: 0.2273 +Index: 43617, SMILES: COC(=O)Nc1nc2ccc(Sc3ccccc3)cc2[nH]1, Value: 0.2915 +Index: 43618, SMILES: COC(=O)Nc1nc2ccc(Sc3ccccc3)cc2[nH]1, Value: 0.3745 +Index: 43619, SMILES: COC(=O)Nc1nc2ccc(Sc3ccccc3)cc2[nH]1, Value: 0.4698 +Index: 43638, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.1236 +Index: 43639, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.1503 +Index: 43640, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.1796 +Index: 43641, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.2144 +Index: 43642, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.2554 +Index: 43643, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.3042 +Index: 43644, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.3596 +Index: 43645, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.4222 +Index: 43646, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.4936 +Index: 43660, SMILES: COc1cc(N)nc(OC)n1, Value: 0.1229 +Index: 43661, SMILES: COc1cc(N)nc(OC)n1, Value: 0.1578 +Index: 43662, SMILES: COc1cc(N)nc(OC)n1, Value: 0.201 +Index: 43663, SMILES: COc1cc(N)nc(OC)n1, Value: 0.254 +Index: 43664, SMILES: COc1cc(N)nc(OC)n1, Value: 0.3187 +Index: 43665, SMILES: COc1cc(N)nc(OC)n1, Value: 0.397 +Index: 43699, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.1201 +Index: 43700, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.1324 +Index: 43701, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.1465 +Index: 43702, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.1621 +Index: 43703, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.181 +Index: 43704, SMILES: Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1, Value: 0.1998 +Index: 43727, SMILES: CN1CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1, Value: 0.1172 +Index: 43728, SMILES: CN1CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1, Value: 0.1232 +Index: 43729, SMILES: CN1CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1, Value: 0.1291 +Index: 43730, SMILES: CN1CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1, Value: 0.1352 +Index: 43731, SMILES: CN1CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1, Value: 0.1412 +Index: 43732, SMILES: CN1CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1, Value: 0.1478 +Index: 43745, SMILES: O=c1cc(CO)occ1O, Value: 0.1234 +Index: 43746, SMILES: O=c1cc(CO)occ1O, Value: 0.1347 +Index: 43747, SMILES: O=c1cc(CO)occ1O, Value: 0.1467 +Index: 43748, SMILES: O=c1cc(CO)occ1O, Value: 0.1571 +Index: 43749, SMILES: O=c1cc(CO)occ1O, Value: 0.1682 +Index: 43750, SMILES: O=c1cc(CO)occ1O, Value: 0.1805 +Index: 43751, SMILES: O=c1cc(CO)occ1O, Value: 0.1933 +Index: 43762, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.13604 +Index: 43763, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.14558 +Index: 43764, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.15436 +Index: 43765, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.16378 +Index: 43766, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.17404 +Index: 43767, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.18591 +Index: 43768, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.19747 +Index: 43769, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.20666 +Index: 43770, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.2186 +Index: 43771, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.23153 +Index: 43781, SMILES: CC(C)Oc1ccc2c(=O)c(-c3ccccc3)coc2c1, Value: 0.12603 +Index: 43782, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1723 +Index: 43783, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1932 +Index: 43784, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2125 +Index: 43785, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2391 +Index: 43786, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2636 +Index: 43787, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2927 +Index: 43788, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3198 +Index: 43789, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3599 +Index: 43790, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3899 +Index: 43791, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.4335 +Index: 43792, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1854 +Index: 43793, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1976 +Index: 43794, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.2105 +Index: 43795, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.2215 +Index: 43796, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.2362 +Index: 43797, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.2508 +Index: 43798, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.265 +Index: 43799, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.2836 +Index: 43800, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.2993 +Index: 43801, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.3152 +Index: 43803, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1305 +Index: 43804, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1475 +Index: 43805, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1645 +Index: 43806, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1838 +Index: 43807, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2056 +Index: 43808, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2309 +Index: 43809, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2574 +Index: 43810, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2854 +Index: 43811, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.3129 +Index: 43812, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.3437 +Index: 43824, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.2082 +Index: 43825, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.2195 +Index: 43826, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.2312 +Index: 43827, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.2439 +Index: 43828, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.2565 +Index: 43829, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.269 +Index: 43830, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.282 +Index: 43831, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.2956 +Index: 43832, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3084 +Index: 43833, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3221 +Index: 43834, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3356 +Index: 43835, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3501 +Index: 43836, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3646 +Index: 43837, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.379 +Index: 43838, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3932 +Index: 43842, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1219 +Index: 43843, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1307 +Index: 43844, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1403 +Index: 43845, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1497 +Index: 43846, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1608 +Index: 43847, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.171 +Index: 43848, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1823 +Index: 43849, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1936 +Index: 43850, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.2059 +Index: 43851, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.2188 +Index: 43852, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.2324 +Index: 43853, SMILES: Cc1ccc(N)c([N+](=O)[O-])c1, Value: 0.2468 +Index: 43854, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.324 +Index: 43855, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3472 +Index: 43856, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3678 +Index: 43857, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3933 +Index: 43858, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.4188 +Index: 43859, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.4465 +Index: 43860, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.4717 +Index: 43861, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.5028 +Index: 43862, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.5285 +Index: 43863, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.5608 +Index: 43864, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.5942 +Index: 43865, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.6272 +Index: 43866, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.6603 +Index: 43874, SMILES: CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C, Value: 0.1188 +Index: 43885, SMILES: COc1cc(Cl)nc(N)n1, Value: 0.1197 +Index: 43887, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1186 +Index: 43888, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.135 +Index: 43889, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1521 +Index: 43890, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1703 +Index: 43891, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.1917 +Index: 43892, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.2135 +Index: 43893, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.2374 +Index: 43894, SMILES: O=Cc1ccc([N+](=O)[O-])cc1, Value: 0.2617 +Index: 43899, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1169 +Index: 43900, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1336 +Index: 43901, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1525 +Index: 43902, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1732 +Index: 43903, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1965 +Index: 43904, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.2224 +Index: 43930, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1182 +Index: 43931, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1261 +Index: 43932, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1348 +Index: 43933, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1424 +Index: 43934, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1516 +Index: 43935, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1622 +Index: 43941, SMILES: O=C1NC(=O)C2C3C=CC(C3)C12, Value: 0.116284 +Index: 43942, SMILES: O=C1NC(=O)C2C3C=CC(C3)C12, Value: 0.128815 +Index: 43943, SMILES: O=C1NC(=O)C2C3C=CC(C3)C12, Value: 0.144514 +Index: 43944, SMILES: O=C1NC(=O)C2C3C=CC(C3)C12, Value: 0.158621 +Index: 43945, SMILES: O=C1NC(=O)C2C3C=CC(C3)C12, Value: 0.176989 +Index: 43948, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1223 +Index: 43949, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1355 +Index: 43950, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1484 +Index: 43951, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1608 +Index: 43952, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1729 +Index: 43953, SMILES: Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)Cn4cnnn4)[C@H]3SC2)s1, Value: 0.14424 +Index: 43954, SMILES: Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)Cn4cnnn4)[C@H]3SC2)s1, Value: 0.16096 +Index: 43955, SMILES: Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)Cn4cnnn4)[C@H]3SC2)s1, Value: 0.1615 +Index: 43956, SMILES: Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)Cn4cnnn4)[C@H]3SC2)s1, Value: 0.16207 +Index: 43957, SMILES: Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)Cn4cnnn4)[C@H]3SC2)s1, Value: 0.16558 +Index: 43958, SMILES: Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)Cn4cnnn4)[C@H]3SC2)s1, Value: 0.16713 +Index: 43959, SMILES: Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)Cn4cnnn4)[C@H]3SC2)s1, Value: 0.16967 +Index: 43967, SMILES: O=C1C=CC(=O)O1, Value: 0.12494 +Index: 43968, SMILES: O=C1C=CC(=O)O1, Value: 0.14958 +Index: 43969, SMILES: O=C1C=CC(=O)O1, Value: 0.17639 +Index: 43973, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.114754 +Index: 43974, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.119783 +Index: 43975, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.125537 +Index: 43976, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.131599 +Index: 43977, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.137913 +Index: 43978, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.144616 +Index: 43979, SMILES: C/C=C/C(=O)O, Value: 0.4381 +Index: 43980, SMILES: C/C=C/C(=O)O, Value: 0.4711 +Index: 43981, SMILES: C/C=C/C(=O)O, Value: 0.5 +Index: 43982, SMILES: C/C=C/C(=O)O, Value: 0.5486 +Index: 43983, SMILES: C/C=C/C(=O)O, Value: 0.5776 +Index: 43984, SMILES: C/C=C/C(=O)O, Value: 0.6088 +Index: 44003, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.1946 +Index: 44004, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2152 +Index: 44005, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2395 +Index: 44006, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2676 +Index: 44007, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.2988 +Index: 44008, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.3303 +Index: 44009, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.367 +Index: 44010, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.404 +Index: 44011, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.4452 +Index: 44012, SMILES: CC(=O)Nc1ccccc1[N+](=O)[O-], Value: 0.4906 +Index: 44018, SMILES: CN1COCN(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-], Value: 0.119 +Index: 44019, SMILES: CN1COCN(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-], Value: 0.1281 +Index: 44020, SMILES: CN1COCN(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-], Value: 0.1378 +Index: 44021, SMILES: CN1COCN(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-], Value: 0.1492 +Index: 44022, SMILES: CN1COCN(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-], Value: 0.1608 +Index: 44037, SMILES: Nc1cccc(Cl)c1C(=O)O, Value: 0.1189 +Index: 44038, SMILES: Nc1cccc(Cl)c1C(=O)O, Value: 0.1347 +Index: 44039, SMILES: Nc1cccc(Cl)c1C(=O)O, Value: 0.155 +Index: 44040, SMILES: Nc1cccc(Cl)c1C(=O)O, Value: 0.1777 +Index: 44041, SMILES: Nc1cccc(Cl)c1C(=O)O, Value: 0.2045 +Index: 44049, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1237 +Index: 44050, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1449 +Index: 44051, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.1667 +Index: 44052, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.191 +Index: 44053, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.2187 +Index: 44054, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.2481 +Index: 44055, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.2795 +Index: 44056, SMILES: O=C(O)c1cccc([N+](=O)[O-])c1O, Value: 0.3134 +Index: 44059, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1162 +Index: 44060, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1298 +Index: 44061, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1464 +Index: 44062, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1655 +Index: 44063, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1852 +Index: 44064, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.2073 +Index: 44065, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.234 +Index: 44066, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.2635 +Index: 44105, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.1201 +Index: 44106, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.2563 +Index: 44107, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.2718 +Index: 44108, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.2873 +Index: 44109, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.3031 +Index: 44110, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.321 +Index: 44111, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.3393 +Index: 44112, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.3593 +Index: 44113, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.3802 +Index: 44114, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.4023 +Index: 44115, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.4257 +Index: 44121, SMILES: Nc1ccc(Cl)cc1[N+](=O)[O-], Value: 0.1249 +Index: 44122, SMILES: Nc1ccc(Cl)cc1[N+](=O)[O-], Value: 0.1425 +Index: 44123, SMILES: Nc1ccc(Cl)cc1[N+](=O)[O-], Value: 0.1667 +Index: 44124, SMILES: Nc1ccc(Cl)cc1[N+](=O)[O-], Value: 0.1874 +Index: 44125, SMILES: Nc1ccc(Cl)cc1[N+](=O)[O-], Value: 0.2227 +Index: 44126, SMILES: O=C(O)c1cccnc1Cl, Value: 0.2063 +Index: 44127, SMILES: O=C(O)c1cccnc1Cl, Value: 0.235 +Index: 44128, SMILES: O=C(O)c1cccnc1Cl, Value: 0.2649 +Index: 44129, SMILES: O=C(O)c1cccnc1Cl, Value: 0.2947 +Index: 44130, SMILES: O=C(O)c1cccnc1Cl, Value: 0.3281 +Index: 44131, SMILES: O=C(O)c1cccnc1Cl, Value: 0.3599 +Index: 44132, SMILES: O=C(O)c1cccnc1Cl, Value: 0.3965 +Index: 44133, SMILES: O=C(O)c1cccnc1Cl, Value: 0.4374 +Index: 44134, SMILES: O=C(O)c1cccnc1Cl, Value: 0.4782 +Index: 44145, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1347 +Index: 44146, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1415 +Index: 44147, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1493 +Index: 44148, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1591 +Index: 44149, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1689 +Index: 44150, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1789 +Index: 44151, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1888 +Index: 44152, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1992 +Index: 44153, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.2113 +Index: 44154, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.2271 +Index: 44160, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1269 +Index: 44161, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1404 +Index: 44162, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1574 +Index: 44163, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1778 +Index: 44173, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1172 +Index: 44174, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1314 +Index: 44175, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1545 +Index: 44176, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1786 +Index: 44177, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2124 +Index: 44178, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2448 +Index: 44179, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2845 +Index: 44180, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.3241 +Index: 44181, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.3723 +Index: 44182, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.4237 +Index: 44206, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.1967 +Index: 44207, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.2214 +Index: 44208, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.2549 +Index: 44209, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.2994 +Index: 44210, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.3524 +Index: 44211, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.4046 +Index: 44212, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.4604 +Index: 44213, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.5228 +Index: 44214, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.589 +Index: 44218, SMILES: N#Cc1cccc([N+](=O)[O-])c1C#N, Value: 0.1154 +Index: 44219, SMILES: N#Cc1cccc([N+](=O)[O-])c1C#N, Value: 0.1277 +Index: 44220, SMILES: N#Cc1cccc([N+](=O)[O-])c1C#N, Value: 0.1408 +Index: 44221, SMILES: N#Cc1cccc([N+](=O)[O-])c1C#N, Value: 0.1549 +Index: 44222, SMILES: N#Cc1cccc([N+](=O)[O-])c1C#N, Value: 0.1699 +Index: 44223, SMILES: N#Cc1cccc([N+](=O)[O-])c1C#N, Value: 0.186 +Index: 44224, SMILES: N#Cc1cccc([N+](=O)[O-])c1C#N, Value: 0.2031 +Index: 44244, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.155 +Index: 44245, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1605 +Index: 44246, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1664 +Index: 44247, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1729 +Index: 44248, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1794 +Index: 44249, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1862 +Index: 44250, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.1931 +Index: 44251, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.201 +Index: 44252, SMILES: Nc1cc([N+](=O)[O-])ccc1Cl, Value: 0.2092 +Index: 44260, SMILES: NC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1248 +Index: 44261, SMILES: NC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1442 +Index: 44262, SMILES: NC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1686 +Index: 44295, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1602 +Index: 44296, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1725 +Index: 44297, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1801 +Index: 44298, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.2019 +Index: 44299, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.2049 +Index: 44300, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.2249 +Index: 44301, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.2485 +Index: 44302, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.2523 +Index: 44303, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.2812 +Index: 44304, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.20874 +Index: 44305, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.20748 +Index: 44306, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.20632 +Index: 44307, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.20585 +Index: 44308, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.20506 +Index: 44309, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.20416 +Index: 44310, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.20344 +Index: 44311, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.20221 +Index: 44312, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.20156 +Index: 44313, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.20076 +Index: 44314, SMILES: O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-], Value: 0.20013 +Index: 44321, SMILES: CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21, Value: 0.1261548 +Index: 44322, SMILES: CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21, Value: 0.13793523 +Index: 44323, SMILES: CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21, Value: 0.15257119 +Index: 44324, SMILES: CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21, Value: 0.16311335 +Index: 44329, SMILES: CCN1CCCC1CNC(=O)c1cc(S(N)(=O)=O)ccc1OC, Value: 0.1187 +Index: 44330, SMILES: CCN1CCCC1CNC(=O)c1cc(S(N)(=O)=O)ccc1OC, Value: 0.1235 +Index: 44331, SMILES: CCN1CCCC1CNC(=O)c1cc(S(N)(=O)=O)ccc1OC, Value: 0.1334 +Index: 44332, SMILES: CCN1CCCC1CNC(=O)c1cc(S(N)(=O)=O)ccc1OC, Value: 0.1404 +Index: 44346, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1675 +Index: 44347, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.178 +Index: 44348, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1839 +Index: 44349, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1938 +Index: 44350, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2033 +Index: 44351, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2138 +Index: 44352, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2267 +Index: 44353, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2398 +Index: 44354, SMILES: c1ccc2ccccc2c1, Value: 0.2685 +Index: 44355, SMILES: c1ccc2ccccc2c1, Value: 0.2893 +Index: 44356, SMILES: c1ccc2ccccc2c1, Value: 0.3073 +Index: 44357, SMILES: c1ccc2ccccc2c1, Value: 0.3358 +Index: 44358, SMILES: c1ccc2ccccc2c1, Value: 0.3785 +Index: 44359, SMILES: c1ccc2ccccc2c1, Value: 0.4101 +Index: 44360, SMILES: c1ccc2ccccc2c1, Value: 0.4383 +Index: 44361, SMILES: c1ccc2ccccc2c1, Value: 0.4864 +Index: 44362, SMILES: c1ccc2ccccc2c1, Value: 0.5346 +Index: 44363, SMILES: c1ccc2ccccc2c1, Value: 0.5767 +Index: 44380, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.1626 +Index: 44381, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.2604 +Index: 44382, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.4843 +Index: 44383, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.1755 +Index: 44384, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.3147 +Index: 44385, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.2095 +Index: 44386, SMILES: CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, Value: 0.3958 +Index: 44387, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.1611 +Index: 44388, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.1885 +Index: 44389, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.2201 +Index: 44390, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.2581 +Index: 44391, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.2794 +Index: 44423, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1162 +Index: 44424, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1298 +Index: 44425, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1464 +Index: 44426, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1655 +Index: 44427, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1852 +Index: 44428, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.2073 +Index: 44429, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.234 +Index: 44430, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.2635 +Index: 44431, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1172 +Index: 44432, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1314 +Index: 44433, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1545 +Index: 44434, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1786 +Index: 44435, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2124 +Index: 44436, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2448 +Index: 44437, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2845 +Index: 44438, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.3241 +Index: 44439, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.3723 +Index: 44440, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.4237 +Index: 44441, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1347 +Index: 44442, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1415 +Index: 44443, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1493 +Index: 44444, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1591 +Index: 44445, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1689 +Index: 44446, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1789 +Index: 44447, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1888 +Index: 44448, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.1992 +Index: 44449, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.2113 +Index: 44450, SMILES: Nc1c(Cl)cc([N+](=O)[O-])cc1Cl, Value: 0.2271 +Index: 44456, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1269 +Index: 44457, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1404 +Index: 44458, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1574 +Index: 44459, SMILES: N[C@H](Cc1c[nH]cn1)C(=O)O, Value: 0.1778 +Index: 44472, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.1322 +Index: 44473, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.1532 +Index: 44474, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.1763 +Index: 44475, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.2038 +Index: 44476, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.2331 +Index: 44477, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.2677 +Index: 44482, SMILES: O=Cc1ccc(C(=O)O)cc1, Value: 0.121 +Index: 44483, SMILES: O=Cc1ccc(C(=O)O)cc1, Value: 0.1397 +Index: 44484, SMILES: O=Cc1ccc(C(=O)O)cc1, Value: 0.1607 +Index: 44485, SMILES: O=Cc1ccc(C(=O)O)cc1, Value: 0.1843 +Index: 44486, SMILES: O=Cc1ccc(C(=O)O)cc1, Value: 0.2106 +Index: 44496, SMILES: O=c1cc(CO)occ1O, Value: 0.1701 +Index: 44497, SMILES: O=c1cc(CO)occ1O, Value: 0.1789 +Index: 44498, SMILES: O=c1cc(CO)occ1O, Value: 0.1854 +Index: 44499, SMILES: O=c1cc(CO)occ1O, Value: 0.1932 +Index: 44500, SMILES: O=c1cc(CO)occ1O, Value: 0.2012 +Index: 44501, SMILES: O=c1cc(CO)occ1O, Value: 0.2085 +Index: 44502, SMILES: O=c1cc(CO)occ1O, Value: 0.2157 +Index: 44503, SMILES: O=c1cc(CO)occ1O, Value: 0.2232 +Index: 44504, SMILES: O=c1cc(CO)occ1O, Value: 0.2317 +Index: 44505, SMILES: O=c1cc(CO)occ1O, Value: 0.2408 +Index: 44506, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1541 +Index: 44507, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1611 +Index: 44508, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1687 +Index: 44509, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1779 +Index: 44510, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1865 +Index: 44511, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1976 +Index: 44512, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.2083 +Index: 44513, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.2198 +Index: 44514, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.2323 +Index: 44515, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.2458 +Index: 44530, SMILES: Nc1ccc(N)c([N+](=O)[O-])c1, Value: 0.1205 +Index: 44546, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.1566 +Index: 44547, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.1624 +Index: 44548, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.168 +Index: 44549, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.1743 +Index: 44550, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.1809 +Index: 44551, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.1879 +Index: 44552, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.1951 +Index: 44553, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.2021 +Index: 44554, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.2091 +Index: 44555, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.2166 +Index: 44556, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.2244 +Index: 44557, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.2327 +Index: 44558, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.2423 +Index: 44559, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.2515 +Index: 44560, SMILES: Cn1cnc([N+](=O)[O-])c1Cl, Value: 0.2614 +Index: 44561, SMILES: Nc1nnc[nH]1, Value: 0.1451 +Index: 44562, SMILES: Nc1nnc[nH]1, Value: 0.1517 +Index: 44563, SMILES: Nc1nnc[nH]1, Value: 0.1589 +Index: 44564, SMILES: Nc1nnc[nH]1, Value: 0.1658 +Index: 44565, SMILES: Nc1nnc[nH]1, Value: 0.1727 +Index: 44566, SMILES: Nc1nnc[nH]1, Value: 0.181 +Index: 44567, SMILES: Nc1nnc[nH]1, Value: 0.1893 +Index: 44568, SMILES: Nc1nnc[nH]1, Value: 0.198 +Index: 44569, SMILES: Nc1nnc[nH]1, Value: 0.2062 +Index: 44570, SMILES: Nc1nnc[nH]1, Value: 0.2155 +Index: 44571, SMILES: Nc1nnc[nH]1, Value: 0.2248 +Index: 44572, SMILES: Nc1nnc[nH]1, Value: 0.2343 +Index: 44573, SMILES: Nc1nnc[nH]1, Value: 0.2444 +Index: 44574, SMILES: Nc1nnc[nH]1, Value: 0.2553 +Index: 44575, SMILES: Nc1nnc[nH]1, Value: 0.2673 +Index: 44601, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1177 +Index: 44602, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1226 +Index: 44603, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1277 +Index: 44604, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1328 +Index: 44605, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1382 +Index: 44606, SMILES: Cc1cc(C(=O)O)ccc1[N+](=O)[O-], Value: 0.1447 +Index: 44607, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1634 +Index: 44608, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1856 +Index: 44609, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2067 +Index: 44610, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2266 +Index: 44611, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2456 +Index: 44892, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.115432 +Index: 44893, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.127412 +Index: 44894, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.14546 +Index: 44895, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.15566 +Index: 44896, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.172406 +Index: 44952, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1167 +Index: 44953, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1247 +Index: 44954, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1372 +Index: 44955, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1452 +Index: 44956, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1605 +Index: 44957, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1668 +Index: 44958, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1827 +Index: 44959, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.1923 +Index: 44965, SMILES: CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC.Cl, Value: 0.13493 +Index: 44966, SMILES: CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC.Cl, Value: 0.14566 +Index: 44967, SMILES: CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC.Cl, Value: 0.15713 +Index: 44968, SMILES: CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC.Cl, Value: 0.17182 +Index: 44969, SMILES: CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC.Cl, Value: 0.18893 +Index: 45121, SMILES: O=C(O)c1ccccc1, Value: 0.1398 +Index: 45122, SMILES: O=C(O)c1ccccc1, Value: 0.1554 +Index: 45123, SMILES: O=C(O)c1ccccc1, Value: 0.1851 +Index: 45272, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.13512 +Index: 45273, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.16836 +Index: 45274, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.20653 +Index: 45275, SMILES: Cc1nc(CCl)nc2ccccc12, Value: 0.24935 +Index: 45276, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1472 +Index: 45277, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2334 +Index: 45278, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3617 +Index: 45279, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4706 +Index: 45280, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6014 +Index: 45281, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6772 +Index: 45411, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.126 +Index: 45412, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1604 +Index: 45413, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2041 +Index: 45427, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.1147 +Index: 45428, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.1339 +Index: 45429, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.1866 +Index: 45430, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.2527 +Index: 45574, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1309 +Index: 45575, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1469 +Index: 45576, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1652 +Index: 45577, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.1856 +Index: 45578, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2073 +Index: 45579, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.2305 +Index: 45580, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.255 +Index: 45581, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.286 +Index: 45582, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.3181 +Index: 45583, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.3502 +Index: 45584, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.3905 +Index: 45585, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.4341 +Index: 45586, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.4807 +Index: 45587, SMILES: Clc1cc(Cl)cc(Cl)c1, Value: 0.5285 +Index: 45615, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1536 +Index: 45616, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.2502 +Index: 45617, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.3427 +Index: 45618, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.5113 +Index: 45619, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.7507 +Index: 45919, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1302 +Index: 45920, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.1491 +Index: 45921, SMILES: O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O, Value: 0.172 +Index: 45932, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.13179 +Index: 45933, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.16297 +Index: 45941, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.1166 +Index: 45942, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.1239 +Index: 45943, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.1309 +Index: 45944, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.1395 +Index: 45945, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.1465 +Index: 45946, SMILES: O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])CN([N+](=O)[O-])C1, Value: 0.1576 +Index: 45954, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.2349 +Index: 45955, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.2486 +Index: 45956, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.2641 +Index: 45957, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.2811 +Index: 45958, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.3002 +Index: 45959, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.3209 +Index: 45960, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.3437 +Index: 45984, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.1559 +Index: 45985, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.177 +Index: 45986, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2099 +Index: 45987, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2384 +Index: 45988, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.2884 +Index: 45989, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.3269 +Index: 45990, SMILES: O=C1C=CC(=O)N1c1ccccc1Br, Value: 0.387 +Index: 46022, SMILES: NNC(=O)NN.O=[N+]([O-])NC1=NC(C2N=NC(N[N+](=O)[O-])=N2)N=N1, Value: 0.1282923 +Index: 46023, SMILES: NNC(=O)NN.O=[N+]([O-])NC1=NC(C2N=NC(N[N+](=O)[O-])=N2)N=N1, Value: 0.1536735 +Index: 46024, SMILES: NNC(=O)NN.O=[N+]([O-])NC1=NC(C2N=NC(N[N+](=O)[O-])=N2)N=N1, Value: 0.182555 +Index: 46025, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.3758 +Index: 46026, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.4256 +Index: 46027, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.4812 +Index: 46028, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.5396 +Index: 46029, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.6083 +Index: 46030, SMILES: CC(=NC#N)N(C)Cc1ccc(Cl)nc1, Value: 0.6799 +Index: 46060, SMILES: NC(=O)c1ccc([N+](=O)[O-])cc1, Value: 0.1169 +Index: 46111, SMILES: On1nnc2ccccc21, Value: 0.1275 +Index: 46112, SMILES: On1nnc2ccccc21, Value: 0.1416 +Index: 46113, SMILES: On1nnc2ccccc21, Value: 0.1571 +Index: 46144, SMILES: C[n+]1ccn(CCOCOCCn2cc[n+](C)c2)c1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F, Value: 0.119263 +Index: 46145, SMILES: C[n+]1ccn(CCOCOCCn2cc[n+](C)c2)c1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F, Value: 0.130678 +Index: 46146, SMILES: C[n+]1ccn(CCOCOCCn2cc[n+](C)c2)c1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F, Value: 0.140125 +Index: 46157, SMILES: O=C1O[B-]2(OC1=O)OC(=O)C(=O)O2.[Li+], Value: 0.14842 +Index: 46158, SMILES: O=C1O[B-]2(OC1=O)OC(=O)C(=O)O2.[Li+], Value: 0.13927 +Index: 46159, SMILES: O=C1O[B-]2(OC1=O)OC(=O)C(=O)O2.[Li+], Value: 0.12708 +Index: 46225, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1828 +Index: 46226, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1906 +Index: 46227, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1989 +Index: 46228, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2073 +Index: 46229, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2173 +Index: 46230, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2286 +Index: 46231, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2418 +Index: 46232, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2537 +Index: 46267, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1488 +Index: 46268, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1532 +Index: 46269, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1587 +Index: 46270, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1645 +Index: 46271, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1708 +Index: 46272, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1806 +Index: 46273, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1847 +Index: 46274, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.192 +Index: 46275, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.2014 +Index: 46276, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.2349 +Index: 46277, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.2486 +Index: 46278, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.2641 +Index: 46279, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.2811 +Index: 46280, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.3002 +Index: 46281, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.3209 +Index: 46282, SMILES: COc1cc([N+](=O)[O-])ccc1N, Value: 0.3437 +Index: 46307, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.167 +Index: 46308, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.1908 +Index: 46309, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.2188 +Index: 46310, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.2487 +Index: 46311, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.2833 +Index: 46312, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.3191 +Index: 46313, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.3594 +Index: 46314, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.4034 +Index: 46315, SMILES: CCCc1cc(=O)[nH]c(=S)[nH]1, Value: 0.4519 +Index: 46340, SMILES: O=c1cc(CO)occ1O, Value: 0.2385 +Index: 46341, SMILES: O=c1cc(CO)occ1O, Value: 0.2489 +Index: 46342, SMILES: O=c1cc(CO)occ1O, Value: 0.2589 +Index: 46343, SMILES: O=c1cc(CO)occ1O, Value: 0.2681 +Index: 46344, SMILES: O=c1cc(CO)occ1O, Value: 0.28 +Index: 46345, SMILES: O=c1cc(CO)occ1O, Value: 0.2918 +Index: 46346, SMILES: O=c1cc(CO)occ1O, Value: 0.303 +Index: 46347, SMILES: O=c1cc(CO)occ1O, Value: 0.3163 +Index: 46348, SMILES: O=c1cc(CO)occ1O, Value: 0.3305 +Index: 46349, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.21388 +Index: 46350, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.22565 +Index: 46351, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.24001 +Index: 46352, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.25642 +Index: 46353, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.27207 +Index: 46354, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.28696 +Index: 46355, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.30321 +Index: 46360, SMILES: CN1COCN(Cc2cnc(Cl)s2)C1=N[N+](=O)[O-], Value: 0.1174 +Index: 46361, SMILES: CN1COCN(Cc2cnc(Cl)s2)C1=N[N+](=O)[O-], Value: 0.1335 +Index: 46362, SMILES: CN1COCN(Cc2cnc(Cl)s2)C1=N[N+](=O)[O-], Value: 0.1518 +Index: 46363, SMILES: CN1COCN(Cc2cnc(Cl)s2)C1=N[N+](=O)[O-], Value: 0.172 +Index: 46373, SMILES: Cc1c(C(N)=O)cc([N+](=O)[O-])cc1[N+](=O)[O-], Value: 0.204 +Index: 46374, SMILES: Cc1c(C(N)=O)cc([N+](=O)[O-])cc1[N+](=O)[O-], Value: 0.2159 +Index: 46375, SMILES: Cc1c(C(N)=O)cc([N+](=O)[O-])cc1[N+](=O)[O-], Value: 0.2278 +Index: 46376, SMILES: Cc1c(C(N)=O)cc([N+](=O)[O-])cc1[N+](=O)[O-], Value: 0.2391 +Index: 46377, SMILES: Cc1c(C(N)=O)cc([N+](=O)[O-])cc1[N+](=O)[O-], Value: 0.2521 +Index: 46378, SMILES: Cc1c(C(N)=O)cc([N+](=O)[O-])cc1[N+](=O)[O-], Value: 0.2647 +Index: 46379, SMILES: Cc1c(C(N)=O)cc([N+](=O)[O-])cc1[N+](=O)[O-], Value: 0.2773 +Index: 46380, SMILES: Cc1c(C(N)=O)cc([N+](=O)[O-])cc1[N+](=O)[O-], Value: 0.2897 +Index: 46386, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1272 +Index: 46387, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1502 +Index: 46388, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1771 +Index: 46389, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2005 +Index: 46390, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2336 +Index: 46391, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2638 +Index: 46392, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.2776 +Index: 46393, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.2907 +Index: 46394, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3036 +Index: 46395, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3166 +Index: 46396, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3297 +Index: 46397, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.343 +Index: 46398, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3559 +Index: 46399, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3692 +Index: 46400, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.3839 +Index: 46401, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.398 +Index: 46402, SMILES: c1ccc(-c2nnn[nH]2)cc1, Value: 0.4119 +Index: 46408, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1829 +Index: 46409, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1882 +Index: 46410, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1934 +Index: 46411, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2037 +Index: 46412, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2137 +Index: 46413, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2235 +Index: 46414, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.233 +Index: 46415, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2377 +Index: 46416, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2423 +Index: 46417, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.2607 +Index: 46418, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.152575 +Index: 46419, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.158583 +Index: 46420, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.165193 +Index: 46421, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.172145 +Index: 46422, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.179432 +Index: 46423, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.187111 +Index: 46434, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1189 +Index: 46435, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1358 +Index: 46436, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.177 +Index: 46437, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1903 +Index: 46438, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2683 +Index: 46439, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2985 +Index: 46440, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.361 +Index: 46441, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3999 +Index: 46442, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4603 +Index: 46443, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5428 +Index: 46444, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5992 +Index: 46445, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6672 +Index: 46446, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.743 +Index: 46455, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1225 +Index: 46456, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1303 +Index: 46457, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1388 +Index: 46518, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1251 +Index: 46519, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1439 +Index: 46520, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.1819 +Index: 46521, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2144 +Index: 46522, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.2417 +Index: 46523, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.314 +Index: 46524, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3493 +Index: 46525, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.3931 +Index: 46526, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.4445 +Index: 46527, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5062 +Index: 46528, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.5641 +Index: 46529, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6319 +Index: 46530, SMILES: COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC, Value: 0.6961 +Index: 46562, SMILES: N#Cc1cccnc1, Value: 0.239 +Index: 46563, SMILES: N#Cc1cccnc1, Value: 0.393 +Index: 46564, SMILES: N#Cc1cccnc1, Value: 0.568 +Index: 46570, SMILES: N#Cc1ccncc1, Value: 0.151 +Index: 46571, SMILES: N#Cc1ccncc1, Value: 0.287 +Index: 46601, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1291 +Index: 46602, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1816 +Index: 46603, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.2442 +Index: 46604, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.3023 +Index: 46605, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.3621 +Index: 46606, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.4352 +Index: 46607, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.5111 +Index: 46608, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.5717 +Index: 46609, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.6439 +Index: 46610, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.7218 +Index: 46611, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.7923 +Index: 46616, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.12 +Index: 46617, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.1297 +Index: 46618, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.1498 +Index: 46619, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.1943 +Index: 46620, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.2413 +Index: 46621, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.3119 +Index: 46622, SMILES: O=[N+]([O-])c1cccc(Cl)c1Cl, Value: 0.3801 +Index: 46623, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1339 +Index: 46624, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1614 +Index: 46625, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1913 +Index: 46626, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.2158 +Index: 46627, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.2639 +Index: 46628, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.3066 +Index: 46629, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.3542 +Index: 46630, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.4119 +Index: 46631, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.4914 +Index: 46632, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.5479 +Index: 46633, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.6348 +Index: 46635, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1418 +Index: 46636, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1583 +Index: 46637, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1924 +Index: 46638, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.2411 +Index: 46639, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.2912 +Index: 46640, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.3472 +Index: 46641, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.403 +Index: 46642, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.4624 +Index: 46643, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.5191 +Index: 46644, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.5821 +Index: 46665, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1228 +Index: 46666, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1301 +Index: 46667, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1434 +Index: 46668, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1591 +Index: 46669, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1777 +Index: 46670, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.1959 +Index: 46671, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.2143 +Index: 46672, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.2366 +Index: 46673, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.2611 +Index: 46674, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.2877 +Index: 46675, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.3149 +Index: 46676, SMILES: COc1cnc(Cl)nc1Cl, Value: 0.3432 +Index: 46679, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.124 +Index: 46680, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.15 +Index: 46681, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.18 +Index: 46682, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.21 +Index: 46683, SMILES: CCCCCCCCCCCCCCCc1cccc(O)c1, Value: 0.242 +Index: 46717, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.118682 +Index: 46718, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.1513 +Index: 46719, SMILES: CC(C)(C#N)N=NC(C)(C)C#N, Value: 0.18131 +Index: 46785, SMILES: O=[PH](O)c1ccccc1, Value: 0.1454 +Index: 46786, SMILES: O=[PH](O)c1ccccc1, Value: 0.2254 +Index: 46787, SMILES: O=[PH](O)c1ccccc1, Value: 0.3085 +Index: 46788, SMILES: O=[PH](O)c1ccccc1, Value: 0.4152 +Index: 46789, SMILES: O=[PH](O)c1ccccc1, Value: 0.5544 +Index: 46794, SMILES: CP(=O)(O)c1ccccc1, Value: 0.1625 +Index: 46795, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2183 +Index: 46796, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3012 +Index: 46797, SMILES: CP(=O)(O)c1ccccc1, Value: 0.4194 +Index: 46798, SMILES: CP(=O)(O)c1ccccc1, Value: 0.5628 +Index: 46880, SMILES: CP(=O)(c1ccccc1)c1ccccc1, Value: 0.12307 +Index: 46881, SMILES: CP(=O)(c1ccccc1)c1ccccc1, Value: 0.15627 +Index: 46882, SMILES: CP(=O)(c1ccccc1)c1ccccc1, Value: 0.18304 +Index: 46886, SMILES: O=P(c1ccccc1)(c1ccccc1)c1ccccc1, Value: 0.12254 +Index: 46887, SMILES: O=P(c1ccccc1)(c1ccccc1)c1ccccc1, Value: 0.15175 +Index: 46888, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.118 +Index: 46889, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.1312 +Index: 46890, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.1424 +Index: 46891, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.1623 +Index: 46892, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.1873 +Index: 46893, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.2148 +Index: 46894, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.2437 +Index: 46895, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.2769 +Index: 46896, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.3121 +Index: 46900, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1257 +Index: 46901, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1432 +Index: 46902, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1584 +Index: 46903, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1835 +Index: 46904, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.2091 +Index: 46905, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.2346 +Index: 46913, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1302 +Index: 46914, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1523 +Index: 46915, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1742 +Index: 46916, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.197 +Index: 46917, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2243 +Index: 46918, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2616 +Index: 46919, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2966 +Index: 46920, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3343 +Index: 46921, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3791 +Index: 46949, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.12 +Index: 46950, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.16 +Index: 46951, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.22 +Index: 46952, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.28 +Index: 46953, SMILES: c1ccc(P(c2ccccc2)c2ccccc2)cc1, Value: 0.37 +Index: 46979, SMILES: Cn1nc([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-], Value: 0.124896 +Index: 46980, SMILES: Cn1nc([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-], Value: 0.167978 +Index: 47036, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1354 +Index: 47037, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.1883 +Index: 47038, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.2609 +Index: 47039, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.3405 +Index: 47040, SMILES: OCC(O)COc1ccc(Cl)cc1, Value: 0.4184 +Index: 47121, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2356 +Index: 47122, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2367 +Index: 47123, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.239 +Index: 47124, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2414 +Index: 47125, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.246 +Index: 47126, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2489 +Index: 47127, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2525 +Index: 47128, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2567 +Index: 47129, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2609 +Index: 47140, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.118345 +Index: 47141, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.138826 +Index: 47142, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.159288 +Index: 47143, SMILES: COc1cc2c(cc1OC)C(=O)CC2, Value: 0.18548 +Index: 47149, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1221 +Index: 47150, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1412 +Index: 47151, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1628 +Index: 47152, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1856 +Index: 47153, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2124 +Index: 47154, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2387 +Index: 47155, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2715 +Index: 47156, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3112 +Index: 47157, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3531 +Index: 47227, SMILES: NC(=O)c1ccccc1N, Value: 0.1274 +Index: 47228, SMILES: NC(=O)c1ccccc1N, Value: 0.1444 +Index: 47229, SMILES: NC(=O)c1ccccc1N, Value: 0.1634 +Index: 47230, SMILES: NC(=O)c1ccccc1N, Value: 0.1862 +Index: 47231, SMILES: NC(=O)c1ccccc1N, Value: 0.2085 +Index: 47265, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.13327 +Index: 47266, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.15561 +Index: 47267, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.18947 +Index: 47268, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.21592 +Index: 47269, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.25429 +Index: 47270, SMILES: Cc1nc(C)c(C)nc1C, Value: 0.29107 +Index: 47315, SMILES: O=C(O)c1ccccc1, Value: 0.125 +Index: 47316, SMILES: O=C(O)c1ccccc1, Value: 0.152 +Index: 47317, SMILES: O=C(O)c1ccccc1, Value: 0.175 +Index: 47318, SMILES: O=C(O)c1ccccc1, Value: 0.198 +Index: 47319, SMILES: O=C(O)c1ccccc1, Value: 0.213 +Index: 47320, SMILES: O=C(O)c1ccccc1, Value: 0.237 +Index: 47321, SMILES: O=C(O)c1ccccc1, Value: 0.26 +Index: 47322, SMILES: O=C(O)c1ccccc1, Value: 0.282 +Index: 47323, SMILES: O=C(O)c1ccccc1, Value: 0.318 +Index: 47324, SMILES: O=C(O)c1ccccc1, Value: 0.348 +Index: 47336, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2056 +Index: 47337, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2345 +Index: 47338, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.2782 +Index: 47339, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3336 +Index: 47340, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.3921 +Index: 47341, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.4549 +Index: 47342, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.5176 +Index: 47343, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.6132 +Index: 47344, SMILES: O=C(c1ccccc1)c1ccccc1, Value: 0.7191 +Index: 47354, SMILES: OC/C=C/c1ccccc1, Value: 0.172 +Index: 47355, SMILES: OC/C=C/c1ccccc1, Value: 0.225 +Index: 47356, SMILES: OC/C=C/c1ccccc1, Value: 0.27 +Index: 47357, SMILES: OC/C=C/c1ccccc1, Value: 0.326 +Index: 47358, SMILES: OC/C=C/c1ccccc1, Value: 0.392 +Index: 47359, SMILES: OC/C=C/c1ccccc1, Value: 0.452 +Index: 47360, SMILES: OC/C=C/c1ccccc1, Value: 0.523 +Index: 47361, SMILES: OC/C=C/c1ccccc1, Value: 0.591 +Index: 47362, SMILES: OC/C=C/c1ccccc1, Value: 0.646 +Index: 47387, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1227 +Index: 47388, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1447 +Index: 47389, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1569 +Index: 47390, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1758 +Index: 47391, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.1975 +Index: 47392, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2225 +Index: 47393, SMILES: O=C1OC(=O)c2c(Cl)cccc21, Value: 0.2515 +Index: 47394, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1339 +Index: 47395, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.1631 +Index: 47396, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.19 +Index: 47397, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2156 +Index: 47398, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2411 +Index: 47399, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2686 +Index: 47400, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.2963 +Index: 47401, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.3295 +Index: 47402, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.3622 +Index: 47403, SMILES: O=C1OC(=O)c2cc(Cl)ccc21, Value: 0.4067 +Index: 47419, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.12217 +Index: 47427, SMILES: O=C(O)c1ccco1, Value: 0.1169 +Index: 47428, SMILES: O=C(O)c1ccco1, Value: 0.127 +Index: 47429, SMILES: O=C(O)c1ccco1, Value: 0.1372 +Index: 47430, SMILES: O=C(O)c1ccco1, Value: 0.1461 +Index: 47431, SMILES: O=C(O)c1ccco1, Value: 0.1559 +Index: 47432, SMILES: O=C(O)c1ccco1, Value: 0.1656 +Index: 47433, SMILES: O=C(O)c1ccco1, Value: 0.1842 +Index: 47434, SMILES: O=C(O)c1ccco1, Value: 0.2161 +Index: 47435, SMILES: O=C(O)c1ccco1, Value: 0.2323 +Index: 47478, SMILES: c1nc[nH]n1, Value: 0.1168 +Index: 47479, SMILES: c1nc[nH]n1, Value: 0.1282 +Index: 47480, SMILES: c1nc[nH]n1, Value: 0.1408 +Index: 47481, SMILES: c1nc[nH]n1, Value: 0.1552 +Index: 47482, SMILES: c1nc[nH]n1, Value: 0.171 +Index: 47483, SMILES: c1nc[nH]n1, Value: 0.1892 +Index: 47484, SMILES: c1nc[nH]n1, Value: 0.2104 +Index: 47538, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.119 +Index: 47539, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1307 +Index: 47540, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1437 +Index: 47541, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1601 +Index: 47602, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1182 +Index: 47603, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1374 +Index: 47604, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1598 +Index: 47605, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1838 +Index: 47606, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2104 +Index: 47607, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2403 +Index: 47608, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2735 +Index: 47609, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3103 +Index: 47610, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.3533 +Index: 47634, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1201 +Index: 47635, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1491 +Index: 47636, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.1861 +Index: 47637, SMILES: Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1, Value: 0.2294 +Index: 47747, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1428 +Index: 47748, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1607 +Index: 47749, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.1807 +Index: 47750, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2031 +Index: 47751, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2279 +Index: 47752, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2557 +Index: 47753, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.2865 +Index: 47754, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3207 +Index: 47755, SMILES: CCCOC(=O)c1ccc(O)cc1, Value: 0.3588 +Index: 47833, SMILES: Cc1ccc2ccccc2c1, Value: 0.621 +Index: 47834, SMILES: Cc1ccc2ccccc2c1, Value: 0.6731 +Index: 47835, SMILES: Cc1ccc2ccccc2c1, Value: 0.7292 +Index: 47836, SMILES: Cc1ccc2ccccc2c1, Value: 0.7868 +Index: 47837, SMILES: Cc1ccc2ccccc2c1, Value: 0.8494 +Index: 47838, SMILES: Cc1ccc2ccccc2c1, Value: 0.9506 +Index: 47867, SMILES: Nc1cccnc1, Value: 0.4325 +Index: 47868, SMILES: Nc1cccnc1, Value: 0.4806 +Index: 47869, SMILES: Nc1cccnc1, Value: 0.5375 +Index: 47870, SMILES: Nc1cccnc1, Value: 0.591 +Index: 47871, SMILES: Nc1cccnc1, Value: 0.6499 +Index: 47872, SMILES: Nc1cccnc1, Value: 0.7115 +Index: 47873, SMILES: Nc1cccnc1, Value: 0.7704 +Index: 47874, SMILES: Nc1cccnc1, Value: 0.8349 +Index: 47883, SMILES: Nc1ccccn1, Value: 0.1979 +Index: 47884, SMILES: Nc1ccccn1, Value: 0.249 +Index: 47885, SMILES: Nc1ccccn1, Value: 0.3088 +Index: 47886, SMILES: Nc1ccccn1, Value: 0.3775 +Index: 47887, SMILES: Nc1ccccn1, Value: 0.4575 +Index: 47888, SMILES: Nc1ccccn1, Value: 0.5483 +Index: 47889, SMILES: Nc1ccccn1, Value: 0.6545 +Index: 47938, SMILES: c1nc[nH]n1, Value: 0.1359 +Index: 47939, SMILES: c1nc[nH]n1, Value: 0.1667 +Index: 47940, SMILES: c1nc[nH]n1, Value: 0.2111 +Index: 47982, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1204 +Index: 47983, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1364 +Index: 48073, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2551 +Index: 48074, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.274 +Index: 48075, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.2951 +Index: 48076, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.3176 +Index: 48077, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.3411 +Index: 48078, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.3662 +Index: 48079, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.3918 +Index: 48080, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.4184 +Index: 48081, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.4449 +Index: 48082, SMILES: Cc1ccc([N+](=O)[O-])c(C(=O)O)c1, Value: 0.4729 +Index: 48092, SMILES: COC(=O)/C=C/c1ccc(O)cc1, Value: 0.1278 +Index: 48093, SMILES: COC(=O)/C=C/c1ccc(O)cc1, Value: 0.1429 +Index: 48094, SMILES: COC(=O)/C=C/c1ccc(O)cc1, Value: 0.1711 +Index: 48095, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.1821 +Index: 48096, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.2086 +Index: 48097, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.2474 +Index: 48098, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.2946 +Index: 48099, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.3248 +Index: 48141, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.1315 +Index: 48142, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.1699 +Index: 48152, SMILES: Cc1ccc2ccccc2c1, Value: 0.5023 +Index: 48153, SMILES: Cc1ccc2ccccc2c1, Value: 0.5786 +Index: 48154, SMILES: Cc1ccc2ccccc2c1, Value: 0.6502 +Index: 48155, SMILES: Cc1ccc2ccccc2c1, Value: 0.7262 +Index: 48156, SMILES: Cc1ccc2ccccc2c1, Value: 0.8309 +Index: 48157, SMILES: Cc1ccc2ccccc2c1, Value: 0.9065 +Index: 48169, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1318 +Index: 48211, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.123 +Index: 48212, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.15 +Index: 48213, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.182 +Index: 48214, SMILES: Clc1cc(Cl)c(OCCBr)c(Cl)c1, Value: 0.2201 +Index: 48279, SMILES: c1ccc2ccccc2c1, Value: 0.115 +Index: 48280, SMILES: c1ccc2ccccc2c1, Value: 0.1234 +Index: 48281, SMILES: c1ccc2ccccc2c1, Value: 0.1326 +Index: 48282, SMILES: c1ccc2ccccc2c1, Value: 0.1412 +Index: 48283, SMILES: c1ccc2ccccc2c1, Value: 0.1498 +Index: 48284, SMILES: c1ccc2ccccc2c1, Value: 0.1583 +Index: 48285, SMILES: c1ccc2ccccc2c1, Value: 0.16823 +Index: 48286, SMILES: c1ccc2ccccc2c1, Value: 0.177 +Index: 48287, SMILES: c1ccc2ccccc2c1, Value: 0.209 +Index: 48288, SMILES: c1ccc2ccccc2c1, Value: 0.2302 +Index: 48289, SMILES: c1ccc2ccccc2c1, Value: 0.2646 +Index: 48290, SMILES: c1ccc2ccccc2c1, Value: 0.3044 +Index: 48291, SMILES: c1ccc2ccccc2c1, Value: 0.3294 +Index: 48292, SMILES: c1ccc2ccccc2c1, Value: 0.3505 +Index: 48293, SMILES: c1ccc2ccccc2c1, Value: 0.389 +Index: 48299, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.1477 +Index: 48300, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.1872 +Index: 48301, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.2252 +Index: 48302, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.2927 +Index: 48303, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.3596 +Index: 48304, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.4151 +Index: 48315, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1279 +Index: 48316, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1786 +Index: 48317, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.2401 +Index: 48579, SMILES: Cc1ccc2ccccc2c1, Value: 0.2827 +Index: 48580, SMILES: Cc1ccc2ccccc2c1, Value: 0.3479 +Index: 48581, SMILES: Cc1ccc2ccccc2c1, Value: 0.4428 +Index: 48582, SMILES: Cc1ccc2ccccc2c1, Value: 0.55 +Index: 48583, SMILES: Cc1ccc2ccccc2c1, Value: 0.6427 +Index: 48584, SMILES: Cc1ccc2ccccc2c1, Value: 0.8112 +Index: 48651, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1147 +Index: 48652, SMILES: O=[N+]([O-])c1ccc(Cl)c(Cl)c1, Value: 0.1727 +Index: 48796, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1159 +Index: 48797, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.1556 +Index: 48798, SMILES: CC(C)Cc1ccc([C@H](C)C(=O)O)cc1, Value: 0.2104 +Index: 48850, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1339 +Index: 48851, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1712 +Index: 48852, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2231 +Index: 48853, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2516 +Index: 48854, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3221 +Index: 48855, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3795 +Index: 48856, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4424 +Index: 48857, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5188 +Index: 48858, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5926 +Index: 48859, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.7107 +Index: 48860, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.7775 +Index: 48861, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.8583 +Index: 48867, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.1284 +Index: 48868, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.1658 +Index: 48869, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.22 +Index: 48870, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.2846 +Index: 48871, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.3561 +Index: 48872, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.4384 +Index: 48883, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1423 +Index: 48884, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1873 +Index: 48885, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.2397 +Index: 49029, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.132 +Index: 49030, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1605 +Index: 49031, SMILES: COC(=O)c1c(C)cc(O)c(C)c1O, Value: 0.1865 +Index: 49039, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1151 +Index: 49040, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1446 +Index: 49041, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.1721 +Index: 49042, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2062 +Index: 49043, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.2516 +Index: 49044, SMILES: CCOC(=O)c1ccc(N)cc1, Value: 0.3054 +Index: 49047, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1218 +Index: 49048, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1497 +Index: 49049, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1788 +Index: 49050, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2168 +Index: 49051, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2625 +Index: 49052, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3147 +Index: 49053, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3764 +Index: 49054, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4463 +Index: 49055, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5371 +Index: 49065, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1206 +Index: 49066, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.148 +Index: 49067, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.1821 +Index: 49068, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2113 +Index: 49069, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.2527 +Index: 49070, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.299 +Index: 49071, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.3525 +Index: 49072, SMILES: CC(C)Cc1ccc(C(C)C(=O)O)cc1, Value: 0.4169 +Index: 49113, SMILES: COc1cc(CO)ccc1O, Value: 0.14 +Index: 49411, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.8952 +Index: 49412, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.866 +Index: 49413, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.8216 +Index: 49414, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.7736 +Index: 49415, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.7148 +Index: 49416, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.6997 +Index: 49417, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.6373 +Index: 49418, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.6177 +Index: 49419, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.5471 +Index: 49420, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.5144 +Index: 49421, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4647 +Index: 49422, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4319 +Index: 49423, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4019 +Index: 49424, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3607 +Index: 49425, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3381 +Index: 49426, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3068 +Index: 49427, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.2767 +Index: 49436, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.1307 +Index: 49437, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.1895 +Index: 49438, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.3349 +Index: 49439, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.3238 +Index: 49440, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.279 +Index: 49441, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.2537 +Index: 49442, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.2018 +Index: 49443, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1828 +Index: 49444, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1459 +Index: 49445, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1151 +Index: 49462, SMILES: COC(=O)c1ccc(C(=O)OC)cc1, Value: 0.1149615 +Index: 49463, SMILES: COC(=O)c1ccc(C(=O)OC)cc1, Value: 0.1250998 +Index: 49464, SMILES: COC(=O)c1ccc(C(=O)OC)cc1, Value: 0.1361086 +Index: 49568, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.1235 +Index: 49569, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.1423 +Index: 49570, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.1652 +Index: 49571, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.197 +Index: 49572, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.2301 +Index: 49573, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.2685 +Index: 49574, SMILES: Nc1ccc(Cc2ccc(N)cc2)cc1, Value: 0.3064 +Index: 49577, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.1263 +Index: 49578, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.14271 +Index: 49579, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.16428 +Index: 49580, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.19052 +Index: 49581, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.2181 +Index: 49582, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.24757 +Index: 49583, SMILES: O=P(NCc1ccccc1)(Oc1ccccc1)Oc1ccccc1, Value: 0.27526 +Index: 49601, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.2293 +Index: 49602, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.2622 +Index: 49603, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.3121 +Index: 49604, SMILES: CS(=O)(=O)c1ccc(F)cc1, Value: 0.352 +Index: 49642, SMILES: c1ccc(CSSCc2ccccc2)cc1, Value: 0.1314 +Index: 49643, SMILES: c1ccc(CSSCc2ccccc2)cc1, Value: 0.1597 +Index: 49644, SMILES: c1ccc(CSSCc2ccccc2)cc1, Value: 0.2085 +Index: 49645, SMILES: c1ccc(CSSCc2ccccc2)cc1, Value: 0.2462 +Index: 49646, SMILES: c1ccc(CSSCc2ccccc2)cc1, Value: 0.2915 +Index: 49667, SMILES: Clc1ccc(SSc2ccc(Cl)cc2)cc1, Value: 0.122 +Index: 49668, SMILES: Clc1ccc(SSc2ccc(Cl)cc2)cc1, Value: 0.174 +Index: 49669, SMILES: Clc1ccc(SSc2ccc(Cl)cc2)cc1, Value: 0.243 +Index: 49670, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.1807 +Index: 49671, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.2176 +Index: 49672, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.258 +Index: 49673, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.3083 +Index: 49674, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.35041 +Index: 49675, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.3861 +Index: 49676, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.424 +Index: 49677, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.4556 +Index: 49678, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.226 +Index: 49679, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.263 +Index: 49680, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.296 +Index: 49681, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.3378 +Index: 49682, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.3912 +Index: 49683, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.4487 +Index: 49684, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.5114 +Index: 49685, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.5575 +Index: 49701, SMILES: O=[PH](O)c1ccccc1, Value: 0.1336 +Index: 49702, SMILES: O=[PH](O)c1ccccc1, Value: 0.1573 +Index: 49703, SMILES: O=[PH](O)c1ccccc1, Value: 0.1861 +Index: 49704, SMILES: O=[PH](O)c1ccccc1, Value: 0.2284 +Index: 49705, SMILES: O=[PH](O)c1ccccc1, Value: 0.2691 +Index: 49706, SMILES: O=[PH](O)c1ccccc1, Value: 0.315 +Index: 49707, SMILES: O=[PH](O)c1ccccc1, Value: 0.3568 +Index: 49709, SMILES: CP(=O)(O)c1ccccc1, Value: 0.1317 +Index: 49710, SMILES: CP(=O)(O)c1ccccc1, Value: 0.1558 +Index: 49711, SMILES: CP(=O)(O)c1ccccc1, Value: 0.1883 +Index: 49712, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2142 +Index: 49713, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2552 +Index: 49714, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2882 +Index: 49715, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3398 +Index: 49801, SMILES: Nc1ccccn1, Value: 0.3092 +Index: 49802, SMILES: Nc1ccccn1, Value: 0.3245 +Index: 49803, SMILES: Nc1ccccn1, Value: 0.3496 +Index: 49804, SMILES: Nc1ccccn1, Value: 0.3705 +Index: 49805, SMILES: Nc1ccccn1, Value: 0.3921 +Index: 49806, SMILES: Nc1ccccn1, Value: 0.4155 +Index: 49807, SMILES: Nc1ccccn1, Value: 0.4392 +Index: 49808, SMILES: Nc1ccccn1, Value: 0.4649 +Index: 49809, SMILES: Nc1ccccn1, Value: 0.4908 +Index: 49810, SMILES: Nc1ccccn1, Value: 0.5198 +Index: 49811, SMILES: Nc1ccccn1, Value: 0.5485 +Index: 49812, SMILES: Nc1ccccn1, Value: 0.5796 +Index: 49813, SMILES: Nc1ccccn1, Value: 0.6112 +Index: 49814, SMILES: Nc1ccccn1, Value: 0.6452 +Index: 49815, SMILES: Nc1ccccn1, Value: 0.681 +Index: 49816, SMILES: Nc1ccccn1, Value: 0.7182 +Index: 49821, SMILES: C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4, Value: 0.12688714 +Index: 49822, SMILES: C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4, Value: 0.15696479 +Index: 49823, SMILES: C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4, Value: 0.19262803 +Index: 49824, SMILES: C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4, Value: 0.23593246 +Index: 49825, SMILES: C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4, Value: 0.28652702 +Index: 49829, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1318 +Index: 49830, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1526 +Index: 49831, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1731 +Index: 49832, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.1952 +Index: 49833, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.2199 +Index: 49834, SMILES: c1ccc2c(c1)Cc1ccccc1-2, Value: 0.2497 +Index: 50012, SMILES: CC1(C)CO[P+]([O-])(Oc2c(Br)cc(Br)cc2Br)OC1, Value: 0.12367 +Index: 50053, SMILES: O=P(O)(O)c1ccccc1, Value: 0.12186 +Index: 50054, SMILES: O=P(O)(O)c1ccccc1, Value: 0.13301 +Index: 50055, SMILES: O=P(O)(O)c1ccccc1, Value: 0.14331 +Index: 50056, SMILES: O=P(O)(O)c1ccccc1, Value: 0.15764 +Index: 50057, SMILES: O=P(O)(O)c1ccccc1, Value: 0.17008 +Index: 50058, SMILES: O=P(O)(O)c1ccccc1, Value: 0.18302 +Index: 50059, SMILES: O=P(O)(O)c1ccccc1, Value: 0.19637 +Index: 50060, SMILES: O=P(O)(O)c1ccccc1, Value: 0.21159 +Index: 50061, SMILES: O=P(O)(O)c1ccccc1, Value: 0.22705 +Index: 50062, SMILES: O=P(O)(O)c1ccccc1, Value: 0.24317 +Index: 50063, SMILES: O=P(O)(O)c1ccccc1, Value: 0.25981 +Index: 50064, SMILES: O=P(O)(O)c1ccccc1, Value: 0.27798 +Index: 50117, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1307 +Index: 50118, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1522 +Index: 50119, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.18 +Index: 50120, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2105 +Index: 50121, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2448 +Index: 50206, SMILES: O=C(O)c1ccccc1, Value: 0.1185 +Index: 50207, SMILES: O=C(O)c1ccccc1, Value: 0.1336 +Index: 50208, SMILES: O=C(O)c1ccccc1, Value: 0.1502 +Index: 50209, SMILES: O=C(O)c1ccccc1, Value: 0.1682 +Index: 50210, SMILES: O=C(O)c1ccccc1, Value: 0.1878 +Index: 50211, SMILES: O=C(O)c1ccccc1, Value: 0.2091 +Index: 50212, SMILES: O=C(O)c1ccccc1, Value: 0.2322 +Index: 50213, SMILES: O=C(O)c1ccccc1, Value: 0.2599 +Index: 50251, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.44272 +Index: 50252, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.42978 +Index: 50253, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.41097 +Index: 50254, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.39527 +Index: 50255, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.38559 +Index: 50256, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.3759 +Index: 50257, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.36148 +Index: 50258, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.35094 +Index: 50259, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.34096 +Index: 50260, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.33075 +Index: 50265, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1295 +Index: 50266, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1549 +Index: 50267, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1791 +Index: 50268, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.211 +Index: 50269, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2431 +Index: 50270, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2773 +Index: 50393, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1155 +Index: 50394, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1259 +Index: 50395, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.137 +Index: 50396, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1485 +Index: 50397, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1611 +Index: 50398, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1754 +Index: 50399, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1895 +Index: 50418, SMILES: C/C=C/C=C/C(=O)O, Value: 0.12125 +Index: 50419, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.3391 +Index: 50420, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.3485 +Index: 50421, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.3656 +Index: 50422, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.3843 +Index: 50423, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.4104 +Index: 50424, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.4361 +Index: 50425, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.4657 +Index: 50426, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.5017 +Index: 50427, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.5476 +Index: 50428, SMILES: Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl, Value: 0.5873 +Index: 50432, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1308 +Index: 50433, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1492 +Index: 50434, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1693 +Index: 50435, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.1914 +Index: 50436, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.2157 +Index: 50437, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.24 +Index: 50438, SMILES: O=C(O)Cc1ccc([N+](=O)[O-])cc1, Value: 0.2707 +Index: 50456, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.127 +Index: 50457, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.146 +Index: 50458, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.1719 +Index: 50459, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.2028 +Index: 50460, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.2361 +Index: 50461, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.2738 +Index: 50462, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.3165 +Index: 50463, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.3639 +Index: 50464, SMILES: C=CC(=O)NC(C)(C)C, Value: 0.4298 +Index: 50465, SMILES: Cc1cccc(Nc2ccccc2C(=O)O)c1C, Value: 0.1219 +Index: 50466, SMILES: Cc1cccc(Nc2ccccc2C(=O)O)c1C, Value: 0.1377 +Index: 50467, SMILES: Cc1cccc(Nc2ccccc2C(=O)O)c1C, Value: 0.1535 +Index: 50468, SMILES: Cc1cccc(Nc2ccccc2C(=O)O)c1C, Value: 0.1648 +Index: 50469, SMILES: Cc1cccc(Nc2ccccc2C(=O)O)c1C, Value: 0.1753 +Index: 50470, SMILES: Cc1cccc(Nc2ccccc2C(=O)O)c1C, Value: 0.1901 +Index: 50507, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1395 +Index: 50508, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1439 +Index: 50509, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1479 +Index: 50510, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1525 +Index: 50511, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.157 +Index: 50512, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1636 +Index: 50513, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1664 +Index: 50514, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1767 +Index: 50515, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.1845 +Index: 50516, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.20318 +Index: 50517, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.18787 +Index: 50518, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.16959 +Index: 50519, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.1557 +Index: 50520, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.14234 +Index: 50521, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.12916 +Index: 50522, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.11617 +Index: 50526, SMILES: O=c1cc(CO)occ1O, Value: 0.1479 +Index: 50527, SMILES: O=c1cc(CO)occ1O, Value: 0.1574 +Index: 50528, SMILES: O=c1cc(CO)occ1O, Value: 0.1651 +Index: 50529, SMILES: O=c1cc(CO)occ1O, Value: 0.174 +Index: 50530, SMILES: O=c1cc(CO)occ1O, Value: 0.1843 +Index: 50531, SMILES: O=c1cc(CO)occ1O, Value: 0.1937 +Index: 50532, SMILES: O=c1cc(CO)occ1O, Value: 0.205 +Index: 50533, SMILES: O=c1cc(CO)occ1O, Value: 0.2161 +Index: 50534, SMILES: O=c1cc(CO)occ1O, Value: 0.2276 +Index: 50535, SMILES: O=c1cc(CO)occ1O, Value: 0.2404 +Index: 50536, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.20528 +Index: 50537, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.21287 +Index: 50538, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.22261 +Index: 50539, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.23182 +Index: 50540, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.24276 +Index: 50541, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.25178 +Index: 50542, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.26133 +Index: 50543, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.27328 +Index: 50544, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.28373 +Index: 50545, SMILES: O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1, Value: 0.29494 +Index: 50554, SMILES: CC(C)Oc1ccc2c(=O)c(-c3ccccc3)coc2c1, Value: 0.133441 +Index: 50555, SMILES: CC(C)Oc1ccc2c(=O)c(-c3ccccc3)coc2c1, Value: 0.152426 +Index: 50556, SMILES: O=C(O)c1ccccc1, Value: 0.4694 +Index: 50557, SMILES: O=C(O)c1ccccc1, Value: 0.4722 +Index: 50558, SMILES: O=C(O)c1ccccc1, Value: 0.4752 +Index: 50559, SMILES: O=C(O)c1ccccc1, Value: 0.4832 +Index: 50560, SMILES: O=C(O)c1ccccc1, Value: 0.4889 +Index: 50561, SMILES: O=C(O)c1ccccc1, Value: 0.4963 +Index: 50562, SMILES: O=C(O)c1ccccc1, Value: 0.5053 +Index: 50563, SMILES: O=C(O)c1ccccc1, Value: 0.5155 +Index: 50564, SMILES: O=C(O)c1ccccc1, Value: 0.5292 +Index: 50565, SMILES: O=C(O)c1ccccc1, Value: 0.5484 +Index: 50572, SMILES: CN1COCN(Cc2cnc(Cl)s2)C1=N[N+](=O)[O-], Value: 0.1205 +Index: 50573, SMILES: CN1COCN(Cc2cnc(Cl)s2)C1=N[N+](=O)[O-], Value: 0.1328 +Index: 50574, SMILES: CN1COCN(Cc2cnc(Cl)s2)C1=N[N+](=O)[O-], Value: 0.1453 +Index: 50575, SMILES: CN1COCN(Cc2cnc(Cl)s2)C1=N[N+](=O)[O-], Value: 0.1568 +Index: 50578, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.1335 +Index: 50579, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.1556 +Index: 50580, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.1795 +Index: 50581, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.2053 +Index: 50582, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.2318 +Index: 50583, SMILES: Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-], Value: 0.2634 +Index: 50584, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.133202 +Index: 50585, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.13618 +Index: 50586, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.139498 +Index: 50587, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.143043 +Index: 50588, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.146998 +Index: 50589, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.151518 +Index: 50590, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.156414 +Index: 50591, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.161716 +Index: 50592, SMILES: Nc1ccc(Oc2ccc(N)cc2)cc1, Value: 0.167684 +Index: 50613, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1278 +Index: 50614, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1584 +Index: 50615, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1964 +Index: 50616, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2445 +Index: 50637, SMILES: O=C1CCCC(=O)O1, Value: 0.119 +Index: 50638, SMILES: O=C1CCCC(=O)O1, Value: 0.152 +Index: 50639, SMILES: O=C1CCCC(=O)O1, Value: 0.183 +Index: 50640, SMILES: O=C1CCCC(=O)O1, Value: 0.223 +Index: 50641, SMILES: O=C1CCCC(=O)O1, Value: 0.27 +Index: 50642, SMILES: O=C1CCCC(=O)O1, Value: 0.323 +Index: 50643, SMILES: O=C1CCCC(=O)O1, Value: 0.376 +Index: 50644, SMILES: O=C1CCCC(=O)O1, Value: 0.436 +Index: 50645, SMILES: O=C1CCCC(=O)O1, Value: 0.502 +Index: 50646, SMILES: O=C1CCCC(=O)O1, Value: 0.557 +Index: 50661, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1252 +Index: 50710, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.2296 +Index: 50711, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.2394 +Index: 50712, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.2524 +Index: 50713, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.2677 +Index: 50714, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.2792 +Index: 50715, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.2977 +Index: 50716, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.3065 +Index: 50717, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.3272 +Index: 50718, SMILES: C[N+](C)(C)CC(=O)[O-], Value: 0.3441 +Index: 50780, SMILES: C1N2CN3CN1CN(C2)C3, Value: 0.2448 +Index: 50781, SMILES: C1N2CN3CN1CN(C2)C3, Value: 0.2453 +Index: 50782, SMILES: C1N2CN3CN1CN(C2)C3, Value: 0.2463 +Index: 50783, SMILES: C1N2CN3CN1CN(C2)C3, Value: 0.2492 +Index: 50784, SMILES: C1N2CN3CN1CN(C2)C3, Value: 0.2501 +Index: 50785, SMILES: C1N2CN3CN1CN(C2)C3, Value: 0.2513 +Index: 50786, SMILES: C1N2CN3CN1CN(C2)C3, Value: 0.2556 +Index: 50875, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1587 +Index: 50876, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.1818 +Index: 50877, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2061 +Index: 50878, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2355 +Index: 50879, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.2666 +Index: 50880, SMILES: O=Cc1cccc([N+](=O)[O-])c1, Value: 0.3041 +Index: 50945, SMILES: O=C1C=CC(=O)O1, Value: 0.11896 +Index: 50946, SMILES: O=C1C=CC(=O)O1, Value: 0.14648 +Index: 50959, SMILES: C/C=C/C(=O)O, Value: 0.2064 +Index: 50960, SMILES: C/C=C/C(=O)O, Value: 0.2321 +Index: 50961, SMILES: C/C=C/C(=O)O, Value: 0.2723 +Index: 50962, SMILES: C/C=C/C(=O)O, Value: 0.3086 +Index: 50963, SMILES: C/C=C/C(=O)O, Value: 0.3582 +Index: 50964, SMILES: C/C=C/C(=O)O, Value: 0.4169 +Index: 51083, SMILES: O=C(O)c1ccccc1, Value: 0.1458 +Index: 51084, SMILES: O=C(O)c1ccccc1, Value: 0.1489 +Index: 51085, SMILES: O=C(O)c1ccccc1, Value: 0.1706 +Index: 51086, SMILES: O=C(O)c1ccccc1, Value: 0.1902 +Index: 51087, SMILES: O=C(O)c1ccccc1, Value: 0.2129 +Index: 51088, SMILES: O=C(O)c1ccccc1, Value: 0.2349 +Index: 51089, SMILES: O=C(O)c1ccccc1, Value: 0.2507 +Index: 51090, SMILES: O=C(O)c1ccccc1, Value: 0.2712 +Index: 51091, SMILES: O=C(O)c1ccccc1, Value: 0.293 +Index: 51092, SMILES: O=C(O)c1ccccc1, Value: 0.3321 +Index: 51131, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1403 +Index: 51132, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.151 +Index: 51133, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.164 +Index: 51134, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1776 +Index: 51135, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.1933 +Index: 51136, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.2308 +Index: 51137, SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1, Value: 0.252 +Index: 51142, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.1186 +Index: 51143, SMILES: Nc1ccc(C(=O)O)cc1.[K], Value: 0.1252 +Index: 51219, SMILES: O=C(O)c1ccccc1, Value: 0.1238 +Index: 51220, SMILES: O=C(O)c1ccccc1, Value: 0.1394 +Index: 51221, SMILES: O=C(O)c1ccccc1, Value: 0.1564 +Index: 51222, SMILES: O=C(O)c1ccccc1, Value: 0.175 +Index: 51223, SMILES: O=C(O)c1ccccc1, Value: 0.1953 +Index: 51224, SMILES: O=C(O)c1ccccc1, Value: 0.2175 +Index: 51225, SMILES: O=C(O)c1ccccc1, Value: 0.2417 +Index: 51226, SMILES: O=C(O)c1ccccc1, Value: 0.2639 +Index: 51227, SMILES: O=C(O)c1ccccc1, Value: 0.281 +Index: 51246, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.38785 +Index: 51247, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.44105 +Index: 51248, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.52425 +Index: 51249, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.58745 +Index: 51250, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.64065 +Index: 51251, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.70385 +Index: 51252, SMILES: O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])O.O=[N+]([O-])O, Value: 0.78705 +Index: 51303, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.122 +Index: 51304, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.141 +Index: 51305, SMILES: O=C(O)Cc1cccc2ccccc12, Value: 0.16 +Index: 51312, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.1151 +Index: 51313, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.1356 +Index: 51314, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.1608 +Index: 51315, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.392 +Index: 51316, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.42437 +Index: 51317, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.45455 +Index: 51318, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.48566 +Index: 51319, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.51592 +Index: 51320, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.54637 +Index: 51321, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.5724 +Index: 51322, SMILES: CC(C)c1ccc2sc3ccccc3c(=O)c2c1, Value: 0.61476 +Index: 51345, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.1489 +Index: 51346, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.1821 +Index: 51347, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.2162 +Index: 51348, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.2581 +Index: 51349, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.3122 +Index: 51350, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.3554 +Index: 51351, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.4014 +Index: 51352, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.4433 +Index: 51353, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.5018 +Index: 51354, SMILES: COc1cccc(Nc2ccccc2)c1, Value: 0.5446 +Index: 51355, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.1891 +Index: 51356, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.2314 +Index: 51357, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.2784 +Index: 51358, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.3114 +Index: 51359, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.3602 +Index: 51360, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.4154 +Index: 51361, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.4658 +Index: 51362, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.5148 +Index: 51363, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.5622 +Index: 51364, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.615 +Index: 51365, SMILES: CSc1cccc(Nc2ccccc2)c1, Value: 0.6544 +Index: 51459, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.766 +Index: 51460, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.6699 +Index: 51461, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.609 +Index: 51462, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.5474 +Index: 51463, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.5256 +Index: 51464, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.503 +Index: 51465, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4825 +Index: 51466, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4776 +Index: 51467, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4552 +Index: 51468, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4438 +Index: 51469, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4263 +Index: 51470, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4071 +Index: 51471, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3963 +Index: 51472, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3782 +Index: 51473, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3763 +Index: 51474, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3624 +Index: 51475, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3558 +Index: 51476, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3419 +Index: 51477, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3377 +Index: 51478, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3237 +Index: 51479, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.322 +Index: 51480, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3219 +Index: 51481, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3058 +Index: 51482, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3045 +Index: 51483, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3013 +Index: 51484, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.2882 +Index: 51485, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.1912 +Index: 51486, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.2039 +Index: 51487, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.2327 +Index: 51488, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.2582 +Index: 51489, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.2888 +Index: 51490, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.3289 +Index: 51491, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.3545 +Index: 51492, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.3964 +Index: 51493, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.443 +Index: 51494, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.488 +Index: 51495, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.4112 +Index: 51496, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.3669 +Index: 51497, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.3348 +Index: 51498, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.3098 +Index: 51499, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.2647 +Index: 51500, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.2316 +Index: 51501, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.2055 +Index: 51502, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1874 +Index: 51503, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1715 +Index: 51504, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1458 +Index: 51505, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1276 +Index: 51517, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.8572 +Index: 51518, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.813 +Index: 51519, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.7645 +Index: 51520, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.7304 +Index: 51521, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.6408 +Index: 51522, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.6057 +Index: 51523, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.5321 +Index: 51524, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4986 +Index: 51525, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4631 +Index: 51526, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4463 +Index: 51527, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4045 +Index: 51528, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3449 +Index: 51529, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3053 +Index: 51530, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.2586 +Index: 51531, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.2087 +Index: 51532, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.185 +Index: 51533, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.1568 +Index: 51535, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.116 +Index: 51536, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.1258 +Index: 51537, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.1373 +Index: 51538, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.1552 +Index: 51539, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.1716 +Index: 51540, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.1977 +Index: 51541, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.232 +Index: 51542, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.2745 +Index: 51543, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.3399 +Index: 51544, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.3452 +Index: 51545, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.3143 +Index: 51546, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.2606 +Index: 51547, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.229 +Index: 51548, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1956 +Index: 51549, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1647 +Index: 51550, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1281 +Index: 51558, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.7314 +Index: 51559, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.628 +Index: 51560, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.5667 +Index: 51561, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.4787 +Index: 51562, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3707 +Index: 51563, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.3545 +Index: 51564, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.328 +Index: 51565, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.253 +Index: 51566, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.236 +Index: 51567, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.2103 +Index: 51568, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.1982 +Index: 51569, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.1628 +Index: 51570, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.1394 +Index: 51571, SMILES: CC(C)COc1ccccc1B(O)O, Value: 0.1179 +Index: 51589, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.1324 +Index: 51590, SMILES: CC(C)COc1cccc(B(O)O)c1, Value: 0.1536 +Index: 51591, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.3224 +Index: 51592, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.2656 +Index: 51593, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.2038 +Index: 51594, SMILES: CC(C)COc1ccc(B(O)O)cc1, Value: 0.1182 +Index: 51634, SMILES: O=C1CCC(=O)O1, Value: 0.197 +Index: 51635, SMILES: O=C1CCC(=O)O1, Value: 0.218 +Index: 51636, SMILES: O=C1CCC(=O)O1, Value: 0.239 +Index: 51637, SMILES: O=C1CCC(=O)O1, Value: 0.261 +Index: 51638, SMILES: O=C1CCC(=O)O1, Value: 0.283 +Index: 51639, SMILES: O=C1CCC(=O)O1, Value: 0.307 +Index: 51640, SMILES: O=C1CCC(=O)O1, Value: 0.331 +Index: 51641, SMILES: O=C1CCC(=O)O1, Value: 0.354 +Index: 51642, SMILES: O=C1CCC(=O)O1, Value: 0.378 +Index: 51689, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1182 +Index: 51690, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1239 +Index: 51691, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1326 +Index: 51692, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1419 +Index: 51693, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1524 +Index: 51694, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1603 +Index: 51695, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1748 +Index: 51696, SMILES: Cc1ccccc1S(N)(=O)=O, Value: 0.1866 +Index: 51697, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1395 +Index: 51698, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1458 +Index: 51699, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1517 +Index: 51700, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1595 +Index: 51701, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1674 +Index: 51702, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1769 +Index: 51703, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.1869 +Index: 51704, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.2006 +Index: 51705, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.2102 +Index: 51706, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.2284 +Index: 51707, SMILES: NS(=O)(=O)c1ccccc1, Value: 0.2448 +Index: 51745, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.1393 +Index: 51746, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.1453 +Index: 51747, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.1567 +Index: 51748, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.1659 +Index: 51749, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.1784 +Index: 51750, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.1928 +Index: 51751, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.205 +Index: 51752, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.2188 +Index: 51753, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.2304 +Index: 51754, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.2435 +Index: 51755, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.2618 +Index: 51756, SMILES: C=CC(=O)Nc1cc(F)c(Br)c(F)c1, Value: 0.2729 +Index: 51813, SMILES: COC(=O)/C=C/c1ccc(O)cc1, Value: 0.1156 +Index: 51814, SMILES: COC(=O)/C=C/c1ccc(O)cc1, Value: 0.126 +Index: 51815, SMILES: COC(=O)/C=C/c1ccc(O)cc1, Value: 0.1543 +Index: 51816, SMILES: COC(=O)/C=C/c1ccc(O)cc1, Value: 0.1744 +Index: 51817, SMILES: COC(=O)/C=C/c1ccc(O)cc1, Value: 0.2005 +Index: 51818, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.2153 +Index: 51819, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.2457 +Index: 51820, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.287 +Index: 51821, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.312 +Index: 51822, SMILES: COC(=O)/C=C/c1ccc(O)c(OC)c1, Value: 0.3421 +Index: 51827, SMILES: COC(=O)/C=C/c1cc(OC)c(O)c(OC)c1, Value: 0.1397 +Index: 51833, SMILES: O=P(O)(O)c1ccccc1, Value: 0.34187 +Index: 51834, SMILES: O=P(O)(O)c1ccccc1, Value: 0.34847 +Index: 51835, SMILES: O=P(O)(O)c1ccccc1, Value: 0.35862 +Index: 51836, SMILES: O=P(O)(O)c1ccccc1, Value: 0.37067 +Index: 51837, SMILES: O=P(O)(O)c1ccccc1, Value: 0.3828 +Index: 51838, SMILES: O=P(O)(O)c1ccccc1, Value: 0.39737 +Index: 51839, SMILES: O=P(O)(O)c1ccccc1, Value: 0.40841 +Index: 51840, SMILES: O=P(O)(O)c1ccccc1, Value: 0.42518 +Index: 51841, SMILES: O=P(O)(O)c1ccccc1, Value: 0.43852 +Index: 51842, SMILES: O=P(O)(O)c1ccccc1, Value: 0.45305 +Index: 51843, SMILES: O=P(O)(O)c1ccccc1, Value: 0.46841 +Index: 51844, SMILES: O=P(O)(O)c1ccccc1, Value: 0.48308 +Index: 51879, SMILES: CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2, Value: 0.11899 +Index: 51880, SMILES: CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2, Value: 0.1384 +Index: 51881, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.47834 +Index: 51882, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.46892 +Index: 51883, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.45901 +Index: 51884, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.44878 +Index: 51885, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.43623 +Index: 51886, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.42808 +Index: 51887, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.41858 +Index: 51888, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.40525 +Index: 51889, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.39772 +Index: 51890, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.38308 +Index: 51916, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1194 +Index: 51917, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1367 +Index: 51918, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1604 +Index: 51919, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.1916 +Index: 51920, SMILES: N#Cc1ccc2c(c1)OCO2, Value: 0.2209 +Index: 51932, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1219 +Index: 51933, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1309 +Index: 51934, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1401 +Index: 51935, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1472 +Index: 51936, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1606 +Index: 51937, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1706 +Index: 51938, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1827 +Index: 51939, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1952 +Index: 51940, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.2097 +Index: 51946, SMILES: O=P(O)(O)c1ccccc1, Value: 0.30464 +Index: 51947, SMILES: O=P(O)(O)c1ccccc1, Value: 0.31669 +Index: 51948, SMILES: O=P(O)(O)c1ccccc1, Value: 0.32688 +Index: 51949, SMILES: O=P(O)(O)c1ccccc1, Value: 0.33941 +Index: 51950, SMILES: O=P(O)(O)c1ccccc1, Value: 0.35037 +Index: 51951, SMILES: O=P(O)(O)c1ccccc1, Value: 0.36272 +Index: 51952, SMILES: O=P(O)(O)c1ccccc1, Value: 0.37806 +Index: 51953, SMILES: O=P(O)(O)c1ccccc1, Value: 0.39148 +Index: 51954, SMILES: O=P(O)(O)c1ccccc1, Value: 0.40397 +Index: 51955, SMILES: O=P(O)(O)c1ccccc1, Value: 0.42037 +Index: 51956, SMILES: O=P(O)(O)c1ccccc1, Value: 0.43877 +Index: 51957, SMILES: O=P(O)(O)c1ccccc1, Value: 0.45424 +Index: 51972, SMILES: O=[PH](O)c1ccccc1, Value: 0.1238 +Index: 51973, SMILES: O=[PH](O)c1ccccc1, Value: 0.1359 +Index: 51974, SMILES: O=[PH](O)c1ccccc1, Value: 0.148 +Index: 51975, SMILES: O=[PH](O)c1ccccc1, Value: 0.1647 +Index: 51976, SMILES: O=[PH](O)c1ccccc1, Value: 0.2053 +Index: 51977, SMILES: O=[PH](O)c1ccccc1, Value: 0.2265 +Index: 51978, SMILES: O=[PH](O)c1ccccc1, Value: 0.2395 +Index: 51979, SMILES: O=[PH](O)c1ccccc1, Value: 0.2593 +Index: 51980, SMILES: O=[PH](O)c1ccccc1, Value: 0.2834 +Index: 51981, SMILES: O=[PH](O)c1ccccc1, Value: 0.3084 +Index: 51982, SMILES: O=[PH](O)c1ccccc1, Value: 0.3435 +Index: 51983, SMILES: O=[PH](O)c1ccccc1, Value: 0.3719 +Index: 51984, SMILES: O=[PH](O)c1ccccc1, Value: 0.397 +Index: 51985, SMILES: O=[PH](O)c1ccccc1, Value: 0.434 +Index: 51986, SMILES: O=[PH](O)c1ccccc1, Value: 0.459 +Index: 51987, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2522 +Index: 51988, SMILES: CP(=O)(O)c1ccccc1, Value: 0.2889 +Index: 51989, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3479 +Index: 51990, SMILES: CP(=O)(O)c1ccccc1, Value: 0.3972 +Index: 51991, SMILES: CP(=O)(O)c1ccccc1, Value: 0.4406 +Index: 51992, SMILES: CP(=O)(O)c1ccccc1, Value: 0.4716 +Index: 51993, SMILES: CP(=O)(O)c1ccccc1, Value: 0.5193 +Index: 51994, SMILES: CP(=O)(O)c1ccccc1, Value: 0.5866 +Index: 51995, SMILES: CP(=O)(O)c1ccccc1, Value: 0.6392 +Index: 51996, SMILES: CP(=O)(O)c1ccccc1, Value: 0.6965 +Index: 51997, SMILES: CP(=O)(O)c1ccccc1, Value: 0.7509 +Index: 52003, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1158 +Index: 52004, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1473 +Index: 52005, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.1715 +Index: 52006, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.2303 +Index: 52007, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.2988 +Index: 52008, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.3734 +Index: 52009, SMILES: ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1, Value: 0.4568 +Index: 52133, SMILES: CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2, Value: 0.11969 +Index: 52134, SMILES: CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2, Value: 0.13615 +Index: 52174, SMILES: CNC[C@H](O)c1cccc(O)c1.Cl, Value: 0.1224 +Index: 52199, SMILES: O=P(O)(O)c1ccccc1, Value: 0.24429 +Index: 52200, SMILES: O=P(O)(O)c1ccccc1, Value: 0.25721 +Index: 52201, SMILES: O=P(O)(O)c1ccccc1, Value: 0.26617 +Index: 52202, SMILES: O=P(O)(O)c1ccccc1, Value: 0.28042 +Index: 52203, SMILES: O=P(O)(O)c1ccccc1, Value: 0.2952 +Index: 52204, SMILES: O=P(O)(O)c1ccccc1, Value: 0.30747 +Index: 52205, SMILES: O=P(O)(O)c1ccccc1, Value: 0.31845 +Index: 52206, SMILES: O=P(O)(O)c1ccccc1, Value: 0.33643 +Index: 52207, SMILES: O=P(O)(O)c1ccccc1, Value: 0.34944 +Index: 52208, SMILES: O=P(O)(O)c1ccccc1, Value: 0.36789 +Index: 52209, SMILES: O=P(O)(O)c1ccccc1, Value: 0.38224 +Index: 52210, SMILES: O=P(O)(O)c1ccccc1, Value: 0.40088 +Index: 52225, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.53847 +Index: 52226, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.53017 +Index: 52227, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.5215 +Index: 52228, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.51359 +Index: 52229, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.50437 +Index: 52230, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.49573 +Index: 52231, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.48476 +Index: 52232, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.46935 +Index: 52233, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.46084 +Index: 52234, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.44875 +Index: 52260, SMILES: O=P(O)(O)c1ccccc1, Value: 0.13434 +Index: 52261, SMILES: O=P(O)(O)c1ccccc1, Value: 0.14598 +Index: 52262, SMILES: O=P(O)(O)c1ccccc1, Value: 0.15905 +Index: 52263, SMILES: O=P(O)(O)c1ccccc1, Value: 0.17443 +Index: 52264, SMILES: O=P(O)(O)c1ccccc1, Value: 0.188 +Index: 52265, SMILES: O=P(O)(O)c1ccccc1, Value: 0.20198 +Index: 52266, SMILES: O=P(O)(O)c1ccccc1, Value: 0.21757 +Index: 52267, SMILES: O=P(O)(O)c1ccccc1, Value: 0.22987 +Index: 52268, SMILES: O=P(O)(O)c1ccccc1, Value: 0.24541 +Index: 52269, SMILES: O=P(O)(O)c1ccccc1, Value: 0.2598 +Index: 52270, SMILES: O=P(O)(O)c1ccccc1, Value: 0.27796 +Index: 52271, SMILES: O=P(O)(O)c1ccccc1, Value: 0.29727 +Index: 52346, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1219 +Index: 52347, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1513 +Index: 52348, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1834 +Index: 52349, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2198 +Index: 52350, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2655 +Index: 52351, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3222 +Index: 52352, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3898 +Index: 52353, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4639 +Index: 52354, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5495 +Index: 52382, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1194 +Index: 52383, SMILES: O=C(O)CCCCCCCCC(=O)O, Value: 0.1365 +Index: 52424, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.119 +Index: 52425, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1409 +Index: 52426, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1642 +Index: 52427, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.1919 +Index: 52428, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2234 +Index: 52429, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1, Value: 0.2632 +Index: 52463, SMILES: O=P(O)(O)c1ccccc1, Value: 0.19949 +Index: 52464, SMILES: O=P(O)(O)c1ccccc1, Value: 0.20834 +Index: 52465, SMILES: O=P(O)(O)c1ccccc1, Value: 0.21798 +Index: 52466, SMILES: O=P(O)(O)c1ccccc1, Value: 0.2313 +Index: 52467, SMILES: O=P(O)(O)c1ccccc1, Value: 0.2431 +Index: 52468, SMILES: O=P(O)(O)c1ccccc1, Value: 0.2575 +Index: 52469, SMILES: O=P(O)(O)c1ccccc1, Value: 0.26953 +Index: 52470, SMILES: O=P(O)(O)c1ccccc1, Value: 0.28338 +Index: 52471, SMILES: O=P(O)(O)c1ccccc1, Value: 0.29816 +Index: 52472, SMILES: O=P(O)(O)c1ccccc1, Value: 0.31666 +Index: 52473, SMILES: O=P(O)(O)c1ccccc1, Value: 0.33386 +Index: 52474, SMILES: O=P(O)(O)c1ccccc1, Value: 0.35476 +Index: 52501, SMILES: O=C(O)c1ccccc1, Value: 0.133 +Index: 52502, SMILES: O=C(O)c1ccccc1, Value: 0.159 +Index: 52503, SMILES: O=C(O)c1ccccc1, Value: 0.179 +Index: 52504, SMILES: O=C(O)c1ccccc1, Value: 0.198 +Index: 52505, SMILES: O=C(O)c1ccccc1, Value: 0.226 +Index: 52506, SMILES: O=C(O)c1ccccc1, Value: 0.252 +Index: 52507, SMILES: O=C(O)c1ccccc1, Value: 0.282 +Index: 52508, SMILES: O=C(O)c1ccccc1, Value: 0.316 +Index: 52509, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.39541 +Index: 52510, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.38503 +Index: 52511, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.37375 +Index: 52512, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.36549 +Index: 52513, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.35627 +Index: 52514, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.34829 +Index: 52515, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.4601 +Index: 52516, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.43882 +Index: 52517, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.42488 +Index: 52518, SMILES: Nc1nc2ccc(OC(F)(F)F)cc2s1, Value: 0.40794 +Index: 52578, SMILES: O=C(O)c1ccccc1, Value: 0.163 +Index: 52579, SMILES: O=C(O)c1ccccc1, Value: 0.18 +Index: 52580, SMILES: O=C(O)c1ccccc1, Value: 0.196 +Index: 52581, SMILES: O=C(O)c1ccccc1, Value: 0.215 +Index: 52582, SMILES: O=C(O)c1ccccc1, Value: 0.234 +Index: 52583, SMILES: O=C(O)c1ccccc1, Value: 0.256 +Index: 52584, SMILES: O=C(O)c1ccccc1, Value: 0.279 +Index: 52585, SMILES: O=C(O)c1ccccc1, Value: 0.315 +Index: 52586, SMILES: O=C(O)c1ccccc1, Value: 0.349 +Index: 52587, SMILES: O=C(O)c1ccccc1, Value: 0.388 +Index: 52668, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.126 +Index: 52669, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.1604 +Index: 52670, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.2041 +Index: 52671, SMILES: N#CCc1ccccc1[N+](=O)[O-], Value: 0.26 +Index: 52692, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1321 +Index: 52693, SMILES: O=C(O)Cc1ccccc1Cl, Value: 0.1651 +Index: 52704, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1218 +Index: 52705, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1464 +Index: 52706, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1726 +Index: 52707, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1994 +Index: 52708, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2283 +Index: 52709, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2602 +Index: 52710, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2967 +Index: 52711, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3423 +Index: 52712, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3957 +Index: 52751, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1547 +Index: 52752, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1822 +Index: 52753, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1982 +Index: 52754, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.2225 +Index: 52755, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.2507 +Index: 52756, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.2652 +Index: 52757, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.2947 +Index: 52758, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.3226 +Index: 52759, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.3671 +Index: 52760, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.394 +Index: 52761, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.433 +Index: 52762, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.317 +Index: 52763, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3281 +Index: 52764, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3407 +Index: 52765, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3581 +Index: 52766, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3773 +Index: 52767, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.397 +Index: 52768, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4154 +Index: 52769, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4202 +Index: 52770, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4402 +Index: 52771, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.5802 +Index: 52772, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.5894 +Index: 52773, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6007 +Index: 52774, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6088 +Index: 52775, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6241 +Index: 52776, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6308 +Index: 52777, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.641 +Index: 52778, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6518 +Index: 52779, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6642 +Index: 52780, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1453 +Index: 52781, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1515 +Index: 52782, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1596 +Index: 52783, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1719 +Index: 52784, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.1886 +Index: 52785, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.2085 +Index: 52786, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.2245 +Index: 52787, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.2404 +Index: 52788, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.2582 +Index: 52789, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.2931 +Index: 52790, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.308 +Index: 52791, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.3407 +Index: 52792, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.3752 +Index: 52793, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.4091 +Index: 52794, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2, Value: 0.464 +Index: 52795, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3094 +Index: 52796, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3288 +Index: 52797, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3446 +Index: 52798, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.3575 +Index: 52799, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.38 +Index: 52800, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4141 +Index: 52801, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4401 +Index: 52802, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4616 +Index: 52803, SMILES: CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)C2, Value: 0.4968 +Index: 52804, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6003 +Index: 52805, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6369 +Index: 52806, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.66 +Index: 52807, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.6833 +Index: 52808, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.7139 +Index: 52809, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.7359 +Index: 52810, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.7387 +Index: 52811, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.7702 +Index: 52812, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.7948 +Index: 52813, SMILES: CC12CCC(CC1=O)C2(C)C, Value: 0.824 +Index: 52838, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.146843 +Index: 52839, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.188092 +Index: 52840, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.238838 +Index: 52841, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.29902 +Index: 52842, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.371877 +Index: 52843, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.45562 +Index: 52844, SMILES: CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1, Value: 0.553111 +Index: 52853, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1289 +Index: 52854, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1579 +Index: 52855, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1841 +Index: 52856, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2103 +Index: 52857, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2386 +Index: 52858, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2687 +Index: 52859, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3039 +Index: 52860, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3445 +Index: 52861, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3899 +Index: 52862, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.4403 +Index: 52867, SMILES: O=C(O)c1ccccc1, Value: 0.1147 +Index: 52868, SMILES: O=C(O)c1ccccc1, Value: 0.1482 +Index: 52869, SMILES: O=C(O)c1ccccc1, Value: 0.1685 +Index: 52870, SMILES: O=C(O)c1ccccc1, Value: 0.1905 +Index: 52871, SMILES: O=C(O)c1ccccc1, Value: 0.2178 +Index: 52872, SMILES: O=C(O)c1ccccc1, Value: 0.2441 +Index: 52880, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.1489 +Index: 52881, SMILES: Cc1ccc2cc(C)ccc2c1, Value: 0.1974 +Index: 52895, SMILES: CC(C)(C)NSc1nc2ccccc2s1, Value: 0.115 +Index: 52896, SMILES: CC(C)(C)NSc1nc2ccccc2s1, Value: 0.124 +Index: 52897, SMILES: CC(C)(C)NSc1nc2ccccc2s1, Value: 0.135 +Index: 52898, SMILES: CC(C)(C)NSc1nc2ccccc2s1, Value: 0.149 +Index: 52899, SMILES: CC(C)(C)NSc1nc2ccccc2s1, Value: 0.165 +Index: 52900, SMILES: CC(C)(C)NSc1nc2ccccc2s1, Value: 0.176 +Index: 52901, SMILES: CC(C)(C)NSc1nc2ccccc2s1, Value: 0.198 +Index: 52902, SMILES: O=C1CCCC(=O)O1, Value: 0.153 +Index: 52903, SMILES: O=C1CCCC(=O)O1, Value: 0.205 +Index: 52904, SMILES: O=C1CCCC(=O)O1, Value: 0.231 +Index: 52905, SMILES: O=C1CCCC(=O)O1, Value: 0.259 +Index: 52906, SMILES: O=C1CCCC(=O)O1, Value: 0.299 +Index: 52907, SMILES: O=C1CCCC(=O)O1, Value: 0.342 +Index: 52908, SMILES: O=C1CCCC(=O)O1, Value: 0.388 +Index: 52909, SMILES: O=C1CCCC(=O)O1, Value: 0.437 +Index: 52910, SMILES: O=C1CCCC(=O)O1, Value: 0.502 +Index: 52911, SMILES: O=C1CCCC(=O)O1, Value: 0.562 +Index: 52913, SMILES: CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2, Value: 0.1225 +Index: 52914, SMILES: CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2, Value: 0.134 +Index: 52915, SMILES: CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2, Value: 0.15 +Index: 52916, SMILES: CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2, Value: 0.1607 +Index: 52917, SMILES: CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2, Value: 0.1729 +Index: 52918, SMILES: CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2, Value: 0.1788 +Index: 52919, SMILES: CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2, Value: 0.1814 +Index: 52978, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.115 +Index: 52979, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1282 +Index: 52980, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1416 +Index: 52981, SMILES: CC(C)(C)c1ccc(C(=O)O)cc1, Value: 0.1542 +Index: 52998, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.1178 +Index: 52999, SMILES: COc1ccc(CC(=O)O)cc1, Value: 0.1388 +Index: 53004, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.137762 +Index: 53005, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.181402 +Index: 53006, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.236802 +Index: 53007, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.313144 +Index: 53008, SMILES: O=[N+]([O-])c1c[nH]nc1[N+](=O)[O-], Value: 0.410601 +Index: 53027, SMILES: O=C(O)c1ccccc1, Value: 0.492 +Index: 53028, SMILES: O=C(O)c1ccccc1, Value: 0.507 +Index: 53029, SMILES: O=C(O)c1ccccc1, Value: 0.522 +Index: 53030, SMILES: O=C(O)c1ccccc1, Value: 0.53 +Index: 53031, SMILES: O=C(O)c1ccccc1, Value: 0.543 +Index: 53032, SMILES: O=C(O)c1ccccc1, Value: 0.553 +Index: 53033, SMILES: O=C(O)c1ccccc1, Value: 0.563 +Index: 53034, SMILES: O=C(O)c1ccccc1, Value: 0.581 +Index: 53035, SMILES: O=C(O)c1ccccc1, Value: 0.6 +Index: 53036, SMILES: O=C(O)c1ccccc1, Value: 0.631 +Index: 53037, SMILES: O=C(O)c1ccccc1, Value: 0.234 +Index: 53038, SMILES: O=C(O)c1ccccc1, Value: 0.251 +Index: 53039, SMILES: O=C(O)c1ccccc1, Value: 0.269 +Index: 53040, SMILES: O=C(O)c1ccccc1, Value: 0.287 +Index: 53041, SMILES: O=C(O)c1ccccc1, Value: 0.306 +Index: 53042, SMILES: O=C(O)c1ccccc1, Value: 0.315 +Index: 53043, SMILES: O=C(O)c1ccccc1, Value: 0.336 +Index: 53044, SMILES: O=C(O)c1ccccc1, Value: 0.367 +Index: 53045, SMILES: O=C(O)c1ccccc1, Value: 0.396 +Index: 53046, SMILES: O=C(O)c1ccccc1, Value: 0.426 +Index: 53063, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.1256 +Index: 53064, SMILES: Cc1ccc(NC(=O)/C(=C/Cl)Sc2ccccc2)cc1, Value: 0.1454 +Index: 53104, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.1291 +Index: 53105, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.1432 +Index: 53106, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.1628 +Index: 53107, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.1883 +Index: 53108, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.2164 +Index: 53109, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.2454 +Index: 53110, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.2805 +Index: 53111, SMILES: c1cc2c3c(cccc3c1)CC2, Value: 0.321 +Index: 53112, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.127 +Index: 53113, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1515 +Index: 53114, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1761 +Index: 53115, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2021 +Index: 53116, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2295 +Index: 53117, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2581 +Index: 53118, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2881 +Index: 53119, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.323 +Index: 53120, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3645 +Index: 53121, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.4109 +Index: 53125, SMILES: O=C(O)c1ccccc1, Value: 0.1168 +Index: 53126, SMILES: O=C(O)c1ccccc1, Value: 0.1288 +Index: 53127, SMILES: O=C(O)c1ccccc1, Value: 0.1539 +Index: 53128, SMILES: O=C(O)c1ccccc1, Value: 0.1731 +Index: 53129, SMILES: O=C(O)c1ccccc1, Value: 0.2203 +Index: 53130, SMILES: O=C(O)c1ccccc1, Value: 0.2459 +Index: 53131, SMILES: O=C(O)c1ccccc1, Value: 0.2572 +Index: 53163, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1178 +Index: 53164, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1372 +Index: 53165, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1594 +Index: 53166, SMILES: O=Cc1ccc(C=O)cc1, Value: 0.1819 +Index: 53176, SMILES: O=C(O)c1ccccc1, Value: 0.14 +Index: 53177, SMILES: O=C(O)c1ccccc1, Value: 0.149 +Index: 53178, SMILES: O=C(O)c1ccccc1, Value: 0.178 +Index: 53179, SMILES: O=C(O)c1ccccc1, Value: 0.208 +Index: 53180, SMILES: O=C(O)c1ccccc1, Value: 0.254 +Index: 53181, SMILES: O=C(O)c1ccccc1, Value: 0.293 +Index: 53182, SMILES: O=C(O)c1ccccc1, Value: 0.311 +Index: 53183, SMILES: O=C(O)c1ccccc1, Value: 0.325 +Index: 53184, SMILES: O=C(O)c1ccccc1, Value: 0.337 +Index: 53185, SMILES: O=C(O)c1ccccc1, Value: 0.338 +Index: 53186, SMILES: O=C(O)c1ccccc1, Value: 0.349 +Index: 53187, SMILES: O=C(O)c1ccccc1, Value: 0.351 +Index: 53188, SMILES: O=C(O)c1ccccc1, Value: 0.358 +Index: 53189, SMILES: O=C(O)c1ccccc1, Value: 0.362 +Index: 53190, SMILES: O=C(O)c1ccccc1, Value: 0.369 +Index: 53191, SMILES: O=C(O)c1ccccc1, Value: 0.379 +Index: 53192, SMILES: O=C(O)c1ccccc1, Value: 0.39 +Index: 53193, SMILES: O=C(O)c1ccccc1, Value: 0.399 +Index: 53248, SMILES: c1ccc2ccccc2c1, Value: 0.1831 +Index: 53249, SMILES: c1ccc2ccccc2c1, Value: 0.2047 +Index: 53250, SMILES: c1ccc2ccccc2c1, Value: 0.2319 +Index: 53251, SMILES: c1ccc2ccccc2c1, Value: 0.2593 +Index: 53252, SMILES: c1ccc2ccccc2c1, Value: 0.2989 +Index: 53253, SMILES: c1ccc2ccccc2c1, Value: 0.3345 +Index: 53254, SMILES: c1ccc2ccccc2c1, Value: 0.3865 +Index: 53255, SMILES: c1ccc2ccccc2c1, Value: 0.4327 +Index: 53256, SMILES: c1ccc2ccccc2c1, Value: 0.4834 +Index: 53257, SMILES: c1ccc2ccccc2c1, Value: 0.5393 +Index: 53277, SMILES: O=C(O)COc1ccc(Cl)cc1Cl, Value: 0.1283 +Index: 53366, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.126 +Index: 53367, SMILES: CC(=O)Oc1ccccc1C(=O)O, Value: 0.145 +Index: 53368, SMILES: c1nc[nH]n1, Value: 0.1745 +Index: 53369, SMILES: c1nc[nH]n1, Value: 0.2125 +Index: 53370, SMILES: c1nc[nH]n1, Value: 0.2488 +Index: 53371, SMILES: c1nc[nH]n1, Value: 0.2837 +Index: 53372, SMILES: c1nc[nH]n1, Value: 0.3187 +Index: 53373, SMILES: c1nc[nH]n1, Value: 0.3527 +Index: 53374, SMILES: c1nc[nH]n1, Value: 0.3862 +Index: 53375, SMILES: c1nc[nH]n1, Value: 0.4194 +Index: 53376, SMILES: c1nc[nH]n1, Value: 0.4511 +Index: 53377, SMILES: c1nc[nH]n1, Value: 0.4827 +Index: 53378, SMILES: c1nc[nH]n1, Value: 0.5137 +Index: 53379, SMILES: c1nc[nH]n1, Value: 0.5446 +Index: 53380, SMILES: c1nc[nH]n1, Value: 0.5742 +Index: 53381, SMILES: c1nc[nH]n1, Value: 0.6039 +Index: 53382, SMILES: c1nc[nH]n1, Value: 0.6333 +Index: 53467, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.121 +Index: 53468, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.132 +Index: 53469, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.144 +Index: 53477, SMILES: O=C(NNC(=S)Nc1ccc(Cl)cc1)c1ccncc1, Value: 0.12 +Index: 53478, SMILES: O=C(NNC(=S)Nc1ccc(Cl)cc1)c1ccncc1, Value: 0.126 +Index: 53479, SMILES: O=C(NNC(=S)Nc1ccc(Cl)cc1)c1ccncc1, Value: 0.131 +Index: 53511, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.523 +Index: 53512, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.539 +Index: 53513, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.561 +Index: 53514, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.581 +Index: 53515, SMILES: O=C1Nc2ccccc2C1=O, Value: 0.598 +Index: 53543, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1185 +Index: 53544, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1263 +Index: 53545, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1342 +Index: 53546, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1437 +Index: 53547, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1533 +Index: 53548, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.1656 +Index: 53549, SMILES: CC(=O)Nc1ccc(O)cc1, Value: 0.178 +Index: 53692, SMILES: O=C(O)c1ccccc1, Value: 0.1335 +Index: 53750, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1404 +Index: 53751, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1687 +Index: 53752, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.1935 +Index: 53753, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2186 +Index: 53754, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2453 +Index: 53755, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.2744 +Index: 53756, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.305 +Index: 53757, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3396 +Index: 53758, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.3829 +Index: 53759, SMILES: CC1=CC(=O)c2ccccc2C1=O, Value: 0.4321 +Index: 53788, SMILES: O=C(O)c1ccccc1, Value: 0.115 +Index: 53789, SMILES: O=C(O)c1ccccc1, Value: 0.139 +Index: 53790, SMILES: O=C(O)c1ccccc1, Value: 0.1618 +Index: 53791, SMILES: O=C(O)c1ccccc1, Value: 0.1886 +Index: 53792, SMILES: O=C(O)c1ccccc1, Value: 0.2181 +Index: 53793, SMILES: O=C(O)c1ccccc1, Value: 0.2395 +Index: 53797, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1302 +Index: 53798, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1548 +Index: 53799, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.1832 +Index: 53800, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.2366 +Index: 53801, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.2845 +Index: 53802, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.3411 +Index: 53803, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.4119 +Index: 53804, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.5081 +Index: 53805, SMILES: c1ccc2c(c1)oc1ccccc12, Value: 0.5798 +Index: 53813, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1374 +Index: 53814, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.1801 +Index: 53815, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.2277 +Index: 53816, SMILES: O=C1c2ccccc2-c2ccccc21, Value: 0.3091 +Index: 53845, SMILES: CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21, Value: 0.15129761 +Index: 53846, SMILES: CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21, Value: 0.17278831 +Index: 53919, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1436 +Index: 53920, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1568 +Index: 53921, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1713 +Index: 53922, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2162 +Index: 53923, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2582 +Index: 53924, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2947 +Index: 53925, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3372 +Index: 53926, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3885 +Index: 53927, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4407 +Index: 53928, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5156 +Index: 53929, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.591 +Index: 53930, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.6662 +Index: 53931, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.7246 +Index: 53932, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.8058 +Index: 53933, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.8547 +Index: 53936, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.1254 +Index: 53937, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.1562 +Index: 53938, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.1809 +Index: 53939, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.2272 +Index: 53940, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.2885 +Index: 53941, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.3522 +Index: 53942, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.4134 +Index: 53943, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.4596 +Index: 53944, SMILES: CCCCCCCCCCCCCCCC(=O)O, Value: 0.522 +Index: 53950, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1178 +Index: 53951, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1367 +Index: 53952, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1644 +Index: 53953, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.1854 +Index: 53954, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.2122 +Index: 53955, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.2643 +Index: 53956, SMILES: CCCCCCCCCCCCCCCCCC(=O)O, Value: 0.2985 +Index: 53959, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1504 +Index: 53960, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.1847 +Index: 53961, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2386 +Index: 53962, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.2753 +Index: 53963, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.3399 +Index: 53964, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4041 +Index: 53965, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.4732 +Index: 53966, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5281 +Index: 53967, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.5734 +Index: 53968, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.6453 +Index: 53969, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.709 +Index: 53970, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.7748 +Index: 53971, SMILES: CCCCCCCCCCCC(=O)O, Value: 0.8591 +Index: 53975, SMILES: c1ccc2ccccc2c1, Value: 0.1285 +Index: 53976, SMILES: c1ccc2ccccc2c1, Value: 0.1541 +Index: 53977, SMILES: c1ccc2ccccc2c1, Value: 0.1791 +Index: 53978, SMILES: c1ccc2ccccc2c1, Value: 0.2153 +Index: 53979, SMILES: c1ccc2ccccc2c1, Value: 0.2525 +Index: 53980, SMILES: c1ccc2ccccc2c1, Value: 0.2921 +Index: 53981, SMILES: c1ccc2ccccc2c1, Value: 0.34 +Index: 53982, SMILES: O=C(O)c1ccccc1O, Value: 0.4931 +Index: 54025, SMILES: O=C(O)c1ccccc1, Value: 0.2846 +Index: 54026, SMILES: O=C(O)c1ccccc1, Value: 0.3041 +Index: 54027, SMILES: O=C(O)c1ccccc1, Value: 0.314 +Index: 54028, SMILES: O=C(O)c1ccccc1, Value: 0.3286 +Index: 54029, SMILES: O=C(O)c1ccccc1, Value: 0.3562 +Index: 54030, SMILES: O=C(O)c1ccccc1, Value: 0.3771 +Index: 54031, SMILES: O=C(O)c1ccccc1, Value: 0.4086 +Index: 54032, SMILES: O=C(O)c1ccccc1, Value: 0.4309 +Index: 54033, SMILES: O=C(O)c1ccccc1, Value: 0.4584 +Index: 54034, SMILES: O=C(O)c1ccccc1, Value: 0.4716 +Index: 54037, SMILES: O=C(O)c1ccccc1, Value: 0.1313 +Index: 54038, SMILES: O=C(O)c1ccccc1, Value: 0.1476 +Index: 54039, SMILES: O=C(O)c1ccccc1, Value: 0.183 +Index: 54040, SMILES: O=C(O)c1ccccc1, Value: 0.2251 +Index: 54041, SMILES: O=C(O)c1ccccc1, Value: 0.2688 +Index: 54042, SMILES: O=C(O)c1ccccc1, Value: 0.2997 +Index: 54043, SMILES: O=C(O)c1ccccc1, Value: 0.3359 +Index: 54044, SMILES: O=C(O)c1ccccc1, Value: 0.3666 +Index: 54065, SMILES: O=C(O)c1ccccc1, Value: 0.1218 +Index: 54066, SMILES: O=C(O)c1ccccc1, Value: 0.1324 +Index: 54067, SMILES: O=C(O)c1ccccc1, Value: 0.1383 +Index: 54068, SMILES: O=C(O)c1ccccc1, Value: 0.156 +Index: 54069, SMILES: O=C(O)c1ccccc1, Value: 0.1917 +Index: 54070, SMILES: O=C(O)c1ccccc1, Value: 0.2158 +Index: 54071, SMILES: O=C(O)c1ccccc1, Value: 0.2447 +Index: 54072, SMILES: O=C(O)c1ccccc1, Value: 0.2816 +Index: 54073, SMILES: O=C(O)c1ccccc1, Value: 0.3153 +Index: 54074, SMILES: O=C(O)c1ccccc1, Value: 0.3296 +Index: 54081, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.125 +Index: 54082, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1445 +Index: 54083, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1632 +Index: 54084, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1852 +Index: 54085, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2139 +Index: 54086, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2421 +Index: 54087, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2714 +Index: 54088, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2943 +Index: 54093, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1232 +Index: 54094, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1436 +Index: 54095, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.167 +Index: 54096, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.1923 +Index: 54097, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2171 +Index: 54098, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2454 +Index: 54099, SMILES: c1ccc2c(c1)sc1ccccc12, Value: 0.2797 +Index: 54252, SMILES: NC(N)=C([N+](=O)[O-])[N+](=O)[O-], Value: 0.1498 diff --git a/result/1_standard_ML/histogram/delaney_histogram_kde.png b/result/1_standard_ML/histogram/delaney_histogram_kde.png new file mode 100644 index 0000000000000000000000000000000000000000..5f6ab8d239318c623bd2708fc4d991536e5cb6ba --- /dev/null +++ b/result/1_standard_ML/histogram/delaney_histogram_kde.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ac4851b822fecce058d6843899ecca29dd5a51393b1a3a5b0ccefabdc58fc574 +size 147292 diff --git a/result/1_standard_ML/histogram/delaney_outliers_info.txt b/result/1_standard_ML/histogram/delaney_outliers_info.txt new file mode 100644 index 0000000000000000000000000000000000000000..8478c3f201b7e06830d0057ef8a499f0717e0f4f --- /dev/null +++ b/result/1_standard_ML/histogram/delaney_outliers_info.txt @@ -0,0 +1,25 @@ +Outliers for delaney: +Index: 54, SMILES: Clc1cccc(c1Cl)c2c(Cl)c(Cl)cc(Cl)c2Cl , Value: -7.185 +Index: 60, SMILES: Clc1cc(Cl)c(Cl)c(c1Cl)c2c(Cl)c(Cl)cc(Cl)c2Cl , Value: -8.304 +Index: 272, SMILES: CC1(C)C(C=C(Br)Br)C1C(=O)OC(C#N)c2cccc(Oc3ccccc3)c2, Value: -7.44 +Index: 297, SMILES: Clc1cc(c(Cl)c(Cl)c1Cl)c2cc(Cl)c(Cl)c(Cl)c2Cl, Value: -8.468 +Index: 299, SMILES: CCCCCCCCCCCCCCCCCCCCCCCCCC, Value: -9.702 +Index: 432, SMILES: ClC1=C(Cl)C(Cl)(C(=C1Cl)Cl)C2(Cl)C(=C(Cl)C(=C2Cl)Cl)Cl, Value: -7.848 +Index: 482, SMILES: CC(C)C(Nc1ccc(cc1Cl)C(F)(F)F)C(=O)OC(C#N)c2cccc(Oc3ccccc3)c2, Value: -8.057 +Index: 560, SMILES: Clc1ccc(c(Cl)c1Cl)c2ccc(Cl)c(Cl)c2Cl , Value: -7.192 +Index: 591, SMILES: CC1(C)C(C=C(Cl)Cl)C1C(=O)OCc2cccc(Oc3ccccc3)c2, Value: -7.129 +Index: 603, SMILES: Clc1c(Cl)c(Cl)c(c(Cl)c1Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl , Value: -9.589 +Index: 661, SMILES: Clc1ccc(c(Cl)c1)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -7.898 +Index: 668, SMILES: Clc1ccc(Cl)c(c1)c2cc(Cl)c(Cl)c(Cl)c2Cl, Value: -7.343 +Index: 824, SMILES: Clc1ccc(Cl)c(c1)c2c(Cl)c(Cl)cc(Cl)c2Cl , Value: -7.261 +Index: 862, SMILES: Clc1ccc(cc1Cl)c2cc(Cl)c(Cl)c(Cl)c2Cl , Value: -7.425 +Index: 867, SMILES: CCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCC, Value: -7.117000000000001 +Index: 871, SMILES: Clc1cc(Cl)c(c(Cl)c1)c2c(Cl)cc(Cl)cc2Cl , Value: -7.178999999999999 +Index: 879, SMILES: Clc1ccc(Cl)c(c1)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -7.898 +Index: 908, SMILES: Clc1ccc(c(Cl)c1)c2cc(Cl)c(Cl)c(Cl)c2Cl , Value: -7.343 +Index: 939, SMILES: OC(CC(c1ccccc1)c3c(O)c2ccccc2oc3=O)c4ccc(cc4)c5ccc(Br)cc5 , Value: -7.877000000000001 +Index: 965, SMILES: c1(C(=O)OCCCCCC(C)(C))c(C(=O)OCCCCCC(C)(C))cccc1, Value: -7.117000000000001 +Index: 968, SMILES: CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC , Value: -7.148 +Index: 1042, SMILES: Clc1cc(Cl)c(cc1Cl)c2cc(Cl)c(Cl)cc2Cl , Value: -7.343 +Index: 1097, SMILES: CCCCCCCCCCCCCCCCCCCC, Value: -7.576 +Index: 1120, SMILES: Clc1ccc(c(Cl)c1Cl)c2c(Cl)cc(Cl)c(Cl)c2Cl , Value: -7.746 diff --git a/result/1_standard_ML/histogram/huusk_histogram_kde.png b/result/1_standard_ML/histogram/huusk_histogram_kde.png new file mode 100644 index 0000000000000000000000000000000000000000..3745d94061559e502952768d6e396801f669d777 --- /dev/null +++ b/result/1_standard_ML/histogram/huusk_histogram_kde.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fd259a6a5c603ad1bc11e5826e087122cca9b29c66669916f2f32f45222fc98c +size 151226 diff --git a/result/1_standard_ML/histogram/huusk_outliers_info.txt b/result/1_standard_ML/histogram/huusk_outliers_info.txt new file mode 100644 index 0000000000000000000000000000000000000000..35ee56c0fb1017a29780d092cb1e2d8ffd760fb5 --- /dev/null +++ b/result/1_standard_ML/histogram/huusk_outliers_info.txt @@ -0,0 +1,31 @@ +Outliers for huusk: +Index: 71, SMILES: c1ccc2c3cc4ccccc4cc3Cc2c1, Value: -8.04 +Index: 73, SMILES: c(c(c(cc1)ccc2)c2cc3)(c3cc(c4ccc5)c5)c14, Value: -8.19 +Index: 76, SMILES: c(c(ccc1)ccc2)(c1c(c(c(cc3)ccc4)c45)c3)c25, Value: -8.8 +Index: 77, SMILES: c16cccc2ccc3ccc4ccc5cccc6c5c4c3c12, Value: -9.03 +Index: 83, SMILES: c12ccccc1cc3c4ccccc4c5c3c2ccc5, Value: -8.23 +Index: 84, SMILES: c1ccc4c(c1)ccc5c2cccc3cccc(c23)c45, Value: -8.0 +Index: 85, SMILES: c2ccc1cc3c(cc1c2)c4cccc5cccc3c45, Value: -8.49 +Index: 86, SMILES: c(c(c(c(c1)ccc2)c2)cc(c3c(c(c4)ccc5)c5)c4)(c1)c3, Value: -8.66 +Index: 202, SMILES: c1c(Cl)c(Cl)cc(Cl)c1c2c(Cl)cc(Cl)c(Cl)c2, Value: -8.56 +Index: 203, SMILES: Clc1cc(Cl)c(Cl)cc1c2c(Cl)c(Cl)ccc2Cl, Value: -8.65 +Index: 204, SMILES: Clc1cc(Cl)c(Cl)cc1c2c(Cl)c(Cl)cc(Cl)c2, Value: -8.6 +Index: 205, SMILES: c1cc(Cl)c(Cl)c(Cl)c1c2c(Cl)cc(Cl)c(Cl)c2, Value: -8.32 +Index: 207, SMILES: Clc1c(Cl)cc(Cl)cc1c2c(Cl)cc(Cl)cc2Cl, Value: -8.71 +Index: 210, SMILES: c1ccc(Cl)c(Cl)c1c2c(Cl)c(Cl)c(Cl)c(Cl)c2, Value: -8.42 +Index: 211, SMILES: Clc1cc(Cl)c(Cl)c(Cl)c1c2c(Cl)cc(Cl)c(Cl)c2, Value: -7.92 +Index: 212, SMILES: c1cc(Cl)c(Cl)c(Cl)c1c2c(Cl)c(Cl)c(Cl)cc2Cl, Value: -8.3 +Index: 213, SMILES: c1c(Cl)ccc(Cl)c1c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -8.94 +Index: 214, SMILES: c1c(Cl)c(Cl)c(Cl)c(Cl)c1c2c(Cl)c(Cl)c(Cl)c(Cl)c2, Value: -9.16 +Index: 215, SMILES: c1c(Cl)c(Cl)c(Cl)c(Cl)c1c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -10.26 +Index: 216, SMILES: Clc1c(Cl)c(Cl)c(Cl)c(Cl)c1c2c(Cl)c(Cl)cc(Cl)c2Cl, Value: -10.41 +Index: 217, SMILES: Clc1c(Cl)c(Cl)c(Cl)c(Cl)c1c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl, Value: -11.62 +Index: 681, SMILES: FC(F)(F)c(cccc1C(n(ncn2)c2)(c(cccc3)c3)c(cccc4)c4)c1, Value: -8.4 +Index: 1035, SMILES: c(c(cc(c1ccc2)c2)cc(c3ccc4)c4)(c1)c3, Value: -8.6 +Index: 1036, SMILES: c1ccc2ccc3c4ccccc4ccc3c2c1, Value: -8.06 +Index: 1039, SMILES: c(c(ccc1C)cc(c2ccc3cccc4)c34)(c1CC5)c25, Value: -7.92 +Index: 1067, SMILES: c1c(Cl)ccc(Cl)c1c2c(Cl)c(Cl)c(Cl)cc2, Value: -7.91 +Index: 1068, SMILES: Clc1c(Cl)c(Cl)c(Cl)c(Cl)c1c2ccccc2, Value: -7.92 +Index: 1070, SMILES: c1cc(Cl)c(Cl)c(Cl)c1c2c(Cl)c(Cl)c(Cl)cc2, Value: -8.01 +Index: 1071, SMILES: Clc1c(Cl)cc(Cl)c(Cl)c1c2c(Cl)c(Cl)cc(Cl)c2Cl, Value: -9.15 +Index: 1271, SMILES: Clc1ccc(Cl)c(c1)c2cc(Cl)c(Cl)cc2Cl, Value: -7.89 diff --git a/result/1_standard_ML/histogram/lovric_histogram_kde.png b/result/1_standard_ML/histogram/lovric_histogram_kde.png new file mode 100644 index 0000000000000000000000000000000000000000..fadf991f61cd0c88521bf02502f27cbfa2bee6dd --- /dev/null +++ b/result/1_standard_ML/histogram/lovric_histogram_kde.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f12e43cd5fc06e72d86a59e298fc17c517aed250d8b08f78aeb787b08376e984 +size 138394 diff --git a/result/1_standard_ML/histogram/lovric_outliers_info.txt b/result/1_standard_ML/histogram/lovric_outliers_info.txt new file mode 100644 index 0000000000000000000000000000000000000000..9ced0654b7cf2738d5efbaa0289dfaf400a6ca92 --- /dev/null +++ b/result/1_standard_ML/histogram/lovric_outliers_info.txt @@ -0,0 +1,23 @@ +Outliers for lovric: +Index: 36, SMILES: CC(=O)O[C@@H]1C2=C(C)[C@H](C[C@@](O)([C@@H](OC(=O)c3ccccc3)[C@@H]3[C@@]4(CO[C@@H]4C[C@H](O)[C@@]3(C)C1=O)OC(C)=O)C2(C)C)OC(=O)[C@H](O)[C@@H](NC(=O)c1ccccc1)c1ccccc1, Value: -6.63 +Index: 49, SMILES: CC(C)(C)NC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C=C(CC[C@]4(C)[C@H]3CC[C@]12C)C(O)=O, Value: -8.7585 +Index: 55, SMILES: CC(C)(C)c1ccc(cc1)[C@@H](O)CCCN1CCC(CC1)C(O)(c1ccccc1)c1ccccc1, Value: -6.69 +Index: 160, SMILES: CCC1=C(C)CN(C(=O)NCCc2ccc(cc2)S(=O)(=O)NC(=O)N[C@H]2CC[C@H](C)CC2)C1=O, Value: -6.44 +Index: 236, SMILES: CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1, Value: -8.174 +Index: 252, SMILES: CCCOc1ccc2[C@@H]([C@H]([C@@H](c2c1)c1ccc(OC)cc1OCC(O)=O)C(O)=O)c1ccc2OCOc2c1, Value: -6.771 +Index: 257, SMILES: CCC[C@@]1(CCc2ccccc2)CC(=O)[C@@H]([C@H](CC)c2cccc(NS(=O)(=O)c3ccc(cn3)C(F)(F)F)c2)C(=O)O1, Value: -6.3 +Index: 303, SMILES: CCOC(=O)c1cncn1[C@H](C)c1ccccc1, Value: -6.735 +Index: 327, SMILES: CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H]12, Value: -6.0 +Index: 336, SMILES: CC\C(=C(/c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1, Value: -8.02 +Index: 339, SMILES: CCc1ccc(CCOc2ccc(C[C@H]3SC(=O)NC3=O)cc2)nc1, Value: -6.185 +Index: 350, SMILES: CN(C)C(=O)C(CCN1CCC(O)(CC1)c1ccc(Cl)cc1)(c1ccccc1)c1ccccc1, Value: -7.074 +Index: 368, SMILES: CN(C)CC\C=C1\c2ccccc2Sc2ccc(Cl)cc12, Value: -6.308 +Index: 452, SMILES: COc1ccc(Cl)cc1C(=O)NCCc1ccc(cc1)S(=O)(=O)NC(=O)NC1CCCCC1, Value: -6.755 +Index: 500, SMILES: C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)C3=CC[C@]2(C)[C@H]1C(=O)CN1CCN(CC1)c1cc(nc(n1)N1CCCC1)N1CCCC1, Value: -7.59 +Index: 559, SMILES: Cc1ccc(Cl)c(Nc2ccccc2C(O)=O)c1Cl, Value: -6.267 +Index: 569, SMILES: Cc1cccc(CN2CCN(CC2)[C@H](c2ccccc2)c2ccc(Cl)cc2)c1, Value: -6.481 +Index: 570, SMILES: Cc1cccc(Nc2ccccc2C(O)=O)c1C, Value: -6.544 +Index: 598, SMILES: Clc1ccc(CC[C@@](Cn2cncn2)(C#N)c2ccccc2)cc1, Value: -6.226 +Index: 603, SMILES: Clc1cccc(N2CCN(CCCCOc3ccc4CCC(=O)Nc4c3)CC2)c1Cl, Value: -6.585 +Index: 733, SMILES: OC(=O)c1cc(ccc1O)\N=N\c1ccc(cc1)S(=O)(=O)Nc1ccccn1, Value: -6.137 +Index: 823, SMILES: c1cn(cn1)[C@H](c1ccccc1)c1ccc(cc1)-c1ccccc1, Value: -6.27 diff --git a/result/1_standard_ML/histogram/ws496_histogram_kde.png b/result/1_standard_ML/histogram/ws496_histogram_kde.png new file mode 100644 index 0000000000000000000000000000000000000000..d074c63a6a1e971b168c9976ee2178d26faf35dc --- /dev/null +++ b/result/1_standard_ML/histogram/ws496_histogram_kde.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3be5d7ea28223cd643fc12b5cdb172865032f97f3972f6721cbdd88c2263eb0d +size 141037 diff --git a/result/1_standard_ML/histogram/ws496_outliers_info.txt b/result/1_standard_ML/histogram/ws496_outliers_info.txt new file mode 100644 index 0000000000000000000000000000000000000000..5bb5d51af1f22b4870408cacdeb9b751c86cab5d --- /dev/null +++ b/result/1_standard_ML/histogram/ws496_outliers_info.txt @@ -0,0 +1,15 @@ +Outliers for ws496: +Index: 38, SMILES: c1ccc2cc3c(cc2c1)Cc1ccccc31, Value: -8.04 +Index: 40, SMILES: c1ccc2c(c1)cc1ccc3cccc4ccc2c1c34, Value: -8.19 +Index: 43, SMILES: c1ccc2c(c1)ccc1c3ccccc3ccc21, Value: -8.06 +Index: 44, SMILES: c1cc2cccc3c4cccc5cccc(c(c1)c23)c45, Value: -8.8 +Index: 45, SMILES: c1cc2ccc3ccc4ccc5cccc6c(c1)c2c3c4c56, Value: -9.03 +Index: 48, SMILES: c1ccc2c(c1)ccc1c3cccc4cccc(c34)c21, Value: -8.0 +Index: 49, SMILES: c1ccc2cc3c4cccc5cccc(c3cc2c1)c45, Value: -8.49 +Index: 111, SMILES: c1cc(c(c(c1c1cc(c(cc1Cl)Cl)Cl)Cl)Cl)Cl, Value: -8.32 +Index: 114, SMILES: c1c(cc(c(c1Cl)c1c(cc(cc1Cl)Cl)Cl)Cl)Cl, Value: -8.71 +Index: 116, SMILES: c1cc(c(c(c1c1ccc(c(c1Cl)Cl)Cl)Cl)Cl)Cl, Value: -8.01 +Index: 118, SMILES: c1cc(c(cc1Cl)c1c(c(c(c(c1Cl)Cl)Cl)Cl)Cl)Cl, Value: -8.94 +Index: 119, SMILES: c1c(c2cc(c(c(c2Cl)Cl)Cl)Cl)c(c(c(c1Cl)Cl)Cl)Cl, Value: -9.16 +Index: 120, SMILES: c1c(c2c(c(c(c(c2Cl)Cl)Cl)Cl)Cl)c(c(c(c1Cl)Cl)Cl)Cl, Value: -10.26 +Index: 121, SMILES: c1c(c(c(c2c(c(c(c(c2Cl)Cl)Cl)Cl)Cl)c(c1Cl)Cl)Cl)Cl, Value: -10.41 diff --git a/result/2_solubility_fingerprint_compare/failed/Lovric2020_logS0/failed_smiles.csv b/result/2_solubility_fingerprint_compare/failed/Lovric2020_logS0/failed_smiles.csv new file mode 100644 index 0000000000000000000000000000000000000000..935612774e742c602638c7832c66cfb1f7c2fd04 --- /dev/null +++ b/result/2_solubility_fingerprint_compare/failed/Lovric2020_logS0/failed_smiles.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:274dbe195d685fb43c9d4b0922d32ab4e6040ecf56a9c8d519df1036f651da1d +size 152 diff --git a/result/2_solubility_fingerprint_compare/failed/Lovric2020_logS0/mol_461.png b/result/2_solubility_fingerprint_compare/failed/Lovric2020_logS0/mol_461.png new file mode 100644 index 0000000000000000000000000000000000000000..55692c6accef84e85b20cfc76e8b15aed353b2be --- /dev/null +++ b/result/2_solubility_fingerprint_compare/failed/Lovric2020_logS0/mol_461.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8c83de338b5a413138cb9e3551f1535106277fc54ebb691c166c4be71ed59a73 +size 11204 diff --git a/result/2_solubility_fingerprint_compare/failed/Lovric2020_logS0/mol_462.png b/result/2_solubility_fingerprint_compare/failed/Lovric2020_logS0/mol_462.png new file mode 100644 index 0000000000000000000000000000000000000000..f0df4745bec58e541491d1143c470ab6fefdac28 --- /dev/null +++ b/result/2_solubility_fingerprint_compare/failed/Lovric2020_logS0/mol_462.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:acfd5ab93a734d2b3591fb5e032b3c7f4dbada3682ba8a2adfdb05cc69c5b1a6 +size 11252 diff --git a/result/2_solubility_fingerprint_compare/fingerprint_compare_delaney.png b/result/2_solubility_fingerprint_compare/fingerprint_compare_delaney.png new file mode 100644 index 0000000000000000000000000000000000000000..5c0ee7a2b0b741986a73ec5214e575292704d3d3 --- /dev/null +++ b/result/2_solubility_fingerprint_compare/fingerprint_compare_delaney.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bde6e7e396807ba7e4ed0eef3fcb2a43add2fb61b58b9574fab23c8eab4011fb +size 516910 diff --git a/result/2_solubility_fingerprint_compare/fingerprint_compare_huuskonen.png b/result/2_solubility_fingerprint_compare/fingerprint_compare_huuskonen.png new file mode 100644 index 0000000000000000000000000000000000000000..058a2e7ca0793b540f4756fdd7c666a049034cd7 --- /dev/null +++ b/result/2_solubility_fingerprint_compare/fingerprint_compare_huuskonen.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:83de12edb7bd1029557d2cf2d5159e8c8f9637ef3b234396841a40204bf613b1 +size 552238 diff --git a/result/2_solubility_fingerprint_compare/fingerprint_compare_lovrics.png b/result/2_solubility_fingerprint_compare/fingerprint_compare_lovrics.png new file mode 100644 index 0000000000000000000000000000000000000000..5a0d8097b8ff4d748f16b0de16d7fdd3f9a9df59 --- /dev/null +++ b/result/2_solubility_fingerprint_compare/fingerprint_compare_lovrics.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9f5ad74a3d12ad706e50e4183e4c7bffc5a4338605639a0a8a0187ff7047b03d +size 471623 diff --git a/result/2_solubility_fingerprint_compare/fingerprint_compare_ws496.png b/result/2_solubility_fingerprint_compare/fingerprint_compare_ws496.png new file mode 100644 index 0000000000000000000000000000000000000000..35d78f679820407eef35a2ed9dd3bfcadb88c525 --- /dev/null +++ b/result/2_solubility_fingerprint_compare/fingerprint_compare_ws496.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d30c06ab3164a1f6fc30c47c6bd4b590b5fa15e9cd50304889e57a2b451d4f43 +size 421675 diff --git a/result/3_solubility_descriptor_deeplearning/DNN_descriptor_r2score_horizontal.png b/result/3_solubility_descriptor_deeplearning/DNN_descriptor_r2score_horizontal.png new file mode 100644 index 0000000000000000000000000000000000000000..373a0246f0598a7c553b98d041d4b9a90847370d --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/DNN_descriptor_r2score_horizontal.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6bccbe6224649cc1dd5bd916723604807ae5f6be2d0c7ab367ea119cbad61434 +size 772096 diff --git a/result/3_solubility_descriptor_deeplearning/DNN_descriptor_r2score_vertical.png b/result/3_solubility_descriptor_deeplearning/DNN_descriptor_r2score_vertical.png new file mode 100644 index 0000000000000000000000000000000000000000..488b6522974ae9270584fbe0b7e293af5bcedeee --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/DNN_descriptor_r2score_vertical.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9d6b15973982b4f7cc0fadfa7874b4f3c5fc6dbec0c364f1094f72567b00abf1 +size 625638 diff --git a/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[de].csv b/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[de].csv new file mode 100644 index 0000000000000000000000000000000000000000..f283dd7f6ced7adef488eaa84d4453e10d88cb9a --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[de].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:aff77c9551d893a4d28916f8372a2d611afcde59fd05532cf26a4dc8b5b07690 +size 1767 diff --git a/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[hu].csv b/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[hu].csv new file mode 100644 index 0000000000000000000000000000000000000000..90f460161ff7f217ea553c90b14dbba83fe5776e --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[hu].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:44c42522f272f82a7a492268d454faf8b3897d1d84b0cdbcf510eea0c46feb0c +size 2515 diff --git a/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[lo].csv b/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[lo].csv new file mode 100644 index 0000000000000000000000000000000000000000..fff8803f4f72f47fa90130e65d3a64e9cdf40c54 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[lo].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:719258c686bbba1519a5d8a68a049d6480a14da7fb9f60963c6bd07f38a54a85 +size 1191 diff --git a/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[ws].csv b/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[ws].csv new file mode 100644 index 0000000000000000000000000000000000000000..fe7ee52f189d995569abcc667e463eb0d8dcd07a --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/[3]_individual_r2_score_higher_than_original_prediction[ws].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b9fe759d2230a7527f8a5c9f379848910701182cdc1d891ce7b3b18debdcc302 +size 1986 diff --git a/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score.png b/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score.png new file mode 100644 index 0000000000000000000000000000000000000000..6c9f7803d42564c346bab395e200545a36431f9a --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4a7d28c9394cb220b0dafcd9d55d3486941c97b0bf4bb1aa7797a646245bb2ef +size 552148 diff --git a/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score_horizontal_title.png b/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score_horizontal_title.png new file mode 100644 index 0000000000000000000000000000000000000000..b8b8b1d01fcb428305f9e52eae6b0ff002634689 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score_horizontal_title.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:5473c486c8930f5f8664a931480d209691be2adcedb7dd69e761a05387b4cbad +size 762351 diff --git a/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score_result_ALL_horizontal.png b/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score_result_ALL_horizontal.png new file mode 100644 index 0000000000000000000000000000000000000000..5b4b73b8ea108e92bb3f91e1875e4766bd8c76fe --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score_result_ALL_horizontal.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e5a1812e8a4f562d1193227efc274b4afaf7f1180acf1ddedda4fe76d9f78c31 +size 5339650 diff --git a/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score_result_ALL_vertical.png b/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score_result_ALL_vertical.png new file mode 100644 index 0000000000000000000000000000000000000000..8dbc0b97da5530d6e96b75143d801cdc36999fd6 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/chem_descriptor_r2score_result_ALL_vertical.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3f8f49c93b4996eee609efc61be746bea2ae4f54a8b82e5c91a840679807890f +size 2389618 diff --git a/result/3_solubility_descriptor_deeplearning/delaney_fps_descriptor_individual_learning_results.csv b/result/3_solubility_descriptor_deeplearning/delaney_fps_descriptor_individual_learning_results.csv new file mode 100644 index 0000000000000000000000000000000000000000..c2388f2a8bb992f4cf9c4e11bec7f4091784e0ab --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/delaney_fps_descriptor_individual_learning_results.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:41efef0704f1b85bb0fbaaa95da7a1e67786abcea87370ef6800369f9eaef643 +size 2688 diff --git a/result/3_solubility_descriptor_deeplearning/delaney_fps_descriptor_individual_learning_results_time.csv b/result/3_solubility_descriptor_deeplearning/delaney_fps_descriptor_individual_learning_results_time.csv new file mode 100644 index 0000000000000000000000000000000000000000..261de951cf58c6ad50b8cb5f2ea34a34587c6801 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/delaney_fps_descriptor_individual_learning_results_time.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3b355f7990af4209f2260cf95b45c49c6b084ec1201ef65d4442aab56292c5c8 +size 3909 diff --git a/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[de].csv b/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[de].csv new file mode 100644 index 0000000000000000000000000000000000000000..88bbb5716b2b5b0461158ec8a81806f31de3fbc3 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[de].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d65d0100b498256fbbd98b8fa16fa3eccf9500a7fa4eef03d1f1d70221f46b68 +size 3087 diff --git a/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[hu].csv b/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[hu].csv new file mode 100644 index 0000000000000000000000000000000000000000..0b8c6158bd5e98afee4012ccfb6bf77faff6d1ca --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[hu].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:20fd8f92ad903b4f0a78bac549bc26d77479b53de78b87094b573e88625ffc60 +size 3088 diff --git a/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[lo].csv b/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[lo].csv new file mode 100644 index 0000000000000000000000000000000000000000..546fdf638264dcc8630e9b87bf3a18c4b8a4c562 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[lo].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:792eb9732c058c2cf871a738e7fb5a938839f144227896968d20e315dd832527 +size 3090 diff --git a/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[ws].csv b/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[ws].csv new file mode 100644 index 0000000000000000000000000000000000000000..2a361e9c62a2dc218d1063dac8ddac0151ca99dc --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/dnn_feature_r2_score[ws].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d9f6c14c10231d6d5785232c878ff7cfe0ba7ae596d538cd925b3cd4a73e7ee3 +size 3079 diff --git a/result/3_solubility_descriptor_deeplearning/failed/Lovric2020_logS0/failed_smiles.csv b/result/3_solubility_descriptor_deeplearning/failed/Lovric2020_logS0/failed_smiles.csv new file mode 100644 index 0000000000000000000000000000000000000000..489f4b05052884e7392a237dcd55fde72bc2c61b --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/failed/Lovric2020_logS0/failed_smiles.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:efcaea023d5d6b877b5c576e2e94dc9b026e21d3577586f3eae9aa920a5d1e8a +size 152 diff --git a/result/3_solubility_descriptor_deeplearning/failed/Lovric2020_logS0/mol_461.png b/result/3_solubility_descriptor_deeplearning/failed/Lovric2020_logS0/mol_461.png new file mode 100644 index 0000000000000000000000000000000000000000..55692c6accef84e85b20cfc76e8b15aed353b2be --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/failed/Lovric2020_logS0/mol_461.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8c83de338b5a413138cb9e3551f1535106277fc54ebb691c166c4be71ed59a73 +size 11204 diff --git a/result/3_solubility_descriptor_deeplearning/failed/Lovric2020_logS0/mol_462.png b/result/3_solubility_descriptor_deeplearning/failed/Lovric2020_logS0/mol_462.png new file mode 100644 index 0000000000000000000000000000000000000000..f0df4745bec58e541491d1143c470ab6fefdac28 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/failed/Lovric2020_logS0/mol_462.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:acfd5ab93a734d2b3591fb5e032b3c7f4dbada3682ba8a2adfdb05cc69c5b1a6 +size 11252 diff --git a/result/3_solubility_descriptor_deeplearning/hussk_fps_descriptor_individual_learning_results.csv b/result/3_solubility_descriptor_deeplearning/hussk_fps_descriptor_individual_learning_results.csv new file mode 100644 index 0000000000000000000000000000000000000000..0ce3e56efec1234a11d596d89df003d0c99beca5 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/hussk_fps_descriptor_individual_learning_results.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a09f59da9032f63028a5bbae1deb05a9fe3cec08817708573fe8f4d37f94d20c +size 2689 diff --git a/result/3_solubility_descriptor_deeplearning/hussk_fps_descriptor_individual_learning_results_time.csv b/result/3_solubility_descriptor_deeplearning/hussk_fps_descriptor_individual_learning_results_time.csv new file mode 100644 index 0000000000000000000000000000000000000000..d73f3ea7c010457a4967c0b2edb8f983cb14e91a --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/hussk_fps_descriptor_individual_learning_results_time.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bedb720251abcd0ee57cbc96952ea4ee4b19ab61bf9bceee92df742551194c4b +size 3922 diff --git a/result/3_solubility_descriptor_deeplearning/lovric_fps_descriptor_individual_learning_results.csv b/result/3_solubility_descriptor_deeplearning/lovric_fps_descriptor_individual_learning_results.csv new file mode 100644 index 0000000000000000000000000000000000000000..d38267d1a3bab33ed8c002fd95ac51c823a0a725 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/lovric_fps_descriptor_individual_learning_results.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:eeeb265a117a4576c1ea5638d56a82504e9333f5dbd7d6e0357fd4c276fb3145 +size 2691 diff --git a/result/3_solubility_descriptor_deeplearning/lovric_fps_descriptor_individual_learning_results_time.csv b/result/3_solubility_descriptor_deeplearning/lovric_fps_descriptor_individual_learning_results_time.csv new file mode 100644 index 0000000000000000000000000000000000000000..6160524583a25eb0bdd2e00eefa32a863d278b39 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/lovric_fps_descriptor_individual_learning_results_time.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:de08c7466172b3eb40e1d1ffa41361456fc049fc59eb08de37b9452cf03c2309 +size 3916 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_de_32batch_100epoch_0.01lr.png b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_de_32batch_100epoch_0.01lr.png new file mode 100644 index 0000000000000000000000000000000000000000..11c131bbc9e8383143174b0b7d0431280472ccaa --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_de_32batch_100epoch_0.01lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2a0159a1757174d5df086dfe7233339b0b47a9561539c20206362e839a161a91 +size 841371 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_de_32batch_50epoch_0.0001lr.png b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_de_32batch_50epoch_0.0001lr.png new file mode 100644 index 0000000000000000000000000000000000000000..659e193840d7b154867b0da9505e27bfc6b7a74d --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_de_32batch_50epoch_0.0001lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4ccca803b8df966fefab370620413b78f7bb04784299154f82ffea63afe1733b +size 866432 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_hu_32batch_100epoch_0.01lr.png b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_hu_32batch_100epoch_0.01lr.png new file mode 100644 index 0000000000000000000000000000000000000000..d587e6238f9847bb53c9982d10d52a4c6dc9a013 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_hu_32batch_100epoch_0.01lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f70b1bf5e62c54e6fb71364808ca4faf71037897056fbb9a64a397a3332539d3 +size 837592 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_hu_32batch_50epoch_0.0001lr.png b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_hu_32batch_50epoch_0.0001lr.png new file mode 100644 index 0000000000000000000000000000000000000000..211bfa74c83006cbd108e1c437178a7e41072b83 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_hu_32batch_50epoch_0.0001lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:cfa205bbdfa5423001e6b92a787567c6be39e7da91db935956b1179ca202701a +size 865426 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_lo_32batch_100epoch_0.01lr.png b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_lo_32batch_100epoch_0.01lr.png new file mode 100644 index 0000000000000000000000000000000000000000..b58db9bb61285147e6cf30f9baa7e970700f205f --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_lo_32batch_100epoch_0.01lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:5a28e5c75c0611ea119d83fdd67183167aa04d9cb4321f386128b2bd0f440028 +size 827712 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_lo_32batch_50epoch_0.0001lr.png b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_lo_32batch_50epoch_0.0001lr.png new file mode 100644 index 0000000000000000000000000000000000000000..a9fca3727c1d97f916f367acccbce8d70a0c1996 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_lo_32batch_50epoch_0.0001lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:cceb2c54273ba94c4f536454429bd2b8efad2ba69d6ecea1d79889f10c0d0290 +size 853819 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_ws_32batch_100epoch_0.01lr.png b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_ws_32batch_100epoch_0.01lr.png new file mode 100644 index 0000000000000000000000000000000000000000..ca2d5a4c28b33f577024c9fe7ebfbeb80b0e1513 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_ws_32batch_100epoch_0.01lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:698d33e9fd9c2c03665af6147ab29d6d64f2a977c8c192382fa8b9b6e6176367 +size 840584 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_ws_32batch_10epoch_0.0001lr.png b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_ws_32batch_10epoch_0.0001lr.png new file mode 100644 index 0000000000000000000000000000000000000000..5618ec7a0955ee03358315ae576ed825189f9dc5 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_ws_32batch_10epoch_0.0001lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:aa086b0b992efaae3a4015916774d0b81471ec834fee07f938fa9f22a9fb3524 +size 219102 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_ws_32batch_50epoch_0.0001lr.png b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_ws_32batch_50epoch_0.0001lr.png new file mode 100644 index 0000000000000000000000000000000000000000..ffe461e6697a930ba58c39a6144f506ba811bdce --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_all_minus_inc_ws_32batch_50epoch_0.0001lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:08332a6a9a10f63ed58113b96b8148ef8c619a39721a9be095962920da7cb3a8 +size 866920 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_de.png b/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_de.png new file mode 100644 index 0000000000000000000000000000000000000000..9a2a22739888c5aaf7cce3c79945810ff3f2394a --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_de.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8cdfe517d471582fe508e245fa8ad1a9c550712f0e239eef36c66e4ced5ef84f +size 936131 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_hu.png b/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_hu.png new file mode 100644 index 0000000000000000000000000000000000000000..dee7274791008297da45b3fe0ebe610ff88f676f --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_hu.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a79aee52737f498ebaeb49b5efec78efb5f55d94040cccc40cced19163729bb1 +size 929000 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_lo.png b/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_lo.png new file mode 100644 index 0000000000000000000000000000000000000000..c3303bb038770dc57a69fec6dc437db26ee5cf82 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_lo.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1853d2ce22932570285fd8b51459d856ff862a52701e80dce581472c76301b11 +size 931951 diff --git a/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_ws.png b/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_ws.png new file mode 100644 index 0000000000000000000000000000000000000000..458b7218ed7bbb3a66b5ef1b0463734c3a3384d7 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/r2_score_each_descriptors_ws.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:845963283ba560031b3c16da1c2f740dd5b04ae2fae50ab03c13bc7b69652d9c +size 935043 diff --git a/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_de_32batch_100epoch_0.01lr.csv b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_de_32batch_100epoch_0.01lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..cc8c5009e690a714fe0e66c65a59c112ae2c7bcb --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_de_32batch_100epoch_0.01lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:afc9c7f036d816552e533158c22e06675d0c0f68b5bec9a93a867e5363fabf06 +size 2693 diff --git a/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_de_32batch_50epoch_0.0001lr.csv b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_de_32batch_50epoch_0.0001lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..3acda9fd5e643f436fed7bdccbbfc2f373a276dd --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_de_32batch_50epoch_0.0001lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9808b0d3c34ff46eba389796ecd72f9cdea27a5141e70bfbc286f2b5baef0266 +size 2684 diff --git a/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_hu_32batch_100epoch_0.01lr.csv b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_hu_32batch_100epoch_0.01lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..7e53155327d2c49ef2e1adb4ef7a6a6c677a574d --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_hu_32batch_100epoch_0.01lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4f1ccf6e02b7ef57c6aeefe2581e56a3ea85d9d7a510728d500be2ff072ed7d3 +size 2694 diff --git a/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_hu_32batch_50epoch_0.0001lr.csv b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_hu_32batch_50epoch_0.0001lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..f1040db34475a0aca88db476064524321e98d940 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_hu_32batch_50epoch_0.0001lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7f478144c3eae2cf9c2ae4f8bd059e5bbc3e602db93b32227bc83121ef656eea +size 2677 diff --git a/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_lo_32batch_100epoch_0.01lr.csv b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_lo_32batch_100epoch_0.01lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..8a4bec56de978499f570b1ece65d9df3e060b5dd --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_lo_32batch_100epoch_0.01lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c2b234229eb2db1465592932974569042a705a6c054f59527d28b243daa872c1 +size 2696 diff --git a/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_lo_32batch_50epoch_0.0001lr.csv b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_lo_32batch_50epoch_0.0001lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..857732caa53cabc28e0bade114d1cfbf4af0a15e --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_lo_32batch_50epoch_0.0001lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7b956016f146e68045564778f22489598fb946f2fd19f97762968ec2bc64e147 +size 2675 diff --git a/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_ws_32batch_100epoch_0.01lr.csv b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_ws_32batch_100epoch_0.01lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..5166a357503ce78c1697f64011a0435451103746 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_ws_32batch_100epoch_0.01lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:68868bf6a5ad3ab218230363b71fea2fa4ce7a049a500b160270876e2d59da9d +size 2685 diff --git a/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_ws_32batch_10epoch_0.0001lr.csv b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_ws_32batch_10epoch_0.0001lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..9574481ba844b65b3dd9cd72c3e38add04a5e9e5 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_ws_32batch_10epoch_0.0001lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:440dcd793df8aa89bd059da7210419a5e79a91a6570fbb7e4ff31d985466ee8d +size 100 diff --git a/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_ws_32batch_50epoch_0.0001lr.csv b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_ws_32batch_50epoch_0.0001lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..80daad0eb17ce59c11363fdf5f9a82a0cd3ce955 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/record_fps2_r2_score_ws_32batch_50epoch_0.0001lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:64d5b010572891f3086b70284411e62d5203a33cdaaa33f3affa0d4b81d0c0b8 +size 2676 diff --git a/result/3_solubility_descriptor_deeplearning/ws496_fps_descriptor_individual_learning_results.csv b/result/3_solubility_descriptor_deeplearning/ws496_fps_descriptor_individual_learning_results.csv new file mode 100644 index 0000000000000000000000000000000000000000..77bd14b532563d63bf2a70f57f63a8bd0f40cb9f --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/ws496_fps_descriptor_individual_learning_results.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:faf3208a4ca8579d87b6915a73440b51034fe489a5bd86fd1278e34698afc439 +size 2680 diff --git a/result/3_solubility_descriptor_deeplearning/ws496_fps_descriptor_individual_learning_results_time.csv b/result/3_solubility_descriptor_deeplearning/ws496_fps_descriptor_individual_learning_results_time.csv new file mode 100644 index 0000000000000000000000000000000000000000..aa5959c1ab0a2b3d5b44806205eb058aa1c6c6f7 --- /dev/null +++ b/result/3_solubility_descriptor_deeplearning/ws496_fps_descriptor_individual_learning_results_time.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:53b97ee8559192aba214988306be9cf296a016aad90e3dc8338c4a0330a07ee4 +size 3924 diff --git a/result/3_solubility_feature_checker/failed/Lovric2020_logS0/failed_smiles.csv b/result/3_solubility_feature_checker/failed/Lovric2020_logS0/failed_smiles.csv new file mode 100644 index 0000000000000000000000000000000000000000..489f4b05052884e7392a237dcd55fde72bc2c61b --- /dev/null +++ b/result/3_solubility_feature_checker/failed/Lovric2020_logS0/failed_smiles.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:efcaea023d5d6b877b5c576e2e94dc9b026e21d3577586f3eae9aa920a5d1e8a +size 152 diff --git a/result/3_solubility_feature_checker/failed/Lovric2020_logS0/mol_461.png b/result/3_solubility_feature_checker/failed/Lovric2020_logS0/mol_461.png new file mode 100644 index 0000000000000000000000000000000000000000..55692c6accef84e85b20cfc76e8b15aed353b2be --- /dev/null +++ b/result/3_solubility_feature_checker/failed/Lovric2020_logS0/mol_461.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8c83de338b5a413138cb9e3551f1535106277fc54ebb691c166c4be71ed59a73 +size 11204 diff --git a/result/3_solubility_feature_checker/failed/Lovric2020_logS0/mol_462.png b/result/3_solubility_feature_checker/failed/Lovric2020_logS0/mol_462.png new file mode 100644 index 0000000000000000000000000000000000000000..f0df4745bec58e541491d1143c470ab6fefdac28 --- /dev/null +++ b/result/3_solubility_feature_checker/failed/Lovric2020_logS0/mol_462.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:acfd5ab93a734d2b3591fb5e032b3c7f4dbada3682ba8a2adfdb05cc69c5b1a6 +size 11252 diff --git a/result/4_ANO_feature/failed/Lovric2020_logS0/failed_smiles.csv b/result/4_ANO_feature/failed/Lovric2020_logS0/failed_smiles.csv new file mode 100644 index 0000000000000000000000000000000000000000..489f4b05052884e7392a237dcd55fde72bc2c61b --- /dev/null +++ b/result/4_ANO_feature/failed/Lovric2020_logS0/failed_smiles.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:efcaea023d5d6b877b5c576e2e94dc9b026e21d3577586f3eae9aa920a5d1e8a +size 152 diff --git a/result/4_ANO_feature/failed/Lovric2020_logS0/mol_461.png b/result/4_ANO_feature/failed/Lovric2020_logS0/mol_461.png new file mode 100644 index 0000000000000000000000000000000000000000..55692c6accef84e85b20cfc76e8b15aed353b2be --- /dev/null +++ b/result/4_ANO_feature/failed/Lovric2020_logS0/mol_461.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8c83de338b5a413138cb9e3551f1535106277fc54ebb691c166c4be71ed59a73 +size 11204 diff --git a/result/4_ANO_feature/failed/Lovric2020_logS0/mol_462.png b/result/4_ANO_feature/failed/Lovric2020_logS0/mol_462.png new file mode 100644 index 0000000000000000000000000000000000000000..f0df4745bec58e541491d1143c470ab6fefdac28 --- /dev/null +++ b/result/4_ANO_feature/failed/Lovric2020_logS0/mol_462.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:acfd5ab93a734d2b3591fb5e032b3c7f4dbada3682ba8a2adfdb05cc69c5b1a6 +size 11252 diff --git a/result/5_ANO_structure/failed/Lovric2020_logS0/failed_smiles.csv b/result/5_ANO_structure/failed/Lovric2020_logS0/failed_smiles.csv new file mode 100644 index 0000000000000000000000000000000000000000..489f4b05052884e7392a237dcd55fde72bc2c61b --- /dev/null +++ b/result/5_ANO_structure/failed/Lovric2020_logS0/failed_smiles.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:efcaea023d5d6b877b5c576e2e94dc9b026e21d3577586f3eae9aa920a5d1e8a +size 152 diff --git a/result/5_ANO_structure/failed/Lovric2020_logS0/mol_461.png b/result/5_ANO_structure/failed/Lovric2020_logS0/mol_461.png new file mode 100644 index 0000000000000000000000000000000000000000..55692c6accef84e85b20cfc76e8b15aed353b2be --- /dev/null +++ b/result/5_ANO_structure/failed/Lovric2020_logS0/mol_461.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8c83de338b5a413138cb9e3551f1535106277fc54ebb691c166c4be71ed59a73 +size 11204 diff --git a/result/5_ANO_structure/failed/Lovric2020_logS0/mol_462.png b/result/5_ANO_structure/failed/Lovric2020_logS0/mol_462.png new file mode 100644 index 0000000000000000000000000000000000000000..f0df4745bec58e541491d1143c470ab6fefdac28 --- /dev/null +++ b/result/5_ANO_structure/failed/Lovric2020_logS0/mol_462.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:acfd5ab93a734d2b3591fb5e032b3c7f4dbada3682ba8a2adfdb05cc69c5b1a6 +size 11252 diff --git a/result/6_ANO_network_[fea_struc]/failed/Lovric2020_logS0/failed_smiles.csv b/result/6_ANO_network_[fea_struc]/failed/Lovric2020_logS0/failed_smiles.csv new file mode 100644 index 0000000000000000000000000000000000000000..489f4b05052884e7392a237dcd55fde72bc2c61b --- /dev/null +++ b/result/6_ANO_network_[fea_struc]/failed/Lovric2020_logS0/failed_smiles.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:efcaea023d5d6b877b5c576e2e94dc9b026e21d3577586f3eae9aa920a5d1e8a +size 152 diff --git a/result/6_ANO_network_[fea_struc]/failed/Lovric2020_logS0/mol_461.png b/result/6_ANO_network_[fea_struc]/failed/Lovric2020_logS0/mol_461.png new file mode 100644 index 0000000000000000000000000000000000000000..55692c6accef84e85b20cfc76e8b15aed353b2be --- /dev/null +++ b/result/6_ANO_network_[fea_struc]/failed/Lovric2020_logS0/mol_461.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8c83de338b5a413138cb9e3551f1535106277fc54ebb691c166c4be71ed59a73 +size 11204 diff --git a/result/6_ANO_network_[fea_struc]/failed/Lovric2020_logS0/mol_462.png b/result/6_ANO_network_[fea_struc]/failed/Lovric2020_logS0/mol_462.png new file mode 100644 index 0000000000000000000000000000000000000000..f0df4745bec58e541491d1143c470ab6fefdac28 --- /dev/null +++ b/result/6_ANO_network_[fea_struc]/failed/Lovric2020_logS0/mol_462.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:acfd5ab93a734d2b3591fb5e032b3c7f4dbada3682ba8a2adfdb05cc69c5b1a6 +size 11252 diff --git a/result_prior/3d_structures/de/with_labels/molecule_0001.html b/result_prior/3d_structures/de/with_labels/molecule_0001.html new file mode 100644 index 0000000000000000000000000000000000000000..47c46fdf332c6745733c346cc1309674c0e4cfb2 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0001.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0002.html b/result_prior/3d_structures/de/with_labels/molecule_0002.html new file mode 100644 index 0000000000000000000000000000000000000000..6df4f93cd87725e7fefeb0aaffb257d54c9cea17 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0002.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0003.html b/result_prior/3d_structures/de/with_labels/molecule_0003.html new file mode 100644 index 0000000000000000000000000000000000000000..d249805eff1bb3f37edf75ff3a637a8372297e3e --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0003.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0004.html b/result_prior/3d_structures/de/with_labels/molecule_0004.html new file mode 100644 index 0000000000000000000000000000000000000000..3cb3d9a33a222c106bbfa4e18a6cdb57fb096de7 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0004.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0005.html b/result_prior/3d_structures/de/with_labels/molecule_0005.html new file mode 100644 index 0000000000000000000000000000000000000000..ba7281657a40a4da6fc60bb839d702b2a2ec0345 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0005.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0006.html b/result_prior/3d_structures/de/with_labels/molecule_0006.html new file mode 100644 index 0000000000000000000000000000000000000000..7a98eca9daf83997edc97048718cf822a136ef8f --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0006.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0007.html b/result_prior/3d_structures/de/with_labels/molecule_0007.html new file mode 100644 index 0000000000000000000000000000000000000000..a0200284fae9c4619c9b2b777d0341ed71c95ece --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0007.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0008.html b/result_prior/3d_structures/de/with_labels/molecule_0008.html new file mode 100644 index 0000000000000000000000000000000000000000..057e577cf7dc1fb3ebc7fe6e2943fa0061f9c1c7 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0008.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0009.html b/result_prior/3d_structures/de/with_labels/molecule_0009.html new file mode 100644 index 0000000000000000000000000000000000000000..92f01f4b9eb6d6a74bb154e60bdfbc070e5d0ee5 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0009.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0010.html b/result_prior/3d_structures/de/with_labels/molecule_0010.html new file mode 100644 index 0000000000000000000000000000000000000000..f9200d640465f57ce46c5243ae77d4b3d953121f --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0010.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0011.html b/result_prior/3d_structures/de/with_labels/molecule_0011.html new file mode 100644 index 0000000000000000000000000000000000000000..5c289c8b37dba8229dfce276e9ef41d083f57a3e --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0011.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0012.html b/result_prior/3d_structures/de/with_labels/molecule_0012.html new file mode 100644 index 0000000000000000000000000000000000000000..a27573e22fafe732780b8831221ce1adc40a5b88 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0012.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0013.html b/result_prior/3d_structures/de/with_labels/molecule_0013.html new file mode 100644 index 0000000000000000000000000000000000000000..af0ea2908cf14e811836dbde8ee6b071e0cb1bf8 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0013.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0014.html b/result_prior/3d_structures/de/with_labels/molecule_0014.html new file mode 100644 index 0000000000000000000000000000000000000000..014c22c83faaf2f0ed437498e028d81c371b1ba7 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0014.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0015.html b/result_prior/3d_structures/de/with_labels/molecule_0015.html new file mode 100644 index 0000000000000000000000000000000000000000..069fd8eae24cb83d9026089af7b9b06d3febb8e3 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0015.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0016.html b/result_prior/3d_structures/de/with_labels/molecule_0016.html new file mode 100644 index 0000000000000000000000000000000000000000..f7c246a80bdb606faeeee93a9932be9d71aacf4d --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0016.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0017.html b/result_prior/3d_structures/de/with_labels/molecule_0017.html new file mode 100644 index 0000000000000000000000000000000000000000..05e89d18b842ca9af6593016475309551cef00c5 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0017.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0018.html b/result_prior/3d_structures/de/with_labels/molecule_0018.html new file mode 100644 index 0000000000000000000000000000000000000000..1b09f1fd37d845b0d7b0ce398b6d3b1aeb6a4709 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0018.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0019.html b/result_prior/3d_structures/de/with_labels/molecule_0019.html new file mode 100644 index 0000000000000000000000000000000000000000..74792da56f627a9a84e1f9a812e90e6a34ca60c5 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0019.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0020.html b/result_prior/3d_structures/de/with_labels/molecule_0020.html new file mode 100644 index 0000000000000000000000000000000000000000..8932ad1518439e879656dda1bf9879d64c42c3b9 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0020.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0021.html b/result_prior/3d_structures/de/with_labels/molecule_0021.html new file mode 100644 index 0000000000000000000000000000000000000000..8edfd125fc34bd9ad4ed10358e2747e8c5bfd3e4 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0021.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0022.html b/result_prior/3d_structures/de/with_labels/molecule_0022.html new file mode 100644 index 0000000000000000000000000000000000000000..78754a4b840f832eceb9eb82ae90369b8618fd26 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0022.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0023.html b/result_prior/3d_structures/de/with_labels/molecule_0023.html new file mode 100644 index 0000000000000000000000000000000000000000..f36870be885a84e60b7bca419ba1a2aaf4d9d575 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0023.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0024.html b/result_prior/3d_structures/de/with_labels/molecule_0024.html new file mode 100644 index 0000000000000000000000000000000000000000..61080dc4e7c2980a7dc335f815e35dc3eb302bd5 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0024.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0025.html b/result_prior/3d_structures/de/with_labels/molecule_0025.html new file mode 100644 index 0000000000000000000000000000000000000000..fc3bb2d52555c008b305848e54ba085d800b2476 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0025.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0026.html b/result_prior/3d_structures/de/with_labels/molecule_0026.html new file mode 100644 index 0000000000000000000000000000000000000000..a1ccafbd6389c03031a1d57cc4b89c6cfae808f6 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0026.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0027.html b/result_prior/3d_structures/de/with_labels/molecule_0027.html new file mode 100644 index 0000000000000000000000000000000000000000..4fbe561c7617ecb91c7a17e52d8300bcd9d6d725 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0027.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0028.html b/result_prior/3d_structures/de/with_labels/molecule_0028.html new file mode 100644 index 0000000000000000000000000000000000000000..fa77a5b936c3de4e07c6a913f332703398e06c88 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0028.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0029.html b/result_prior/3d_structures/de/with_labels/molecule_0029.html new file mode 100644 index 0000000000000000000000000000000000000000..57ddb4f68db999a58ca91cfc678400ba2a07de8c --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0029.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0030.html b/result_prior/3d_structures/de/with_labels/molecule_0030.html new file mode 100644 index 0000000000000000000000000000000000000000..7c9aa593d79527a6e02b2825cf09170c463cb2f5 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0030.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0031.html b/result_prior/3d_structures/de/with_labels/molecule_0031.html new file mode 100644 index 0000000000000000000000000000000000000000..5224655467f715d7c70f8ccf1fc77243bba24f75 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0031.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0032.html b/result_prior/3d_structures/de/with_labels/molecule_0032.html new file mode 100644 index 0000000000000000000000000000000000000000..a4b8d1187d65206a5e69a15287046eca788a4e2e --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0032.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0033.html b/result_prior/3d_structures/de/with_labels/molecule_0033.html new file mode 100644 index 0000000000000000000000000000000000000000..7db97a00882b8a34b75e478d7033a1e47dc55d81 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0033.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0034.html b/result_prior/3d_structures/de/with_labels/molecule_0034.html new file mode 100644 index 0000000000000000000000000000000000000000..97db3a7cd7ab6819ac10917facafd8429557c350 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0034.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0035.html b/result_prior/3d_structures/de/with_labels/molecule_0035.html new file mode 100644 index 0000000000000000000000000000000000000000..19c09ff719a3035a2765268bf145ce2fa47497d0 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0035.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0036.html b/result_prior/3d_structures/de/with_labels/molecule_0036.html new file mode 100644 index 0000000000000000000000000000000000000000..ac25b6ae3e6360c8278411156a6367ff5e5e8d71 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0036.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0037.html b/result_prior/3d_structures/de/with_labels/molecule_0037.html new file mode 100644 index 0000000000000000000000000000000000000000..63eee0da2973cb590834281b042572336f7dfe0a --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0037.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0038.html b/result_prior/3d_structures/de/with_labels/molecule_0038.html new file mode 100644 index 0000000000000000000000000000000000000000..1be56574e2215c7e3a188d116468bd727a366824 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0038.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0039.html b/result_prior/3d_structures/de/with_labels/molecule_0039.html new file mode 100644 index 0000000000000000000000000000000000000000..cf0b6766e3aab5777f81731103fa78ce7e480f5d --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0039.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0040.html b/result_prior/3d_structures/de/with_labels/molecule_0040.html new file mode 100644 index 0000000000000000000000000000000000000000..84200b8bacdad98c8dc10f41de1ee3ca530d4fba --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0040.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0041.html b/result_prior/3d_structures/de/with_labels/molecule_0041.html new file mode 100644 index 0000000000000000000000000000000000000000..3fcc827d8b43428524fa538f1acd0a8e036c2f30 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0041.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0042.html b/result_prior/3d_structures/de/with_labels/molecule_0042.html new file mode 100644 index 0000000000000000000000000000000000000000..7eef5dfcc36e019c3bbf68c4293036b0737b2735 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0042.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0043.html b/result_prior/3d_structures/de/with_labels/molecule_0043.html new file mode 100644 index 0000000000000000000000000000000000000000..3568d7c4a9f8ba334dbaab62200ba0cd93002845 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0043.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0044.html b/result_prior/3d_structures/de/with_labels/molecule_0044.html new file mode 100644 index 0000000000000000000000000000000000000000..1bfda7d0bb801da95479f3231b8e2d16f6d87175 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0044.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0045.html b/result_prior/3d_structures/de/with_labels/molecule_0045.html new file mode 100644 index 0000000000000000000000000000000000000000..05fd2e942d64779ee6f600722846a8a9e79a246b --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0045.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0046.html b/result_prior/3d_structures/de/with_labels/molecule_0046.html new file mode 100644 index 0000000000000000000000000000000000000000..138f44a0d9fca76e9ac3acead674f3563d61f124 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0046.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0047.html b/result_prior/3d_structures/de/with_labels/molecule_0047.html new file mode 100644 index 0000000000000000000000000000000000000000..00c978cee58ee0b863ff90f8e76e216ab63ae021 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0047.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0048.html b/result_prior/3d_structures/de/with_labels/molecule_0048.html new file mode 100644 index 0000000000000000000000000000000000000000..d83bf79bc37098c6e5c9ebdca28b5bcd904f459c --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0048.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0049.html b/result_prior/3d_structures/de/with_labels/molecule_0049.html new file mode 100644 index 0000000000000000000000000000000000000000..56667771369616d279837c5b3a0cac5dc432a754 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0049.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0050.html b/result_prior/3d_structures/de/with_labels/molecule_0050.html new file mode 100644 index 0000000000000000000000000000000000000000..40929989fb2ff77036dd9b70ffa7be6781d7eb44 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0050.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0051.html b/result_prior/3d_structures/de/with_labels/molecule_0051.html new file mode 100644 index 0000000000000000000000000000000000000000..a02ee2b249914aee35decfa0845a4fd6a2892e85 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0051.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0052.html b/result_prior/3d_structures/de/with_labels/molecule_0052.html new file mode 100644 index 0000000000000000000000000000000000000000..275621f6e0eea543501a2528e58138b67ac420db --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0052.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0053.html b/result_prior/3d_structures/de/with_labels/molecule_0053.html new file mode 100644 index 0000000000000000000000000000000000000000..211b3893263995df096e4352a9705c596930dd3a --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0053.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0054.html b/result_prior/3d_structures/de/with_labels/molecule_0054.html new file mode 100644 index 0000000000000000000000000000000000000000..fbba5ab1b500aedb504761effb616c749230ff89 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0054.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0055.html b/result_prior/3d_structures/de/with_labels/molecule_0055.html new file mode 100644 index 0000000000000000000000000000000000000000..6cd3f391f057b82e9703246995c52ad7b01ad354 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0055.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0056.html b/result_prior/3d_structures/de/with_labels/molecule_0056.html new file mode 100644 index 0000000000000000000000000000000000000000..c41029b0cacf60bbd4fece8bedcd85d18c3b7c05 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0056.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0057.html b/result_prior/3d_structures/de/with_labels/molecule_0057.html new file mode 100644 index 0000000000000000000000000000000000000000..b57675024c3a9c1d774441a61606e641d9ebde87 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0057.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0058.html b/result_prior/3d_structures/de/with_labels/molecule_0058.html new file mode 100644 index 0000000000000000000000000000000000000000..d25623a32348ec867afb0901ca0ac609c18d89bc --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0058.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0059.html b/result_prior/3d_structures/de/with_labels/molecule_0059.html new file mode 100644 index 0000000000000000000000000000000000000000..f91bf461ea951d4777bc31bcf88f32b0fd3c33c0 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0059.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0060.html b/result_prior/3d_structures/de/with_labels/molecule_0060.html new file mode 100644 index 0000000000000000000000000000000000000000..bfdfcdf04202403082d9b94c385b512ac8b9112a --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0060.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0061.html b/result_prior/3d_structures/de/with_labels/molecule_0061.html new file mode 100644 index 0000000000000000000000000000000000000000..8d240e4346724f0178d907485e08ffc9390bbce7 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0061.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0062.html b/result_prior/3d_structures/de/with_labels/molecule_0062.html new file mode 100644 index 0000000000000000000000000000000000000000..1c4631214df60a568131ee0f663a843edee9fa5c --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0062.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0063.html b/result_prior/3d_structures/de/with_labels/molecule_0063.html new file mode 100644 index 0000000000000000000000000000000000000000..124526e65dde5481da50c16241b33e6ad5979b5f --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0063.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0064.html b/result_prior/3d_structures/de/with_labels/molecule_0064.html new file mode 100644 index 0000000000000000000000000000000000000000..dc1bdced461a46cd399ce1fa0194fa0257a3cb38 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0064.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0065.html b/result_prior/3d_structures/de/with_labels/molecule_0065.html new file mode 100644 index 0000000000000000000000000000000000000000..03b1c37c81b90f76301aebe52aa53e5fed8be246 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0065.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0066.html b/result_prior/3d_structures/de/with_labels/molecule_0066.html new file mode 100644 index 0000000000000000000000000000000000000000..41cacd4399898d4cbc03d6842e450c3fc8eca71b --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0066.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0067.html b/result_prior/3d_structures/de/with_labels/molecule_0067.html new file mode 100644 index 0000000000000000000000000000000000000000..c621aef68eabd98eecccfa304df3a296ebe45f93 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0067.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0068.html b/result_prior/3d_structures/de/with_labels/molecule_0068.html new file mode 100644 index 0000000000000000000000000000000000000000..77d8584f789a797d068870e1e2d97b5c9f85541f --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0068.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0069.html b/result_prior/3d_structures/de/with_labels/molecule_0069.html new file mode 100644 index 0000000000000000000000000000000000000000..f1a38ae20bd3169a785e39919f74fe9a40e9e467 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0069.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0070.html b/result_prior/3d_structures/de/with_labels/molecule_0070.html new file mode 100644 index 0000000000000000000000000000000000000000..b726eda28ef663f6503af821846c68e157ef859d --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0070.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0071.html b/result_prior/3d_structures/de/with_labels/molecule_0071.html new file mode 100644 index 0000000000000000000000000000000000000000..085d3e75df553c4c1ce952cab0d200363f52757d --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0071.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0072.html b/result_prior/3d_structures/de/with_labels/molecule_0072.html new file mode 100644 index 0000000000000000000000000000000000000000..0f59baf8471c085639010680d660c9eab2936894 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0072.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0073.html b/result_prior/3d_structures/de/with_labels/molecule_0073.html new file mode 100644 index 0000000000000000000000000000000000000000..432f27359fc7854e8d69c7993f48184be4d90a1f --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0073.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0074.html b/result_prior/3d_structures/de/with_labels/molecule_0074.html new file mode 100644 index 0000000000000000000000000000000000000000..37047387ad2b7cc052b9849a7dc42e8f836ef4a9 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0074.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0075.html b/result_prior/3d_structures/de/with_labels/molecule_0075.html new file mode 100644 index 0000000000000000000000000000000000000000..37066bb46a91c04113942b4c5cfa3f358ba926a7 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0075.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0076.html b/result_prior/3d_structures/de/with_labels/molecule_0076.html new file mode 100644 index 0000000000000000000000000000000000000000..9e7ccf806b6f910421de7c00f4405be3105c2079 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0076.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0077.html b/result_prior/3d_structures/de/with_labels/molecule_0077.html new file mode 100644 index 0000000000000000000000000000000000000000..e521e1c79589af7a9e333aa2045c8f67c9471675 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0077.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0078.html b/result_prior/3d_structures/de/with_labels/molecule_0078.html new file mode 100644 index 0000000000000000000000000000000000000000..066826819729e85ade84108d458b169760d10ee8 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0078.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0079.html b/result_prior/3d_structures/de/with_labels/molecule_0079.html new file mode 100644 index 0000000000000000000000000000000000000000..df0ea8dc4b0975305d09008544ef978016233fa1 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0079.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0080.html b/result_prior/3d_structures/de/with_labels/molecule_0080.html new file mode 100644 index 0000000000000000000000000000000000000000..06f0d8be2e4da311abbe666ad6a01b0d04c5ab77 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0080.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0081.html b/result_prior/3d_structures/de/with_labels/molecule_0081.html new file mode 100644 index 0000000000000000000000000000000000000000..e2f779e7f7ee5626549eb6c297c0d09fd68177fc --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0081.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0082.html b/result_prior/3d_structures/de/with_labels/molecule_0082.html new file mode 100644 index 0000000000000000000000000000000000000000..3249fca02de502d8694a5aa73a6e5e54d76bc7d0 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0082.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0083.html b/result_prior/3d_structures/de/with_labels/molecule_0083.html new file mode 100644 index 0000000000000000000000000000000000000000..d8dd5de6ea686a1b3f098756e25208f2ae264a67 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0083.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0084.html b/result_prior/3d_structures/de/with_labels/molecule_0084.html new file mode 100644 index 0000000000000000000000000000000000000000..3ee088409f832ac988f0b149dffb20e32e5b610d --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0084.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0085.html b/result_prior/3d_structures/de/with_labels/molecule_0085.html new file mode 100644 index 0000000000000000000000000000000000000000..3633a92fd78e3e6cb8b50fdf3667d3594c66601b --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0085.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0086.html b/result_prior/3d_structures/de/with_labels/molecule_0086.html new file mode 100644 index 0000000000000000000000000000000000000000..3ab7c0397dadf6f2265cb1de391ddbc00adafba6 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0086.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0087.html b/result_prior/3d_structures/de/with_labels/molecule_0087.html new file mode 100644 index 0000000000000000000000000000000000000000..e3f443ef118c1a2efb1dad52c65ac342d860d720 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0087.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0088.html b/result_prior/3d_structures/de/with_labels/molecule_0088.html new file mode 100644 index 0000000000000000000000000000000000000000..0329e8716591697bb54cae107562f8d494e19f16 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0088.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0089.html b/result_prior/3d_structures/de/with_labels/molecule_0089.html new file mode 100644 index 0000000000000000000000000000000000000000..31fb2fb21d582415c58929cf605199af082710cf --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0089.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0090.html b/result_prior/3d_structures/de/with_labels/molecule_0090.html new file mode 100644 index 0000000000000000000000000000000000000000..b351834029b6e56f014953ca4da940f011248fd3 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0090.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0091.html b/result_prior/3d_structures/de/with_labels/molecule_0091.html new file mode 100644 index 0000000000000000000000000000000000000000..da4d76f2841fa0b3a7c5ed3ddf45603a66dd7d42 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0091.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0092.html b/result_prior/3d_structures/de/with_labels/molecule_0092.html new file mode 100644 index 0000000000000000000000000000000000000000..d8d89afc4262fea9703fc7410347e488c58b28cb --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0092.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0093.html b/result_prior/3d_structures/de/with_labels/molecule_0093.html new file mode 100644 index 0000000000000000000000000000000000000000..1c3044ae8ff6f268a9b24abc01057bfc462909aa --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0093.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0094.html b/result_prior/3d_structures/de/with_labels/molecule_0094.html new file mode 100644 index 0000000000000000000000000000000000000000..01550b544977d91b4e29415258cdae3a1209ec30 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0094.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0095.html b/result_prior/3d_structures/de/with_labels/molecule_0095.html new file mode 100644 index 0000000000000000000000000000000000000000..063d834bb8e4c8e4465c664b899c7e0f283e97fb --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0095.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0096.html b/result_prior/3d_structures/de/with_labels/molecule_0096.html new file mode 100644 index 0000000000000000000000000000000000000000..e8b0c6d8b8325e48c671191600da12cb6d7d3d03 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0096.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0097.html b/result_prior/3d_structures/de/with_labels/molecule_0097.html new file mode 100644 index 0000000000000000000000000000000000000000..5f56a9152790b9a301796cd0f9188d5a3f5018d8 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0097.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0098.html b/result_prior/3d_structures/de/with_labels/molecule_0098.html new file mode 100644 index 0000000000000000000000000000000000000000..82725ff4facc7701d2c203ad006f34c08eb7a044 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0098.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0099.html b/result_prior/3d_structures/de/with_labels/molecule_0099.html new file mode 100644 index 0000000000000000000000000000000000000000..4029123ffd126501bff8c754c5d709d96ddde29d --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0099.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0100.html b/result_prior/3d_structures/de/with_labels/molecule_0100.html new file mode 100644 index 0000000000000000000000000000000000000000..43631c584d3b2ff36a8e8da24614c3e79d71248f --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0100.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0101.html b/result_prior/3d_structures/de/with_labels/molecule_0101.html new file mode 100644 index 0000000000000000000000000000000000000000..392174b7b58f8b72c0b8bfaf1016ce5ed8cd2ce8 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0101.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0102.html b/result_prior/3d_structures/de/with_labels/molecule_0102.html new file mode 100644 index 0000000000000000000000000000000000000000..c7f7777ff2607b61dc334bbe34080d03e14a9b87 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0102.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0103.html b/result_prior/3d_structures/de/with_labels/molecule_0103.html new file mode 100644 index 0000000000000000000000000000000000000000..d052f9d56a171a3ae337584e5aad2927be5ca50f --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0103.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0104.html b/result_prior/3d_structures/de/with_labels/molecule_0104.html new file mode 100644 index 0000000000000000000000000000000000000000..d58cc145a54dd60f6eb118fd894e7d7b0e851c90 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0104.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0105.html b/result_prior/3d_structures/de/with_labels/molecule_0105.html new file mode 100644 index 0000000000000000000000000000000000000000..cd85b520d432ba93f329832af0ed8bcdbcda37f3 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0105.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0106.html b/result_prior/3d_structures/de/with_labels/molecule_0106.html new file mode 100644 index 0000000000000000000000000000000000000000..223f5ba41b777316feb22d41d3fe1cede3573aa3 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0106.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0107.html b/result_prior/3d_structures/de/with_labels/molecule_0107.html new file mode 100644 index 0000000000000000000000000000000000000000..4d13c7b0040ab0c0564b42f4a4d69cd1da322a13 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0107.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0108.html b/result_prior/3d_structures/de/with_labels/molecule_0108.html new file mode 100644 index 0000000000000000000000000000000000000000..bfbe5794adbdfcbe9ab733b25fb0a280f1835e12 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0108.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0109.html b/result_prior/3d_structures/de/with_labels/molecule_0109.html new file mode 100644 index 0000000000000000000000000000000000000000..76b7394e397285106000835123f8eaedeebff175 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0109.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0110.html b/result_prior/3d_structures/de/with_labels/molecule_0110.html new file mode 100644 index 0000000000000000000000000000000000000000..df63f5bb34a29a2141b0c6d7a6249671f145ec61 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0110.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0111.html b/result_prior/3d_structures/de/with_labels/molecule_0111.html new file mode 100644 index 0000000000000000000000000000000000000000..b6c3455dbb4add4b2b4c4bacdc25ebaad96a9927 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0111.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0112.html b/result_prior/3d_structures/de/with_labels/molecule_0112.html new file mode 100644 index 0000000000000000000000000000000000000000..81abfd83aad5d6045d339b25be7f68fc2327d0e3 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0112.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/with_labels/molecule_0113.html b/result_prior/3d_structures/de/with_labels/molecule_0113.html new file mode 100644 index 0000000000000000000000000000000000000000..3952d57f16254ad72300151fbc761e95d11976a0 --- /dev/null +++ b/result_prior/3d_structures/de/with_labels/molecule_0113.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0001.html b/result_prior/3d_structures/de/without_labels/molecule_0001.html new file mode 100644 index 0000000000000000000000000000000000000000..648bfa69e116f889f5cfe43b26938307d394b5ce --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0001.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0002.html b/result_prior/3d_structures/de/without_labels/molecule_0002.html new file mode 100644 index 0000000000000000000000000000000000000000..e59a53e9fdf0357cab975bf808bec1e82285a7e4 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0002.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0003.html b/result_prior/3d_structures/de/without_labels/molecule_0003.html new file mode 100644 index 0000000000000000000000000000000000000000..901c033a63a96bbd07bf775af24bf365fac85852 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0003.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0004.html b/result_prior/3d_structures/de/without_labels/molecule_0004.html new file mode 100644 index 0000000000000000000000000000000000000000..04bbdc23bcc9080685148df2e82818b9e77cea17 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0004.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0005.html b/result_prior/3d_structures/de/without_labels/molecule_0005.html new file mode 100644 index 0000000000000000000000000000000000000000..b91c72ffb26ccd272b3d55e9be327bdfae9c8f8a --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0005.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0006.html b/result_prior/3d_structures/de/without_labels/molecule_0006.html new file mode 100644 index 0000000000000000000000000000000000000000..420941297985ed0ebcb18876d4f683ff22b3850c --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0006.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0007.html b/result_prior/3d_structures/de/without_labels/molecule_0007.html new file mode 100644 index 0000000000000000000000000000000000000000..7d6587139718c9530417b5f6ae73103086307717 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0007.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0008.html b/result_prior/3d_structures/de/without_labels/molecule_0008.html new file mode 100644 index 0000000000000000000000000000000000000000..96cd27440ba33063a652c0e2d1eef7134438eef1 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0008.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0009.html b/result_prior/3d_structures/de/without_labels/molecule_0009.html new file mode 100644 index 0000000000000000000000000000000000000000..d6858d73d43932c8942d4c717b865ef5f08cb1fa --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0009.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0010.html b/result_prior/3d_structures/de/without_labels/molecule_0010.html new file mode 100644 index 0000000000000000000000000000000000000000..c0d9060029a60abeb14792ad5c130cc2e4ae6252 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0010.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0011.html b/result_prior/3d_structures/de/without_labels/molecule_0011.html new file mode 100644 index 0000000000000000000000000000000000000000..48f8c51550c65e9a6311da93727708cd2832fafe --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0011.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0012.html b/result_prior/3d_structures/de/without_labels/molecule_0012.html new file mode 100644 index 0000000000000000000000000000000000000000..12a4d1c35774f96c8b91d96586f3710f28664aac --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0012.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0013.html b/result_prior/3d_structures/de/without_labels/molecule_0013.html new file mode 100644 index 0000000000000000000000000000000000000000..09053af532ca821645142d4909b4de6a40779f48 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0013.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0014.html b/result_prior/3d_structures/de/without_labels/molecule_0014.html new file mode 100644 index 0000000000000000000000000000000000000000..642e769b0f17a0ddf3986187e68969920d334bf2 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0014.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0015.html b/result_prior/3d_structures/de/without_labels/molecule_0015.html new file mode 100644 index 0000000000000000000000000000000000000000..792fba2296c7a9d06b18627907d4154660b4d94c --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0015.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0016.html b/result_prior/3d_structures/de/without_labels/molecule_0016.html new file mode 100644 index 0000000000000000000000000000000000000000..64232fb1f0a1f96633959e5550c985e3356e5a50 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0016.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0017.html b/result_prior/3d_structures/de/without_labels/molecule_0017.html new file mode 100644 index 0000000000000000000000000000000000000000..2ed8720e6fe54537baa6e5dee4f3a600b9b50e74 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0017.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0018.html b/result_prior/3d_structures/de/without_labels/molecule_0018.html new file mode 100644 index 0000000000000000000000000000000000000000..375cc28b950c9b71dd49215c51753e8ab750e5ed --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0018.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0019.html b/result_prior/3d_structures/de/without_labels/molecule_0019.html new file mode 100644 index 0000000000000000000000000000000000000000..dd186a1d3c3ed0713626a24b05f4f73e96fc305f --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0019.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0020.html b/result_prior/3d_structures/de/without_labels/molecule_0020.html new file mode 100644 index 0000000000000000000000000000000000000000..e1cd47c28bc49fb09bbc851dca2896ee116f818d --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0020.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0021.html b/result_prior/3d_structures/de/without_labels/molecule_0021.html new file mode 100644 index 0000000000000000000000000000000000000000..2b8024a3a458da13f9a37e0d9641b9de8c28b023 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0021.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0022.html b/result_prior/3d_structures/de/without_labels/molecule_0022.html new file mode 100644 index 0000000000000000000000000000000000000000..fd7b7159fc963c9a484d94f0d2c5c9f3615d7c4c --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0022.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0023.html b/result_prior/3d_structures/de/without_labels/molecule_0023.html new file mode 100644 index 0000000000000000000000000000000000000000..d53df7ed1aaa514eec1686243c8fc476b1e0dec5 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0023.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0024.html b/result_prior/3d_structures/de/without_labels/molecule_0024.html new file mode 100644 index 0000000000000000000000000000000000000000..7b3c1078b4a332c6f3a2e2e9386f8e8db4af343d --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0024.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0025.html b/result_prior/3d_structures/de/without_labels/molecule_0025.html new file mode 100644 index 0000000000000000000000000000000000000000..f08c3333aacf5f412436d59e1c8fda4e58d7b9a3 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0025.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0026.html b/result_prior/3d_structures/de/without_labels/molecule_0026.html new file mode 100644 index 0000000000000000000000000000000000000000..4f2f98e3581ecc0d35e9da87f5396cf93c4777fd --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0026.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0027.html b/result_prior/3d_structures/de/without_labels/molecule_0027.html new file mode 100644 index 0000000000000000000000000000000000000000..57c3e47ea0012f392f6a2c907c2b3e164c320b7a --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0027.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0028.html b/result_prior/3d_structures/de/without_labels/molecule_0028.html new file mode 100644 index 0000000000000000000000000000000000000000..e193b56ff862ce3f941d29e7b68c8c8db12639b4 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0028.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0029.html b/result_prior/3d_structures/de/without_labels/molecule_0029.html new file mode 100644 index 0000000000000000000000000000000000000000..eee4ec7b6921d0599619188153c4ed246762629b --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0029.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0030.html b/result_prior/3d_structures/de/without_labels/molecule_0030.html new file mode 100644 index 0000000000000000000000000000000000000000..98ec5d07b48bf42751481562cdfc3f656f285ce5 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0030.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0031.html b/result_prior/3d_structures/de/without_labels/molecule_0031.html new file mode 100644 index 0000000000000000000000000000000000000000..3ef88d529f27430eff45fa748f55d6ab7b37386d --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0031.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0032.html b/result_prior/3d_structures/de/without_labels/molecule_0032.html new file mode 100644 index 0000000000000000000000000000000000000000..1f67d75ec79bcb62a1cb39357222255474b837d9 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0032.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0033.html b/result_prior/3d_structures/de/without_labels/molecule_0033.html new file mode 100644 index 0000000000000000000000000000000000000000..84b0d919916e967a323ea6e22b415add58eb0f79 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0033.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0034.html b/result_prior/3d_structures/de/without_labels/molecule_0034.html new file mode 100644 index 0000000000000000000000000000000000000000..09cdfdcea405dc5bfcc24eb722182033d9dbdc8b --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0034.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0035.html b/result_prior/3d_structures/de/without_labels/molecule_0035.html new file mode 100644 index 0000000000000000000000000000000000000000..a70388478572ccf978e7328535451be2258ecaf9 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0035.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0036.html b/result_prior/3d_structures/de/without_labels/molecule_0036.html new file mode 100644 index 0000000000000000000000000000000000000000..b73aabb379fe9072d7272e74431aa6e96806dd4b --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0036.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0037.html b/result_prior/3d_structures/de/without_labels/molecule_0037.html new file mode 100644 index 0000000000000000000000000000000000000000..47f08b74f902186ebf0a83079fccebab361e2020 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0037.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0038.html b/result_prior/3d_structures/de/without_labels/molecule_0038.html new file mode 100644 index 0000000000000000000000000000000000000000..8907b3d14eebf2d8e0a48c63957906ac4db45c2b --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0038.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0039.html b/result_prior/3d_structures/de/without_labels/molecule_0039.html new file mode 100644 index 0000000000000000000000000000000000000000..74f557396fb019c4b7aeb745421676aeb038bd90 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0039.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0040.html b/result_prior/3d_structures/de/without_labels/molecule_0040.html new file mode 100644 index 0000000000000000000000000000000000000000..0eb7e8e8d659a941414d7efeba80f3777b689e2d --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0040.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0041.html b/result_prior/3d_structures/de/without_labels/molecule_0041.html new file mode 100644 index 0000000000000000000000000000000000000000..08758880dea4ebee321b7a11eff3f461808a4f24 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0041.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0042.html b/result_prior/3d_structures/de/without_labels/molecule_0042.html new file mode 100644 index 0000000000000000000000000000000000000000..c598fe5d56d04a4667b483ebac761b21549005a3 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0042.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0043.html b/result_prior/3d_structures/de/without_labels/molecule_0043.html new file mode 100644 index 0000000000000000000000000000000000000000..e56e5ce99588c5593bd68335fca326dab7b7d44d --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0043.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0044.html b/result_prior/3d_structures/de/without_labels/molecule_0044.html new file mode 100644 index 0000000000000000000000000000000000000000..aff67c29e53527198aef9a943b1af753d66655e1 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0044.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0045.html b/result_prior/3d_structures/de/without_labels/molecule_0045.html new file mode 100644 index 0000000000000000000000000000000000000000..b53e5adfa46ce39f789d5b4250bf108d760d7c54 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0045.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0046.html b/result_prior/3d_structures/de/without_labels/molecule_0046.html new file mode 100644 index 0000000000000000000000000000000000000000..579ea648cd2ddba7fcbee460f01ff2a185f50acb --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0046.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0047.html b/result_prior/3d_structures/de/without_labels/molecule_0047.html new file mode 100644 index 0000000000000000000000000000000000000000..a5baa9e30d5fe6fc84ab01e6c99bd1852dc4720e --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0047.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0048.html b/result_prior/3d_structures/de/without_labels/molecule_0048.html new file mode 100644 index 0000000000000000000000000000000000000000..10f447cd2b51298183146ccb7a2f6e34c922da6c --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0048.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0049.html b/result_prior/3d_structures/de/without_labels/molecule_0049.html new file mode 100644 index 0000000000000000000000000000000000000000..58213b4e990a56a5bd61e6ccb9da021fdd37b3e7 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0049.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0050.html b/result_prior/3d_structures/de/without_labels/molecule_0050.html new file mode 100644 index 0000000000000000000000000000000000000000..6c41cb096174f9a63e2c5942cfc8008da1cf3b8f --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0050.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0051.html b/result_prior/3d_structures/de/without_labels/molecule_0051.html new file mode 100644 index 0000000000000000000000000000000000000000..340d20f73c16e6150eff2e07c20116c8c441646b --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0051.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0052.html b/result_prior/3d_structures/de/without_labels/molecule_0052.html new file mode 100644 index 0000000000000000000000000000000000000000..0f45c5af14500fd5ab6ed39f0ccc0d4bcc4d7c79 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0052.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0053.html b/result_prior/3d_structures/de/without_labels/molecule_0053.html new file mode 100644 index 0000000000000000000000000000000000000000..256c0dc13ce8fde18c11b4e1ff1cc54cc280d6ce --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0053.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0054.html b/result_prior/3d_structures/de/without_labels/molecule_0054.html new file mode 100644 index 0000000000000000000000000000000000000000..02256ab3ce012f103f2661f2c63310ddc286604c --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0054.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0055.html b/result_prior/3d_structures/de/without_labels/molecule_0055.html new file mode 100644 index 0000000000000000000000000000000000000000..979bb7f3a3b415e9b6cafb99e8be533414a565e5 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0055.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0056.html b/result_prior/3d_structures/de/without_labels/molecule_0056.html new file mode 100644 index 0000000000000000000000000000000000000000..15f32e1ead07933946d11727ba18a8e9ae02ff7c --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0056.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0057.html b/result_prior/3d_structures/de/without_labels/molecule_0057.html new file mode 100644 index 0000000000000000000000000000000000000000..1d6bd79899c4623de5930ff013a25b929c3d7fd4 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0057.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0058.html b/result_prior/3d_structures/de/without_labels/molecule_0058.html new file mode 100644 index 0000000000000000000000000000000000000000..030e19ead8930da0f96032f0042981d6b6218267 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0058.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0059.html b/result_prior/3d_structures/de/without_labels/molecule_0059.html new file mode 100644 index 0000000000000000000000000000000000000000..72d696848c75d53ac04aa4970130a8019310a033 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0059.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0060.html b/result_prior/3d_structures/de/without_labels/molecule_0060.html new file mode 100644 index 0000000000000000000000000000000000000000..678b817665e122134770f9d8bb4f0fae46a9c35b --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0060.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0061.html b/result_prior/3d_structures/de/without_labels/molecule_0061.html new file mode 100644 index 0000000000000000000000000000000000000000..04f059f6962f8d5f2275a732e93628902d068968 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0061.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0062.html b/result_prior/3d_structures/de/without_labels/molecule_0062.html new file mode 100644 index 0000000000000000000000000000000000000000..5baa54877e2e9abc5acdea0b1a9395a4c844fffd --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0062.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0063.html b/result_prior/3d_structures/de/without_labels/molecule_0063.html new file mode 100644 index 0000000000000000000000000000000000000000..379d5d0797331529e0524bdcced039e555762d9a --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0063.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0064.html b/result_prior/3d_structures/de/without_labels/molecule_0064.html new file mode 100644 index 0000000000000000000000000000000000000000..79ae5437ad98b2c0bd7c5061b5e5caefc5c3d62e --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0064.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0065.html b/result_prior/3d_structures/de/without_labels/molecule_0065.html new file mode 100644 index 0000000000000000000000000000000000000000..0640a544e2e8eb5b8b02c1107fe8d04fecc4dd50 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0065.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0066.html b/result_prior/3d_structures/de/without_labels/molecule_0066.html new file mode 100644 index 0000000000000000000000000000000000000000..565735f3f0e61805b2e0971bf08f31310b9eb109 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0066.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0067.html b/result_prior/3d_structures/de/without_labels/molecule_0067.html new file mode 100644 index 0000000000000000000000000000000000000000..8dd66113d4c8118112a2c4e5b67d97140e1d763a --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0067.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0068.html b/result_prior/3d_structures/de/without_labels/molecule_0068.html new file mode 100644 index 0000000000000000000000000000000000000000..9e59a3e02113dc9f8b64d847a6252eaff6e170c3 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0068.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0069.html b/result_prior/3d_structures/de/without_labels/molecule_0069.html new file mode 100644 index 0000000000000000000000000000000000000000..385d1b4318db4b1c3a770bd133dea318ae0c37cf --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0069.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0070.html b/result_prior/3d_structures/de/without_labels/molecule_0070.html new file mode 100644 index 0000000000000000000000000000000000000000..8601a726caddeec7e54b5698a8627b49ed2b4198 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0070.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0071.html b/result_prior/3d_structures/de/without_labels/molecule_0071.html new file mode 100644 index 0000000000000000000000000000000000000000..aa5a86731f239f225ee12428ef90816ca4fd33d0 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0071.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0072.html b/result_prior/3d_structures/de/without_labels/molecule_0072.html new file mode 100644 index 0000000000000000000000000000000000000000..87f863ce6c372337af5e443110bd7c23b941f7a4 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0072.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0073.html b/result_prior/3d_structures/de/without_labels/molecule_0073.html new file mode 100644 index 0000000000000000000000000000000000000000..07db5137cd6cffba92b987628aa47468dbf8e7d0 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0073.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0074.html b/result_prior/3d_structures/de/without_labels/molecule_0074.html new file mode 100644 index 0000000000000000000000000000000000000000..b5eed9852f6c83cf1c52cd779c4fca81690f639f --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0074.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0075.html b/result_prior/3d_structures/de/without_labels/molecule_0075.html new file mode 100644 index 0000000000000000000000000000000000000000..94db4f0f3695451e43e155662e12e0f9e602cc4b --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0075.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0076.html b/result_prior/3d_structures/de/without_labels/molecule_0076.html new file mode 100644 index 0000000000000000000000000000000000000000..774fed9bcb4e78dbba9d9e5c0b9cc95f1210f11e --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0076.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0077.html b/result_prior/3d_structures/de/without_labels/molecule_0077.html new file mode 100644 index 0000000000000000000000000000000000000000..d825ecf9198a2018a1078a017476ae0f24922754 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0077.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0078.html b/result_prior/3d_structures/de/without_labels/molecule_0078.html new file mode 100644 index 0000000000000000000000000000000000000000..efef0cc549aeef98e1ebaf40a31f828c73d6da92 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0078.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0079.html b/result_prior/3d_structures/de/without_labels/molecule_0079.html new file mode 100644 index 0000000000000000000000000000000000000000..a32f9b781d712d68732a466b89018c8ba6285acb --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0079.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0080.html b/result_prior/3d_structures/de/without_labels/molecule_0080.html new file mode 100644 index 0000000000000000000000000000000000000000..204eebb3ec010a293fcca2c663a6b6fb49d19e7e --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0080.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0081.html b/result_prior/3d_structures/de/without_labels/molecule_0081.html new file mode 100644 index 0000000000000000000000000000000000000000..ac6d0eda662f5b5fcd975b7707b589dda7a3c84b --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0081.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0082.html b/result_prior/3d_structures/de/without_labels/molecule_0082.html new file mode 100644 index 0000000000000000000000000000000000000000..b112117e08757289f2ef1774d07fbdf526d06bfa --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0082.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0083.html b/result_prior/3d_structures/de/without_labels/molecule_0083.html new file mode 100644 index 0000000000000000000000000000000000000000..0a7866296c966e1e5e30bb41b91dc94b9d6a5c34 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0083.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0084.html b/result_prior/3d_structures/de/without_labels/molecule_0084.html new file mode 100644 index 0000000000000000000000000000000000000000..626113d9745ad6940190eb211b5a87d4fabd2b23 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0084.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0085.html b/result_prior/3d_structures/de/without_labels/molecule_0085.html new file mode 100644 index 0000000000000000000000000000000000000000..ce74bc21e830fa34816ece2ef3bc54628efe8c8a --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0085.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0086.html b/result_prior/3d_structures/de/without_labels/molecule_0086.html new file mode 100644 index 0000000000000000000000000000000000000000..ddb62d0f462dc0cbe6b0048287d70abfbd417afa --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0086.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0087.html b/result_prior/3d_structures/de/without_labels/molecule_0087.html new file mode 100644 index 0000000000000000000000000000000000000000..b9c7102d4f4878b8e02b6af3dbbb155a147236fc --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0087.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0088.html b/result_prior/3d_structures/de/without_labels/molecule_0088.html new file mode 100644 index 0000000000000000000000000000000000000000..c4f34c3d3b67ac95aeaaf0e027ea919c31fc4e07 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0088.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0089.html b/result_prior/3d_structures/de/without_labels/molecule_0089.html new file mode 100644 index 0000000000000000000000000000000000000000..deb7eebb59df7dd09143c9a8de22f828e40c4299 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0089.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0090.html b/result_prior/3d_structures/de/without_labels/molecule_0090.html new file mode 100644 index 0000000000000000000000000000000000000000..b5ae8a023ae8db2afaeefe111f510f6956384dd1 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0090.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0091.html b/result_prior/3d_structures/de/without_labels/molecule_0091.html new file mode 100644 index 0000000000000000000000000000000000000000..ad10ffa73af919128cb22aedb145525d7fe4085e --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0091.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0092.html b/result_prior/3d_structures/de/without_labels/molecule_0092.html new file mode 100644 index 0000000000000000000000000000000000000000..e7a920d88d5bfbf767000fc8ce8100669e4a7cb6 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0092.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0093.html b/result_prior/3d_structures/de/without_labels/molecule_0093.html new file mode 100644 index 0000000000000000000000000000000000000000..0dc29596ac2fde8669c8fbbd65ab901777cfbc87 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0093.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0094.html b/result_prior/3d_structures/de/without_labels/molecule_0094.html new file mode 100644 index 0000000000000000000000000000000000000000..59988f4e7d4636f1c5cbf1d83871388f5a0cee24 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0094.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0095.html b/result_prior/3d_structures/de/without_labels/molecule_0095.html new file mode 100644 index 0000000000000000000000000000000000000000..fcba8c0c303795b3e9447613fa1bc083e320f213 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0095.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0096.html b/result_prior/3d_structures/de/without_labels/molecule_0096.html new file mode 100644 index 0000000000000000000000000000000000000000..449aaf1683398f48b32b541d31276339b91e2d3a --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0096.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0097.html b/result_prior/3d_structures/de/without_labels/molecule_0097.html new file mode 100644 index 0000000000000000000000000000000000000000..457de703167520b6812fa5b8d43c5ef9edb01a0e --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0097.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0098.html b/result_prior/3d_structures/de/without_labels/molecule_0098.html new file mode 100644 index 0000000000000000000000000000000000000000..adf440e4a3733d03d50a13996b58986128fcc1c3 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0098.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0099.html b/result_prior/3d_structures/de/without_labels/molecule_0099.html new file mode 100644 index 0000000000000000000000000000000000000000..7452a30e99191279630739cbedf2b6d2c40e70c5 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0099.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0100.html b/result_prior/3d_structures/de/without_labels/molecule_0100.html new file mode 100644 index 0000000000000000000000000000000000000000..130b1389d5245ef9254f49f98b1996b2541439f4 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0100.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0101.html b/result_prior/3d_structures/de/without_labels/molecule_0101.html new file mode 100644 index 0000000000000000000000000000000000000000..f9f6ca7aae48cfc60da55f2b41ed6d120a4b760c --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0101.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0102.html b/result_prior/3d_structures/de/without_labels/molecule_0102.html new file mode 100644 index 0000000000000000000000000000000000000000..bb398550d4b452b10758b6fc8af0c15fd261979f --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0102.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0103.html b/result_prior/3d_structures/de/without_labels/molecule_0103.html new file mode 100644 index 0000000000000000000000000000000000000000..bcfee22133b8a610501b01883bd06d06712fe245 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0103.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0104.html b/result_prior/3d_structures/de/without_labels/molecule_0104.html new file mode 100644 index 0000000000000000000000000000000000000000..aaef121683dc7d38ff8074f791d18a236238a429 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0104.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0105.html b/result_prior/3d_structures/de/without_labels/molecule_0105.html new file mode 100644 index 0000000000000000000000000000000000000000..53470d0a10eac5ba9e302f2b398b072b54ec6424 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0105.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0106.html b/result_prior/3d_structures/de/without_labels/molecule_0106.html new file mode 100644 index 0000000000000000000000000000000000000000..380bace19f7e22ea049da8e13de9809fffa24202 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0106.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0107.html b/result_prior/3d_structures/de/without_labels/molecule_0107.html new file mode 100644 index 0000000000000000000000000000000000000000..af2777a8dc37c131bc334e06cfa9c7bb6186066f --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0107.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0108.html b/result_prior/3d_structures/de/without_labels/molecule_0108.html new file mode 100644 index 0000000000000000000000000000000000000000..a9729cfd0823fc1da424712bece6d87502a32325 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0108.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0109.html b/result_prior/3d_structures/de/without_labels/molecule_0109.html new file mode 100644 index 0000000000000000000000000000000000000000..a9b800f888959113141d8fa90bb37e3ba170b493 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0109.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0110.html b/result_prior/3d_structures/de/without_labels/molecule_0110.html new file mode 100644 index 0000000000000000000000000000000000000000..98fb635f9961d63d8dd100a604afb3c2c1e27973 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0110.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0111.html b/result_prior/3d_structures/de/without_labels/molecule_0111.html new file mode 100644 index 0000000000000000000000000000000000000000..2affc0ef1e506b3f13bed175cf312c7df3f1e466 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0111.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0112.html b/result_prior/3d_structures/de/without_labels/molecule_0112.html new file mode 100644 index 0000000000000000000000000000000000000000..694783b6902e61e9f23a90277a27da3404fc7111 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0112.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/de/without_labels/molecule_0113.html b/result_prior/3d_structures/de/without_labels/molecule_0113.html new file mode 100644 index 0000000000000000000000000000000000000000..3df136cdf9ae084362dc07431433e4d08b819452 --- /dev/null +++ b/result_prior/3d_structures/de/without_labels/molecule_0113.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0001.html b/result_prior/3d_structures/hu/with_labels/molecule_0001.html new file mode 100644 index 0000000000000000000000000000000000000000..85f38e3150d8d24aa87318427c7ccfa6f1dbd382 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0001.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0002.html b/result_prior/3d_structures/hu/with_labels/molecule_0002.html new file mode 100644 index 0000000000000000000000000000000000000000..d3ef90779b42fbe894756e10bd615900680c8cc0 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0002.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0003.html b/result_prior/3d_structures/hu/with_labels/molecule_0003.html new file mode 100644 index 0000000000000000000000000000000000000000..12bb6bee91f7fe4da9a06767af4e6a812c4ea740 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0003.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0004.html b/result_prior/3d_structures/hu/with_labels/molecule_0004.html new file mode 100644 index 0000000000000000000000000000000000000000..cc36043eafbc68f93f0818e5b11dd542f3d14bed --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0004.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0005.html b/result_prior/3d_structures/hu/with_labels/molecule_0005.html new file mode 100644 index 0000000000000000000000000000000000000000..3a6f9e28b3b6b273b26f0768911a7e2af2b98fdd --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0005.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0006.html b/result_prior/3d_structures/hu/with_labels/molecule_0006.html new file mode 100644 index 0000000000000000000000000000000000000000..67900d342fd8f35670531c60296d859e3b626547 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0006.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0007.html b/result_prior/3d_structures/hu/with_labels/molecule_0007.html new file mode 100644 index 0000000000000000000000000000000000000000..5f4c9eb48c19f65b3e2c355a6cb6e2c72a9fe513 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0007.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0008.html b/result_prior/3d_structures/hu/with_labels/molecule_0008.html new file mode 100644 index 0000000000000000000000000000000000000000..845e70addd11802cfdf6a3abe6e73a06a5819aab --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0008.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0009.html b/result_prior/3d_structures/hu/with_labels/molecule_0009.html new file mode 100644 index 0000000000000000000000000000000000000000..df8e52ea0d990b60dfc34ca84d57e243fddbd8f7 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0009.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0010.html b/result_prior/3d_structures/hu/with_labels/molecule_0010.html new file mode 100644 index 0000000000000000000000000000000000000000..ff27e4c0480c9b78ac07193c7e66d0a66b62cc5e --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0010.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0011.html b/result_prior/3d_structures/hu/with_labels/molecule_0011.html new file mode 100644 index 0000000000000000000000000000000000000000..cfa3c539e93a761faa87ee44f2b662c246739cfa --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0011.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0012.html b/result_prior/3d_structures/hu/with_labels/molecule_0012.html new file mode 100644 index 0000000000000000000000000000000000000000..d397452d6cc21feba8b7e91c4ce895320935c583 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0012.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0013.html b/result_prior/3d_structures/hu/with_labels/molecule_0013.html new file mode 100644 index 0000000000000000000000000000000000000000..4b6dbc95e187da029fa9efb8f05b62a6ef1afe6c --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0013.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0014.html b/result_prior/3d_structures/hu/with_labels/molecule_0014.html new file mode 100644 index 0000000000000000000000000000000000000000..769f539acd10f2d226c803c1e2cf2849cc8a14e2 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0014.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0015.html b/result_prior/3d_structures/hu/with_labels/molecule_0015.html new file mode 100644 index 0000000000000000000000000000000000000000..8ec905c990a73938f2864a66cced80cc86bd797b --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0015.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0016.html b/result_prior/3d_structures/hu/with_labels/molecule_0016.html new file mode 100644 index 0000000000000000000000000000000000000000..426bcadc54483e5cc7ce1fecee2e1b88667c9009 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0016.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0017.html b/result_prior/3d_structures/hu/with_labels/molecule_0017.html new file mode 100644 index 0000000000000000000000000000000000000000..d7855152e82f05ec942c0ea9549b1755dde23390 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0017.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0018.html b/result_prior/3d_structures/hu/with_labels/molecule_0018.html new file mode 100644 index 0000000000000000000000000000000000000000..d4791df990505359bf6dfef029484e4b3c578caf --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0018.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0019.html b/result_prior/3d_structures/hu/with_labels/molecule_0019.html new file mode 100644 index 0000000000000000000000000000000000000000..1ce55ad2c3c945bb7a79c2aa0364d741a9314bab --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0019.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0020.html b/result_prior/3d_structures/hu/with_labels/molecule_0020.html new file mode 100644 index 0000000000000000000000000000000000000000..573a3641de8bee52c1feb4117ba75bf205744c96 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0020.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0021.html b/result_prior/3d_structures/hu/with_labels/molecule_0021.html new file mode 100644 index 0000000000000000000000000000000000000000..f24e5ccf7dd876271e7651b6a2c5bb0b68129781 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0021.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0022.html b/result_prior/3d_structures/hu/with_labels/molecule_0022.html new file mode 100644 index 0000000000000000000000000000000000000000..a3f018501434f89454c9d614d3e652981faaf26f --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0022.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0023.html b/result_prior/3d_structures/hu/with_labels/molecule_0023.html new file mode 100644 index 0000000000000000000000000000000000000000..e016973a8fd493edd4848e0d593633a040ad59a7 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0023.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0024.html b/result_prior/3d_structures/hu/with_labels/molecule_0024.html new file mode 100644 index 0000000000000000000000000000000000000000..4e4e09ffa5491b8e75d0812a021edfbc9226e4cc --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0024.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0025.html b/result_prior/3d_structures/hu/with_labels/molecule_0025.html new file mode 100644 index 0000000000000000000000000000000000000000..de059fe633775c1867c81d5482ffe74b9acc12df --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0025.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0026.html b/result_prior/3d_structures/hu/with_labels/molecule_0026.html new file mode 100644 index 0000000000000000000000000000000000000000..3a928392cf49a62fd381b8956643a4562e02bc02 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0026.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0027.html b/result_prior/3d_structures/hu/with_labels/molecule_0027.html new file mode 100644 index 0000000000000000000000000000000000000000..c2099108e32adced60b38c19bf855ab3a2c92c56 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0027.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0028.html b/result_prior/3d_structures/hu/with_labels/molecule_0028.html new file mode 100644 index 0000000000000000000000000000000000000000..de158e7700a96ea20e159e8d524c4bcdb6f45983 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0028.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0029.html b/result_prior/3d_structures/hu/with_labels/molecule_0029.html new file mode 100644 index 0000000000000000000000000000000000000000..ac24fb4a17c4a58daac51849037b64b83d6afaf5 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0029.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0030.html b/result_prior/3d_structures/hu/with_labels/molecule_0030.html new file mode 100644 index 0000000000000000000000000000000000000000..bfaabe0bf820c9ee7432c81d7aa2d8dd803acdb9 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0030.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0031.html b/result_prior/3d_structures/hu/with_labels/molecule_0031.html new file mode 100644 index 0000000000000000000000000000000000000000..c92325f8b404e34d4a5607ca9beac275af2ee0b4 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0031.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0032.html b/result_prior/3d_structures/hu/with_labels/molecule_0032.html new file mode 100644 index 0000000000000000000000000000000000000000..99015429a782c50e0345285a3cda5f5800b31fb8 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0032.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0033.html b/result_prior/3d_structures/hu/with_labels/molecule_0033.html new file mode 100644 index 0000000000000000000000000000000000000000..91b88010e839f035452bddb050e58f8be4632243 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0033.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0034.html b/result_prior/3d_structures/hu/with_labels/molecule_0034.html new file mode 100644 index 0000000000000000000000000000000000000000..288af691c82f0f4860699cbb4214c91c1744a668 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0034.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0035.html b/result_prior/3d_structures/hu/with_labels/molecule_0035.html new file mode 100644 index 0000000000000000000000000000000000000000..77594cd739cde8d67d62d4e8d4f8a54beadd9076 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0035.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0036.html b/result_prior/3d_structures/hu/with_labels/molecule_0036.html new file mode 100644 index 0000000000000000000000000000000000000000..17e33d4d3c81f6a6bccd59efc7ca671096237f10 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0036.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0037.html b/result_prior/3d_structures/hu/with_labels/molecule_0037.html new file mode 100644 index 0000000000000000000000000000000000000000..f9f4d75c40119a59444927688c8d0f4520755f22 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0037.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0038.html b/result_prior/3d_structures/hu/with_labels/molecule_0038.html new file mode 100644 index 0000000000000000000000000000000000000000..eedfc40e12ba44476b3932d6aa38fd995bb60dfd --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0038.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0039.html b/result_prior/3d_structures/hu/with_labels/molecule_0039.html new file mode 100644 index 0000000000000000000000000000000000000000..f56da2bae4d296f856fdde70d055021aacbee248 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0039.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0040.html b/result_prior/3d_structures/hu/with_labels/molecule_0040.html new file mode 100644 index 0000000000000000000000000000000000000000..68b8417b006d553bb80f32e6e53e433f5c944ee9 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0040.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0041.html b/result_prior/3d_structures/hu/with_labels/molecule_0041.html new file mode 100644 index 0000000000000000000000000000000000000000..b7adcea3007b6e1276056f127e4767535d6665b0 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0041.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0042.html b/result_prior/3d_structures/hu/with_labels/molecule_0042.html new file mode 100644 index 0000000000000000000000000000000000000000..45cd3e8c452f2015c8b82829381799e03a8a8131 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0042.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0043.html b/result_prior/3d_structures/hu/with_labels/molecule_0043.html new file mode 100644 index 0000000000000000000000000000000000000000..fbfef214dc62f0b2965d3860381b8ad90ccd4240 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0043.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0044.html b/result_prior/3d_structures/hu/with_labels/molecule_0044.html new file mode 100644 index 0000000000000000000000000000000000000000..8bc8421d57aad096b5fca643b3b94efc1294150b --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0044.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0045.html b/result_prior/3d_structures/hu/with_labels/molecule_0045.html new file mode 100644 index 0000000000000000000000000000000000000000..77a95f3157e4dd6af7ebf04f55f5fb75b9c55e86 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0045.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0046.html b/result_prior/3d_structures/hu/with_labels/molecule_0046.html new file mode 100644 index 0000000000000000000000000000000000000000..313eb34417b5b1827987fab920b757ca4192525a --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0046.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0047.html b/result_prior/3d_structures/hu/with_labels/molecule_0047.html new file mode 100644 index 0000000000000000000000000000000000000000..11d27ff8822f7160803d1715a512552f6bf94b51 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0047.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0048.html b/result_prior/3d_structures/hu/with_labels/molecule_0048.html new file mode 100644 index 0000000000000000000000000000000000000000..127e306fc305d18c70060ef323077f520ff54b5a --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0048.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0049.html b/result_prior/3d_structures/hu/with_labels/molecule_0049.html new file mode 100644 index 0000000000000000000000000000000000000000..e3c22416679b57b8ee0bc2e8798b11697e7af2e5 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0049.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0050.html b/result_prior/3d_structures/hu/with_labels/molecule_0050.html new file mode 100644 index 0000000000000000000000000000000000000000..cca0e117eec03b8cf9f2ccb876b1fc43a2f10ad4 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0050.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0051.html b/result_prior/3d_structures/hu/with_labels/molecule_0051.html new file mode 100644 index 0000000000000000000000000000000000000000..7ae4f2329926f56a05f653e9913314f37cccb0e6 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0051.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0052.html b/result_prior/3d_structures/hu/with_labels/molecule_0052.html new file mode 100644 index 0000000000000000000000000000000000000000..fda0e3d792113e65f803796fe054cadfe8cb92b2 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0052.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0053.html b/result_prior/3d_structures/hu/with_labels/molecule_0053.html new file mode 100644 index 0000000000000000000000000000000000000000..b3e563a29b8daec6098b1452fde842a9a83a3c00 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0053.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0054.html b/result_prior/3d_structures/hu/with_labels/molecule_0054.html new file mode 100644 index 0000000000000000000000000000000000000000..f74bf790a20c587b539be6f2458f1d828d2bd731 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0054.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0055.html b/result_prior/3d_structures/hu/with_labels/molecule_0055.html new file mode 100644 index 0000000000000000000000000000000000000000..88c0a3e8ca3bf027632807a52a50f2f7d73604e5 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0055.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0056.html b/result_prior/3d_structures/hu/with_labels/molecule_0056.html new file mode 100644 index 0000000000000000000000000000000000000000..3f4c21ac611fcff5560bb1ec3fb3701fb47b01bf --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0056.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0057.html b/result_prior/3d_structures/hu/with_labels/molecule_0057.html new file mode 100644 index 0000000000000000000000000000000000000000..c914389cbf39c4b612dd4ff0b4001c02cce92ff2 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0057.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0058.html b/result_prior/3d_structures/hu/with_labels/molecule_0058.html new file mode 100644 index 0000000000000000000000000000000000000000..920bb050e11b72d3db0feeba14e20e1259f19edc --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0058.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0059.html b/result_prior/3d_structures/hu/with_labels/molecule_0059.html new file mode 100644 index 0000000000000000000000000000000000000000..1ee8f461ee9a1548db414b424f41eb1484527349 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0059.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0060.html b/result_prior/3d_structures/hu/with_labels/molecule_0060.html new file mode 100644 index 0000000000000000000000000000000000000000..79143ba3e13b420c40f4626f007bf22d8ffd6476 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0060.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0061.html b/result_prior/3d_structures/hu/with_labels/molecule_0061.html new file mode 100644 index 0000000000000000000000000000000000000000..1f41fbcd3e00f93225e176e7ea1ead4ff22782cc --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0061.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0062.html b/result_prior/3d_structures/hu/with_labels/molecule_0062.html new file mode 100644 index 0000000000000000000000000000000000000000..cf05d3b616dd7703924b528a1c135f04ff0a6b46 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0062.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0063.html b/result_prior/3d_structures/hu/with_labels/molecule_0063.html new file mode 100644 index 0000000000000000000000000000000000000000..ca14a3c0dcb14a760ef927b6b0812ccbf962ca8b --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0063.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0064.html b/result_prior/3d_structures/hu/with_labels/molecule_0064.html new file mode 100644 index 0000000000000000000000000000000000000000..cf1e298035bc71982a781b05f8c554877673f1d9 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0064.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0065.html b/result_prior/3d_structures/hu/with_labels/molecule_0065.html new file mode 100644 index 0000000000000000000000000000000000000000..aab4b10bdf14b8a0b12bf6ba2c043ec1b3491589 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0065.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0066.html b/result_prior/3d_structures/hu/with_labels/molecule_0066.html new file mode 100644 index 0000000000000000000000000000000000000000..c22060b75f0c1569b3e0faeae6016c6247f0f8df --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0066.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0067.html b/result_prior/3d_structures/hu/with_labels/molecule_0067.html new file mode 100644 index 0000000000000000000000000000000000000000..070824052485989c3e5104e109322291d8f2e69a --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0067.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0068.html b/result_prior/3d_structures/hu/with_labels/molecule_0068.html new file mode 100644 index 0000000000000000000000000000000000000000..a4eda0ffa498700f7c101bcc5fad90c9af5e1204 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0068.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0069.html b/result_prior/3d_structures/hu/with_labels/molecule_0069.html new file mode 100644 index 0000000000000000000000000000000000000000..c605f33c1ec5c06c73f5a8963ec66995dedb1839 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0069.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0070.html b/result_prior/3d_structures/hu/with_labels/molecule_0070.html new file mode 100644 index 0000000000000000000000000000000000000000..c19231eec8960d9e85835c8f6defef14c3816c3f --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0070.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0071.html b/result_prior/3d_structures/hu/with_labels/molecule_0071.html new file mode 100644 index 0000000000000000000000000000000000000000..0f2d1ce6f5d059c476eee69f293179ba39de74ef --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0071.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0072.html b/result_prior/3d_structures/hu/with_labels/molecule_0072.html new file mode 100644 index 0000000000000000000000000000000000000000..45f6cc09adaf6f2dd5cf3efee6f44645dc66040c --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0072.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0073.html b/result_prior/3d_structures/hu/with_labels/molecule_0073.html new file mode 100644 index 0000000000000000000000000000000000000000..f9ba1efa6493f64bcb5f3cda8c572ea243b34f04 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0073.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0074.html b/result_prior/3d_structures/hu/with_labels/molecule_0074.html new file mode 100644 index 0000000000000000000000000000000000000000..e19f546dc80c1ca9e9d006315b09624507324d61 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0074.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0075.html b/result_prior/3d_structures/hu/with_labels/molecule_0075.html new file mode 100644 index 0000000000000000000000000000000000000000..2591d1b9e73a08fc7a0c11df1bba5bce2c16f4a9 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0075.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0076.html b/result_prior/3d_structures/hu/with_labels/molecule_0076.html new file mode 100644 index 0000000000000000000000000000000000000000..bc55fe8b77968a8fab92092247b4be224ab851d2 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0076.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0077.html b/result_prior/3d_structures/hu/with_labels/molecule_0077.html new file mode 100644 index 0000000000000000000000000000000000000000..44f8b5002da5844b3330ef6f517b0cd4cef20416 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0077.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0078.html b/result_prior/3d_structures/hu/with_labels/molecule_0078.html new file mode 100644 index 0000000000000000000000000000000000000000..0a137d60cd5a0e5ca2c1358bd19d78298ca71a02 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0078.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0079.html b/result_prior/3d_structures/hu/with_labels/molecule_0079.html new file mode 100644 index 0000000000000000000000000000000000000000..fdc8e2c4215e02f81bce95bbd7e5f34f679a4645 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0079.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0080.html b/result_prior/3d_structures/hu/with_labels/molecule_0080.html new file mode 100644 index 0000000000000000000000000000000000000000..89ab5ece313f5b7a890407bb5cdaac50c755143f --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0080.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0081.html b/result_prior/3d_structures/hu/with_labels/molecule_0081.html new file mode 100644 index 0000000000000000000000000000000000000000..27a27cf997f31a3f5127816e8b3fcf9d425e542e --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0081.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0082.html b/result_prior/3d_structures/hu/with_labels/molecule_0082.html new file mode 100644 index 0000000000000000000000000000000000000000..8cfbe33aa92a31f05fc9c7533b416f3e75ee1f99 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0082.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0083.html b/result_prior/3d_structures/hu/with_labels/molecule_0083.html new file mode 100644 index 0000000000000000000000000000000000000000..4f373ba4aa8e54b71ebaad802fa1852009c620ce --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0083.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0084.html b/result_prior/3d_structures/hu/with_labels/molecule_0084.html new file mode 100644 index 0000000000000000000000000000000000000000..462e398aaa1bcd3f3370404f4beb9b3745bf2852 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0084.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0085.html b/result_prior/3d_structures/hu/with_labels/molecule_0085.html new file mode 100644 index 0000000000000000000000000000000000000000..285df9a465823365138378772d0af1cc76c574fd --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0085.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0086.html b/result_prior/3d_structures/hu/with_labels/molecule_0086.html new file mode 100644 index 0000000000000000000000000000000000000000..26768a1a9c9d79aafc699ef4d31c8f8ccbdd85d4 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0086.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0087.html b/result_prior/3d_structures/hu/with_labels/molecule_0087.html new file mode 100644 index 0000000000000000000000000000000000000000..b1936d1dbddb2bd5bd418400e424a7483e3be122 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0087.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0088.html b/result_prior/3d_structures/hu/with_labels/molecule_0088.html new file mode 100644 index 0000000000000000000000000000000000000000..c61116a49582efa15c0c312cc0ceb66e5726a3b6 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0088.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0089.html b/result_prior/3d_structures/hu/with_labels/molecule_0089.html new file mode 100644 index 0000000000000000000000000000000000000000..6966604e44a74d34654b0be99fe1f8eecc8d1834 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0089.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0090.html b/result_prior/3d_structures/hu/with_labels/molecule_0090.html new file mode 100644 index 0000000000000000000000000000000000000000..f427684000bc298470da70432d05c37cd84be3e4 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0090.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0091.html b/result_prior/3d_structures/hu/with_labels/molecule_0091.html new file mode 100644 index 0000000000000000000000000000000000000000..88617e7caf6e93cd4cdf876be01f17f607125118 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0091.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0092.html b/result_prior/3d_structures/hu/with_labels/molecule_0092.html new file mode 100644 index 0000000000000000000000000000000000000000..e56a868974a178ae7ac934ec9c2e3849ee8dc78c --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0092.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0093.html b/result_prior/3d_structures/hu/with_labels/molecule_0093.html new file mode 100644 index 0000000000000000000000000000000000000000..0ecb7cc6f5a50efb009490c85288151f91c7a4db --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0093.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0094.html b/result_prior/3d_structures/hu/with_labels/molecule_0094.html new file mode 100644 index 0000000000000000000000000000000000000000..e648d9c0fdf75f68bce8e568d72edc4f75348a2a --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0094.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0095.html b/result_prior/3d_structures/hu/with_labels/molecule_0095.html new file mode 100644 index 0000000000000000000000000000000000000000..66b604fc26564c045934b8fcc334418ac0760bae --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0095.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0096.html b/result_prior/3d_structures/hu/with_labels/molecule_0096.html new file mode 100644 index 0000000000000000000000000000000000000000..ade1eeb130e2f665a5d2a2ba7ccc0a68e428a528 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0096.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0097.html b/result_prior/3d_structures/hu/with_labels/molecule_0097.html new file mode 100644 index 0000000000000000000000000000000000000000..581a1afcedfec464a2243fcd1c009df4a9374d4f --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0097.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0098.html b/result_prior/3d_structures/hu/with_labels/molecule_0098.html new file mode 100644 index 0000000000000000000000000000000000000000..a34f83ca8d02c0aff94fd9fed5eb06203615eb79 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0098.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0099.html b/result_prior/3d_structures/hu/with_labels/molecule_0099.html new file mode 100644 index 0000000000000000000000000000000000000000..9ff6c3938a18d53808313e7711b4762f97daf03d --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0099.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0100.html b/result_prior/3d_structures/hu/with_labels/molecule_0100.html new file mode 100644 index 0000000000000000000000000000000000000000..cee9900c9fbd25982ea47438764a170464b69ec7 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0100.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0101.html b/result_prior/3d_structures/hu/with_labels/molecule_0101.html new file mode 100644 index 0000000000000000000000000000000000000000..2dce859b6778111dc61c305b4749ba8728ab46b0 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0101.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0102.html b/result_prior/3d_structures/hu/with_labels/molecule_0102.html new file mode 100644 index 0000000000000000000000000000000000000000..ef1ceb68f79f20b7d9dd6c294fe25940a4ffb2a1 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0102.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0103.html b/result_prior/3d_structures/hu/with_labels/molecule_0103.html new file mode 100644 index 0000000000000000000000000000000000000000..1bc6efdb698a88a3300ed90ae1e907ad10dfacd7 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0103.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0104.html b/result_prior/3d_structures/hu/with_labels/molecule_0104.html new file mode 100644 index 0000000000000000000000000000000000000000..9b9d1cdd64913c5329a07d10c6e765fdd6fef869 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0104.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0105.html b/result_prior/3d_structures/hu/with_labels/molecule_0105.html new file mode 100644 index 0000000000000000000000000000000000000000..93d270e3c55cd07f5ef3389cf568315803cde05d --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0105.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0106.html b/result_prior/3d_structures/hu/with_labels/molecule_0106.html new file mode 100644 index 0000000000000000000000000000000000000000..2fea9198a7ee6ce003c249f676742e2e8f9184ff --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0106.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0107.html b/result_prior/3d_structures/hu/with_labels/molecule_0107.html new file mode 100644 index 0000000000000000000000000000000000000000..9156b435f8fe7871f45f4cf1e79518006f4b1806 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0107.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0108.html b/result_prior/3d_structures/hu/with_labels/molecule_0108.html new file mode 100644 index 0000000000000000000000000000000000000000..1db6eb049852ee8df5065c3c1b3ffa33691a2096 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0108.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0109.html b/result_prior/3d_structures/hu/with_labels/molecule_0109.html new file mode 100644 index 0000000000000000000000000000000000000000..c0343b866eda5a2be698987f78807e07f6509984 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0109.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0110.html b/result_prior/3d_structures/hu/with_labels/molecule_0110.html new file mode 100644 index 0000000000000000000000000000000000000000..c49c4a7487e26601a4ffecc5c88fac38a481e06c --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0110.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0111.html b/result_prior/3d_structures/hu/with_labels/molecule_0111.html new file mode 100644 index 0000000000000000000000000000000000000000..b55dbf6498ee24ce0d4e78475b3a1321d6f3810b --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0111.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0112.html b/result_prior/3d_structures/hu/with_labels/molecule_0112.html new file mode 100644 index 0000000000000000000000000000000000000000..5fac895f55dfd43badd8090b25eaf25404f905c5 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0112.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0113.html b/result_prior/3d_structures/hu/with_labels/molecule_0113.html new file mode 100644 index 0000000000000000000000000000000000000000..87e7b5530c920fee6fa64f05b89e6584210a3f7a --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0113.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0114.html b/result_prior/3d_structures/hu/with_labels/molecule_0114.html new file mode 100644 index 0000000000000000000000000000000000000000..7302cb9e3e3afce99d3e341b4e89d8c5ca929a5b --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0114.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0115.html b/result_prior/3d_structures/hu/with_labels/molecule_0115.html new file mode 100644 index 0000000000000000000000000000000000000000..14f8a7bd73431434451e8f7b673cf2316e4f9305 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0115.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0116.html b/result_prior/3d_structures/hu/with_labels/molecule_0116.html new file mode 100644 index 0000000000000000000000000000000000000000..c36e9c77f0db6de1c656bb89e06df33abf0f1dba --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0116.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0117.html b/result_prior/3d_structures/hu/with_labels/molecule_0117.html new file mode 100644 index 0000000000000000000000000000000000000000..97bb507ced6a8e5d428b7e462a77d2a7181782e5 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0117.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0118.html b/result_prior/3d_structures/hu/with_labels/molecule_0118.html new file mode 100644 index 0000000000000000000000000000000000000000..35283d68e4e804f11e1c8bddbd44889b3a9c8dab --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0118.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0119.html b/result_prior/3d_structures/hu/with_labels/molecule_0119.html new file mode 100644 index 0000000000000000000000000000000000000000..6831a9f24b5afee51cb59d54bc17ff73fcfef2ac --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0119.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0120.html b/result_prior/3d_structures/hu/with_labels/molecule_0120.html new file mode 100644 index 0000000000000000000000000000000000000000..1f1cec9cc84a8833e6f0fdf93c49c72d1ea90212 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0120.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0121.html b/result_prior/3d_structures/hu/with_labels/molecule_0121.html new file mode 100644 index 0000000000000000000000000000000000000000..cee7b5eb890ed0c95fc6202d21cf02bb9fd6dd59 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0121.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0122.html b/result_prior/3d_structures/hu/with_labels/molecule_0122.html new file mode 100644 index 0000000000000000000000000000000000000000..967cdcb5e2c70511d1fb462664199927d752a350 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0122.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0123.html b/result_prior/3d_structures/hu/with_labels/molecule_0123.html new file mode 100644 index 0000000000000000000000000000000000000000..b4c4e95163bfbe7a0d800501b1a20db756cfb48a --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0123.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0124.html b/result_prior/3d_structures/hu/with_labels/molecule_0124.html new file mode 100644 index 0000000000000000000000000000000000000000..2dee06f93f883673b3d9e85655ff689017d8608a --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0124.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0125.html b/result_prior/3d_structures/hu/with_labels/molecule_0125.html new file mode 100644 index 0000000000000000000000000000000000000000..08d52ac7a50f3febdb759c729a87a8d92a0dd33f --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0125.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0126.html b/result_prior/3d_structures/hu/with_labels/molecule_0126.html new file mode 100644 index 0000000000000000000000000000000000000000..24149f1573696aa05cc7b31d5b00a08fe2c975a1 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0126.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0127.html b/result_prior/3d_structures/hu/with_labels/molecule_0127.html new file mode 100644 index 0000000000000000000000000000000000000000..303d4bd7ed296da27f886f0512bee6a4f9f8dfc1 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0127.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0128.html b/result_prior/3d_structures/hu/with_labels/molecule_0128.html new file mode 100644 index 0000000000000000000000000000000000000000..900cd35f21ba1ddc5638e724e83aaa4f25b4affe --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0128.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0129.html b/result_prior/3d_structures/hu/with_labels/molecule_0129.html new file mode 100644 index 0000000000000000000000000000000000000000..c302e8e47b5ff8ed4cdb052e9398c807b3fef786 --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0129.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/with_labels/molecule_0130.html b/result_prior/3d_structures/hu/with_labels/molecule_0130.html new file mode 100644 index 0000000000000000000000000000000000000000..66a4473ca2b0cce2a6476fa0c5791488ff6da13f --- /dev/null +++ b/result_prior/3d_structures/hu/with_labels/molecule_0130.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0001.html b/result_prior/3d_structures/hu/without_labels/molecule_0001.html new file mode 100644 index 0000000000000000000000000000000000000000..651cd5753d84623d24c52d63e9b8e61528268b5e --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0001.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0002.html b/result_prior/3d_structures/hu/without_labels/molecule_0002.html new file mode 100644 index 0000000000000000000000000000000000000000..144be1799c7f8523fa41b16ae2441f98d1770772 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0002.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0003.html b/result_prior/3d_structures/hu/without_labels/molecule_0003.html new file mode 100644 index 0000000000000000000000000000000000000000..07d2549dcc56968aa2b96c287c8421838351fc24 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0003.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0004.html b/result_prior/3d_structures/hu/without_labels/molecule_0004.html new file mode 100644 index 0000000000000000000000000000000000000000..e06375e8cad2f738dde8265c2143f628f0ea9b54 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0004.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0005.html b/result_prior/3d_structures/hu/without_labels/molecule_0005.html new file mode 100644 index 0000000000000000000000000000000000000000..f1ca5e0e1df12e363f6c58c6faf660c530ea1e95 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0005.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0006.html b/result_prior/3d_structures/hu/without_labels/molecule_0006.html new file mode 100644 index 0000000000000000000000000000000000000000..50257d8ddfa4528dabd216ac28fbf8f95029f042 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0006.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0007.html b/result_prior/3d_structures/hu/without_labels/molecule_0007.html new file mode 100644 index 0000000000000000000000000000000000000000..96708b917248503063a8709a77ba4400fcd6c800 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0007.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0008.html b/result_prior/3d_structures/hu/without_labels/molecule_0008.html new file mode 100644 index 0000000000000000000000000000000000000000..cd3399e816766a7405815a51e27a4f561bd1eb6c --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0008.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0009.html b/result_prior/3d_structures/hu/without_labels/molecule_0009.html new file mode 100644 index 0000000000000000000000000000000000000000..7463c95f7935b6311b49eb5f5efe4ef2309db2fc --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0009.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0010.html b/result_prior/3d_structures/hu/without_labels/molecule_0010.html new file mode 100644 index 0000000000000000000000000000000000000000..400c7990e9b9815ce44fc747a56ca4a64e2c6c5f --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0010.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0011.html b/result_prior/3d_structures/hu/without_labels/molecule_0011.html new file mode 100644 index 0000000000000000000000000000000000000000..de7eb838621452f1d8970a5c1845c5759a2ab97d --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0011.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0012.html b/result_prior/3d_structures/hu/without_labels/molecule_0012.html new file mode 100644 index 0000000000000000000000000000000000000000..68d96229cc02e1aa8c9b69840f517f51bfb0923f --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0012.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0013.html b/result_prior/3d_structures/hu/without_labels/molecule_0013.html new file mode 100644 index 0000000000000000000000000000000000000000..fb8c9a58208976ab50a818bfe719fdcf64637328 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0013.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0014.html b/result_prior/3d_structures/hu/without_labels/molecule_0014.html new file mode 100644 index 0000000000000000000000000000000000000000..0ac9fbedfcc632915acf9832fe6109cb0e5ad275 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0014.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0015.html b/result_prior/3d_structures/hu/without_labels/molecule_0015.html new file mode 100644 index 0000000000000000000000000000000000000000..7a584aaafa2444635ba46964e7b877299488144e --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0015.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0016.html b/result_prior/3d_structures/hu/without_labels/molecule_0016.html new file mode 100644 index 0000000000000000000000000000000000000000..77f80eefa464d90c14768edaf19ecad7c6b58e9b --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0016.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0017.html b/result_prior/3d_structures/hu/without_labels/molecule_0017.html new file mode 100644 index 0000000000000000000000000000000000000000..be86d1cf63f64ef4215f2a1273c14866829d3394 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0017.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0018.html b/result_prior/3d_structures/hu/without_labels/molecule_0018.html new file mode 100644 index 0000000000000000000000000000000000000000..46e2689e1d51cd8f7336060efde317d335366149 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0018.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0019.html b/result_prior/3d_structures/hu/without_labels/molecule_0019.html new file mode 100644 index 0000000000000000000000000000000000000000..6159e9a33d432bdc5f680f451553d9b5454cb8a6 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0019.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0020.html b/result_prior/3d_structures/hu/without_labels/molecule_0020.html new file mode 100644 index 0000000000000000000000000000000000000000..b87354751379ec825f6817674561da0d18bc9289 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0020.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0021.html b/result_prior/3d_structures/hu/without_labels/molecule_0021.html new file mode 100644 index 0000000000000000000000000000000000000000..e904139999157adf34775902db691b4dbafbb95e --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0021.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0022.html b/result_prior/3d_structures/hu/without_labels/molecule_0022.html new file mode 100644 index 0000000000000000000000000000000000000000..56518256d5c52256ad94f01582edfd10dba87726 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0022.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0023.html b/result_prior/3d_structures/hu/without_labels/molecule_0023.html new file mode 100644 index 0000000000000000000000000000000000000000..7692ad415163357ad415b17bd8781fd5f8ed751c --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0023.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0024.html b/result_prior/3d_structures/hu/without_labels/molecule_0024.html new file mode 100644 index 0000000000000000000000000000000000000000..a784dbaf1cbe51a81eb5871aff2594e234c430be --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0024.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0025.html b/result_prior/3d_structures/hu/without_labels/molecule_0025.html new file mode 100644 index 0000000000000000000000000000000000000000..73f5e9d6888c04d9a0da226f1852b5308a5e6ddb --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0025.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0026.html b/result_prior/3d_structures/hu/without_labels/molecule_0026.html new file mode 100644 index 0000000000000000000000000000000000000000..b4df65c7789d8c9fdb93126b2288e89b7c94895f --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0026.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0027.html b/result_prior/3d_structures/hu/without_labels/molecule_0027.html new file mode 100644 index 0000000000000000000000000000000000000000..03cf73449173cfa027ae23c0a27c8a266537899f --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0027.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0028.html b/result_prior/3d_structures/hu/without_labels/molecule_0028.html new file mode 100644 index 0000000000000000000000000000000000000000..cf499194961ce59fca6a7cd997e3094540aeec61 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0028.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0029.html b/result_prior/3d_structures/hu/without_labels/molecule_0029.html new file mode 100644 index 0000000000000000000000000000000000000000..505b6b54238a450fea71d372edcff58315a0f965 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0029.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0030.html b/result_prior/3d_structures/hu/without_labels/molecule_0030.html new file mode 100644 index 0000000000000000000000000000000000000000..3865c43e89d985343c9ba97b1739997a5255df42 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0030.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0031.html b/result_prior/3d_structures/hu/without_labels/molecule_0031.html new file mode 100644 index 0000000000000000000000000000000000000000..3cc101ca092527532bb7acff6b905eff2b1a459a --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0031.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0032.html b/result_prior/3d_structures/hu/without_labels/molecule_0032.html new file mode 100644 index 0000000000000000000000000000000000000000..d9aad7516abd46493848ed94ce010af285594a4f --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0032.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0033.html b/result_prior/3d_structures/hu/without_labels/molecule_0033.html new file mode 100644 index 0000000000000000000000000000000000000000..226b43b2015f0976eca50800ebee9739252d360d --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0033.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0034.html b/result_prior/3d_structures/hu/without_labels/molecule_0034.html new file mode 100644 index 0000000000000000000000000000000000000000..fd2c5277443e2165d90611f54e35d60eb0bb76f2 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0034.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0035.html b/result_prior/3d_structures/hu/without_labels/molecule_0035.html new file mode 100644 index 0000000000000000000000000000000000000000..dabe34417ac06a0126612af574f1f2f125fd5193 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0035.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0036.html b/result_prior/3d_structures/hu/without_labels/molecule_0036.html new file mode 100644 index 0000000000000000000000000000000000000000..2e8f34f8fc00046dd2fa8f7c72be5b47909b94b4 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0036.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0037.html b/result_prior/3d_structures/hu/without_labels/molecule_0037.html new file mode 100644 index 0000000000000000000000000000000000000000..bdc1c1e05561edb06858feebe2779f9437eb5d16 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0037.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0038.html b/result_prior/3d_structures/hu/without_labels/molecule_0038.html new file mode 100644 index 0000000000000000000000000000000000000000..fb1d994edd85af066eb088bf296944449b6cbbb0 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0038.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0039.html b/result_prior/3d_structures/hu/without_labels/molecule_0039.html new file mode 100644 index 0000000000000000000000000000000000000000..38afc38d14db2ccd80b489928ea033256f7d156c --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0039.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0040.html b/result_prior/3d_structures/hu/without_labels/molecule_0040.html new file mode 100644 index 0000000000000000000000000000000000000000..366cdf5f80a505edf6673482391a119070528ced --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0040.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0041.html b/result_prior/3d_structures/hu/without_labels/molecule_0041.html new file mode 100644 index 0000000000000000000000000000000000000000..56d536726b856ed81d8dc426d37d40491e453812 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0041.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0042.html b/result_prior/3d_structures/hu/without_labels/molecule_0042.html new file mode 100644 index 0000000000000000000000000000000000000000..5337c8e95a8dd7aaffc339df283b72f0f191e629 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0042.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0043.html b/result_prior/3d_structures/hu/without_labels/molecule_0043.html new file mode 100644 index 0000000000000000000000000000000000000000..956d315579544a7dbe0cab4c9efdacd0d0a09bf1 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0043.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0044.html b/result_prior/3d_structures/hu/without_labels/molecule_0044.html new file mode 100644 index 0000000000000000000000000000000000000000..aa111f24a50ee1fd5bc3f42d9b08274912d61c1c --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0044.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0045.html b/result_prior/3d_structures/hu/without_labels/molecule_0045.html new file mode 100644 index 0000000000000000000000000000000000000000..8fc60c40fd4f7877db1b704513b56675f57ef6c9 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0045.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0046.html b/result_prior/3d_structures/hu/without_labels/molecule_0046.html new file mode 100644 index 0000000000000000000000000000000000000000..8bc5520cd8baa4b38662c56db1f895fcc6e08618 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0046.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0047.html b/result_prior/3d_structures/hu/without_labels/molecule_0047.html new file mode 100644 index 0000000000000000000000000000000000000000..505da4f1b8d804e2f6932a3bc0397596a3e2bb55 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0047.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0048.html b/result_prior/3d_structures/hu/without_labels/molecule_0048.html new file mode 100644 index 0000000000000000000000000000000000000000..75b28edfb78a8a11ee5465917f575db887d92587 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0048.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0049.html b/result_prior/3d_structures/hu/without_labels/molecule_0049.html new file mode 100644 index 0000000000000000000000000000000000000000..8f756ae64c477f9181ec93cdf3d52965444871d3 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0049.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0050.html b/result_prior/3d_structures/hu/without_labels/molecule_0050.html new file mode 100644 index 0000000000000000000000000000000000000000..62e6981a058feabe36f8c51e38d80fb6c2399576 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0050.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0051.html b/result_prior/3d_structures/hu/without_labels/molecule_0051.html new file mode 100644 index 0000000000000000000000000000000000000000..f49408e0ba6d87dba5e91fd826d3429e6506e6b8 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0051.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0052.html b/result_prior/3d_structures/hu/without_labels/molecule_0052.html new file mode 100644 index 0000000000000000000000000000000000000000..3ed0c2a28f304d90e951a8f0411732c1a9ffb959 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0052.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0053.html b/result_prior/3d_structures/hu/without_labels/molecule_0053.html new file mode 100644 index 0000000000000000000000000000000000000000..ab4214551576b577215c5f82bc923456cae12f35 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0053.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0054.html b/result_prior/3d_structures/hu/without_labels/molecule_0054.html new file mode 100644 index 0000000000000000000000000000000000000000..63e891d437d3145cf050b56e03a202de724fbe3d --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0054.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0055.html b/result_prior/3d_structures/hu/without_labels/molecule_0055.html new file mode 100644 index 0000000000000000000000000000000000000000..fa5e29e6d3891bb0a5a3adb83afeb22229e3fd24 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0055.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0056.html b/result_prior/3d_structures/hu/without_labels/molecule_0056.html new file mode 100644 index 0000000000000000000000000000000000000000..67cf2eb8b747dd486c9a024699872b0ce688ac1c --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0056.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0057.html b/result_prior/3d_structures/hu/without_labels/molecule_0057.html new file mode 100644 index 0000000000000000000000000000000000000000..e8f23311b97079f4f8fba0ef6226f85d720be9b9 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0057.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0058.html b/result_prior/3d_structures/hu/without_labels/molecule_0058.html new file mode 100644 index 0000000000000000000000000000000000000000..32336824a1afd4588478030ff90fbb4b09d0348f --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0058.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0059.html b/result_prior/3d_structures/hu/without_labels/molecule_0059.html new file mode 100644 index 0000000000000000000000000000000000000000..aaf49bc7be99a68688af69c745a2f83cacda9e0f --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0059.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0060.html b/result_prior/3d_structures/hu/without_labels/molecule_0060.html new file mode 100644 index 0000000000000000000000000000000000000000..f6f5bc01092dac870c04676b82c961d2456d7d71 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0060.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0061.html b/result_prior/3d_structures/hu/without_labels/molecule_0061.html new file mode 100644 index 0000000000000000000000000000000000000000..602ffeaea45f99631fc7c284667181f267df3f4f --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0061.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0062.html b/result_prior/3d_structures/hu/without_labels/molecule_0062.html new file mode 100644 index 0000000000000000000000000000000000000000..3cf128bb9dbcd92b45caa37fcb2b59accfc82e2a --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0062.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0063.html b/result_prior/3d_structures/hu/without_labels/molecule_0063.html new file mode 100644 index 0000000000000000000000000000000000000000..b79686acfcf715f79dbc09d2d56ad302ae5e6af0 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0063.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0064.html b/result_prior/3d_structures/hu/without_labels/molecule_0064.html new file mode 100644 index 0000000000000000000000000000000000000000..c9715fb45311ea6cc6632825e14a3b871cde31a3 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0064.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0065.html b/result_prior/3d_structures/hu/without_labels/molecule_0065.html new file mode 100644 index 0000000000000000000000000000000000000000..fb958f56cc88c529288e33de3d7e7bb4384dc3ec --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0065.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0066.html b/result_prior/3d_structures/hu/without_labels/molecule_0066.html new file mode 100644 index 0000000000000000000000000000000000000000..b73e400d638ae4116c00934a286f80bca2778ae2 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0066.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0067.html b/result_prior/3d_structures/hu/without_labels/molecule_0067.html new file mode 100644 index 0000000000000000000000000000000000000000..2976736ccddc0baddb2a09b046a15bef0e2fb064 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0067.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0068.html b/result_prior/3d_structures/hu/without_labels/molecule_0068.html new file mode 100644 index 0000000000000000000000000000000000000000..983ce869cc47f3da590041c70235ac456e3c733e --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0068.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0069.html b/result_prior/3d_structures/hu/without_labels/molecule_0069.html new file mode 100644 index 0000000000000000000000000000000000000000..9b0249f12d234710a1ce2cf1cf8e922f1b4067b8 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0069.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0070.html b/result_prior/3d_structures/hu/without_labels/molecule_0070.html new file mode 100644 index 0000000000000000000000000000000000000000..659502beacb15dc4cd49fb65b6397feb9673d371 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0070.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0071.html b/result_prior/3d_structures/hu/without_labels/molecule_0071.html new file mode 100644 index 0000000000000000000000000000000000000000..fea467e838d8ba27c64811314e951c5883690b0f --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0071.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0072.html b/result_prior/3d_structures/hu/without_labels/molecule_0072.html new file mode 100644 index 0000000000000000000000000000000000000000..b29bbf474d3d83b0939571bd7eed78cc91a02b23 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0072.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0073.html b/result_prior/3d_structures/hu/without_labels/molecule_0073.html new file mode 100644 index 0000000000000000000000000000000000000000..f91cc5256736a818c8a3819ad5e87743dc7638fc --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0073.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0074.html b/result_prior/3d_structures/hu/without_labels/molecule_0074.html new file mode 100644 index 0000000000000000000000000000000000000000..ba6a9416ec14217d2811ef503ba337e742c67535 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0074.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0075.html b/result_prior/3d_structures/hu/without_labels/molecule_0075.html new file mode 100644 index 0000000000000000000000000000000000000000..1991dfa14120caa82bbb5cd3f0972931b3a0392c --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0075.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0076.html b/result_prior/3d_structures/hu/without_labels/molecule_0076.html new file mode 100644 index 0000000000000000000000000000000000000000..5d9ded2ae1d002f797e3ba151b3232072c606d89 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0076.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0077.html b/result_prior/3d_structures/hu/without_labels/molecule_0077.html new file mode 100644 index 0000000000000000000000000000000000000000..23f06064476e2165ee1a9faa5564f116f5ffd6ee --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0077.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0078.html b/result_prior/3d_structures/hu/without_labels/molecule_0078.html new file mode 100644 index 0000000000000000000000000000000000000000..0ac749ba6350702b62ab64f3b4b6199ac81d2df0 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0078.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0079.html b/result_prior/3d_structures/hu/without_labels/molecule_0079.html new file mode 100644 index 0000000000000000000000000000000000000000..d62a8536ff883fb2eb10f5bc361a9555f40c7fc1 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0079.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0080.html b/result_prior/3d_structures/hu/without_labels/molecule_0080.html new file mode 100644 index 0000000000000000000000000000000000000000..281e65882108b5f785211ae63582906eec8b5b93 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0080.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0081.html b/result_prior/3d_structures/hu/without_labels/molecule_0081.html new file mode 100644 index 0000000000000000000000000000000000000000..a74e26ad65a5c28c5ac2fb4db514c8e673a4da22 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0081.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0082.html b/result_prior/3d_structures/hu/without_labels/molecule_0082.html new file mode 100644 index 0000000000000000000000000000000000000000..bc20a488473611cdf5ecb7a98ba5349d908d2691 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0082.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0083.html b/result_prior/3d_structures/hu/without_labels/molecule_0083.html new file mode 100644 index 0000000000000000000000000000000000000000..2abef85c4a87b971684a48a536d3d52873575124 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0083.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0084.html b/result_prior/3d_structures/hu/without_labels/molecule_0084.html new file mode 100644 index 0000000000000000000000000000000000000000..03c4c637c167fb6573705cd245111c7ee2179613 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0084.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0085.html b/result_prior/3d_structures/hu/without_labels/molecule_0085.html new file mode 100644 index 0000000000000000000000000000000000000000..b9c3cacffdbc68a83e72612f0c68d318d73b1f94 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0085.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0086.html b/result_prior/3d_structures/hu/without_labels/molecule_0086.html new file mode 100644 index 0000000000000000000000000000000000000000..9dcc8a3af6cd921d1cbe4394368569f58a6152d7 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0086.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0087.html b/result_prior/3d_structures/hu/without_labels/molecule_0087.html new file mode 100644 index 0000000000000000000000000000000000000000..3d6517b7a17303c63572f7d1febdb2f4ae70dc2b --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0087.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0088.html b/result_prior/3d_structures/hu/without_labels/molecule_0088.html new file mode 100644 index 0000000000000000000000000000000000000000..bbcb4e652e9c5905d0cc21cb34eecf597f8a723b --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0088.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0089.html b/result_prior/3d_structures/hu/without_labels/molecule_0089.html new file mode 100644 index 0000000000000000000000000000000000000000..37005b2037c122243af9491b553d426c8e1fcbc4 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0089.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0090.html b/result_prior/3d_structures/hu/without_labels/molecule_0090.html new file mode 100644 index 0000000000000000000000000000000000000000..bfc6f8f6e7ca2bcebac22158491f09377658a394 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0090.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0091.html b/result_prior/3d_structures/hu/without_labels/molecule_0091.html new file mode 100644 index 0000000000000000000000000000000000000000..5805bc75407d2bd515e9c690d7f0e24799219a2d --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0091.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0092.html b/result_prior/3d_structures/hu/without_labels/molecule_0092.html new file mode 100644 index 0000000000000000000000000000000000000000..52484ca1a9e60b11f6ba28a30bdcae5472c7f979 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0092.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0093.html b/result_prior/3d_structures/hu/without_labels/molecule_0093.html new file mode 100644 index 0000000000000000000000000000000000000000..704146e3d083658096f0c68006c881cb18b8968b --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0093.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0094.html b/result_prior/3d_structures/hu/without_labels/molecule_0094.html new file mode 100644 index 0000000000000000000000000000000000000000..13ebfccb4cca1279b07f6f602cc431a14fd7c977 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0094.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0095.html b/result_prior/3d_structures/hu/without_labels/molecule_0095.html new file mode 100644 index 0000000000000000000000000000000000000000..cdff11391967ef415950cb1ae09353a71c06edc9 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0095.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0096.html b/result_prior/3d_structures/hu/without_labels/molecule_0096.html new file mode 100644 index 0000000000000000000000000000000000000000..90a9da002003c07af348ad489baf2f1d29b4578e --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0096.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0097.html b/result_prior/3d_structures/hu/without_labels/molecule_0097.html new file mode 100644 index 0000000000000000000000000000000000000000..44a88dc455c48238465b0f2cf675c7f5a2729b39 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0097.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0098.html b/result_prior/3d_structures/hu/without_labels/molecule_0098.html new file mode 100644 index 0000000000000000000000000000000000000000..5f100ff61621490b45107d33fc906532017ce7fc --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0098.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0099.html b/result_prior/3d_structures/hu/without_labels/molecule_0099.html new file mode 100644 index 0000000000000000000000000000000000000000..34bd093bd468dfa699078ed07cd99aea19feb9e5 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0099.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0100.html b/result_prior/3d_structures/hu/without_labels/molecule_0100.html new file mode 100644 index 0000000000000000000000000000000000000000..0398fbec02eaf052e731330321237e6aa8c209df --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0100.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0101.html b/result_prior/3d_structures/hu/without_labels/molecule_0101.html new file mode 100644 index 0000000000000000000000000000000000000000..a40995243f37710b3b3fd70ffdee186b033fd3aa --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0101.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0102.html b/result_prior/3d_structures/hu/without_labels/molecule_0102.html new file mode 100644 index 0000000000000000000000000000000000000000..fa0a85b80e4bc122c9a0a58d1482293328d0a1ee --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0102.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0103.html b/result_prior/3d_structures/hu/without_labels/molecule_0103.html new file mode 100644 index 0000000000000000000000000000000000000000..3aa0e2d8172299b8517733cdbadd51c29c3dfeb0 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0103.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0104.html b/result_prior/3d_structures/hu/without_labels/molecule_0104.html new file mode 100644 index 0000000000000000000000000000000000000000..867b65acae037f784dde2f9d9c80051cbcc6a284 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0104.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0105.html b/result_prior/3d_structures/hu/without_labels/molecule_0105.html new file mode 100644 index 0000000000000000000000000000000000000000..524700c91aae09d95eb57c2f293f074f220814a6 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0105.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0106.html b/result_prior/3d_structures/hu/without_labels/molecule_0106.html new file mode 100644 index 0000000000000000000000000000000000000000..c42b11326ca02af9427eb2e327f32d37c5cbf7fe --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0106.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0107.html b/result_prior/3d_structures/hu/without_labels/molecule_0107.html new file mode 100644 index 0000000000000000000000000000000000000000..e93d937cedf36e99daeafe3343248d2bcbfe0b87 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0107.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0108.html b/result_prior/3d_structures/hu/without_labels/molecule_0108.html new file mode 100644 index 0000000000000000000000000000000000000000..c342efdfd9d8375b37d74fdc07f97996c591b7f8 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0108.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0109.html b/result_prior/3d_structures/hu/without_labels/molecule_0109.html new file mode 100644 index 0000000000000000000000000000000000000000..5f23ce0e169ca7b4f518f22b264e6018ed2b5a06 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0109.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0110.html b/result_prior/3d_structures/hu/without_labels/molecule_0110.html new file mode 100644 index 0000000000000000000000000000000000000000..4395fe0c27e3bae45b57bb2ef561ec49d6a1e3c4 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0110.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0111.html b/result_prior/3d_structures/hu/without_labels/molecule_0111.html new file mode 100644 index 0000000000000000000000000000000000000000..40cd7ea67db5e2b69833d9f38ddc6fe81d0d6a71 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0111.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0112.html b/result_prior/3d_structures/hu/without_labels/molecule_0112.html new file mode 100644 index 0000000000000000000000000000000000000000..1ea9c87c717e8b95e6dbd2a1dc58598d88399cd5 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0112.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0113.html b/result_prior/3d_structures/hu/without_labels/molecule_0113.html new file mode 100644 index 0000000000000000000000000000000000000000..f384a5b4035b0bb8a2a9de131992a52d39ecaa54 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0113.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0114.html b/result_prior/3d_structures/hu/without_labels/molecule_0114.html new file mode 100644 index 0000000000000000000000000000000000000000..1cc6b677f57709aebc7a900a7d67e2f1bc32dd49 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0114.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0115.html b/result_prior/3d_structures/hu/without_labels/molecule_0115.html new file mode 100644 index 0000000000000000000000000000000000000000..8999da29623bc35ed72c5b051d6c75fbe77931fc --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0115.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0116.html b/result_prior/3d_structures/hu/without_labels/molecule_0116.html new file mode 100644 index 0000000000000000000000000000000000000000..36ddb7f75092b388e75531e1b9f3e0fed991e174 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0116.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0117.html b/result_prior/3d_structures/hu/without_labels/molecule_0117.html new file mode 100644 index 0000000000000000000000000000000000000000..f608e5471a5b61ba801a1b0114fbc906b4639db3 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0117.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0118.html b/result_prior/3d_structures/hu/without_labels/molecule_0118.html new file mode 100644 index 0000000000000000000000000000000000000000..da0a4e8c2e3a71cc8d7259355b7b3ef9d0a27c0f --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0118.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0119.html b/result_prior/3d_structures/hu/without_labels/molecule_0119.html new file mode 100644 index 0000000000000000000000000000000000000000..24b2d148816e4d21bdbe193ee5c6f0c812d3c78a --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0119.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0120.html b/result_prior/3d_structures/hu/without_labels/molecule_0120.html new file mode 100644 index 0000000000000000000000000000000000000000..90ce4518314473117d5f23265271135e3a376244 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0120.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0121.html b/result_prior/3d_structures/hu/without_labels/molecule_0121.html new file mode 100644 index 0000000000000000000000000000000000000000..d32134482ce90a88914e3033445810c4c995cbd6 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0121.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0122.html b/result_prior/3d_structures/hu/without_labels/molecule_0122.html new file mode 100644 index 0000000000000000000000000000000000000000..98e128676e6f15c3625c2c27d3a8e3c072eb97da --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0122.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0123.html b/result_prior/3d_structures/hu/without_labels/molecule_0123.html new file mode 100644 index 0000000000000000000000000000000000000000..bd196141c0c846a9061231447f62cd8bda1cfca9 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0123.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0124.html b/result_prior/3d_structures/hu/without_labels/molecule_0124.html new file mode 100644 index 0000000000000000000000000000000000000000..090bf1685bc39e5bb7e72cde533c7ca7481c913b --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0124.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0125.html b/result_prior/3d_structures/hu/without_labels/molecule_0125.html new file mode 100644 index 0000000000000000000000000000000000000000..6ccec5af4ca43e310e5d50dd47429d066393a1d3 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0125.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0126.html b/result_prior/3d_structures/hu/without_labels/molecule_0126.html new file mode 100644 index 0000000000000000000000000000000000000000..a43b9c5cc189ef2cd8196e376db5b53742524b86 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0126.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0127.html b/result_prior/3d_structures/hu/without_labels/molecule_0127.html new file mode 100644 index 0000000000000000000000000000000000000000..103947e3c7fb0ffaa6142f5315fcccfee9794253 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0127.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0128.html b/result_prior/3d_structures/hu/without_labels/molecule_0128.html new file mode 100644 index 0000000000000000000000000000000000000000..95245f14fe825d0f79e8abaac9f447510c6624bc --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0128.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0129.html b/result_prior/3d_structures/hu/without_labels/molecule_0129.html new file mode 100644 index 0000000000000000000000000000000000000000..b9527e3ac9a25dfd79670db09fa947f33c85bba9 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0129.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/hu/without_labels/molecule_0130.html b/result_prior/3d_structures/hu/without_labels/molecule_0130.html new file mode 100644 index 0000000000000000000000000000000000000000..7413615262f63f12121986e462c5173df47588e9 --- /dev/null +++ b/result_prior/3d_structures/hu/without_labels/molecule_0130.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0001.html b/result_prior/3d_structures/lo/with_labels/molecule_0001.html new file mode 100644 index 0000000000000000000000000000000000000000..105bbc74c1e3ffe101978ddce44f532d138ee713 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0001.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0002.html b/result_prior/3d_structures/lo/with_labels/molecule_0002.html new file mode 100644 index 0000000000000000000000000000000000000000..4a3fb5dc399448ff9f011a1f7fab25a5eb3c5432 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0002.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0003.html b/result_prior/3d_structures/lo/with_labels/molecule_0003.html new file mode 100644 index 0000000000000000000000000000000000000000..6f9b43ebb2e6861712bbbd397cf8076ced2ed2ad --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0003.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0004.html b/result_prior/3d_structures/lo/with_labels/molecule_0004.html new file mode 100644 index 0000000000000000000000000000000000000000..66037a09521fb6def35535607c1f8c78e28f9a69 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0004.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0005.html b/result_prior/3d_structures/lo/with_labels/molecule_0005.html new file mode 100644 index 0000000000000000000000000000000000000000..e72aff3a7206dd74514a7dc896709ade2efc2a54 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0005.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0006.html b/result_prior/3d_structures/lo/with_labels/molecule_0006.html new file mode 100644 index 0000000000000000000000000000000000000000..3cbd492c02b26e93add1ae28f35cc4d7aae5fa43 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0006.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0007.html b/result_prior/3d_structures/lo/with_labels/molecule_0007.html new file mode 100644 index 0000000000000000000000000000000000000000..df7c569554a1b71dcc47d25c9ea3a21fae46f4e2 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0007.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0008.html b/result_prior/3d_structures/lo/with_labels/molecule_0008.html new file mode 100644 index 0000000000000000000000000000000000000000..f09a19edfcde9bd754ac29ecc7d414a248d853fe --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0008.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0009.html b/result_prior/3d_structures/lo/with_labels/molecule_0009.html new file mode 100644 index 0000000000000000000000000000000000000000..d9060f71578a33301f4611fec6bb1a1441447ed4 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0009.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0010.html b/result_prior/3d_structures/lo/with_labels/molecule_0010.html new file mode 100644 index 0000000000000000000000000000000000000000..e1e9edd8dfa4088dacd735641c525c0c8efd09fb --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0010.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0011.html b/result_prior/3d_structures/lo/with_labels/molecule_0011.html new file mode 100644 index 0000000000000000000000000000000000000000..3b9709adc75c683dcff38c24799e0608e64599e0 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0011.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0012.html b/result_prior/3d_structures/lo/with_labels/molecule_0012.html new file mode 100644 index 0000000000000000000000000000000000000000..b5aa01a032c95576f88168c02b2617d5244ee0af --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0012.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0013.html b/result_prior/3d_structures/lo/with_labels/molecule_0013.html new file mode 100644 index 0000000000000000000000000000000000000000..3cadb30c5018f938a7904f8cbf6f331a35c1b235 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0013.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0014.html b/result_prior/3d_structures/lo/with_labels/molecule_0014.html new file mode 100644 index 0000000000000000000000000000000000000000..5944ba2dbf6093ca25ae9c8e29c30fb4c4a0c0b7 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0014.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0015.html b/result_prior/3d_structures/lo/with_labels/molecule_0015.html new file mode 100644 index 0000000000000000000000000000000000000000..c1f820f5258936d093398e17ec1a0ee7470ab11f --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0015.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0016.html b/result_prior/3d_structures/lo/with_labels/molecule_0016.html new file mode 100644 index 0000000000000000000000000000000000000000..226c6f2080dd45fbedc0219a5b125e843dd6fbb0 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0016.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0017.html b/result_prior/3d_structures/lo/with_labels/molecule_0017.html new file mode 100644 index 0000000000000000000000000000000000000000..a591261222d8f6368edf07f7afe9b3afb76b832d --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0017.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0018.html b/result_prior/3d_structures/lo/with_labels/molecule_0018.html new file mode 100644 index 0000000000000000000000000000000000000000..a80ec08242f539740ab1c32b60290a84bb68ef39 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0018.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0019.html b/result_prior/3d_structures/lo/with_labels/molecule_0019.html new file mode 100644 index 0000000000000000000000000000000000000000..5061e78593218270cef3225f26a6d1a5922f5604 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0019.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0020.html b/result_prior/3d_structures/lo/with_labels/molecule_0020.html new file mode 100644 index 0000000000000000000000000000000000000000..f4eaef24a325418f8cfba2925507f7c4b5f7aa21 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0020.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0021.html b/result_prior/3d_structures/lo/with_labels/molecule_0021.html new file mode 100644 index 0000000000000000000000000000000000000000..a5ad7318efdb2574543567df36584e58599b9580 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0021.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0022.html b/result_prior/3d_structures/lo/with_labels/molecule_0022.html new file mode 100644 index 0000000000000000000000000000000000000000..bc0ab4eee3d19d12a772c6ea306f811d874992bc --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0022.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0023.html b/result_prior/3d_structures/lo/with_labels/molecule_0023.html new file mode 100644 index 0000000000000000000000000000000000000000..1980bf11980338f05ad1abbe807a3da72241fc36 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0023.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0024.html b/result_prior/3d_structures/lo/with_labels/molecule_0024.html new file mode 100644 index 0000000000000000000000000000000000000000..f5e6e035d467221c7b428a1ee8c8e4ba02932b3b --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0024.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0025.html b/result_prior/3d_structures/lo/with_labels/molecule_0025.html new file mode 100644 index 0000000000000000000000000000000000000000..bfa449d4a0e3cddfdd47cde68b48747cb3c1176c --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0025.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0026.html b/result_prior/3d_structures/lo/with_labels/molecule_0026.html new file mode 100644 index 0000000000000000000000000000000000000000..356e565dcce93fb799ed5fc9ff94b9787be46d59 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0026.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0027.html b/result_prior/3d_structures/lo/with_labels/molecule_0027.html new file mode 100644 index 0000000000000000000000000000000000000000..612b7e5e5a9b37f65dafdbcf8232ce00449ca3d9 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0027.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0028.html b/result_prior/3d_structures/lo/with_labels/molecule_0028.html new file mode 100644 index 0000000000000000000000000000000000000000..0618515dfb291e12f08ccb4232cb46e5db306765 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0028.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0029.html b/result_prior/3d_structures/lo/with_labels/molecule_0029.html new file mode 100644 index 0000000000000000000000000000000000000000..6a2a4c5154f090fc3a7513406822ff9084805533 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0029.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0030.html b/result_prior/3d_structures/lo/with_labels/molecule_0030.html new file mode 100644 index 0000000000000000000000000000000000000000..9514d0208db96e7efea5990611d35b393336b8be --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0030.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0031.html b/result_prior/3d_structures/lo/with_labels/molecule_0031.html new file mode 100644 index 0000000000000000000000000000000000000000..8084a9ec7bbb81a094ce3eb420abd2c4cdf7864c --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0031.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0032.html b/result_prior/3d_structures/lo/with_labels/molecule_0032.html new file mode 100644 index 0000000000000000000000000000000000000000..8ad213fe8ae0b8f0c2eee7c214d0d36f53370332 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0032.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0033.html b/result_prior/3d_structures/lo/with_labels/molecule_0033.html new file mode 100644 index 0000000000000000000000000000000000000000..e4abee8c62328697ce8fdd522cf87df291ea74f3 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0033.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0034.html b/result_prior/3d_structures/lo/with_labels/molecule_0034.html new file mode 100644 index 0000000000000000000000000000000000000000..1809c23a6f96da5fb94c5130ade526eaf67eafe9 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0034.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0035.html b/result_prior/3d_structures/lo/with_labels/molecule_0035.html new file mode 100644 index 0000000000000000000000000000000000000000..d19fbb6cb4232ed2315ed1c9e43a4cb70028d976 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0035.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0036.html b/result_prior/3d_structures/lo/with_labels/molecule_0036.html new file mode 100644 index 0000000000000000000000000000000000000000..4e09d6c2e6675942a952ae5a20ecaf51f476272f --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0036.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0037.html b/result_prior/3d_structures/lo/with_labels/molecule_0037.html new file mode 100644 index 0000000000000000000000000000000000000000..9cba91dc7630c6e84ed5b12ec88bcc1ffdb115aa --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0037.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0038.html b/result_prior/3d_structures/lo/with_labels/molecule_0038.html new file mode 100644 index 0000000000000000000000000000000000000000..196467d8dd4cdd537dd8bf0976610e2608683d10 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0038.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0039.html b/result_prior/3d_structures/lo/with_labels/molecule_0039.html new file mode 100644 index 0000000000000000000000000000000000000000..e9e93c22dcd8c08dc686a6eb8cbae9507d3699ad --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0039.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0040.html b/result_prior/3d_structures/lo/with_labels/molecule_0040.html new file mode 100644 index 0000000000000000000000000000000000000000..1e808bd9736819a382ea36a2227f62584e7fb14a --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0040.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0041.html b/result_prior/3d_structures/lo/with_labels/molecule_0041.html new file mode 100644 index 0000000000000000000000000000000000000000..49853fbe43b7068e5fb38483b4d2470908b9caee --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0041.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0042.html b/result_prior/3d_structures/lo/with_labels/molecule_0042.html new file mode 100644 index 0000000000000000000000000000000000000000..fd16625755ef116ca046cf7afa94faf6c109318c --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0042.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0043.html b/result_prior/3d_structures/lo/with_labels/molecule_0043.html new file mode 100644 index 0000000000000000000000000000000000000000..f3bcdd9e9bfd4383ed483cfaf079edb5c311c6af --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0043.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0044.html b/result_prior/3d_structures/lo/with_labels/molecule_0044.html new file mode 100644 index 0000000000000000000000000000000000000000..5a672815cda0443f44f653ae077f44af240eba93 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0044.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0045.html b/result_prior/3d_structures/lo/with_labels/molecule_0045.html new file mode 100644 index 0000000000000000000000000000000000000000..dfdfbc38b834a9d068c4094bc8caef5df426dab4 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0045.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0046.html b/result_prior/3d_structures/lo/with_labels/molecule_0046.html new file mode 100644 index 0000000000000000000000000000000000000000..162ab6f193042bd31d8a03ba1cdc6c6d018516b7 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0046.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0047.html b/result_prior/3d_structures/lo/with_labels/molecule_0047.html new file mode 100644 index 0000000000000000000000000000000000000000..90496a9c7c43c681dc26039191f68684343e4c33 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0047.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0048.html b/result_prior/3d_structures/lo/with_labels/molecule_0048.html new file mode 100644 index 0000000000000000000000000000000000000000..ca9f77f546ca1d00df492b9ae2b9971fb8dfbc2e --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0048.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0049.html b/result_prior/3d_structures/lo/with_labels/molecule_0049.html new file mode 100644 index 0000000000000000000000000000000000000000..722ece685f8523afd914bbf582962650f37d86d3 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0049.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0050.html b/result_prior/3d_structures/lo/with_labels/molecule_0050.html new file mode 100644 index 0000000000000000000000000000000000000000..024534781d67ef92ed05f3f93bc70fc6da89b7c4 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0050.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0051.html b/result_prior/3d_structures/lo/with_labels/molecule_0051.html new file mode 100644 index 0000000000000000000000000000000000000000..e043c381bbd05f3f6fd9f7f8590e4d2f66e20914 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0051.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0052.html b/result_prior/3d_structures/lo/with_labels/molecule_0052.html new file mode 100644 index 0000000000000000000000000000000000000000..4bbfe85c0bcd509d07174fe60a24bce8c3a79601 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0052.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0053.html b/result_prior/3d_structures/lo/with_labels/molecule_0053.html new file mode 100644 index 0000000000000000000000000000000000000000..a23cec5416c35da54f14608681640a6ec40c3552 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0053.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0054.html b/result_prior/3d_structures/lo/with_labels/molecule_0054.html new file mode 100644 index 0000000000000000000000000000000000000000..5aa645d640e9339e0fd80124e1d6ff8258b781ec --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0054.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0055.html b/result_prior/3d_structures/lo/with_labels/molecule_0055.html new file mode 100644 index 0000000000000000000000000000000000000000..df513366d73bd182e69cf1e62a8bd0ece8a17de6 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0055.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0056.html b/result_prior/3d_structures/lo/with_labels/molecule_0056.html new file mode 100644 index 0000000000000000000000000000000000000000..f03c9b84f33e8e9bd0c4b3f12c04ea7fea0c0c8e --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0056.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0057.html b/result_prior/3d_structures/lo/with_labels/molecule_0057.html new file mode 100644 index 0000000000000000000000000000000000000000..758dd6f67bbb749e961d67333c4c5d2a02dd6946 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0057.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0058.html b/result_prior/3d_structures/lo/with_labels/molecule_0058.html new file mode 100644 index 0000000000000000000000000000000000000000..05d2bd3b559aa8ee18b8314a9ec2e51b80205081 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0058.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0059.html b/result_prior/3d_structures/lo/with_labels/molecule_0059.html new file mode 100644 index 0000000000000000000000000000000000000000..e178d8187b66c69900d3a65e54f971653f6bd907 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0059.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0060.html b/result_prior/3d_structures/lo/with_labels/molecule_0060.html new file mode 100644 index 0000000000000000000000000000000000000000..70a981ee74b00b13f550b4225e003d76bc0c42fa --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0060.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0061.html b/result_prior/3d_structures/lo/with_labels/molecule_0061.html new file mode 100644 index 0000000000000000000000000000000000000000..6cba3661126b614219f3b1a8884f4dfeb471f0e9 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0061.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0062.html b/result_prior/3d_structures/lo/with_labels/molecule_0062.html new file mode 100644 index 0000000000000000000000000000000000000000..7d8227171c003bca010e1c1685d0adbf9afc01a8 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0062.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0063.html b/result_prior/3d_structures/lo/with_labels/molecule_0063.html new file mode 100644 index 0000000000000000000000000000000000000000..f943c84f58819dbe3239133301c045548834a47b --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0063.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0064.html b/result_prior/3d_structures/lo/with_labels/molecule_0064.html new file mode 100644 index 0000000000000000000000000000000000000000..8b223b88b7cce028e2857418d9b75916a6d86675 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0064.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0065.html b/result_prior/3d_structures/lo/with_labels/molecule_0065.html new file mode 100644 index 0000000000000000000000000000000000000000..85773a0c7dab49b1fc34bd297031d551d9bd77a1 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0065.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0066.html b/result_prior/3d_structures/lo/with_labels/molecule_0066.html new file mode 100644 index 0000000000000000000000000000000000000000..790921242be71c65ce032ead3f79176123a80c9a --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0066.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0067.html b/result_prior/3d_structures/lo/with_labels/molecule_0067.html new file mode 100644 index 0000000000000000000000000000000000000000..7fa1f31967d26b45642bffd0106a5f4b6da33d25 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0067.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0068.html b/result_prior/3d_structures/lo/with_labels/molecule_0068.html new file mode 100644 index 0000000000000000000000000000000000000000..6d0a265af80264976750437515de5422558bb67f --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0068.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0069.html b/result_prior/3d_structures/lo/with_labels/molecule_0069.html new file mode 100644 index 0000000000000000000000000000000000000000..c9e8115246a4c0b3666c5c386f464773655b30f0 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0069.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0070.html b/result_prior/3d_structures/lo/with_labels/molecule_0070.html new file mode 100644 index 0000000000000000000000000000000000000000..2fea67ae33675168ddb867297030d2551f8e357c --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0070.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0071.html b/result_prior/3d_structures/lo/with_labels/molecule_0071.html new file mode 100644 index 0000000000000000000000000000000000000000..869aa50be78e5312f95e20b044431e6a1215f759 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0071.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0072.html b/result_prior/3d_structures/lo/with_labels/molecule_0072.html new file mode 100644 index 0000000000000000000000000000000000000000..63234b4ceff8a777c956fbf2e03fa291e67cf67e --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0072.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0073.html b/result_prior/3d_structures/lo/with_labels/molecule_0073.html new file mode 100644 index 0000000000000000000000000000000000000000..ef84c0c7147848cd866998923381f6c676da8063 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0073.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0074.html b/result_prior/3d_structures/lo/with_labels/molecule_0074.html new file mode 100644 index 0000000000000000000000000000000000000000..2a6c582cf827c59a757ee0c1d15c7d30da252c7f --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0074.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0075.html b/result_prior/3d_structures/lo/with_labels/molecule_0075.html new file mode 100644 index 0000000000000000000000000000000000000000..d626c2bef32874b22a2148a014fc12ae79445aca --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0075.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0076.html b/result_prior/3d_structures/lo/with_labels/molecule_0076.html new file mode 100644 index 0000000000000000000000000000000000000000..74f1653890feaba37d664c5ef6b46aa526c7c273 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0076.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0077.html b/result_prior/3d_structures/lo/with_labels/molecule_0077.html new file mode 100644 index 0000000000000000000000000000000000000000..862e14ebdf916b288c32c001eaf35517eaee8d12 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0077.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0078.html b/result_prior/3d_structures/lo/with_labels/molecule_0078.html new file mode 100644 index 0000000000000000000000000000000000000000..4ce8ddb216eb6bc8912a90f3c424a8790d0d3909 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0078.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0079.html b/result_prior/3d_structures/lo/with_labels/molecule_0079.html new file mode 100644 index 0000000000000000000000000000000000000000..406e5db2333fce8a8faa4e7b3b5a2d50df861fdb --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0079.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0080.html b/result_prior/3d_structures/lo/with_labels/molecule_0080.html new file mode 100644 index 0000000000000000000000000000000000000000..95aa6de3c622f4a592a1b5191af6b44dcfdfa927 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0080.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0081.html b/result_prior/3d_structures/lo/with_labels/molecule_0081.html new file mode 100644 index 0000000000000000000000000000000000000000..b9c7de0437beb578f2e9ab99ac6132a49517ae98 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0081.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0082.html b/result_prior/3d_structures/lo/with_labels/molecule_0082.html new file mode 100644 index 0000000000000000000000000000000000000000..975f3dd69772acfdddef3a44d363fa908c9b34a1 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0082.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/with_labels/molecule_0083.html b/result_prior/3d_structures/lo/with_labels/molecule_0083.html new file mode 100644 index 0000000000000000000000000000000000000000..3493c5c1ceafc167337be2364ead21a7008d94a3 --- /dev/null +++ b/result_prior/3d_structures/lo/with_labels/molecule_0083.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0001.html b/result_prior/3d_structures/lo/without_labels/molecule_0001.html new file mode 100644 index 0000000000000000000000000000000000000000..e014a2a18e540823d8e8b0dadffafdea94b4884c --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0001.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0002.html b/result_prior/3d_structures/lo/without_labels/molecule_0002.html new file mode 100644 index 0000000000000000000000000000000000000000..7f9e1553abb1554d7b8297d380c4c82b81e5b386 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0002.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0003.html b/result_prior/3d_structures/lo/without_labels/molecule_0003.html new file mode 100644 index 0000000000000000000000000000000000000000..8a2bcff5af60060b09310ea483900b87d008f477 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0003.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0004.html b/result_prior/3d_structures/lo/without_labels/molecule_0004.html new file mode 100644 index 0000000000000000000000000000000000000000..bdfe51e266d85cde2e20285f6e8900d4bda690a4 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0004.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0005.html b/result_prior/3d_structures/lo/without_labels/molecule_0005.html new file mode 100644 index 0000000000000000000000000000000000000000..5a74e93c91acc3f61175ec5402dcc2d4ef00239d --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0005.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0006.html b/result_prior/3d_structures/lo/without_labels/molecule_0006.html new file mode 100644 index 0000000000000000000000000000000000000000..22f478d2dfbfc2a011ab192c51a98ab1c622c3a7 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0006.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0007.html b/result_prior/3d_structures/lo/without_labels/molecule_0007.html new file mode 100644 index 0000000000000000000000000000000000000000..0e20fc45c40b551cb06392eccbc1a2d477d9bc72 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0007.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0008.html b/result_prior/3d_structures/lo/without_labels/molecule_0008.html new file mode 100644 index 0000000000000000000000000000000000000000..56b43abe5ee2c1629e3cb1c97754348051cdd45b --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0008.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0009.html b/result_prior/3d_structures/lo/without_labels/molecule_0009.html new file mode 100644 index 0000000000000000000000000000000000000000..40e224141f340bdb18da7e923b9108356e8ab465 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0009.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0010.html b/result_prior/3d_structures/lo/without_labels/molecule_0010.html new file mode 100644 index 0000000000000000000000000000000000000000..0727bc0ca6f5ec35242a643787c8056d41a25b09 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0010.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0011.html b/result_prior/3d_structures/lo/without_labels/molecule_0011.html new file mode 100644 index 0000000000000000000000000000000000000000..3caac9f213bfa4bba754e244ce089323f2a802d3 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0011.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0012.html b/result_prior/3d_structures/lo/without_labels/molecule_0012.html new file mode 100644 index 0000000000000000000000000000000000000000..49e5e2de153b54b7e4eecca08170e6a78e7b0a90 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0012.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0013.html b/result_prior/3d_structures/lo/without_labels/molecule_0013.html new file mode 100644 index 0000000000000000000000000000000000000000..d7aeba1a850f7c70e36fee01f1036e62291cb324 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0013.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0014.html b/result_prior/3d_structures/lo/without_labels/molecule_0014.html new file mode 100644 index 0000000000000000000000000000000000000000..5096f09cc8b21afe7dfcef014e0c277116ff59f6 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0014.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0015.html b/result_prior/3d_structures/lo/without_labels/molecule_0015.html new file mode 100644 index 0000000000000000000000000000000000000000..19814bdb3b4e483cce3d3d827484ecb1d2b08d24 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0015.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0016.html b/result_prior/3d_structures/lo/without_labels/molecule_0016.html new file mode 100644 index 0000000000000000000000000000000000000000..c201c75f15e673e8cee77d089dd94605234dabdd --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0016.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0017.html b/result_prior/3d_structures/lo/without_labels/molecule_0017.html new file mode 100644 index 0000000000000000000000000000000000000000..fd6addd0ef573286a56c2868c1df6b09d4dbd8f0 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0017.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0018.html b/result_prior/3d_structures/lo/without_labels/molecule_0018.html new file mode 100644 index 0000000000000000000000000000000000000000..e293ebea1ec3ee367e3315238d127309aaec295d --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0018.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0019.html b/result_prior/3d_structures/lo/without_labels/molecule_0019.html new file mode 100644 index 0000000000000000000000000000000000000000..355b9dbe56ee3a46589f653b90732493e74d3063 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0019.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0020.html b/result_prior/3d_structures/lo/without_labels/molecule_0020.html new file mode 100644 index 0000000000000000000000000000000000000000..7bfb6eac6ce2205e4d45e5ae49434b11207c9126 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0020.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0021.html b/result_prior/3d_structures/lo/without_labels/molecule_0021.html new file mode 100644 index 0000000000000000000000000000000000000000..529e5e01f8f691d7c2b3c8dbba911f7e742bb08c --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0021.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0022.html b/result_prior/3d_structures/lo/without_labels/molecule_0022.html new file mode 100644 index 0000000000000000000000000000000000000000..4377f18a171c243bc64ea1c370919d8789104287 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0022.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0023.html b/result_prior/3d_structures/lo/without_labels/molecule_0023.html new file mode 100644 index 0000000000000000000000000000000000000000..8f132379abdf54f652c36be97af1e8fdf7d3429f --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0023.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0024.html b/result_prior/3d_structures/lo/without_labels/molecule_0024.html new file mode 100644 index 0000000000000000000000000000000000000000..f6bc23c797855ff0dedafc100f3106fe087f13f6 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0024.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0025.html b/result_prior/3d_structures/lo/without_labels/molecule_0025.html new file mode 100644 index 0000000000000000000000000000000000000000..a4d665e3028f5992034cf9f7ed8aebf1a8f2dea2 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0025.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0026.html b/result_prior/3d_structures/lo/without_labels/molecule_0026.html new file mode 100644 index 0000000000000000000000000000000000000000..f18f30a5c44454399bc7627b3302b09782c09e7e --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0026.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0027.html b/result_prior/3d_structures/lo/without_labels/molecule_0027.html new file mode 100644 index 0000000000000000000000000000000000000000..9e3d7dcfc678fa37d7e7bff1cc6add5c9879b9bc --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0027.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0028.html b/result_prior/3d_structures/lo/without_labels/molecule_0028.html new file mode 100644 index 0000000000000000000000000000000000000000..77f6e6c9486c55cb0ecd1726f08f19fa7eba123c --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0028.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0029.html b/result_prior/3d_structures/lo/without_labels/molecule_0029.html new file mode 100644 index 0000000000000000000000000000000000000000..bd117d261072b7c82012cf4b9ca04839ee567fbb --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0029.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0030.html b/result_prior/3d_structures/lo/without_labels/molecule_0030.html new file mode 100644 index 0000000000000000000000000000000000000000..c915a3e2180f4dd0909c65ed3959cb3696af9689 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0030.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0031.html b/result_prior/3d_structures/lo/without_labels/molecule_0031.html new file mode 100644 index 0000000000000000000000000000000000000000..c04a3787f03136f0393bf36ef9e9dcfc13b18d24 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0031.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0032.html b/result_prior/3d_structures/lo/without_labels/molecule_0032.html new file mode 100644 index 0000000000000000000000000000000000000000..4d61634e7c6359fb4437fc91d8208e404422034c --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0032.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0033.html b/result_prior/3d_structures/lo/without_labels/molecule_0033.html new file mode 100644 index 0000000000000000000000000000000000000000..eee69c2e0420c3e8ea24e5e034f8dcebcf5e32a2 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0033.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0034.html b/result_prior/3d_structures/lo/without_labels/molecule_0034.html new file mode 100644 index 0000000000000000000000000000000000000000..b232a06b57dc2b664a4b8c1312ba90f067bdcfd1 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0034.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0035.html b/result_prior/3d_structures/lo/without_labels/molecule_0035.html new file mode 100644 index 0000000000000000000000000000000000000000..1513573cb4cd576ebe8117b1c9c00a05e1f4c544 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0035.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0036.html b/result_prior/3d_structures/lo/without_labels/molecule_0036.html new file mode 100644 index 0000000000000000000000000000000000000000..8024837b1ab319c4007537427f1d620c10ecbf01 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0036.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0037.html b/result_prior/3d_structures/lo/without_labels/molecule_0037.html new file mode 100644 index 0000000000000000000000000000000000000000..e9af3848cc709e9c41af0d84bd5f683de1631cd0 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0037.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0038.html b/result_prior/3d_structures/lo/without_labels/molecule_0038.html new file mode 100644 index 0000000000000000000000000000000000000000..3fe05bbb6e94b4f78c2bfefc7d6f5b47f8ed8536 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0038.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0039.html b/result_prior/3d_structures/lo/without_labels/molecule_0039.html new file mode 100644 index 0000000000000000000000000000000000000000..6c5d436145e9f68ee4f4492e0a677688370f1fbd --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0039.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0040.html b/result_prior/3d_structures/lo/without_labels/molecule_0040.html new file mode 100644 index 0000000000000000000000000000000000000000..4a1067bb498716c1cdddbc5f3064737d21d1161e --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0040.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0041.html b/result_prior/3d_structures/lo/without_labels/molecule_0041.html new file mode 100644 index 0000000000000000000000000000000000000000..1a42cbd6f2c157ebed41675acdf2ea58bd99e117 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0041.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0042.html b/result_prior/3d_structures/lo/without_labels/molecule_0042.html new file mode 100644 index 0000000000000000000000000000000000000000..492ba0c2decb8f996e050b07dcb715710a22ebe7 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0042.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0043.html b/result_prior/3d_structures/lo/without_labels/molecule_0043.html new file mode 100644 index 0000000000000000000000000000000000000000..6be95653acb3b003a85609c3934c13b6296aecc6 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0043.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0044.html b/result_prior/3d_structures/lo/without_labels/molecule_0044.html new file mode 100644 index 0000000000000000000000000000000000000000..94408c6ca6d953d5d3e3db5eae388c3fe935db9a --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0044.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0045.html b/result_prior/3d_structures/lo/without_labels/molecule_0045.html new file mode 100644 index 0000000000000000000000000000000000000000..e824233c298d3781cbc3404aede680173e1b9a2f --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0045.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0046.html b/result_prior/3d_structures/lo/without_labels/molecule_0046.html new file mode 100644 index 0000000000000000000000000000000000000000..d5106e06fcbb92f92b6bafbdf79bafa375dfcc91 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0046.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0047.html b/result_prior/3d_structures/lo/without_labels/molecule_0047.html new file mode 100644 index 0000000000000000000000000000000000000000..4168297a7a570d8fb6216c4e3201b6c3a6f55bdd --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0047.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0048.html b/result_prior/3d_structures/lo/without_labels/molecule_0048.html new file mode 100644 index 0000000000000000000000000000000000000000..07627e778c3659155bc9ff99e18931b046c8ac1f --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0048.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0049.html b/result_prior/3d_structures/lo/without_labels/molecule_0049.html new file mode 100644 index 0000000000000000000000000000000000000000..23b5c3f9048cbe9a13869be5ad64135b09f94139 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0049.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0050.html b/result_prior/3d_structures/lo/without_labels/molecule_0050.html new file mode 100644 index 0000000000000000000000000000000000000000..97737a86df0d123ce9e5a9a9bd27d8f8aead3b4a --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0050.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0051.html b/result_prior/3d_structures/lo/without_labels/molecule_0051.html new file mode 100644 index 0000000000000000000000000000000000000000..41fd08154a3c16691a01c3c38b922048e34fac1a --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0051.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0052.html b/result_prior/3d_structures/lo/without_labels/molecule_0052.html new file mode 100644 index 0000000000000000000000000000000000000000..f00295023e29c7f028683ea3d6d6a85cc22a0602 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0052.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0053.html b/result_prior/3d_structures/lo/without_labels/molecule_0053.html new file mode 100644 index 0000000000000000000000000000000000000000..945252774a2d2a1c991959557b95ab83906961bf --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0053.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0054.html b/result_prior/3d_structures/lo/without_labels/molecule_0054.html new file mode 100644 index 0000000000000000000000000000000000000000..c120d5cd72e9726a534d4f97a32996a9ba03e173 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0054.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0055.html b/result_prior/3d_structures/lo/without_labels/molecule_0055.html new file mode 100644 index 0000000000000000000000000000000000000000..c31363d84a1d6994cb65413cb7acce9d5e89b840 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0055.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0056.html b/result_prior/3d_structures/lo/without_labels/molecule_0056.html new file mode 100644 index 0000000000000000000000000000000000000000..a4947f461613272a12828f315f2bcdae17e87dde --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0056.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0057.html b/result_prior/3d_structures/lo/without_labels/molecule_0057.html new file mode 100644 index 0000000000000000000000000000000000000000..d8b72c9d9ac2245bcd0b653c545c81fea968fc99 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0057.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0058.html b/result_prior/3d_structures/lo/without_labels/molecule_0058.html new file mode 100644 index 0000000000000000000000000000000000000000..2506f5cebd9571cb05b32bd04e633a6bfd1112ee --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0058.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0059.html b/result_prior/3d_structures/lo/without_labels/molecule_0059.html new file mode 100644 index 0000000000000000000000000000000000000000..259994c13bd42853530913cf38d4dfaba349776e --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0059.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0060.html b/result_prior/3d_structures/lo/without_labels/molecule_0060.html new file mode 100644 index 0000000000000000000000000000000000000000..fa8d75a359ed02f5c7e9e66141be6acd6b664aa9 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0060.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0061.html b/result_prior/3d_structures/lo/without_labels/molecule_0061.html new file mode 100644 index 0000000000000000000000000000000000000000..cab525352f9fccf402430a213255a83f5f60eaae --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0061.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0062.html b/result_prior/3d_structures/lo/without_labels/molecule_0062.html new file mode 100644 index 0000000000000000000000000000000000000000..f2d808157b6cc02a3008c308844b8909778e22ce --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0062.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0063.html b/result_prior/3d_structures/lo/without_labels/molecule_0063.html new file mode 100644 index 0000000000000000000000000000000000000000..a8e68983eede5ae840c0d57adfcc3cd31598e668 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0063.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0064.html b/result_prior/3d_structures/lo/without_labels/molecule_0064.html new file mode 100644 index 0000000000000000000000000000000000000000..acb0d6121e8d98b8ec589f7c1ef00172e71583d8 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0064.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0065.html b/result_prior/3d_structures/lo/without_labels/molecule_0065.html new file mode 100644 index 0000000000000000000000000000000000000000..c19c0e395e243d5be9d0bcbb17f1ad1e5d2aa965 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0065.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0066.html b/result_prior/3d_structures/lo/without_labels/molecule_0066.html new file mode 100644 index 0000000000000000000000000000000000000000..f0ae7fa9db19197e764991ab7c7de91518574597 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0066.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0067.html b/result_prior/3d_structures/lo/without_labels/molecule_0067.html new file mode 100644 index 0000000000000000000000000000000000000000..836676ed1fdd0920c0cb3f7f66865fcb3941e8f8 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0067.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0068.html b/result_prior/3d_structures/lo/without_labels/molecule_0068.html new file mode 100644 index 0000000000000000000000000000000000000000..aecd6adfeee55acf4b16de35dc425e185305f932 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0068.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0069.html b/result_prior/3d_structures/lo/without_labels/molecule_0069.html new file mode 100644 index 0000000000000000000000000000000000000000..7f6ef3b6f083dfcae93056eb793c55ac00f61474 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0069.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0070.html b/result_prior/3d_structures/lo/without_labels/molecule_0070.html new file mode 100644 index 0000000000000000000000000000000000000000..799701395e62eb1a1f13fe6d003c491be7861a56 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0070.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0071.html b/result_prior/3d_structures/lo/without_labels/molecule_0071.html new file mode 100644 index 0000000000000000000000000000000000000000..84b92d94bb9935b7ebd43d573b943916521b76f9 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0071.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0072.html b/result_prior/3d_structures/lo/without_labels/molecule_0072.html new file mode 100644 index 0000000000000000000000000000000000000000..7c50a4e826d930031cfaad1eefe9a038832c0bb6 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0072.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0073.html b/result_prior/3d_structures/lo/without_labels/molecule_0073.html new file mode 100644 index 0000000000000000000000000000000000000000..ac8d9b8e217e352f9217a38cab55fd86694d0f2e --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0073.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0074.html b/result_prior/3d_structures/lo/without_labels/molecule_0074.html new file mode 100644 index 0000000000000000000000000000000000000000..16ab87df9cbdc316ed5e11dc3020a2ba057a2693 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0074.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0075.html b/result_prior/3d_structures/lo/without_labels/molecule_0075.html new file mode 100644 index 0000000000000000000000000000000000000000..18fda2a01896773b1990ffcb6e8b423ad7d1d6a7 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0075.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0076.html b/result_prior/3d_structures/lo/without_labels/molecule_0076.html new file mode 100644 index 0000000000000000000000000000000000000000..35eadc19d1ff0d3ca072addd4258f14473646ad5 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0076.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0077.html b/result_prior/3d_structures/lo/without_labels/molecule_0077.html new file mode 100644 index 0000000000000000000000000000000000000000..d156ab241bac0041de53457a7c175d9812680b83 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0077.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0078.html b/result_prior/3d_structures/lo/without_labels/molecule_0078.html new file mode 100644 index 0000000000000000000000000000000000000000..545d671198c15b4ebe454c0bd63418a08b1e5e74 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0078.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0079.html b/result_prior/3d_structures/lo/without_labels/molecule_0079.html new file mode 100644 index 0000000000000000000000000000000000000000..3da8ca2d42dcf2637be2b549606f4df4271e3aa5 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0079.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0080.html b/result_prior/3d_structures/lo/without_labels/molecule_0080.html new file mode 100644 index 0000000000000000000000000000000000000000..7ecd2090ffd6ecd9ed37a519b93b0ce80e723a73 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0080.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0081.html b/result_prior/3d_structures/lo/without_labels/molecule_0081.html new file mode 100644 index 0000000000000000000000000000000000000000..3ba86a2dcc284e2dbfe7e2d495d52109536c0ad1 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0081.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0082.html b/result_prior/3d_structures/lo/without_labels/molecule_0082.html new file mode 100644 index 0000000000000000000000000000000000000000..f6b3a4c4d6d2c466c6d5e1ea1f29cee3b97def16 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0082.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/lo/without_labels/molecule_0083.html b/result_prior/3d_structures/lo/without_labels/molecule_0083.html new file mode 100644 index 0000000000000000000000000000000000000000..8297ad3a2ad388995dd826f3aa24bb86733eb068 --- /dev/null +++ b/result_prior/3d_structures/lo/without_labels/molecule_0083.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0001.html b/result_prior/3d_structures/ws/with_labels/molecule_0001.html new file mode 100644 index 0000000000000000000000000000000000000000..71b0b0f90642a9c7859f202070fb619a1bbbad17 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0001.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0002.html b/result_prior/3d_structures/ws/with_labels/molecule_0002.html new file mode 100644 index 0000000000000000000000000000000000000000..3f086e18dcde505486e2274a1f184b334c2f7fb3 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0002.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0003.html b/result_prior/3d_structures/ws/with_labels/molecule_0003.html new file mode 100644 index 0000000000000000000000000000000000000000..14f4f195c8ea40cac967ce7b9a953ebbf56ab747 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0003.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0004.html b/result_prior/3d_structures/ws/with_labels/molecule_0004.html new file mode 100644 index 0000000000000000000000000000000000000000..58957eea9fd0c8ca40a0b8502237ee6ef21b3af9 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0004.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0005.html b/result_prior/3d_structures/ws/with_labels/molecule_0005.html new file mode 100644 index 0000000000000000000000000000000000000000..d454820153fe85a2ef444228743efec3e2e533ff --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0005.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0006.html b/result_prior/3d_structures/ws/with_labels/molecule_0006.html new file mode 100644 index 0000000000000000000000000000000000000000..1cc3ba8a7fac0e9788a21789bfd8a49ea721243e --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0006.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0007.html b/result_prior/3d_structures/ws/with_labels/molecule_0007.html new file mode 100644 index 0000000000000000000000000000000000000000..e626f964c5ba55461172cabf0ae6c2563eba5ee3 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0007.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0008.html b/result_prior/3d_structures/ws/with_labels/molecule_0008.html new file mode 100644 index 0000000000000000000000000000000000000000..8c8b8204c825dbfd0f7b171a8392a7dfc8352313 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0008.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0009.html b/result_prior/3d_structures/ws/with_labels/molecule_0009.html new file mode 100644 index 0000000000000000000000000000000000000000..ebe799083825db89ccff1bcea9dbeb5ad45a0af7 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0009.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0010.html b/result_prior/3d_structures/ws/with_labels/molecule_0010.html new file mode 100644 index 0000000000000000000000000000000000000000..5ae1a78f2a670d4f4b852460d80398ec0e5400b4 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0010.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0011.html b/result_prior/3d_structures/ws/with_labels/molecule_0011.html new file mode 100644 index 0000000000000000000000000000000000000000..0062dde76cac2abccc82a61a80bee6c4fb61c669 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0011.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0012.html b/result_prior/3d_structures/ws/with_labels/molecule_0012.html new file mode 100644 index 0000000000000000000000000000000000000000..5c4aba55f5ef7649d9f0e706ffa3a1aa8bcd6f06 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0012.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0013.html b/result_prior/3d_structures/ws/with_labels/molecule_0013.html new file mode 100644 index 0000000000000000000000000000000000000000..efae4e56cc0e707ed0856ad79bd11d2d69dc9f58 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0013.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0014.html b/result_prior/3d_structures/ws/with_labels/molecule_0014.html new file mode 100644 index 0000000000000000000000000000000000000000..041fe24b89f36d6deed002b3d03c399f9c37867c --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0014.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0015.html b/result_prior/3d_structures/ws/with_labels/molecule_0015.html new file mode 100644 index 0000000000000000000000000000000000000000..f3859d35cae4aa6102227d5b402956e22a2f0a34 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0015.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0016.html b/result_prior/3d_structures/ws/with_labels/molecule_0016.html new file mode 100644 index 0000000000000000000000000000000000000000..c1deeccc826c2e7da4e8e08bd47d4da1a9823372 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0016.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0017.html b/result_prior/3d_structures/ws/with_labels/molecule_0017.html new file mode 100644 index 0000000000000000000000000000000000000000..9d6fb447072c3a29adc0798ed23fa156ca45361a --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0017.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0018.html b/result_prior/3d_structures/ws/with_labels/molecule_0018.html new file mode 100644 index 0000000000000000000000000000000000000000..19bd78b6997024c1371e3cabfad1dc2246ed19e0 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0018.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0019.html b/result_prior/3d_structures/ws/with_labels/molecule_0019.html new file mode 100644 index 0000000000000000000000000000000000000000..45114510f01e0bd6c5de066c43ef7ddb64553129 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0019.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0020.html b/result_prior/3d_structures/ws/with_labels/molecule_0020.html new file mode 100644 index 0000000000000000000000000000000000000000..f24dea1e9efcd7193174fd2a89f10f635ae16fb5 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0020.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0021.html b/result_prior/3d_structures/ws/with_labels/molecule_0021.html new file mode 100644 index 0000000000000000000000000000000000000000..05ac1658adac9333ceec7a42b3d78f5216a0d677 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0021.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0022.html b/result_prior/3d_structures/ws/with_labels/molecule_0022.html new file mode 100644 index 0000000000000000000000000000000000000000..ad8fc3f8fb833260de5b41a6c37827e40db14fb9 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0022.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0023.html b/result_prior/3d_structures/ws/with_labels/molecule_0023.html new file mode 100644 index 0000000000000000000000000000000000000000..12a9643d3100896aa430c6dd18fd0bc2b9018c64 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0023.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0024.html b/result_prior/3d_structures/ws/with_labels/molecule_0024.html new file mode 100644 index 0000000000000000000000000000000000000000..4df4faf61ea049874406deda6dcb9e3a4cfacff3 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0024.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0025.html b/result_prior/3d_structures/ws/with_labels/molecule_0025.html new file mode 100644 index 0000000000000000000000000000000000000000..eff5c7d19d8b7ceeede46ef23d103435321450bf --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0025.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0026.html b/result_prior/3d_structures/ws/with_labels/molecule_0026.html new file mode 100644 index 0000000000000000000000000000000000000000..f4cc0e41f94b914406ef9198900a3f31e9e94b23 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0026.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0027.html b/result_prior/3d_structures/ws/with_labels/molecule_0027.html new file mode 100644 index 0000000000000000000000000000000000000000..1b5b12782312328e14fb4368c82265837dbc63ba --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0027.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0028.html b/result_prior/3d_structures/ws/with_labels/molecule_0028.html new file mode 100644 index 0000000000000000000000000000000000000000..2a275f60f839c977507a1fa3cca904dc967ca6e0 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0028.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0029.html b/result_prior/3d_structures/ws/with_labels/molecule_0029.html new file mode 100644 index 0000000000000000000000000000000000000000..3b53f6fc1e031b714423632c10f48d2156f9390e --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0029.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0030.html b/result_prior/3d_structures/ws/with_labels/molecule_0030.html new file mode 100644 index 0000000000000000000000000000000000000000..e3a0a7847211c0e3c7928a7aeee3e268c20c8135 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0030.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0031.html b/result_prior/3d_structures/ws/with_labels/molecule_0031.html new file mode 100644 index 0000000000000000000000000000000000000000..d6a57539ad01a8f614321bceaf44dcb6081acd96 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0031.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0032.html b/result_prior/3d_structures/ws/with_labels/molecule_0032.html new file mode 100644 index 0000000000000000000000000000000000000000..89601f5180089d03d720165794b947258ca606f1 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0032.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0033.html b/result_prior/3d_structures/ws/with_labels/molecule_0033.html new file mode 100644 index 0000000000000000000000000000000000000000..f22a311a7993b8dc35efc996c15cc24a1aed5cae --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0033.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0034.html b/result_prior/3d_structures/ws/with_labels/molecule_0034.html new file mode 100644 index 0000000000000000000000000000000000000000..b4260d06b8f0f84fdc56c21aef0c9ac97933bf99 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0034.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0035.html b/result_prior/3d_structures/ws/with_labels/molecule_0035.html new file mode 100644 index 0000000000000000000000000000000000000000..98f1176b709216f8198f24bef6421ee30414df9b --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0035.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0036.html b/result_prior/3d_structures/ws/with_labels/molecule_0036.html new file mode 100644 index 0000000000000000000000000000000000000000..36e5672f8c3acb0db4bc86dd56d890735c6b677f --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0036.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0037.html b/result_prior/3d_structures/ws/with_labels/molecule_0037.html new file mode 100644 index 0000000000000000000000000000000000000000..743e2b5415706a79561d6036b3fd4baf12a2be10 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0037.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0038.html b/result_prior/3d_structures/ws/with_labels/molecule_0038.html new file mode 100644 index 0000000000000000000000000000000000000000..11f4a9b294837a70dbeffb738ed4353b7bcd29de --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0038.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0039.html b/result_prior/3d_structures/ws/with_labels/molecule_0039.html new file mode 100644 index 0000000000000000000000000000000000000000..b806a8599568453e67814d0f42c533f2783438e7 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0039.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0040.html b/result_prior/3d_structures/ws/with_labels/molecule_0040.html new file mode 100644 index 0000000000000000000000000000000000000000..da8d6dc297bdaf24ac7fe0a0e85845a1bbb74ada --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0040.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0041.html b/result_prior/3d_structures/ws/with_labels/molecule_0041.html new file mode 100644 index 0000000000000000000000000000000000000000..d385e76ff6e90f4cdf3288232315811c4898e8e5 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0041.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0042.html b/result_prior/3d_structures/ws/with_labels/molecule_0042.html new file mode 100644 index 0000000000000000000000000000000000000000..863a5d07554130d5ede5c1a22fdec34109395ba0 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0042.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0043.html b/result_prior/3d_structures/ws/with_labels/molecule_0043.html new file mode 100644 index 0000000000000000000000000000000000000000..89e8ce62d02076479440d780ddc857e8676ac146 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0043.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0044.html b/result_prior/3d_structures/ws/with_labels/molecule_0044.html new file mode 100644 index 0000000000000000000000000000000000000000..0d6954be4075082f5fb3b9b62212908b9bab6728 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0044.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0045.html b/result_prior/3d_structures/ws/with_labels/molecule_0045.html new file mode 100644 index 0000000000000000000000000000000000000000..eebf603171ca0702b59388126e263849dd8fdab0 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0045.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0046.html b/result_prior/3d_structures/ws/with_labels/molecule_0046.html new file mode 100644 index 0000000000000000000000000000000000000000..078abb802a5332042f67aef4b375b22dde628d54 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0046.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0047.html b/result_prior/3d_structures/ws/with_labels/molecule_0047.html new file mode 100644 index 0000000000000000000000000000000000000000..2cbddc881097d618e4571e3df1f21e600046b8be --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0047.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0048.html b/result_prior/3d_structures/ws/with_labels/molecule_0048.html new file mode 100644 index 0000000000000000000000000000000000000000..e6ec78d0acd9ca023b7a41d06337c56981340bd3 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0048.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0049.html b/result_prior/3d_structures/ws/with_labels/molecule_0049.html new file mode 100644 index 0000000000000000000000000000000000000000..068f102dc811f40b5626879fd0023beccdc0251b --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0049.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/with_labels/molecule_0050.html b/result_prior/3d_structures/ws/with_labels/molecule_0050.html new file mode 100644 index 0000000000000000000000000000000000000000..d9b4f6ff8d03fc979b4ed6a62330abab86246d59 --- /dev/null +++ b/result_prior/3d_structures/ws/with_labels/molecule_0050.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0001.html b/result_prior/3d_structures/ws/without_labels/molecule_0001.html new file mode 100644 index 0000000000000000000000000000000000000000..e6b86ca7712e1a1893a4a0a2fe781199fab34739 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0001.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0002.html b/result_prior/3d_structures/ws/without_labels/molecule_0002.html new file mode 100644 index 0000000000000000000000000000000000000000..864def791ea040ed0ccbd7c215972a274b9932da --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0002.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0003.html b/result_prior/3d_structures/ws/without_labels/molecule_0003.html new file mode 100644 index 0000000000000000000000000000000000000000..d990a9e15189737d4d5e82509bfb29393ad3e3c7 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0003.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0004.html b/result_prior/3d_structures/ws/without_labels/molecule_0004.html new file mode 100644 index 0000000000000000000000000000000000000000..a8733602bacf3723738e870735ece9dd88a9b335 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0004.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0005.html b/result_prior/3d_structures/ws/without_labels/molecule_0005.html new file mode 100644 index 0000000000000000000000000000000000000000..70de5359ce2633961c7141c999c8ab55481a0042 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0005.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0006.html b/result_prior/3d_structures/ws/without_labels/molecule_0006.html new file mode 100644 index 0000000000000000000000000000000000000000..e648936903eaaa443b1d45f7c4c7f83451cc6a71 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0006.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0007.html b/result_prior/3d_structures/ws/without_labels/molecule_0007.html new file mode 100644 index 0000000000000000000000000000000000000000..1d5435d3e5b6e7c3aba3ebb02c923cb813fbdf70 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0007.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0008.html b/result_prior/3d_structures/ws/without_labels/molecule_0008.html new file mode 100644 index 0000000000000000000000000000000000000000..439a7e0a67dcd3282cb8d1001458d085808a3742 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0008.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0009.html b/result_prior/3d_structures/ws/without_labels/molecule_0009.html new file mode 100644 index 0000000000000000000000000000000000000000..49638109b01c4b69f91c55bc10621fbaba12f4ea --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0009.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0010.html b/result_prior/3d_structures/ws/without_labels/molecule_0010.html new file mode 100644 index 0000000000000000000000000000000000000000..5a5267f5d075bba8cb5d443ef775a782e8776a4e --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0010.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0011.html b/result_prior/3d_structures/ws/without_labels/molecule_0011.html new file mode 100644 index 0000000000000000000000000000000000000000..f7fb48116397820dcf44b9c8518fe2dbd3abc850 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0011.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0012.html b/result_prior/3d_structures/ws/without_labels/molecule_0012.html new file mode 100644 index 0000000000000000000000000000000000000000..12786bcf791ec32fde3dcc7473d9006206efd62a --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0012.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0013.html b/result_prior/3d_structures/ws/without_labels/molecule_0013.html new file mode 100644 index 0000000000000000000000000000000000000000..236b46ce9536b84e158e7a89146b4cb3a44367f6 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0013.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0014.html b/result_prior/3d_structures/ws/without_labels/molecule_0014.html new file mode 100644 index 0000000000000000000000000000000000000000..17e6654ab00e0d369a354445321edd92b1d3c4a2 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0014.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0015.html b/result_prior/3d_structures/ws/without_labels/molecule_0015.html new file mode 100644 index 0000000000000000000000000000000000000000..7048d4177b62b3a0f8f47d9efc3551021023d37c --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0015.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0016.html b/result_prior/3d_structures/ws/without_labels/molecule_0016.html new file mode 100644 index 0000000000000000000000000000000000000000..a0b91b997dec4bd4f53d21bd0090ef1dba68946d --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0016.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0017.html b/result_prior/3d_structures/ws/without_labels/molecule_0017.html new file mode 100644 index 0000000000000000000000000000000000000000..77aaa15b2a3e13717e8fc3e04a57a1fcc1ffc2a3 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0017.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0018.html b/result_prior/3d_structures/ws/without_labels/molecule_0018.html new file mode 100644 index 0000000000000000000000000000000000000000..eca5dc9a0f685f2dd93f08fb9255a452fcd551f7 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0018.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0019.html b/result_prior/3d_structures/ws/without_labels/molecule_0019.html new file mode 100644 index 0000000000000000000000000000000000000000..cff2b506f075b667c82cfaf409b6154a76cee7cc --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0019.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0020.html b/result_prior/3d_structures/ws/without_labels/molecule_0020.html new file mode 100644 index 0000000000000000000000000000000000000000..4f422a041f0fa7182fdb405a75b982773cb92817 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0020.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0021.html b/result_prior/3d_structures/ws/without_labels/molecule_0021.html new file mode 100644 index 0000000000000000000000000000000000000000..4e449603a1d898a152bf5353fe93b0d7b3a79545 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0021.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0022.html b/result_prior/3d_structures/ws/without_labels/molecule_0022.html new file mode 100644 index 0000000000000000000000000000000000000000..4d160e53ed2034c0a783c532aa850901828b545d --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0022.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0023.html b/result_prior/3d_structures/ws/without_labels/molecule_0023.html new file mode 100644 index 0000000000000000000000000000000000000000..97f8739d42287b15fc84a3ff2edd57af1b185c9f --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0023.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0024.html b/result_prior/3d_structures/ws/without_labels/molecule_0024.html new file mode 100644 index 0000000000000000000000000000000000000000..6ad322f2586f3b30beb6cc1dd80e4ce78835182f --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0024.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0025.html b/result_prior/3d_structures/ws/without_labels/molecule_0025.html new file mode 100644 index 0000000000000000000000000000000000000000..4ad5608d367ca9805e6d86b9abfdea7f11ae9519 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0025.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0026.html b/result_prior/3d_structures/ws/without_labels/molecule_0026.html new file mode 100644 index 0000000000000000000000000000000000000000..af15d3e70c3a92b1d636fda2c7594079b2ff7450 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0026.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0027.html b/result_prior/3d_structures/ws/without_labels/molecule_0027.html new file mode 100644 index 0000000000000000000000000000000000000000..e49f06bd935907f200dc1b46961ae18b4e8cc30f --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0027.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0028.html b/result_prior/3d_structures/ws/without_labels/molecule_0028.html new file mode 100644 index 0000000000000000000000000000000000000000..f040cbc8c7df39aaf043dfea9fd06a35abd5acb6 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0028.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0029.html b/result_prior/3d_structures/ws/without_labels/molecule_0029.html new file mode 100644 index 0000000000000000000000000000000000000000..ea670e1830db3fb4042cab7230084c8446597953 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0029.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0030.html b/result_prior/3d_structures/ws/without_labels/molecule_0030.html new file mode 100644 index 0000000000000000000000000000000000000000..e127fdcdba5a749b193a2b5606f160404ef123e5 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0030.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0031.html b/result_prior/3d_structures/ws/without_labels/molecule_0031.html new file mode 100644 index 0000000000000000000000000000000000000000..f8bee6a7664e2ebc22ca1db1144066f3cef00d7c --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0031.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0032.html b/result_prior/3d_structures/ws/without_labels/molecule_0032.html new file mode 100644 index 0000000000000000000000000000000000000000..cff07c649754ad10205629ff1044c40d15021947 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0032.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0033.html b/result_prior/3d_structures/ws/without_labels/molecule_0033.html new file mode 100644 index 0000000000000000000000000000000000000000..3f84fb8cf7c524556a8d36b9d86eeadc94638e3e --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0033.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0034.html b/result_prior/3d_structures/ws/without_labels/molecule_0034.html new file mode 100644 index 0000000000000000000000000000000000000000..273d8243269cf592d5016f7050ce643657422a38 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0034.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0035.html b/result_prior/3d_structures/ws/without_labels/molecule_0035.html new file mode 100644 index 0000000000000000000000000000000000000000..b8dbf459ea862aee840880cb17faf5b3fc61c4ca --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0035.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0036.html b/result_prior/3d_structures/ws/without_labels/molecule_0036.html new file mode 100644 index 0000000000000000000000000000000000000000..c8e77db632066ec251237648fee34deb2df500bc --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0036.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0037.html b/result_prior/3d_structures/ws/without_labels/molecule_0037.html new file mode 100644 index 0000000000000000000000000000000000000000..2b2f372d432065da41cd0f053de3ff4228cf3be9 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0037.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0038.html b/result_prior/3d_structures/ws/without_labels/molecule_0038.html new file mode 100644 index 0000000000000000000000000000000000000000..9848a9cab9b0669ce65456ff791f6076424cb22f --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0038.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0039.html b/result_prior/3d_structures/ws/without_labels/molecule_0039.html new file mode 100644 index 0000000000000000000000000000000000000000..d345b38a467b59faa406948facc79cd309d646b4 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0039.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0040.html b/result_prior/3d_structures/ws/without_labels/molecule_0040.html new file mode 100644 index 0000000000000000000000000000000000000000..142e0deae700c227f11db801f0097502f3127b71 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0040.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0041.html b/result_prior/3d_structures/ws/without_labels/molecule_0041.html new file mode 100644 index 0000000000000000000000000000000000000000..3cb018b8e92ef44d1b076e323f9b70dda3581fa3 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0041.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0042.html b/result_prior/3d_structures/ws/without_labels/molecule_0042.html new file mode 100644 index 0000000000000000000000000000000000000000..19c07ba9f47c4332be4ebb6bb925a3c99dd360a2 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0042.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0043.html b/result_prior/3d_structures/ws/without_labels/molecule_0043.html new file mode 100644 index 0000000000000000000000000000000000000000..c544ca248b5c38690cef3245721f07039e5dedc8 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0043.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0044.html b/result_prior/3d_structures/ws/without_labels/molecule_0044.html new file mode 100644 index 0000000000000000000000000000000000000000..f1a3cbf2e3519edf3918ea972f129c9cb48725b3 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0044.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0045.html b/result_prior/3d_structures/ws/without_labels/molecule_0045.html new file mode 100644 index 0000000000000000000000000000000000000000..aa5fd7ae8a2f01290c33df21093a746868ca5e20 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0045.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0046.html b/result_prior/3d_structures/ws/without_labels/molecule_0046.html new file mode 100644 index 0000000000000000000000000000000000000000..f37ca26760001ccdada097950356f02ab51f2acf --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0046.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0047.html b/result_prior/3d_structures/ws/without_labels/molecule_0047.html new file mode 100644 index 0000000000000000000000000000000000000000..974a3a5f847539c3c2ad4dfc7dfeb4cf373df182 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0047.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0048.html b/result_prior/3d_structures/ws/without_labels/molecule_0048.html new file mode 100644 index 0000000000000000000000000000000000000000..03bfcb1d7689f9b4ea950096a6fef917b26f9cea --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0048.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0049.html b/result_prior/3d_structures/ws/without_labels/molecule_0049.html new file mode 100644 index 0000000000000000000000000000000000000000..9935fa7ca8bad1ad7f79b2939d18ea37160c0aff --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0049.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/3d_structures/ws/without_labels/molecule_0050.html b/result_prior/3d_structures/ws/without_labels/molecule_0050.html new file mode 100644 index 0000000000000000000000000000000000000000..55bed18ed6ccf4d7ee8d89240056c0540b9d3df8 --- /dev/null +++ b/result_prior/3d_structures/ws/without_labels/molecule_0050.html @@ -0,0 +1,7 @@ + + + +
+
+ + \ No newline at end of file diff --git a/result_prior/FPs/6_de_feature.csv b/result_prior/FPs/6_de_feature.csv new file mode 100644 index 0000000000000000000000000000000000000000..fb196f511ca6414d88739f7043e0c37a14a313db --- /dev/null +++ b/result_prior/FPs/6_de_feature.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c8a0ed25c1f56afac15648080eceaa87464d616565c2031e52097201d67fda25 +size 16526474 diff --git a/result_prior/FPs/6_hu_feature.csv b/result_prior/FPs/6_hu_feature.csv new file mode 100644 index 0000000000000000000000000000000000000000..2ebe694ba4fa67921149faff4d17bd0182a6cc6b --- /dev/null +++ b/result_prior/FPs/6_hu_feature.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:dfb5e446f043b75804f0c56adafe1dd3c3fb93d23a352e4704bc0f423c24b842 +size 23366008 diff --git a/result_prior/FPs/6_lo_feature.csv b/result_prior/FPs/6_lo_feature.csv new file mode 100644 index 0000000000000000000000000000000000000000..be9953f2e4ea0ed14f393f1ab18a99dcc12b85ae --- /dev/null +++ b/result_prior/FPs/6_lo_feature.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d84ee9e3eea36bfd81b1d92a05bc4d24f9a10ce89beb75c06c7044b146476933 +size 17634818 diff --git a/result_prior/FPs/6_ws_feature.csv b/result_prior/FPs/6_ws_feature.csv new file mode 100644 index 0000000000000000000000000000000000000000..1b35f4a8e4e80790a652adf4fe031fea482163b3 --- /dev/null +++ b/result_prior/FPs/6_ws_feature.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a7ce17072731e377a355f0d97ade833bea0d2d62294bee2da8471c58ac9d043e +size 10697322 diff --git a/result_prior/FPs/all_fps_de.csv b/result_prior/FPs/all_fps_de.csv new file mode 100644 index 0000000000000000000000000000000000000000..370d655a91c640e2d1a90a284222951cf37f413f --- /dev/null +++ b/result_prior/FPs/all_fps_de.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c9d92b3769a5dcf11dac527bbfd815be878860a963523d15d0fb3917ea9d9dae +size 12339997 diff --git a/result_prior/FPs/all_fps_hu.csv b/result_prior/FPs/all_fps_hu.csv new file mode 100644 index 0000000000000000000000000000000000000000..c3f224eec1426dc6e86bcbce126f47573914488c --- /dev/null +++ b/result_prior/FPs/all_fps_hu.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:83b8030601eb71b45f7f949837252b88956d94d036f56d7a1653ae403ed6b053 +size 14118164 diff --git a/result_prior/FPs/all_fps_lo.csv b/result_prior/FPs/all_fps_lo.csv new file mode 100644 index 0000000000000000000000000000000000000000..f9807e7f1e7cace2ebdc2d8debe4cddd9a4fa082 --- /dev/null +++ b/result_prior/FPs/all_fps_lo.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:dad7a394efaa83ee14f45fbd7b573682aa1a666eef40b86e0eb37a3682c43257 +size 9078206 diff --git a/result_prior/FPs/all_fps_ws.csv b/result_prior/FPs/all_fps_ws.csv new file mode 100644 index 0000000000000000000000000000000000000000..6ef7490f85caa76c4ba69bf3aa48ddc81f2b0a7f --- /dev/null +++ b/result_prior/FPs/all_fps_ws.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2717da3e1c66020b2d60c2f57e9832140e3f30f614f85c6eebcc252a9fbe176d +size 5445509 diff --git a/result_prior/FPs/hu_fps.csv b/result_prior/FPs/hu_fps.csv new file mode 100644 index 0000000000000000000000000000000000000000..7b56884a4aa01bfcf7dce1afa8322ee2715eaa6e --- /dev/null +++ b/result_prior/FPs/hu_fps.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:910368c00d4417259aade0a222e4b5ac8e59a973ff6e9b53995805331a5fcfaf +size 24093276 diff --git a/result_prior/FPs/maccs_avalon_fps_de.csv b/result_prior/FPs/maccs_avalon_fps_de.csv new file mode 100644 index 0000000000000000000000000000000000000000..c454010ccc36145bb6505d3b98f3313b10b9d243 --- /dev/null +++ b/result_prior/FPs/maccs_avalon_fps_de.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1b8d70bccacdb7cccbd03c8f2418a4b194eb1075adcea6266c0f36a1fee1764f +size 3071859 diff --git a/result_prior/FPs/maccs_avalon_fps_hu.csv b/result_prior/FPs/maccs_avalon_fps_hu.csv new file mode 100644 index 0000000000000000000000000000000000000000..7be101afacfe049b469bfcce2a05c0ce5762f65d --- /dev/null +++ b/result_prior/FPs/maccs_avalon_fps_hu.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:729908c14d5ca94c96d60994b4883b7ac1f0063dd6ace6c99c29c400c2892641 +size 3514730 diff --git a/result_prior/FPs/maccs_avalon_fps_lo.csv b/result_prior/FPs/maccs_avalon_fps_lo.csv new file mode 100644 index 0000000000000000000000000000000000000000..c67b777424f6034b52be13f13a1bf93c62b222a2 --- /dev/null +++ b/result_prior/FPs/maccs_avalon_fps_lo.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c3eb7bb761c1567a7e3178685dccb3dd6613157e18080f1b3f78666a56526fd5 +size 2259476 diff --git a/result_prior/FPs/maccs_avalon_fps_ws.csv b/result_prior/FPs/maccs_avalon_fps_ws.csv new file mode 100644 index 0000000000000000000000000000000000000000..693854308dc927616b0a228b590db6b5a49e6018 --- /dev/null +++ b/result_prior/FPs/maccs_avalon_fps_ws.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e5ffb6379b3368674de5f8ba276cb3fc71141772851a7128b60ce9417397c6e2 +size 1354715 diff --git a/result_prior/Lipinski5_All_data_de.csv b/result_prior/Lipinski5_All_data_de.csv new file mode 100644 index 0000000000000000000000000000000000000000..d33431533fee90fa6a9e8b56444a1aa8fe354d90 --- /dev/null +++ b/result_prior/Lipinski5_All_data_de.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8a42ab93aec4f2824acbf9c3afa37facfac5f28aeb17d754a4fc1a8e1f126dd3 +size 35248 diff --git a/result_prior/Lipinski5_All_data_hu.csv b/result_prior/Lipinski5_All_data_hu.csv new file mode 100644 index 0000000000000000000000000000000000000000..4e3cebf081e4626a89ba0f563c07a83dbeb707de --- /dev/null +++ b/result_prior/Lipinski5_All_data_hu.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8ede4c985f87bdc38f4101ce5a63b9e0796056b00ae69bb8f9a003477021544a +size 40717 diff --git a/result_prior/Lipinski5_All_data_lo.csv b/result_prior/Lipinski5_All_data_lo.csv new file mode 100644 index 0000000000000000000000000000000000000000..b7ae182c8bb4a817dc1e0ca741cf093f2b4010be --- /dev/null +++ b/result_prior/Lipinski5_All_data_lo.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:aa2723bb9ed981e78c27e3ee0ba7eb639f5792248e38cba71418e6e1d03020aa +size 24734 diff --git a/result_prior/Lipinski5_All_data_ws.csv b/result_prior/Lipinski5_All_data_ws.csv new file mode 100644 index 0000000000000000000000000000000000000000..246911821d3cb574cd386a2bfd587a6a70c7d6ec --- /dev/null +++ b/result_prior/Lipinski5_All_data_ws.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3d1070850096da31dc0988ed2dac7adb197571db72996931928c0142194918d8 +size 15328 diff --git a/result_prior/Lipinski5_test_data_de.csv b/result_prior/Lipinski5_test_data_de.csv new file mode 100644 index 0000000000000000000000000000000000000000..c495ce3694bb660015c10cf6338f8120c1df7c3f --- /dev/null +++ b/result_prior/Lipinski5_test_data_de.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3280c10798e64dbd790bad5cd3b417954b5e87994a35d73078898e004551dc94 +size 3366 diff --git a/result_prior/Lipinski5_test_data_hu.csv b/result_prior/Lipinski5_test_data_hu.csv new file mode 100644 index 0000000000000000000000000000000000000000..83dc85baff481e7d3a514089ad6ca530707d65e2 --- /dev/null +++ b/result_prior/Lipinski5_test_data_hu.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:71de727500034f6f3e7efe8622180f686ecf277e9d432f00e0d09d3f97ef515b +size 3938 diff --git a/result_prior/Lipinski5_test_data_lo.csv b/result_prior/Lipinski5_test_data_lo.csv new file mode 100644 index 0000000000000000000000000000000000000000..cc891868e638ce425ed6fc8812f4711b60d9bdb1 --- /dev/null +++ b/result_prior/Lipinski5_test_data_lo.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9c4315b156f3f5c27a149b6605090945bb420cbb0fb12f1fa7e1069a1fd97db9 +size 2347 diff --git a/result_prior/Lipinski5_test_data_ws.csv b/result_prior/Lipinski5_test_data_ws.csv new file mode 100644 index 0000000000000000000000000000000000000000..54e14a71909450184703e64404fcd08123177ca4 --- /dev/null +++ b/result_prior/Lipinski5_test_data_ws.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a79f537601ef70894cd6274a105c080eb971ff350577251b4d509f3ef6ebf026 +size 1489 diff --git a/result_prior/LogS_frequency.png b/result_prior/LogS_frequency.png new file mode 100644 index 0000000000000000000000000000000000000000..b8ec6d201dea3b128dc8b8753727416f1b3ea5b0 --- /dev/null +++ b/result_prior/LogS_frequency.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:20c907b3465f8f5003fa7edf96f621e8942a34fc12b04ba989a27876fb0c2077 +size 107322 diff --git a/result_prior/TEST_DATA_RESULT/model_prediction_compare1.png b/result_prior/TEST_DATA_RESULT/model_prediction_compare1.png new file mode 100644 index 0000000000000000000000000000000000000000..b211cf46a2232e285982bdf016f4b1e5ac1d1e25 --- /dev/null +++ b/result_prior/TEST_DATA_RESULT/model_prediction_compare1.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:67bd49dfb00649ab401c89ab94899a54ab58cd03125b0b7697aaf182ba150d94 +size 999461 diff --git a/result_prior/TEST_DATA_RESULT/model_prediction_compare2.png b/result_prior/TEST_DATA_RESULT/model_prediction_compare2.png new file mode 100644 index 0000000000000000000000000000000000000000..336369fb61315d7534b69fcfc843caf6765db61e --- /dev/null +++ b/result_prior/TEST_DATA_RESULT/model_prediction_compare2.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f9cec9deb5d1e0736c4a6b580c370e7d12f384f600a8d67f69d886ee5b3c6f51 +size 1035540 diff --git a/result_prior/TEST_DATA_RESULT/model_prediction_compare3.png b/result_prior/TEST_DATA_RESULT/model_prediction_compare3.png new file mode 100644 index 0000000000000000000000000000000000000000..00c82d4c998481bc916c22abcdb255fa51b019da --- /dev/null +++ b/result_prior/TEST_DATA_RESULT/model_prediction_compare3.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:648071748fdf4ada2bb0e1dee34e6e780e7c3b935bf3ae5e84430f7c12d2dbe4 +size 551200 diff --git a/result_prior/Xai/de.png b/result_prior/Xai/de.png new file mode 100644 index 0000000000000000000000000000000000000000..5112dced52588985c4c5ba4309139eed97954e6e --- /dev/null +++ b/result_prior/Xai/de.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f1e95e1632c5915e270f257c881c7e3003255ab4e8e8e32329508135a1b0d3e1 +size 52831 diff --git a/result_prior/Xai/de_variable_importance.png b/result_prior/Xai/de_variable_importance.png new file mode 100644 index 0000000000000000000000000000000000000000..2cb6828010d2be0185025ae18c4c7d8ef415973a --- /dev/null +++ b/result_prior/Xai/de_variable_importance.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b74846c677cf3263800211ffc92d7b23e67263046a6ab61aa74cedcf300ac380 +size 36545 diff --git a/result_prior/Xai/hu.png b/result_prior/Xai/hu.png new file mode 100644 index 0000000000000000000000000000000000000000..dc761c2b8fb699a0a050f5f293014a7e62a40783 --- /dev/null +++ b/result_prior/Xai/hu.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b09a3eb6fa99024b14caf69b9cf898808d6005413d832d9fd70f8b4804b7427b +size 60628 diff --git a/result_prior/Xai/hu_variable_importance.png b/result_prior/Xai/hu_variable_importance.png new file mode 100644 index 0000000000000000000000000000000000000000..3ed1cd5112736108f4e9e488dd0e466ec3f9ddc2 --- /dev/null +++ b/result_prior/Xai/hu_variable_importance.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b131f7fa960f1bcf125fafbda2db3540bd8955baa798fc81b9a8d2b1fd911744 +size 35699 diff --git a/result_prior/Xai/lo.png b/result_prior/Xai/lo.png new file mode 100644 index 0000000000000000000000000000000000000000..4b9754481b998a8fab1ffa9744ed1bbc17047d35 --- /dev/null +++ b/result_prior/Xai/lo.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0f2e79e7ec845c792a654e3217dcaa546c569ac73c64c0436762c33db141aba7 +size 63679 diff --git a/result_prior/Xai/lo_variable_importance.png b/result_prior/Xai/lo_variable_importance.png new file mode 100644 index 0000000000000000000000000000000000000000..f52a4e097ae3765a2f09c1d487cfcd25398bdc2d --- /dev/null +++ b/result_prior/Xai/lo_variable_importance.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f4721c017b5c2c3440e6dbb33e709b4022f3bfeb5f2004262f0dba7b99391c34 +size 40474 diff --git a/result_prior/Xai/ws.png b/result_prior/Xai/ws.png new file mode 100644 index 0000000000000000000000000000000000000000..a28d90fe260a365f3fa40d6750311f939f416c39 --- /dev/null +++ b/result_prior/Xai/ws.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c39aa73fbd804ed0c4fffcf0ffb877ecfb4a1f64b1e04843a547671847b3e069 +size 52579 diff --git a/result_prior/Xai/ws_variable_importance.png b/result_prior/Xai/ws_variable_importance.png new file mode 100644 index 0000000000000000000000000000000000000000..9c354b491ce169ebcb3f196955c8f9b5e863c09e --- /dev/null +++ b/result_prior/Xai/ws_variable_importance.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:94de174ea067180a40b018427d8bd74bf45a1f2d12f47fea4ea39f11d59e22e1 +size 37441 diff --git a/result_prior/bRo5_vis_Delaney.png b/result_prior/bRo5_vis_Delaney.png new file mode 100644 index 0000000000000000000000000000000000000000..f8f458bb24db688e2ef399aba1156de3608e9c87 --- /dev/null +++ b/result_prior/bRo5_vis_Delaney.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:cc9838f7e37919b9517a8b4ac12c068e5c1812ed410130991975816fba836a88 +size 2736884 diff --git a/result_prior/bRo5_vis_Huuskonen.png b/result_prior/bRo5_vis_Huuskonen.png new file mode 100644 index 0000000000000000000000000000000000000000..9ebf947d14104e7cc202a48786bda54ee2ee81eb --- /dev/null +++ b/result_prior/bRo5_vis_Huuskonen.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d654dac7eb238dd8b10143036ef7e17d842b9c298ecf55b640d7b7d7ab049cc3 +size 827854 diff --git a/result_prior/bRo5_vis_Lovrics.png b/result_prior/bRo5_vis_Lovrics.png new file mode 100644 index 0000000000000000000000000000000000000000..f78257dc66a80a11506b86695c2a84aaeb134852 --- /dev/null +++ b/result_prior/bRo5_vis_Lovrics.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f84aac4517fa0a0f47ef0444b715df0bbfdb037a638db6be80ee673b562d84c0 +size 2538741 diff --git a/result_prior/bRo5_vis_ws496.png b/result_prior/bRo5_vis_ws496.png new file mode 100644 index 0000000000000000000000000000000000000000..36a5a955e5016a48164967f4e153377f3ce2cb2e --- /dev/null +++ b/result_prior/bRo5_vis_ws496.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bc6abcf5fc7af92b391db2fdf3e4efd391b433c6990fe94380b6005fb4cd0d9c +size 2005070 diff --git a/result_prior/corr_Delaney.png b/result_prior/corr_Delaney.png new file mode 100644 index 0000000000000000000000000000000000000000..0aa30748b7584bbfec59a963055edd7f80e4299f --- /dev/null +++ b/result_prior/corr_Delaney.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6e151c2ccaefc6fecfe31cbfc8c28a151c0eef2cf8856890dba6f945976dfa8c +size 3146371 diff --git a/result_prior/corr_Huuskonen.png b/result_prior/corr_Huuskonen.png new file mode 100644 index 0000000000000000000000000000000000000000..932091f0bd2477020a5d7657098b8fbba42e6a2e --- /dev/null +++ b/result_prior/corr_Huuskonen.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c442ee0385578a75f3e3e97a370f38268d3a1e3ab0e60301ca5bd4d1f6d3561f +size 2981904 diff --git a/result_prior/corr_Lovrics.png b/result_prior/corr_Lovrics.png new file mode 100644 index 0000000000000000000000000000000000000000..ded7a2b58457600113266994f0d1b843b9bf26eb --- /dev/null +++ b/result_prior/corr_Lovrics.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d4dc6008acf0477316494759d1f4b76fa27fc1f3380a1b02bf23b31a2c8bf98a +size 3608747 diff --git a/result_prior/corr_ws496.png b/result_prior/corr_ws496.png new file mode 100644 index 0000000000000000000000000000000000000000..07b59a183aa0a9cd48cb969b4b38aa490b0c4b0e --- /dev/null +++ b/result_prior/corr_ws496.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3a26493c6d43cbebacc52d3e7cd5400d0cf3d5c0403bc6421ec38ebd132d9742 +size 4310449 diff --git a/result_prior/descriptors_list.png b/result_prior/descriptors_list.png new file mode 100644 index 0000000000000000000000000000000000000000..d08f9898d76618f264680bc6f7a5fc738f882aa6 --- /dev/null +++ b/result_prior/descriptors_list.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c2124de7a49b69a27a5f0c3793df77702dc5efc6114197c5b60b0cb34172f67b +size 867300 diff --git a/result_prior/descriptors_list.svg b/result_prior/descriptors_list.svg new file mode 100644 index 0000000000000000000000000000000000000000..7d5149e3b828d75c54a249e0b01438fc9af0bdc6 --- /dev/null +++ b/result_prior/descriptors_list.svg @@ -0,0 +1,13048 @@ + + + + + + + + +MOLWT + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +MOLMR + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +MOLTPSA + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +MOLLOGP + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +ROTATEDBONDS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +HEAVYATOM + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMHACCEPTOR + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMHDONER + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMHETEROATOM + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMVALENCEELEC + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NHOHCOUNT + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NOCOUNT + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +RINGCOUNT + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMAROMATICR + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMSATURATER + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMALIPHATICR + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +LABUTEASA + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +BALABANJS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +BERTZCTS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +IPC + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +KAPPASERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + +CHISERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +11 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +12 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +13 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +14 + + +PHI + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +HALLKIERALPHA + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMAMIDEBONDS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +FRACTIONCSP3 + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMSPIROATOMS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +NUMBRIDGEHEADATOMS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +PEOEVSASERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +11 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +12 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +13 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +14 + + +SMRVSASERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + +SLOGPVSASERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +11 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +12 + + +ESTATEVSASERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +11 + + +VSAESTATESERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +5 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +6 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +7 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +8 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +9 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +10 + + +AUTOCORR2D + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +BCUT2D + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +PBF + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +PMISERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +3 + + +NPRSERIES + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +2 + + +RADIUSOFGYRATION + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +INERTIALSHAPEFACTOR + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +ECCENTRICIT + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +ASPHERICITY + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +SPHEROCITYINDEX + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +MQNS + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +AUTOCORR3D + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +RDF + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +MORSE + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +WHIM + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + +GETAWAY + +0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +1 + + + + + +EStateVSA10 +EStateVSA11 +VSAEState10 +PEOEVSA10 +PEOEVSA11 +PEOEVSA12 +PEOEVSA13 +PEOEVSA14 +SlogPVSA10 +SlogPVSA11 +SlogPVSA12 +EStateVSA1 +EStateVSA2 +EStateVSA3 +EStateVSA4 +EStateVSA5 +EStateVSA6 +EStateVSA7 +EStateVSA8 +EStateVSA9 +VSAEState1 +VSAEState2 +VSAEState3 +VSAEState4 +VSAEState5 +VSAEState6 +VSAEState7 +VSAEState8 +VSAEState9 +SMRVSA10 +PEOEVSA1 +PEOEVSA2 +PEOEVSA3 +PEOEVSA4 +PEOEVSA5 +PEOEVSA6 +PEOEVSA7 +PEOEVSA8 +PEOEVSA9 +SlogPVSA1 +SlogPVSA2 +SlogPVSA3 +SlogPVSA4 +SlogPVSA5 +SlogPVSA6 +SlogPVSA7 +SlogPVSA8 +SlogPVSA9 +SMRVSA1 +SMRVSA2 +SMRVSA3 +SMRVSA4 +SMRVSA5 +SMRVSA6 +SMRVSA7 +SMRVSA8 +SMRVSA9 +ChiNn_ +ChiNv_ +Kappa1 +Kappa2 +Kappa3 +NPR1 +NPR2 +Chi0n +Chi1n +Chi2n +Chi3n +Chi4n +Chi0v +Chi1v +Chi2v +Chi3v +Chi4v +PMI1 +PMI2 +PMI3 +Chi0 +Chi1 + + + + + + + + + + diff --git a/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_de.csv b/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_de.csv new file mode 100644 index 0000000000000000000000000000000000000000..b632706df2e1757e60f4444949fd4a457d0319e5 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_de.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c37db4950485a785f82b1367f0dab526f906a8f2a6fbd636e89abaca980b41fb +size 3847 diff --git a/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_hu.csv b/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_hu.csv new file mode 100644 index 0000000000000000000000000000000000000000..99ad85cccb7fd1cf593b1c7f1d0ac14124702706 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_hu.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:866488889046e124c0177c3a5b3df2a7ce4123f53069e3ee5feec7d6a33fef2a +size 3845 diff --git a/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_lo.csv b/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_lo.csv new file mode 100644 index 0000000000000000000000000000000000000000..4898094a7dd773d753bbc7f084083516369c0585 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_lo.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2cbfbbcc589ac15cfaccda207e180d77db8a2c54d472e83d5bee6b0a6d27cd0e +size 3857 diff --git a/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_ws.csv b/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_ws.csv new file mode 100644 index 0000000000000000000000000000000000000000..2c7e595d26e5c908a76d78c7eaeb905ed9af9fe9 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/3_r2_score_rank_epoch1000_ws.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a5d89cb792033cc62b966a6bfbc0077c05d2c4934e3c4e389dfecadd629911b9 +size 3854 diff --git a/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[de].csv b/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[de].csv new file mode 100644 index 0000000000000000000000000000000000000000..f8c9bd734d784dd0a98b76b365ebf2a25abd3088 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[de].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:036a64ca1840f0b964d9813282ea830d73d2829228cf23b5246c83d4e19c0a62 +size 3513 diff --git a/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[hu].csv b/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[hu].csv new file mode 100644 index 0000000000000000000000000000000000000000..add775c043203869131d37302a2857c0b76a7e50 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[hu].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:39eecd3c000f20b9cc79ca62cfc2a958382e1096cd9b02b64cc0bf3b0487acd1 +size 1631 diff --git a/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[lo].csv b/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[lo].csv new file mode 100644 index 0000000000000000000000000000000000000000..68b55bba03d08493d21d5120dc34059cda21744e --- /dev/null +++ b/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[lo].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:dfab780d4ab17c93cedbfc23f37b20caacb731e6634b8cc67990ac6f53bb083e +size 1389 diff --git a/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[ws].csv b/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[ws].csv new file mode 100644 index 0000000000000000000000000000000000000000..73ced6f8200a1d1e389319974e71180bf7664d18 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/[3]_individual_r2_score_higher_than_original_prediction[ws].csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7c63e7739fa685b681e3d4437665bbfb15cea7d919477c5a76a2bbcdf84b0cc1 +size 2818 diff --git a/result_prior/dnn_feature_evaluation/chem_descriptor_r2score_result_ALL_horizontal.png b/result_prior/dnn_feature_evaluation/chem_descriptor_r2score_result_ALL_horizontal.png new file mode 100644 index 0000000000000000000000000000000000000000..0e09fe7acc1ce43c54cb3905bbc86b2b6d813288 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/chem_descriptor_r2score_result_ALL_horizontal.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:47906c7884ac37777a1f445a74f6854097248aa81c922e131e5ceb13aa6edb51 +size 5244490 diff --git a/result_prior/dnn_feature_evaluation/chem_descriptor_r2score_result_ALL_vertical.png b/result_prior/dnn_feature_evaluation/chem_descriptor_r2score_result_ALL_vertical.png new file mode 100644 index 0000000000000000000000000000000000000000..3043def0194b15287bbe298cc06e8887d6843a70 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/chem_descriptor_r2score_result_ALL_vertical.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2d645afe4639a04de8c53176a47ba853fd4cd0eb8bb8a90ac6aa3cb34905f677 +size 2409147 diff --git a/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_de_32batch_100epoch_0.001lr.png b/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_de_32batch_100epoch_0.001lr.png new file mode 100644 index 0000000000000000000000000000000000000000..8338628ec120efadbaa2506f9737cb973810d265 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_de_32batch_100epoch_0.001lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:010d681cc5c13e2bcfde3881d258c9312aa45cce672003c10978d873da47d54b +size 421028 diff --git a/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_hu_32batch_100epoch_0.001lr.png b/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_hu_32batch_100epoch_0.001lr.png new file mode 100644 index 0000000000000000000000000000000000000000..014839a5de098080946157c7ac645ef6ba3a0ceb --- /dev/null +++ b/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_hu_32batch_100epoch_0.001lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f9d3d59fea54d3cb1f41ab980baf5c5a55379a61c5d50c3a5d662a800690f653 +size 419268 diff --git a/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_lo_32batch_100epoch_0.001lr.png b/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_lo_32batch_100epoch_0.001lr.png new file mode 100644 index 0000000000000000000000000000000000000000..969d20d65590e17df47604f5469e0c23503786b8 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_lo_32batch_100epoch_0.001lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f4b19e6ca7f593dc62b103cc269cc4b60006831aab53ee1c00f1eb8479a6782a +size 425074 diff --git a/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_ws_32batch_100epoch_0.001lr.png b/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_ws_32batch_100epoch_0.001lr.png new file mode 100644 index 0000000000000000000000000000000000000000..4f7364ca288a403eabf0d84a3df874497d2ae87d --- /dev/null +++ b/result_prior/dnn_feature_evaluation/r2_score_all_minus_inc_ws_32batch_100epoch_0.001lr.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0874909b3c9a14aa7b591e30ab192748bac5b39ceba5d7c75184a85204131158 +size 428462 diff --git a/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_de.png b/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_de.png new file mode 100644 index 0000000000000000000000000000000000000000..fd0035ca352d4bfa831ba8d03e6dc26fef3e0831 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_de.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:93854a1bc4ca9e2119df12ee713b7831f00de5c52bed1e8334b5d552301f0fa6 +size 642398 diff --git a/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_hu.png b/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_hu.png new file mode 100644 index 0000000000000000000000000000000000000000..eedb4b3830ee3eda15a6677eedc53dbf5b24cd2a --- /dev/null +++ b/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_hu.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a50dfe74f7f2b226fc5981d4c748d3b95476d293508dc243ea606bd172904128 +size 642755 diff --git a/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_lo.png b/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_lo.png new file mode 100644 index 0000000000000000000000000000000000000000..193a908815a24b903bf14dba14096bbc77bed56a --- /dev/null +++ b/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_lo.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:91686e463c5926bcf536e59f970c3a1970e81b18853d16dd701c6803abb2de9f +size 647845 diff --git a/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_ws.png b/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_ws.png new file mode 100644 index 0000000000000000000000000000000000000000..e1ad98915748c4e481c4bd0375886ac2a06da864 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/r2_score_each_descriptors_ws.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7aa997cbb598f750fc3008ac7664eb7dbfe188e03d05a864205621bd2f6702ba +size 656298 diff --git a/result_prior/dnn_feature_evaluation/record_fps2_r2_score_de.csv b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_de.csv new file mode 100644 index 0000000000000000000000000000000000000000..8aea5f332902f5101d7ae3c862c72a4c75423940 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_de.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:cf788f007cb042a9c6cbb47e8edd241cfe3a7cacbc0bade49e94cea778343577 +size 3852 diff --git a/result_prior/dnn_feature_evaluation/record_fps2_r2_score_de_32batch_100epoch_0.001lr.csv b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_de_32batch_100epoch_0.001lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..7fb1e1f81e54022083c11575812083822cfacaea --- /dev/null +++ b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_de_32batch_100epoch_0.001lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:85934660ee876d5a4658b7957e83011bdd91689418d08712f2797fa7d2edb5cf +size 3858 diff --git a/result_prior/dnn_feature_evaluation/record_fps2_r2_score_hu.csv b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_hu.csv new file mode 100644 index 0000000000000000000000000000000000000000..d7df3ce9e6ca1d10a33d489b076930ce2c91a131 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_hu.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:030e2053a609fbfb2aa5f3d5d16ebaf7893385ef2c2062887208259fcb2e1a73 +size 3848 diff --git a/result_prior/dnn_feature_evaluation/record_fps2_r2_score_hu_32batch_100epoch_0.001lr.csv b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_hu_32batch_100epoch_0.001lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..22e95bab92f21a643c1a63d99be25f6eaa60e4f3 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_hu_32batch_100epoch_0.001lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:33690b63c130d103b1e38e5037457503366254610513dc7a0669012034933a3b +size 3858 diff --git a/result_prior/dnn_feature_evaluation/record_fps2_r2_score_lo.csv b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_lo.csv new file mode 100644 index 0000000000000000000000000000000000000000..44939aaede5182cc197b7129a185aab11988db59 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_lo.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8cdd8b15a22a3b2cbd05621d17f074d4e4111bd21a664af1168a1993540040ee +size 3848 diff --git a/result_prior/dnn_feature_evaluation/record_fps2_r2_score_lo_32batch_100epoch_0.001lr.csv b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_lo_32batch_100epoch_0.001lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..9b3e12f4388b5e173ed0017e8cc3dd902f70a883 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_lo_32batch_100epoch_0.001lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c796c778916771e389698f27e06f61220b243d143f8863506d4fd89fbd3d154d +size 3876 diff --git a/result_prior/dnn_feature_evaluation/record_fps2_r2_score_ws.csv b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_ws.csv new file mode 100644 index 0000000000000000000000000000000000000000..c2e652621705856e196f4d15e941a60a6121140e --- /dev/null +++ b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_ws.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d1684242cea6ce81c2d2960a90f6b0504fc91c94d9dbfc0b3e23ab43fdac39af +size 3857 diff --git a/result_prior/dnn_feature_evaluation/record_fps2_r2_score_ws_32batch_100epoch_0.001lr.csv b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_ws_32batch_100epoch_0.001lr.csv new file mode 100644 index 0000000000000000000000000000000000000000..f694b7c585a153fdb2d5c28c5800211f9cfdafa6 --- /dev/null +++ b/result_prior/dnn_feature_evaluation/record_fps2_r2_score_ws_32batch_100epoch_0.001lr.csv @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3430a44b9c38892f53fcf687016f40c9bdcb284f668b15add6c44da515bc6245 +size 3860 diff --git a/result_prior/fin_report_drawing_de.xlsx b/result_prior/fin_report_drawing_de.xlsx new file mode 100644 index 0000000000000000000000000000000000000000..1cc395defd69016117bcdccc27e475706f376216 --- /dev/null +++ b/result_prior/fin_report_drawing_de.xlsx @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8774c6cae12417cdb6a9ece425c10689daf3972da46ebc1101b748aee0936481 +size 597579 diff --git a/result_prior/fin_report_drawing_hu.xlsx b/result_prior/fin_report_drawing_hu.xlsx new file mode 100644 index 0000000000000000000000000000000000000000..d52027c310e089894351b4386262dc8f213bdaf6 --- /dev/null +++ b/result_prior/fin_report_drawing_hu.xlsx @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:413736ceeee6db415a796e87135ad457658eadc2859c19abbf7680e4f1a9deaf +size 671589 diff --git a/result_prior/fin_report_drawing_lo.xlsx b/result_prior/fin_report_drawing_lo.xlsx new file mode 100644 index 0000000000000000000000000000000000000000..2688b5794e1eaa8ddc615f0b606aebacaadf54d7 --- /dev/null +++ b/result_prior/fin_report_drawing_lo.xlsx @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8c98a64b7058befd43034620c0da91f9b785c8928bd0dd1dbc3d3cb1e09b2168 +size 454808 diff --git a/result_prior/fin_report_drawing_ws.xlsx b/result_prior/fin_report_drawing_ws.xlsx new file mode 100644 index 0000000000000000000000000000000000000000..01fe78154d9a53053f78f6cd78d7349be98080fc --- /dev/null +++ b/result_prior/fin_report_drawing_ws.xlsx @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9d9db1f8b91856437010a22fd01c5d2fca71e6776a8e5f5af2f641c503e93339 +size 263437 diff --git a/result_prior/res1.png b/result_prior/res1.png new file mode 100644 index 0000000000000000000000000000000000000000..65f089335ca378c2fcb5efe48986656b8439b3e1 --- /dev/null +++ b/result_prior/res1.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:dab767f1e2d7b50cb6497d6b185feadfec4bc51891a23bc153f91f8667c23856 +size 307091 diff --git a/result_prior/res2.png b/result_prior/res2.png new file mode 100644 index 0000000000000000000000000000000000000000..59f6df2d6bb4d338fbeef5108e2e9f61850758fd --- /dev/null +++ b/result_prior/res2.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6596fed523057f12639c5d5aafb7683ffe26efa5a4ff4fe9867f5d07684466ea +size 270923 diff --git a/result_prior/res3.png b/result_prior/res3.png new file mode 100644 index 0000000000000000000000000000000000000000..de2fd858e0e79643e060dbb9eaf6360469d72a04 --- /dev/null +++ b/result_prior/res3.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f01dfff83fc2da7a16a234eca9701bd21b3f36e4aead708e0608cf36a0f3a059 +size 171976 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_AUTOCORR2D.png b/result_prior/result_corr/de/corr[de]_logS_with_AUTOCORR2D.png new file mode 100644 index 0000000000000000000000000000000000000000..2c669130a0d12fef1be769354531bd6c346086fa --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_AUTOCORR2D.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3b93d44e9de9db72c6b62ec5efcd5b782d7982b017d5cefe747f30deebf56a8d +size 272261 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_AUTOCORR2D_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_AUTOCORR2D_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..573c7328115abfb211e758d28309755382f0210f --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_AUTOCORR2D_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d9089e29883164944c6666f35728ae28c8d73ac1ce275eff8e3fe7cc66a9444d +size 141954 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_BalabanJ.png b/result_prior/result_corr/de/corr[de]_logS_with_BalabanJ.png new file mode 100644 index 0000000000000000000000000000000000000000..5d8a2c1e0646a5728bf177a35086bd1cfd82d8f0 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_BalabanJ.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f2356407bef92b52411ed09d67479d1a086378b84430a4b238fbaa83a7648bf6 +size 242919 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_BalabanJ_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_BalabanJ_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..c450901b7c74ed2d6f6c3d16ddc79124ade34e0e --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_BalabanJ_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a34eb4232983e4b68d26c5bf95f5991bfea4ae0837baf9136cb0258942657cac +size 141793 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_FractionCSP3.png b/result_prior/result_corr/de/corr[de]_logS_with_FractionCSP3.png new file mode 100644 index 0000000000000000000000000000000000000000..41c114f1d4372f043d5f97111e2d1c4a182e2ed1 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_FractionCSP3.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2d662221162c60cb753ce081d8cf3ff61194deb5b2d22feacf336cc113a542a2 +size 270832 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_FractionCSP3_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_FractionCSP3_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..e985a71c260850ad40dd30de7162f60e0740fb42 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_FractionCSP3_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:33235fccf02df192b85b6a5e9967b74f674f0adebaaae2a7cc7f0a880f909162 +size 134232 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_GETAWAY.png b/result_prior/result_corr/de/corr[de]_logS_with_GETAWAY.png new file mode 100644 index 0000000000000000000000000000000000000000..fa1568f0f7d6c62f63b07c90329d31e8e4de459c --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_GETAWAY.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:065b86f37b5d5863bbc9c1916d67be27480d4b941f79edbd87313d59b40c9a92 +size 268041 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_GETAWAY_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_GETAWAY_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..0fb0ea67a81436c2beb25f47f1a967d4db37ecb7 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_GETAWAY_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:59b7d840245fb9120836f7765929cffb5664308dc81817a0d24b5e142e628eb0 +size 125668 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_InertialShapeFactor.png b/result_prior/result_corr/de/corr[de]_logS_with_InertialShapeFactor.png new file mode 100644 index 0000000000000000000000000000000000000000..d9f15ad9f647d29c4c199614597c9b3f770918a3 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_InertialShapeFactor.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f140147efb37a094aaa83309dc592f9428f2864b0b986b5a24d3621ff43c291f +size 206024 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_InertialShapeFactor_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_InertialShapeFactor_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..6b3c06ff1d229a9059516cdbc8757f4d30a4d2b0 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_InertialShapeFactor_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bebbf689ce8ed82d7b396734f900fb0bc159adc378982cfa47f943708bacc9eb +size 135451 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_MORSE.png b/result_prior/result_corr/de/corr[de]_logS_with_MORSE.png new file mode 100644 index 0000000000000000000000000000000000000000..20532092d7f5e0babb634ca073855e71d86916f3 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_MORSE.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:27b9b4c0c57478fbe2f0e81203e84ff48490cababbe7991388f59538f57d57d8 +size 127163 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_MORSE_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_MORSE_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..98f14ae9814b31120ba9f8c67786254cf018a41e --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_MORSE_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:72c296db26315fc835e19ab6ac9cc9c1ee0f5da92ee5eeb50725f7d511ec0da9 +size 82159 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_MQNs_.png b/result_prior/result_corr/de/corr[de]_logS_with_MQNs_.png new file mode 100644 index 0000000000000000000000000000000000000000..cb60a6123a7bcce9cf699e0044568b38f83ceac7 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_MQNs_.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b330c0c3db30ba79de0a830bb1898ac3f091f3ce058c51c485910ca355a145e +size 245157 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_MQNs__only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_MQNs__only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..5068b0564cfb4bae782598f54d49ce247fda30f5 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_MQNs__only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:318363102cda926f8bbe258e0933e4f34463323d5b6faad06906362b607018c4 +size 151067 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_MolLogP.png b/result_prior/result_corr/de/corr[de]_logS_with_MolLogP.png new file mode 100644 index 0000000000000000000000000000000000000000..75a4020f06261d08624774af47dda18ee77413ab --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_MolLogP.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4248def08c0dea80c7d48a73485e6d812c3b134ef6f61ba0f318405f2fe432f6 +size 199528 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_MolLogP_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_MolLogP_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..3cbaaddfc21c61c38441196983121bfc2b0e7709 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_MolLogP_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3245f19933a81197b77a73153b2710c3add2ac284603214d80226a0a13bfcd37 +size 138153 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_MolMR.png b/result_prior/result_corr/de/corr[de]_logS_with_MolMR.png new file mode 100644 index 0000000000000000000000000000000000000000..9c27d9a1a4c1f5eea24ea003f478546c496132c7 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_MolMR.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fc86165295097c65a7d8549520ab34dd3702af92f4bcf20166e39306e337886f +size 247472 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_MolMR_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_MolMR_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..ea68562efbfd8568ad94dcabf21a8267ffa70c27 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_MolMR_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e9b54642f9e3371c9a76462558bee4b0de660858178a8dd8bc815763d7e365f1 +size 144476 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_MolWt.png b/result_prior/result_corr/de/corr[de]_logS_with_MolWt.png new file mode 100644 index 0000000000000000000000000000000000000000..129912ccab9e5c27f232f7d9e0cb856994b57b26 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_MolWt.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:706405599e3fc6d1d8caf14a801223ab9d7737e5e3ac2008b5fb4984a272d912 +size 258947 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_MolWt_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_MolWt_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..7bf92fd9ac72f4a148a4d62027c90f2e0943702e --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_MolWt_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:63fe2e082b41b5004f5415a8b9bfd7dd0f0c2f008f357bdbeb0d43287fe9842f +size 151140 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_NPR_series.png b/result_prior/result_corr/de/corr[de]_logS_with_NPR_series.png new file mode 100644 index 0000000000000000000000000000000000000000..05261776759996069975777fac7a4f90547f790f --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_NPR_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ea793ab8f7fd68cda24f63fad233b2b51cb19e718cf88d973d23688a302fc75c +size 142270 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_NPR_series_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_NPR_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..1e41f93b1d57483dc9f5b295919bcf32556c1c5e --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_NPR_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9336079cb3c390ff127a1a8b4aebcc8522424aa1d43b8def4f75a160c6a6f401 +size 106448 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_NumAliphaticRings.png b/result_prior/result_corr/de/corr[de]_logS_with_NumAliphaticRings.png new file mode 100644 index 0000000000000000000000000000000000000000..5e1c5a1590ef653644e39159a485f9c9f8547571 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_NumAliphaticRings.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6fe9d46b9f5ac9c81221a28aaa87e5fce93891d6c673e0d36c008cec78c6e939 +size 206237 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_NumAliphaticRings_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_NumAliphaticRings_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..735bf73649af1b4439e3ecd6c894d646c6e3fe9d --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_NumAliphaticRings_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3b89ba16f14f8b4c0513e046cc01ccdc1f23c3ccac899f96208e94433a21ea4d +size 107644 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_NumBridgeheadAtoms.png b/result_prior/result_corr/de/corr[de]_logS_with_NumBridgeheadAtoms.png new file mode 100644 index 0000000000000000000000000000000000000000..f04ad58f0e0e9e69610c9eb20d4344d88925728b --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_NumBridgeheadAtoms.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:456b6dd5442b2c3807e3e5e21f2e2c3f0a05ebae6707844248b8268f85cc2a65 +size 144398 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_NumBridgeheadAtoms_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_NumBridgeheadAtoms_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..7d01b83f1a4eade00988a4c09b08a3c3901fcfd8 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_NumBridgeheadAtoms_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2bb633f52c53928909aff065138255fd94acc7c3d686b8e9f3e266e3b6434c5e +size 111517 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_NumSaturatedRings.png b/result_prior/result_corr/de/corr[de]_logS_with_NumSaturatedRings.png new file mode 100644 index 0000000000000000000000000000000000000000..8c817d0c29ba8b04e8905744f19067ccf9fbb61b --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_NumSaturatedRings.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d16ab0460ec1cf29a7fd4a2254932bc391867cdd6d7e60b06464af1a70e024d5 +size 209420 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_NumSaturatedRings_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_NumSaturatedRings_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..68d472daf1b10a9771d606b9cf14f4c55f534067 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_NumSaturatedRings_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:51af2e3fdb603c80ee7377ed7e2791a28f07a537e072421fe3b89c0e0c0dfc11 +size 104161 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_NumSpiroAtoms.png b/result_prior/result_corr/de/corr[de]_logS_with_NumSpiroAtoms.png new file mode 100644 index 0000000000000000000000000000000000000000..0dd98d71ce11d6697cb1584250d6e89d3ebdb723 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_NumSpiroAtoms.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f8b42cd96fa9c59eae2bafcc490ae183ef8343900f1fdf2eae5d6fbff65d13c4 +size 89568 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_NumSpiroAtoms_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_NumSpiroAtoms_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..e0b85ead6909fcea9556510d396f666145d19427 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_NumSpiroAtoms_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6d528817190b4b14d86d484ecb6a8b6b8ce9dca75400b0c75d6d8ceaf91423d2 +size 93269 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_PBF.png b/result_prior/result_corr/de/corr[de]_logS_with_PBF.png new file mode 100644 index 0000000000000000000000000000000000000000..1dbd73e50c72c90bc031ae4e20d1e220696ef11d --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_PBF.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:566ead40fedcc38438cf7099944c9be284d0ea68207ee2c81a3f27092556f7e2 +size 207562 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_PBF_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_PBF_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..8f3470a636b60187224410defd05eac3d1c569c0 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_PBF_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4271743f523b2dacfd228ebb749cb6b4b5d3be3f584d66cafc0cf5fbc5608287 +size 130179 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_Phi.png b/result_prior/result_corr/de/corr[de]_logS_with_Phi.png new file mode 100644 index 0000000000000000000000000000000000000000..b1b8c082787120c1c4434bd62599b50a8675a91a --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_Phi.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3fdeca55a898b1418ecd1865ed04a733d1d6ed429f1eddfcbc79265a93caaa57 +size 168728 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_Phi_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_Phi_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..571d15c965a78f15dc4c50501626348ecbb9dbde --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_Phi_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ed51417857570071e079d8a96cc5e095d6f723a01b7003c21d3bf186e6cc34e5 +size 112997 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_RadiusOfGyration.png b/result_prior/result_corr/de/corr[de]_logS_with_RadiusOfGyration.png new file mode 100644 index 0000000000000000000000000000000000000000..acb2c2590b00b4192dfc64e246490ce91471fe7d --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_RadiusOfGyration.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e35301bb496c022b73d6987ac02ba249e644d3c40618cf4d9ae193793bdda4e7 +size 224049 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_RadiusOfGyration_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_RadiusOfGyration_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..25e2a5122246238ff2fbe43eaa0650befa767adf --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_RadiusOfGyration_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3eb7133b3074655a4343bb6eb65c1535ee3d402bfa073185123b7c6ce12533c5 +size 136122 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_SMR_VSA_series.png b/result_prior/result_corr/de/corr[de]_logS_with_SMR_VSA_series.png new file mode 100644 index 0000000000000000000000000000000000000000..966781ac2c40bcd99f63aec53dd37201af42c2d4 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_SMR_VSA_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:88370a1ce43c497d27a3ee83cbe46c7aba5505ef7ea605532580a26230434209 +size 263278 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_SMR_VSA_series_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_SMR_VSA_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..e2ce81c4393d75d4d943033ec499582375dcf1f1 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_SMR_VSA_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6f3f55d4a210b96879cd4facbebdac30342df266cc98f2d6e2d8d53e6b422227 +size 162048 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_TPSA.png b/result_prior/result_corr/de/corr[de]_logS_with_TPSA.png new file mode 100644 index 0000000000000000000000000000000000000000..9435e4d6d27c85ab93b6fc5b875dfa6fc15f279f --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_TPSA.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9b797a127350619428c13ca293bce1d5f31363206e34a9bd7540de548ce4465d +size 207076 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_TPSA_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_TPSA_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..aa4985e08b090fc4288b564adcf26c0e4b66d2fb --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_TPSA_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0d34cb010c7eb023a751309d8f6424b2e4057e10dd9c418bd06d266ab30eedd2 +size 122923 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_ValenceElectrons.png b/result_prior/result_corr/de/corr[de]_logS_with_ValenceElectrons.png new file mode 100644 index 0000000000000000000000000000000000000000..f3c98f32eb929b088b7565b8f1b1a5cdf423472e --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_ValenceElectrons.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ce2297e2da1d44ad00b3fee7dd18bd1d426fda8aaa60b5e0d3e04d087fdb921f +size 262691 diff --git a/result_prior/result_corr/de/corr[de]_logS_with_ValenceElectrons_only_dots.png b/result_prior/result_corr/de/corr[de]_logS_with_ValenceElectrons_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..5833ebb6bbb8ecda4efe8c002ad93b713482a584 --- /dev/null +++ b/result_prior/result_corr/de/corr[de]_logS_with_ValenceElectrons_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:381a1c4270cfb157cdd9028ac399a14bfa5d446cd299ca7b609cfd6a1042c4c7 +size 146833 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR2D.png b/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR2D.png new file mode 100644 index 0000000000000000000000000000000000000000..0cae7bbbad4ec6380965b75485bb199e5dc6c15b --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR2D.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:192322219c76dd53c5a0108ce8712c2ed7afacacf3cfdaf30b6b75355f047286 +size 278599 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR2D_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR2D_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..b17c41034ab9e9e6367661c30c7f9579de2e983d --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR2D_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1e9804eabbdaa78095198a0334607715630bf96a058081b90d125677bf3779a3 +size 147510 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR3D.png b/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR3D.png new file mode 100644 index 0000000000000000000000000000000000000000..6815619d783260059cda0a3c288d7d510443e21f --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR3D.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a2a29dbf1771a16c5ba59a6b384fa2626087553bb0997eb8ffd0a7465672f697 +size 284013 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR3D_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR3D_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..3250278d0c9d77a01c9d94f974a14dd6b76e6848 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_AUTOCORR3D_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:999c4c09bd8ba03e9424d60b775b890745f78e58c3307321e5a8fcdc90941983 +size 168042 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_Chi_series.png b/result_prior/result_corr/hu/corr[hu]_logS_with_Chi_series.png new file mode 100644 index 0000000000000000000000000000000000000000..7633d950aa021ba75c40d1e3e7c79ed0d86bffc4 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_Chi_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b3df4cada671bbd840b978e01f3d2d9f0cc38e383b8745c9a16ad8b6a03ae71f +size 258056 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_Chi_series_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_Chi_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..19ed622fc8e543c90e0a8769b8acec2626c6e5a9 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_Chi_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9db5b9aca8f282419a443516c24d18dbd781011d12a3a4b8eef066355d800ae8 +size 151756 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_EState_VSA_series.png b/result_prior/result_corr/hu/corr[hu]_logS_with_EState_VSA_series.png new file mode 100644 index 0000000000000000000000000000000000000000..e685abebcaf6aded648ce7647fc8b37b2d559d30 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_EState_VSA_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c6f8a666851064c09530d360534083af5b4cbb5633360e693f2c6732da08bd7c +size 260185 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_EState_VSA_series_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_EState_VSA_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..1150f3b58d162b315e2bab0fa8946253349a277a --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_EState_VSA_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d476e6f6793d1616052a860ad781b00abe01354220486706f4ab3affb2b9568d +size 159124 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_Eccentricity.png b/result_prior/result_corr/hu/corr[hu]_logS_with_Eccentricity.png new file mode 100644 index 0000000000000000000000000000000000000000..ddd408ea926e1d6c9b7758cf7f86181aa34f3e9b --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_Eccentricity.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3d3b9df7fdb40a485c47f06a9a2060705b4e52e372923b1e18e114ad9418713e +size 269397 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_Eccentricity_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_Eccentricity_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..e356764754b30e81d985b70666b0316c7fd79f06 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_Eccentricity_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:18c23d8cd052986881cb8a7624b67b811d61f92b54f29352adf3203a0b347f99 +size 164648 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_GETAWAY.png b/result_prior/result_corr/hu/corr[hu]_logS_with_GETAWAY.png new file mode 100644 index 0000000000000000000000000000000000000000..acac404c68159e99fa2f2f6ebde25e3874eb8004 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_GETAWAY.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4fa18d63cabd3cca538c5b5aea4daa895a73e96d194019be683d034f3ebbf3f1 +size 284218 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_GETAWAY_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_GETAWAY_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..97f37822df4b2d3197924da020f496405e58f016 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_GETAWAY_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:049f9151b6a52b1b62eeab717baacef743d4ccf0d091704bd78d9a0957c6dac2 +size 132350 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_HallKierAlpha.png b/result_prior/result_corr/hu/corr[hu]_logS_with_HallKierAlpha.png new file mode 100644 index 0000000000000000000000000000000000000000..13790c7092c2c9e9231cf3e0ea451df0c04c4e0e --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_HallKierAlpha.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e119bb9c4eda3e178618d1b2901ddb15458c25ba406e5c0257cc6ce9299a50f4 +size 250161 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_HallKierAlpha_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_HallKierAlpha_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..ff6f8903ba449db072abcb2042c946b5cf0f08ba --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_HallKierAlpha_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:80bbe9a5144b3fa519b8e5debdd03ea1e4728b30479b0c9604c88f67a9bcaccf +size 143163 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_MQNs_.png b/result_prior/result_corr/hu/corr[hu]_logS_with_MQNs_.png new file mode 100644 index 0000000000000000000000000000000000000000..e4b0001033b5eb3e6fb157397323b12d8453f395 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_MQNs_.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7b2ae3419cc05fbf652b6099cd3e8bb3e978734f980adb20eb21926ef0b3b614 +size 234122 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_MQNs__only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_MQNs__only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..eee947ae825b89028941acdefd08ed366921a594 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_MQNs__only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:5f6672d5d2c331471755e7e9caa43ed4679cfbc76045915462328a4a3330c41b +size 139110 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_MolLogP.png b/result_prior/result_corr/hu/corr[hu]_logS_with_MolLogP.png new file mode 100644 index 0000000000000000000000000000000000000000..25684bca352f4d917b439e25dff80d07c7a39de4 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_MolLogP.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:40aa0722d6e204a0376eccf11d62cb85b67c83d782729fa2eb0b2442f7591593 +size 223742 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_MolLogP_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_MolLogP_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..5f4b6fff03e0093198043bd11ab54342f16de055 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_MolLogP_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f18e60738e10df5179386efc97734947937e4ea531feca0aa67aa92cd44820fb +size 135941 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_MolMR.png b/result_prior/result_corr/hu/corr[hu]_logS_with_MolMR.png new file mode 100644 index 0000000000000000000000000000000000000000..ceb147f90bd22daa6934b60061d2c0b9366d0815 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_MolMR.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:358f3fed10328647ada199030ce6ec0f5b22742d9602453be34d0477615391db +size 254202 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_MolMR_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_MolMR_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..e431b10f91b7a162526856f0d51136b899420276 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_MolMR_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:055667ba9b1379964d60f6ba5b2ddb419d27510cfce39e73bf7537c725698236 +size 143517 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_MolWt.png b/result_prior/result_corr/hu/corr[hu]_logS_with_MolWt.png new file mode 100644 index 0000000000000000000000000000000000000000..9d1de7c5ecf9e4f1a78239038dcc034cc84141c7 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_MolWt.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:325e7ca0fd160a278318a396fa5d272949f34ed854f65d8f14173513d738259a +size 252544 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_MolWt_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_MolWt_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..8d0663485dbf8d6eb65c42727827b8d92b87e7a2 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_MolWt_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:66a009fa80d9caa53d3117a3ba3fc7f2c2f9f1468f5ffc37a05d43e7f416bbdc +size 148435 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_NPR_series.png b/result_prior/result_corr/hu/corr[hu]_logS_with_NPR_series.png new file mode 100644 index 0000000000000000000000000000000000000000..b34ae0e892b37321f90280b50632e9dbd12f1ab1 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_NPR_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:45b3e8acf38858c4de9a0ce19a36b5e8963dd2520d818aacc016f36d2583e9c6 +size 164945 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_NPR_series_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_NPR_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..beaf966c8f4b32dd2dfc4e7b7006c719f7d73f51 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_NPR_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2689d45a9a18946e0fbc38df7fd52f207cd92bd70b5af2f643d02be489d5d1f2 +size 106757 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_NumAmideBonds.png b/result_prior/result_corr/hu/corr[hu]_logS_with_NumAmideBonds.png new file mode 100644 index 0000000000000000000000000000000000000000..7d9712058f89f2ef44ad0223387284ca6c37e5c0 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_NumAmideBonds.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:634c86b6bcb2ea605afc7aef5efc46198771e0f0dae40d549b754a053b50d0e2 +size 180219 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_NumAmideBonds_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_NumAmideBonds_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..602380d887a9dbf8088d6e9644bbe4ef3475038f --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_NumAmideBonds_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:927f48e0f0c7345d486b28a0eb4ce7f9976ee816e080d984039e92d4616f2b65 +size 106387 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_NumRotatableBonds.png b/result_prior/result_corr/hu/corr[hu]_logS_with_NumRotatableBonds.png new file mode 100644 index 0000000000000000000000000000000000000000..b77b404d40346ecfa4be729dd9abfcac311eca79 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_NumRotatableBonds.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:45ffb63c580cca8ff2c63149f9769f5d06a76336b5ffc7e59bba99ee5ff2ec07 +size 210944 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_NumRotatableBonds_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_NumRotatableBonds_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..189a666713a4d4f2334c487d9a89d8ddd9156f7c --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_NumRotatableBonds_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e434673573c33791f227814511c504892c1eb72ed83d96a6d114bc56b7ec94c8 +size 114511 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_NumSaturatedRings.png b/result_prior/result_corr/hu/corr[hu]_logS_with_NumSaturatedRings.png new file mode 100644 index 0000000000000000000000000000000000000000..4813dc948b08fe3ad39472294dca1859280477ba --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_NumSaturatedRings.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e2a7a0f56127788d490f98b66dbb23049cd5016ac4448455aa66353f91c9d45b +size 202734 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_NumSaturatedRings_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_NumSaturatedRings_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..4f41702454d2de38138c280478164c65079f59cc --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_NumSaturatedRings_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:62a2983b3a20fba9e2cd06ae56eab8e0e381394ce347f8b424dcd6bdb12c0107 +size 97230 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_RadiusOfGyration.png b/result_prior/result_corr/hu/corr[hu]_logS_with_RadiusOfGyration.png new file mode 100644 index 0000000000000000000000000000000000000000..3686158ca9d807b05248829dd5ecf5e76c26e3f4 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_RadiusOfGyration.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:dfbc635a0c8d01f333a5b01493cb7aa9bd55736fc6d3ebabf422b07e87b33ffd +size 273837 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_RadiusOfGyration_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_RadiusOfGyration_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..048859b7c1dc5fa54fa7caabe0e4139eb1ee7f69 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_RadiusOfGyration_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4acc4bf39db190372624a55119f7cbaf21e9be916c32f8594c5c2cead7591d31 +size 162073 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_RingCount.png b/result_prior/result_corr/hu/corr[hu]_logS_with_RingCount.png new file mode 100644 index 0000000000000000000000000000000000000000..d0c1d557554c12b1f99d2e15b52e9fd1b9d4e40a --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_RingCount.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:98367081ab7334ce00b16fbb06ee971e5d9f136d960858bbea5688fa0abfecac +size 214244 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_RingCount_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_RingCount_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..e302e43cd434db29c60b207b9cff2a2cf5b59063 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_RingCount_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:13d69ebf2c488221e70a3061e8125552525e8aadf7ebbe761dbd43c1fde1c2df +size 97687 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_SpherocityIndex.png b/result_prior/result_corr/hu/corr[hu]_logS_with_SpherocityIndex.png new file mode 100644 index 0000000000000000000000000000000000000000..ac2cc0699fe5ed6ee796c9b2882d879b83711cc0 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_SpherocityIndex.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:334642ff78e173d977f4447cafb922dd1f9197bb9e20b38b0170c4469a0b87a3 +size 225456 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_SpherocityIndex_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_SpherocityIndex_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..61778327f16be05ce59a0ddec19320b1276c17f3 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_SpherocityIndex_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b9801282914e5e0783c86d64800a0a93152f731bf4637c069cfa1fff99588cec +size 138363 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_TPSA.png b/result_prior/result_corr/hu/corr[hu]_logS_with_TPSA.png new file mode 100644 index 0000000000000000000000000000000000000000..b463a4361ec89bcffe7d0fe170e5d5676236fbaa --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_TPSA.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4568fe9fb4ea34abe7af853ae766d2b5c7139da013c118643d7a7256d6a4c32e +size 208601 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_TPSA_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_TPSA_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..368cf32251755c203e0483a5fa5771618defb5dd --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_TPSA_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:62148bde924ce597c585069c8fe7a5ebfc3a0c698974b11e9a699750180ba839 +size 130216 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_VSA_EState_series.png b/result_prior/result_corr/hu/corr[hu]_logS_with_VSA_EState_series.png new file mode 100644 index 0000000000000000000000000000000000000000..06b99de7b61a194a6d55225b307810c685826347 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_VSA_EState_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:23375492abfae179e9afb14b1960eb954404bdb20646e35e0ae5bc74b2b227ca +size 248792 diff --git a/result_prior/result_corr/hu/corr[hu]_logS_with_VSA_EState_series_only_dots.png b/result_prior/result_corr/hu/corr[hu]_logS_with_VSA_EState_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..da98ee206ece303a6a46ebf1a25cca93e829f8c6 --- /dev/null +++ b/result_prior/result_corr/hu/corr[hu]_logS_with_VSA_EState_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:097f2d01d799f0b9d790c23339e8f21e159847b4220093cfb27139e5c14541c9 +size 149347 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_AUTOCORR2D.png b/result_prior/result_corr/lo/corr[lo]_logS_with_AUTOCORR2D.png new file mode 100644 index 0000000000000000000000000000000000000000..8de96c108f46b85a0ea8cfcda9b13ad27c611a97 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_AUTOCORR2D.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:725beb8aeb321c8de813e7dbd70228d2219353316915f5c033d5770827dc881c +size 263262 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_AUTOCORR2D_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_AUTOCORR2D_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..0326600986bfb96721ccf7071093fd627e8297b2 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_AUTOCORR2D_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ee14ff496c6ad03548e917d481f67d95de1803e59589adec8afb1867357908df +size 142776 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_BalabanJ.png b/result_prior/result_corr/lo/corr[lo]_logS_with_BalabanJ.png new file mode 100644 index 0000000000000000000000000000000000000000..474a566ac9c238dbba2cd0f5b55fecc1f5aec92f --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_BalabanJ.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9acd96d82317b68b94b22679a57c445bda7d4b31a43b5471854b9942906168e4 +size 225657 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_BalabanJ_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_BalabanJ_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..e48c43bd038da7c22a956520bdf1ce8d4344938f --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_BalabanJ_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:25f46fabb0fc781b7fa1265a28bca67fffb183b6a1ac5ca2ae7064832d1064ae +size 130042 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_GETAWAY.png b/result_prior/result_corr/lo/corr[lo]_logS_with_GETAWAY.png new file mode 100644 index 0000000000000000000000000000000000000000..9df379bc5924e091bab2ef0f125adf949d7ea346 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_GETAWAY.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6934c73f0a7e088b654aa2bb134edbbc2c0f89cd7e7c154a5905a3949eefd2ed +size 263763 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_GETAWAY_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_GETAWAY_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..9ed4d4f363931bab2729d2c34059a980f0c9c6b2 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_GETAWAY_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f9eb2cfb7689094362fb8e9916532e7543d375142a41c29cef230b1066f17793 +size 120533 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_HallKierAlpha.png b/result_prior/result_corr/lo/corr[lo]_logS_with_HallKierAlpha.png new file mode 100644 index 0000000000000000000000000000000000000000..57047381e9f9dccf0b5a4b6cc01a45a1933cf460 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_HallKierAlpha.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bfd7fabbc2a465a68ab18800a1c7ce44145cb17c2e46bfdc9d715ba4a4b85ee8 +size 226962 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_HallKierAlpha_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_HallKierAlpha_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..d2efe347dd557bd85a15a9a7037c60fc10c5fa0f --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_HallKierAlpha_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bf510c8afff4fcc2c2fa27b966cb2163b9dd8020aed9e9fc9c435aaa8a2a90e8 +size 130701 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_HeavyAtomCount.png b/result_prior/result_corr/lo/corr[lo]_logS_with_HeavyAtomCount.png new file mode 100644 index 0000000000000000000000000000000000000000..0287649dbe6cf9417491b1341757ce3b3912260a --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_HeavyAtomCount.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6f918b37253ee56d494aa782df1a870bc1e70d18cad0ade23beec2d985d3eeb3 +size 251054 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_HeavyAtomCount_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_HeavyAtomCount_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..8fce4e65bed0492dbb4665c3362bfc9112a27e99 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_HeavyAtomCount_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:5ec41b6bece05fa508063ee9c8587a1aaf79108f76c2ed2d46e76f788828c28e +size 116006 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_InertialShapeFactor.png b/result_prior/result_corr/lo/corr[lo]_logS_with_InertialShapeFactor.png new file mode 100644 index 0000000000000000000000000000000000000000..8da79ec48e34aa43be26f5aa9dbc2e5773b3a642 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_InertialShapeFactor.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d202748d69a449a8fc137f551e391e5ad90d39a60a2db4d8f0c53c25bbca237b +size 177155 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_InertialShapeFactor_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_InertialShapeFactor_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..fe4b60d51a28483c00579279129e68a25240d3b7 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_InertialShapeFactor_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c7820b579a952fd0e2c90ea59ce954a6eab6d823d3568bd4535de6edc7e15a87 +size 121981 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_Ipc.png b/result_prior/result_corr/lo/corr[lo]_logS_with_Ipc.png new file mode 100644 index 0000000000000000000000000000000000000000..c808768947910c33d7d971114f90b48774c07660 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_Ipc.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:208e0d63d3a81cbc4658cae601ad701388b2a9a43f79eefc92c0f24fce97fa65 +size 247902 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_Ipc_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_Ipc_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..41b004b401c088d9f415ae1c19f4fecd77996a6c --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_Ipc_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:aa15db293a36c5af290d63ac22153931e3c5b28fe5424b278a8c56e13fa19031 +size 123658 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_LabuteASA.png b/result_prior/result_corr/lo/corr[lo]_logS_with_LabuteASA.png new file mode 100644 index 0000000000000000000000000000000000000000..3aae28318bfa0775bfb1e7f8eb0ee0fbe12bfa71 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_LabuteASA.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4be0aec81a6c7728ed788c4b8a98276483e2b054bfb19729c89c4694a6aa7c73 +size 261454 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_LabuteASA_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_LabuteASA_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..a1a59dd40dd91ed3e3bf7d19a6b7280e0f5b4880 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_LabuteASA_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:52fb1249d536ad5385e8be59ea03c9fc07588e0d73cf21c19369a2aea1e283ad +size 143905 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_MORSE.png b/result_prior/result_corr/lo/corr[lo]_logS_with_MORSE.png new file mode 100644 index 0000000000000000000000000000000000000000..0d4f12bdf731d4b5f745d0aed74696a24a8a54f0 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_MORSE.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8bd04728ef6aa56496eefdb11c98bfa17d96440d64db12f52dfd80fe122e6907 +size 77655 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_MORSE_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_MORSE_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..3f70263ba2a9ca893571ab5c24f1dbcb21dc4869 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_MORSE_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9ed51e42fe75f28e4dbf0b892247a971fe62f62609f2bd307aa823e0047cc0dc +size 83033 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_MQNs_.png b/result_prior/result_corr/lo/corr[lo]_logS_with_MQNs_.png new file mode 100644 index 0000000000000000000000000000000000000000..4d8d345303f9681c735e072e23fbc353f7a9f49e --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_MQNs_.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a668f7d9167c658ab71ee3e9e17207c2fed552dde6aa2aa9a1a3b3935ffbec5d +size 256630 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_MQNs__only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_MQNs__only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..253600c1b4771df6e0459db6ed57d6fc9791856a --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_MQNs__only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c093497f9fc9206021d96b171b01484291fa40c550af48a0ad1399f6473ecf05 +size 136902 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_MolLogP.png b/result_prior/result_corr/lo/corr[lo]_logS_with_MolLogP.png new file mode 100644 index 0000000000000000000000000000000000000000..167ab4955c2979729b31e385dea2fc8787f74e41 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_MolLogP.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:cf843e1f7500e3255849a97e863349f4388a177f2f41089c3c1acf64b6a6ccc7 +size 231723 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_MolLogP_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_MolLogP_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..bc097ef848acd85e002d6cc37fa1827838ac469d --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_MolLogP_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:943b38ca58661328b4e5ebad167e97643d3ddb4b420daf6ecf18e44f730797aa +size 122860 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_MolMR.png b/result_prior/result_corr/lo/corr[lo]_logS_with_MolMR.png new file mode 100644 index 0000000000000000000000000000000000000000..b9a33739c58ad4dc933bf5eff4b1f9a3b5dbd402 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_MolMR.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:160f2955ecabda85bedde4d4e3c1c527ac99d7f1c89bf94d6c449d40c4bb8dd8 +size 258744 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_MolMR_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_MolMR_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..c66d5b36cc428d3ef7422af19f161f5b047d3782 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_MolMR_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4e251279941389cf742d349f2258aeeb3c42fb494f6f0a8f425638d38fdc6e02 +size 127595 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_MolWt.png b/result_prior/result_corr/lo/corr[lo]_logS_with_MolWt.png new file mode 100644 index 0000000000000000000000000000000000000000..bce266ff23db15962f8b2ca7749547f2e815baf1 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_MolWt.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7d80961601b17eec37cf0bd62bc4bfdb7b59694d3d58ea04fd03890812ca7f3f +size 256373 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_MolWt_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_MolWt_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..6e65dfe03e390b5656dbc1abb39469e0500e5b95 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_MolWt_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fa41085141984c908739a20bf1fa04a0c16e893dac251bfc8704b7321b69e5b8 +size 138135 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NOCount.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NOCount.png new file mode 100644 index 0000000000000000000000000000000000000000..c0dc7139399fb5298770fd13ece4ca569b4bee68 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NOCount.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9fbf6cd8823ffc2b20345b913934f7ad74ebe3e42983b735e8454a48dcac80a8 +size 220787 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NOCount_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NOCount_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..d3665a4f2748e4dfdc9ac9c24952277fc4de4c66 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NOCount_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:53af9929ba2ec463bfc181570cb5d86db64613263ebb626a3272a9b2c7ec168f +size 96186 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NPR_series.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NPR_series.png new file mode 100644 index 0000000000000000000000000000000000000000..de564ae4a01f992b64a5b8019332d3237d7dd4aa --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NPR_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:faec666f9da8eca484a47d95b4a094cd0be928b53360e72ffc67875f79468313 +size 150515 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NPR_series_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NPR_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..d559c3542f720f896b0e808d902425854512eb01 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NPR_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2407170cd2b97141f6b4232483f6c1a41af00b31c7d578a22904e2f291a5e1b9 +size 105802 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NumAmideBonds.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NumAmideBonds.png new file mode 100644 index 0000000000000000000000000000000000000000..6930a1251226b999f05ec6fcf1bc1aa19e56903c --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NumAmideBonds.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:069183c2a81619ff0795749297f574cc97c03b25362cccb5056a86c88c1965a9 +size 215394 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NumAmideBonds_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NumAmideBonds_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..afc4c6f844bea077ecf39b0e13b89e327cc5f8e6 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NumAmideBonds_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a79e3d5e0f912bfd0373c1b4350a092b1f5a3ad5ce11d2dc02972542026f4540 +size 103994 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NumBridgeheadAtoms.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NumBridgeheadAtoms.png new file mode 100644 index 0000000000000000000000000000000000000000..edde0da8375ed6ff9e391a1d0550fff1f37f53a2 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NumBridgeheadAtoms.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8388583f8aa2692db56dcb01f2e130599e902d3b732828f2f3176017861359ed +size 94427 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NumBridgeheadAtoms_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NumBridgeheadAtoms_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..db73d195b7a81438c0d3aa137193c7b72e1dc29b --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NumBridgeheadAtoms_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e2bb0a7ee67cf47bc782dd32033631c2cc0118126094c80ac35fbe058fe2ff34 +size 96296 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NumHAcceptors.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NumHAcceptors.png new file mode 100644 index 0000000000000000000000000000000000000000..7ec8ba7cb372da647e184af3f9c6ace49e8db2c2 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NumHAcceptors.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ea0d048e6f653041c024ba0ab148b2baf85093d02584e06c011dd6eedfe2523a +size 217678 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NumHAcceptors_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NumHAcceptors_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..515ccabd4bdfa97230ac71a7f83a9b0786753307 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NumHAcceptors_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e651a1a621da38a61102334929d2402e18e8f5398d4c171e3368799f127caf31 +size 98490 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NumSpiroAtoms.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NumSpiroAtoms.png new file mode 100644 index 0000000000000000000000000000000000000000..dbdd6533e1a79692b7b0a2cf3c4c9cb0dfa7f817 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NumSpiroAtoms.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f13db47447385f5b6adff281ffe9b7e62c7560180881c78e3087d434ba249f4d +size 148197 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_NumSpiroAtoms_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_NumSpiroAtoms_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..00465f50ac2d6ea8269719afed29d09b00db77f8 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_NumSpiroAtoms_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c591fe4e934685b28a40baab5b139fe31f3d9f53ba0130b83d72cf62b5bc95e6 +size 95675 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_PMI_series.png b/result_prior/result_corr/lo/corr[lo]_logS_with_PMI_series.png new file mode 100644 index 0000000000000000000000000000000000000000..cdafb0e39680784b92b193c995b3044937bbfc87 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_PMI_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b4ba043a7f26ee499182a305897ed02ca7b29167880c55f07c7be42f64b8547f +size 265546 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_PMI_series_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_PMI_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..94602d3c86d27faf1d73fb5ae6d66eb955d3eaf3 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_PMI_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:daca58ce52701b963fdc9780faf18166aa8ea0de6c0fb2ad133024d9aa42482c +size 135204 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_SlogP_VSA_series.png b/result_prior/result_corr/lo/corr[lo]_logS_with_SlogP_VSA_series.png new file mode 100644 index 0000000000000000000000000000000000000000..3d06149e1e87d6b4c8db2fbca47d3ecc746ac9db --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_SlogP_VSA_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8d434017d3e9a15aadb318dde6ca8344ae6733e93cb21f5dca6dc82f335f746a +size 269193 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_SlogP_VSA_series_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_SlogP_VSA_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..a9ff82f5881fb079f9ab8aa654dec3d1c715d538 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_SlogP_VSA_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:23ef48fe08714178044bb6cbde7d80d7db698f9074f894c12530950acf8b02f5 +size 151778 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_SpherocityIndex.png b/result_prior/result_corr/lo/corr[lo]_logS_with_SpherocityIndex.png new file mode 100644 index 0000000000000000000000000000000000000000..6e4772265d3d222d854b74eca98f9fee58345bfe --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_SpherocityIndex.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1622c2f7a968169f011b766add1e5a61ba64584c3aa79fdc087e0a70a9e7ea7a +size 239408 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_SpherocityIndex_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_SpherocityIndex_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..2e0efd7e71548e14aa54291a8e703b1dc2b7cd02 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_SpherocityIndex_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c426e3a08b1ff00d0226ecd1eca18bf16143df1ea7d54bf917095673445e6e0c +size 132836 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_TPSA.png b/result_prior/result_corr/lo/corr[lo]_logS_with_TPSA.png new file mode 100644 index 0000000000000000000000000000000000000000..365a76b81236b8aff659088ec77b2e5bbb247f8b --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_TPSA.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e77763a3eff287b396146c3c8167bb1c620be52ee77254dd4227926c0ab9e5ba +size 236949 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_TPSA_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_TPSA_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..559239a20e45f593bfab2cb88a813b31e8a043e1 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_TPSA_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e478da9b49ba0d7b384e9f4472157a0002ab27aab8759c288b5358bfea2e1214 +size 127673 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_ValenceElectrons.png b/result_prior/result_corr/lo/corr[lo]_logS_with_ValenceElectrons.png new file mode 100644 index 0000000000000000000000000000000000000000..c59a78f1924d9529c0923be8860a49ceb132e6f9 --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_ValenceElectrons.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c345a3a2aa2f1c118e9623ac82f20bb0df02f47b5a7a6ec8dbc0f2c1cb014e49 +size 262261 diff --git a/result_prior/result_corr/lo/corr[lo]_logS_with_ValenceElectrons_only_dots.png b/result_prior/result_corr/lo/corr[lo]_logS_with_ValenceElectrons_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..f5b50d816d7d85674e1353f8ceb230244abf633d --- /dev/null +++ b/result_prior/result_corr/lo/corr[lo]_logS_with_ValenceElectrons_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:55a18813281b439e6ba2f93b51863f9cc5a8cda311984358213cb573eb064c48 +size 137569 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_AUTOCORR3D.png b/result_prior/result_corr/ws/corr[ws]_logS_with_AUTOCORR3D.png new file mode 100644 index 0000000000000000000000000000000000000000..e3cc68d4b3b17f79bad4e7d405822b6f64f0361d --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_AUTOCORR3D.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7dc1ed6e9914a04d7890cddfffe60fbee3c4b5e68aa45335677519574f4ed816 +size 258183 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_AUTOCORR3D_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_AUTOCORR3D_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..a0eebcafe422cc6aeb23ad47c1372346b008f6b8 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_AUTOCORR3D_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:435a2c68b4b135b929e264bae46e5925ab5acdcc68eb93d3c1db959be9dd3933 +size 128156 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_Asphericity.png b/result_prior/result_corr/ws/corr[ws]_logS_with_Asphericity.png new file mode 100644 index 0000000000000000000000000000000000000000..51200591c606161431926f7c5eb63de7badbd219 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_Asphericity.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:37bbd9dc95a978bfddbafb89f693c65e5ea41ee6a30463e214ac5ef37f69bded +size 246080 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_Asphericity_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_Asphericity_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..097862252f72914533a17035da078e7aaf60ef28 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_Asphericity_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7441f6f0eb12784c9d1a71d9bd2bc6197a162320d9755e9bf981fe6667d11604 +size 125023 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_BCUT2D.png b/result_prior/result_corr/ws/corr[ws]_logS_with_BCUT2D.png new file mode 100644 index 0000000000000000000000000000000000000000..9c7685d2d386e20bc55ec800f5448ab8b957efa5 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_BCUT2D.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0a365fb8febcec7f496605b64b373f8dbbe3af1745b8d8cc7eb63ca232c61411 +size 217624 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_BCUT2D_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_BCUT2D_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..8a703b603b4d2e55758a7790abdebb4859974c23 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_BCUT2D_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:48736d1a818e7fd6c3c75d14885cc83d9d91ecea61805cc755097e979ac94892 +size 109955 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_BalabanJ.png b/result_prior/result_corr/ws/corr[ws]_logS_with_BalabanJ.png new file mode 100644 index 0000000000000000000000000000000000000000..bb7cd457bdbcc431cc745c32d2513cfa12ee56ac --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_BalabanJ.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:5a964c4bcde5f402304192f9b4d866fb57cc74e6126df2f437343e9b97576e76 +size 221778 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_BalabanJ_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_BalabanJ_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..58137521db5a39f063963ffa34a7ddc2542d72e8 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_BalabanJ_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f9c608734a23b8d3be39674095cbbfcbec34126a38a4f08fd52f9d2647f3df6a +size 115941 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_FractionCSP3.png b/result_prior/result_corr/ws/corr[ws]_logS_with_FractionCSP3.png new file mode 100644 index 0000000000000000000000000000000000000000..86c6ef3a5f1b6526fbb480bf56a6bc6d324fa89c --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_FractionCSP3.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ff6620801cc4d7052559495833caa7116eb2ae0c06b677ce075c43c828ec5428 +size 263497 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_FractionCSP3_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_FractionCSP3_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..043a8475fdcdd2e52e883ea66842b0dabd8cecfa --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_FractionCSP3_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:05d42ba26f29277e7e219efba2a5a3d4c2bbb51092a5c345bf18fa17bbf18a22 +size 112951 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_GETAWAY.png b/result_prior/result_corr/ws/corr[ws]_logS_with_GETAWAY.png new file mode 100644 index 0000000000000000000000000000000000000000..5747dd64ae57852fb69d02a9371cce62e3efd61b --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_GETAWAY.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fe8aaeef8267cfe2785bf750ce7169461d3a52fe33e35be7e2f1235a0ae707bb +size 265457 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_GETAWAY_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_GETAWAY_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..a573c784b884534f60f2942d0961aa7ccf0fc486 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_GETAWAY_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0a5e5f310e5e7ab96d3eb280d7c23c2180411f41ea3a952b3a0bc2bd22b072c5 +size 109780 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_Heteroatoms.png b/result_prior/result_corr/ws/corr[ws]_logS_with_Heteroatoms.png new file mode 100644 index 0000000000000000000000000000000000000000..25bb6934bcdb9619681ca9febf11f22e35274cc0 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_Heteroatoms.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:304c62955359db6ebca76ce77f2ad631bfaaaace76f4cfbdd0eb60eb269d903a +size 222896 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_Heteroatoms_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_Heteroatoms_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..8ddaea7a4342564ab7dd3aa09a69866969bd5199 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_Heteroatoms_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1d9ada608a2390ada9da7031118a7b285e0c0a9cc77ddb9f082876954979eb3d +size 93634 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_InertialShapeFactor.png b/result_prior/result_corr/ws/corr[ws]_logS_with_InertialShapeFactor.png new file mode 100644 index 0000000000000000000000000000000000000000..dc7de1f7e426c6ba7267c0e293e69fcf2a4e6148 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_InertialShapeFactor.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:85941fe387c0900db235f41f985de1be0851b16fa9bbfb0e0de72e7427658403 +size 221429 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_InertialShapeFactor_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_InertialShapeFactor_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..fec8c557c4245975449bfa79c040e0ba540a0ac1 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_InertialShapeFactor_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:369dafa5c54701745197acc774d1dd7f7597a4825e2cd66c7703568c543f0183 +size 122486 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_MQNs_.png b/result_prior/result_corr/ws/corr[ws]_logS_with_MQNs_.png new file mode 100644 index 0000000000000000000000000000000000000000..f6842c5998bcc3b8818748e06107744b9014b5ff --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_MQNs_.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:42f294504d1e747c79b84fe863b003d8bc0419c863b6eb4be061887862b9b844 +size 227697 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_MQNs__only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_MQNs__only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..49c692854b05998be0ef5198dbe2e96bb0c663d3 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_MQNs__only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0737298b25b6de87059308fa6c8b40acca7af1a4b850c51e1cd2e6afee460f72 +size 117259 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_MolLogP.png b/result_prior/result_corr/ws/corr[ws]_logS_with_MolLogP.png new file mode 100644 index 0000000000000000000000000000000000000000..b73149b67b6342ceca0b7bff0bfee486d42cc5e4 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_MolLogP.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d30a090c96034cb620ffadf4196e140ab59250cb3befcc6a47b1cfdb481b848b +size 232639 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_MolLogP_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_MolLogP_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..4325899b5ef202412592c38718d39c403c02b9e4 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_MolLogP_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ff4e74febe5c14dc0b2c81c0de4970a32c9f88494bf2997589c961e47340888f +size 112937 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_MolMR.png b/result_prior/result_corr/ws/corr[ws]_logS_with_MolMR.png new file mode 100644 index 0000000000000000000000000000000000000000..95fac62959329e73dc819cedc348391c044355d6 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_MolMR.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0acabf6640c01d0d5b4d30964a318134df29d585e34d80a51f90b4d77385994a +size 233117 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_MolMR_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_MolMR_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..6af286ff735aba48f71177fe9b51929e69bc0c64 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_MolMR_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:cc7563add687657cd7105989a9a95ce79f8b4e09fe648dcc58e709c93bb807a5 +size 113278 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_MolWt.png b/result_prior/result_corr/ws/corr[ws]_logS_with_MolWt.png new file mode 100644 index 0000000000000000000000000000000000000000..759b17d624818888cfd63aedb269ca55ae3c83ce --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_MolWt.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:620ae054fbae33cf4fa699e3b6dfc9a8735deddb3768b2b1d83bff21ae3bbb3d +size 245312 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_MolWt_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_MolWt_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..b43d89999ab70255fe900afdb9830f0f5a5b1348 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_MolWt_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:44a6907b65df3a944da4b7def2398fd3b291c571ab9b5e6f22a4a6e5954adb7d +size 113988 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NHOHCount.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NHOHCount.png new file mode 100644 index 0000000000000000000000000000000000000000..0c0aed24226f8c2b212177dcf32664a9b4060b26 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NHOHCount.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:13eae2c8890c077fc05f0c2a747cdc6501ade01ac62cc36985859897abd8d94a +size 187714 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NHOHCount_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NHOHCount_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..1632ca581b305cc8589fe59780766f1b212f8fe0 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NHOHCount_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ebe7ec3906005fb3bae78f9665d6b5d387c2b923d30035e2fa62d86163f23cc0 +size 87074 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NPR_series.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NPR_series.png new file mode 100644 index 0000000000000000000000000000000000000000..c0d1917688d6fe69a3d36ba3ba114e2adce5392e --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NPR_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b66dac2e455e3e813d7c53e8fe07602cf83eb19edec3677f9a08d444ce8fd639 +size 159980 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NPR_series_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NPR_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..f570d04fcc80f6f8a478cdf075f5bfc7c534e7ca --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NPR_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fadd872e17f291bec8879edf2a31497fea6dc3464aaaba5aee01e1223ae75870 +size 105052 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumAmideBonds.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumAmideBonds.png new file mode 100644 index 0000000000000000000000000000000000000000..f54f2231a599e55602f6bfb715e5b5c8ed8f018c --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumAmideBonds.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f76eaf16b0c442017d6a4b75d5dad962369f31782d59cc0fe2cf368d7a5c9b1d +size 208669 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumAmideBonds_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumAmideBonds_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..875180c23e036bf82f95590028eaed0472c39b15 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumAmideBonds_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:570d8ecbfe2f493cb12b7974cccb24f41aeeaa264ff2e0716a5d23e2542e8698 +size 107137 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumAromaticRings.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumAromaticRings.png new file mode 100644 index 0000000000000000000000000000000000000000..95c6428dd9da76b7ee56768891fc676b221b422a --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumAromaticRings.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b1403061b8a87c979fe31d9b83059a1d6993c042700cc70124e75f6b20009b24 +size 212627 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumAromaticRings_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumAromaticRings_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..c2924d3d1872cd302dc64712f14ced786e1f7aca --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumAromaticRings_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:cb3014c44362803a9ac77711a4c5d5f4e5ad0d58592577c319e82a1e025b5d5b +size 103549 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumHAcceptors.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumHAcceptors.png new file mode 100644 index 0000000000000000000000000000000000000000..87e6dfe94062eb4fe48652be5f1cd71c72b3f976 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumHAcceptors.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:aec9b1ad8589489673606327a76a24b6392f945200034e1d2343ef076c5ec874 +size 216638 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumHAcceptors_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumHAcceptors_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..d5a1923b3f9b6cbdf4942971d8122621b290b9bf --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumHAcceptors_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d4338ac34f8c25252f7ed8cecec3ffe3f7268ccdab4ed4fccf956f6d9ab9d8c0 +size 94217 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumHDonors.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumHDonors.png new file mode 100644 index 0000000000000000000000000000000000000000..7be95455c081a8c2dbf8fca03751ace46de50389 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumHDonors.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:17d8d58c6bb3d4afd427630983e12a540e829d1d06801d1ac9d1b79ad064d058 +size 183525 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumHDonors_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumHDonors_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..8f1398cbbe3cedc10a12034466eda58006d3cd68 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumHDonors_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f88183367069818ec1872f5388c087983e699f45687cb6d76d07a1afa0d14f20 +size 87436 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumSaturatedRings.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumSaturatedRings.png new file mode 100644 index 0000000000000000000000000000000000000000..bca75c51cc7806e23c1002b53c2b9d83cee85429 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumSaturatedRings.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6c06141c2accf34ecd526c9b348e1299a5d742c13c900511fd3f751cad2a0370 +size 204941 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumSaturatedRings_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumSaturatedRings_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..e94de00be803959dce20c1f3926b0b507df8c8fb --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumSaturatedRings_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:228792a99f06ec1f799d454a1e8d73c686b2ea00fbe47076d1f570b6ebaf1703 +size 105162 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumSpiroAtoms.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumSpiroAtoms.png new file mode 100644 index 0000000000000000000000000000000000000000..ddf63fa20fbea715d3e37903113ea00190cf49fd --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumSpiroAtoms.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0ce06ddcf06605691ae832b07e748d47c5d241726a50cd0d193fd9694e16c39f +size 88008 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_NumSpiroAtoms_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_NumSpiroAtoms_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..c4bb310b804b0c58f3e0e3e56c5b9e57fdfbf576 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_NumSpiroAtoms_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d5ef5b8a9097507845613e1c7ae24c8396bef5fbd839e84a4f70c4fd31e6af91 +size 91534 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_PEOE_VSA_series.png b/result_prior/result_corr/ws/corr[ws]_logS_with_PEOE_VSA_series.png new file mode 100644 index 0000000000000000000000000000000000000000..2a16449e3fd0b91962dafb114cd8e05af86a4349 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_PEOE_VSA_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1bba1694a71f0d69360d5d9a8474b756759d59504af0e5d80965b2a426a9bdbb +size 251321 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_PEOE_VSA_series_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_PEOE_VSA_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..bdb26177e0c581efcef846e5627aa99899bb693c --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_PEOE_VSA_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6e3932c88b4bc098cfd61ba03e514a8f1848bebe1576968133a7037f18c627fb +size 127896 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_PMI_series.png b/result_prior/result_corr/ws/corr[ws]_logS_with_PMI_series.png new file mode 100644 index 0000000000000000000000000000000000000000..8dc5ee8b17cf14e6946530ecd50dae0869ba6941 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_PMI_series.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e05f99c1c8057103d36c22eb1507c1e5cd5dd97c4b6294dce595f1631e52887b +size 238474 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_PMI_series_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_PMI_series_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..76add9dbe14e83d080d908f3cf5f37ce203ce312 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_PMI_series_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4034dff5f135d907c12ec4901cbe865bf455d3cdae64d338f9f44503c5064c95 +size 119187 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_Phi.png b/result_prior/result_corr/ws/corr[ws]_logS_with_Phi.png new file mode 100644 index 0000000000000000000000000000000000000000..36914769368271983725422aa1a05e93a2a16dbd --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_Phi.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4c92c3cedf717258c42bfdc69f8e34ffb28c9e66b2e227655e954265101a7e51 +size 215156 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_Phi_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_Phi_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..894116760a4ac2c61ab817ff5ff18e557ed5663b --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_Phi_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c14b94a5555d614ea6d1216a9225563dea08bce53bd28ecfe23bb137ac2e110c +size 99810 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_RingCount.png b/result_prior/result_corr/ws/corr[ws]_logS_with_RingCount.png new file mode 100644 index 0000000000000000000000000000000000000000..9681cff674dc8497f76a1e10fd399e76e34364d0 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_RingCount.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:757b981404acbefd1867251866c45dfa96782e44ffdb8daffe4f851b44613ac3 +size 213242 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_RingCount_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_RingCount_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..8864bb3e7590f05ef263ab7bd25a399b0d78c941 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_RingCount_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9e80d566fa36e2d3d03edc7de7f76f186dc194705a73de55ae84974b9a1b945d +size 97842 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_TPSA.png b/result_prior/result_corr/ws/corr[ws]_logS_with_TPSA.png new file mode 100644 index 0000000000000000000000000000000000000000..65ec0f618a1f1603d8f885f51906d731afb08902 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_TPSA.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c695caf69b0e4c76e92d563ec33f8825b28ac8a41e57af18c4c7630f692aa469 +size 217478 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_TPSA_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_TPSA_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..15dc0b4b66e941c57d1aee869dc62dab8f28d36e --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_TPSA_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:dda97247e00ed8cc610269dd0adc7634f8ac8f35527d7acd03824c70cdc3ccd1 +size 102170 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_ValenceElectrons.png b/result_prior/result_corr/ws/corr[ws]_logS_with_ValenceElectrons.png new file mode 100644 index 0000000000000000000000000000000000000000..dcd9cf4068984dc633ad8a8e922c21b9b2776030 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_ValenceElectrons.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9997246b941692de39d78578433db3c59afc33163338257428ceaad82b0cb33b +size 235814 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_ValenceElectrons_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_ValenceElectrons_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..859cb8aa7c9e825d44514c22c9bd2e0dc13fabfb --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_ValenceElectrons_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c17d4c1e4a22c758ae268cd5c99f0048301afbf621e7c7818b77127418bb3c28 +size 123740 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_WHIM.png b/result_prior/result_corr/ws/corr[ws]_logS_with_WHIM.png new file mode 100644 index 0000000000000000000000000000000000000000..7f923b371c495f600817a161de478f1292bcf687 --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_WHIM.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c2ae0939077f74f824f5153498a6926b73aa061b5c6a0d4ac254043ac8d2df35 +size 219645 diff --git a/result_prior/result_corr/ws/corr[ws]_logS_with_WHIM_only_dots.png b/result_prior/result_corr/ws/corr[ws]_logS_with_WHIM_only_dots.png new file mode 100644 index 0000000000000000000000000000000000000000..78d58880a8f7a7cf5d6abd4bf4fd9f22e394782f --- /dev/null +++ b/result_prior/result_corr/ws/corr[ws]_logS_with_WHIM_only_dots.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:84e6787dcafec06fe08b0044e89d59594079ee1bf55624fa1c6ab50743d627f2 +size 106448 diff --git a/result_prior/result_de_logs_predicted.xlsx b/result_prior/result_de_logs_predicted.xlsx new file mode 100644 index 0000000000000000000000000000000000000000..8b6d1e9cd0c9e1a395e60a4763cd2aa2f6208326 --- /dev/null +++ b/result_prior/result_de_logs_predicted.xlsx @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6879a90aeb109258f1e36676d65643be13453cb258432f0fe3b01f038b28610a +size 1792368 diff --git a/result_prior/result_hu_logs_predicted.xlsx b/result_prior/result_hu_logs_predicted.xlsx new file mode 100644 index 0000000000000000000000000000000000000000..4a640af0c1575205bfa836c946ba341135b95926 --- /dev/null +++ b/result_prior/result_hu_logs_predicted.xlsx @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:88f3704dc96c14dd42b4a03e7422fe8d41a6596a2b682b49c5b923c65d330e4f +size 1897934 diff --git a/result_prior/result_lo_logs_predicted.xlsx b/result_prior/result_lo_logs_predicted.xlsx new file mode 100644 index 0000000000000000000000000000000000000000..37cd7b188776198d1509a550c2109dc7d5082c92 --- /dev/null +++ b/result_prior/result_lo_logs_predicted.xlsx @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2121bd5a1ae5a26fb333afefa23cc5c6f41ec5b87f4738e9cfce234564f18873 +size 1380144 diff --git a/result_prior/result_ws_logs_predicted.xlsx b/result_prior/result_ws_logs_predicted.xlsx new file mode 100644 index 0000000000000000000000000000000000000000..2762ec9ad50ed0e25d7739f28a2b0f72c9a9f952 --- /dev/null +++ b/result_prior/result_ws_logs_predicted.xlsx @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:44c0075e45525fc65aa54cd3275ddcd8ed9c6f663a5df8d4118c5dbc3014060a +size 661288